NPASS drugs

Drug Information

Drug ID:	NPD2810
Drug Name:	SM-8849
Molecular Formula:	C18H17FN2S
Canonical SMILES:	CN=c1scc([nH]1)C(c1ccc(c(c1)F)c1ccccc1)C
Standard InCHI:	InChI=1S/C18H17FN2S/c1-12(17-11-22-18(20-2)21-17)14-8-9-15(16(19)10-14)13-6-4-3-5-7-13/h3-12H,1-2H3,(H,20,21)
Standard InCHIKey:	ZTFDMDJGJVUYQE-UHFFFAOYSA-N
Max Developmental Stage:	Discontinued
Max Developmental Stage Source:	TTD

Structural Similarity Between NPASS Natural Products and NPD2810

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	385
0.1-0.2	2555
0.2-0.3	11371
0.3-0.4	12972
0.4-0.5	3147
0.5-0.6	431
0.6-0.7	29
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
Remote Similarity	0.6949	NPC469974
Remote Similarity	0.6754	NPC7067
Remote Similarity	0.6552	NPC108339
Remote Similarity	0.6496	NPC471320
Remote Similarity	0.6496	NPC471319
Remote Similarity	0.6396	NPC133162
Remote Similarity	0.6357	NPC288232
Remote Similarity	0.6355	NPC290638
Remote Similarity	0.6348	NPC191444
Remote Similarity	0.6321	NPC276699
Remote Similarity	0.6306	NPC119677
Remote Similarity	0.6271	NPC329430
Remote Similarity	0.6262	NPC139658
Remote Similarity	0.6261	NPC176858
Remote Similarity	0.626	NPC275467
Remote Similarity	0.625	NPC169016
Remote Similarity	0.6228	NPC60408
Remote Similarity	0.6186	NPC469330
Remote Similarity	0.616	NPC473498
Remote Similarity	0.6132	NPC244738
Remote Similarity	0.609	NPC264580
Remote Similarity	0.6075	NPC122327
Remote Similarity	0.6075	NPC113000
Remote Similarity	0.6075	NPC112609
Remote Similarity	0.605	NPC322040
Remote Similarity	0.6048	NPC474430
Remote Similarity	0.6018	NPC474088
Remote Similarity	0.6017	NPC470926
Remote Similarity	0.6015	NPC192209
Remote Similarity	0.5986	NPC194857
Remote Similarity	0.5986	NPC32858
Remote Similarity	0.5982	NPC231986
Remote Similarity	0.5966	NPC108800
Remote Similarity	0.5962	NPC267443
Remote Similarity	0.5954	NPC314141
Remote Similarity	0.5954	NPC187036
Remote Similarity	0.5943	NPC229235
Remote Similarity	0.5909	NPC325662
Remote Similarity	0.5909	NPC98269
Remote Similarity	0.5897	NPC30445
Remote Similarity	0.5887	NPC474582
Remote Similarity	0.5862	NPC203076
Remote Similarity	0.5862	NPC258046
Remote Similarity	0.5859	NPC79618
Remote Similarity	0.5859	NPC434
Remote Similarity	0.5857	NPC477937
Remote Similarity	0.5856	NPC12857
Remote Similarity	0.584	NPC239854
Remote Similarity	0.5839	NPC273830
Remote Similarity	0.5839	NPC475915
Remote Similarity	0.5833	NPC473661
Remote Similarity	0.5833	NPC54269
Remote Similarity	0.5827	NPC474695
Remote Similarity	0.582	NPC317400
Remote Similarity	0.5814	NPC302790
Remote Similarity	0.5814	NPC164802
Remote Similarity	0.5814	NPC77294
Remote Similarity	0.5804	NPC159661
Remote Similarity	0.578	NPC299134
Remote Similarity	0.5769	NPC198023
Remote Similarity	0.5752	NPC475573
Remote Similarity	0.5752	NPC475289
Remote Similarity	0.5741	NPC87099
Remote Similarity	0.5741	NPC280135
Remote Similarity	0.5741	NPC226999
Remote Similarity	0.5741	NPC39799
Remote Similarity	0.5741	NPC193578
Remote Similarity	0.5741	NPC158028
Remote Similarity	0.5741	NPC135433
Remote Similarity	0.5741	NPC1008
Remote Similarity	0.5714	NPC237227
Remote Similarity	0.5714	NPC291610
Remote Similarity	0.5714	NPC296163
Remote Similarity	0.5714	NPC36440
Remote Similarity	0.5704	NPC478079
Remote Similarity	0.5704	NPC145754
Remote Similarity	0.5701	NPC5324
Remote Similarity	0.5676	NPC271642
Remote Similarity	0.5673	NPC113670
Remote Similarity	0.5673	NPC88566
Remote Similarity	0.5667	NPC316108
Remote Similarity	0.5656	NPC471309
Remote Similarity	0.5645	NPC472258
Remote Similarity	0.5645	NPC311242
Remote Similarity	0.5634	NPC252794
Remote Similarity	0.563	NPC111233
Remote Similarity	0.563	NPC262393
Remote Similarity	0.5625	NPC249018
Remote Similarity	0.5625	NPC3190
Remote Similarity	0.5621	NPC313850
Remote Similarity	0.5614	NPC315216
Remote Similarity	0.561	NPC303045
Remote Similarity	0.561	NPC161972
Remote Similarity	0.5603	NPC104070

Drug Structure

NPD2810 OpenBabel08211702552D 23 25 0 0 1 0 0 0 0 0999 V2000 1.9487 -2.7024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0823 -0.1615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1449 1.2976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1449 0.2976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.2788 1.7976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.2788 -0.2024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.4128 1.2976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8147 -0.2024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6808 0.2976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6808 -1.7024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9781 -0.2079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9487 -1.7024 0.0000 C 0 0 3 0 0 0 0 0 0 0 0 0 5.4128 0.2976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8147 -1.2024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.5468 -0.2024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.5468 -1.2024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0827 -1.2024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5000 -0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.4128 -1.7024 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0 -1.4945 -0.9706 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 0.1691 -1.6092 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -0.0000 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0 -0.0388 -2.5873 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 12 1 0 0 0 0 2 20 1 0 0 0 0 3 4 2 0 0 0 0 3 5 1 0 0 0 0 4 6 1 0 0 0 0 5 7 2 0 0 0 0 6 13 2 0 0 0 0 7 13 1 0 0 0 0 8 9 2 0 0 0 0 8 14 1 0 0 0 0 9 15 1 0 0 0 0 10 14 2 0 0 0 0 10 16 1 0 0 0 0 11 17 2 0 0 0 0 11 22 1 0 0 0 0 12 14 1 0 0 0 0 12 17 1 0 0 0 0 13 15 1 0 0 0 0 15 16 2 0 0 0 0 16 19 1 0 0 0 0 17 21 1 0 0 0 0 18 20 2 3 0 0 0 18 21 1 0 0 0 0 18 22 1 0 0 0 0 21 23 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DIB012895
DrugBank
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID
ChEBI
CAS Number

Drug Properties

Molecular Weight	312.11
ALogP	0.5115
MLogP	3
XLogP	7.035
HDA	2
HBD	1
Rotatable Bonds	6
TPSA	49.69
RO5 Violation	1