NPASS drugs

Drug Information

Drug ID:	NPD2457
Drug Name:	Upadacitinib
Molecular Formula:	C17H19F3N6O
Canonical SMILES:	CC[C@@H]1CN(C[C@@H]1c1cnc2n1c1cc[nH]c1nc2)C(=NCC(F)(F)F)O
Standard InCHI:	InChI=1S/C17H19F3N6O/c1-2-10-7-25(16(27)24-9-17(18,19)20)8-11(10)13-5-22-14-6-23-15-12(26(13)14)3-4-21-15/h3-6,10-11,21H,2,7-9H2,1H3,(H,24,27)/t10-,11+/m1/s1
Standard InCHIKey:	WYQFJHHDOKWSHR-MNOVXSKESA-N
Max Developmental Stage:	Phase 2
Max Developmental Stage Source:	ChEMBL

Structural Similarity Between NPASS Natural Products and NPD2457

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	738
0.1-0.2	20995
0.2-0.3	5304
0.3-0.4	1392
0.4-0.5	1360
0.5-0.6	937
0.6-0.7	161
0.7-0.8	3
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7

Show entries

Search:

Similarity Level	Similarity Score	Natural Product ID
Intermediate Similarity	0.7515	NPC197068
Intermediate Similarity	0.7432	NPC317054
Intermediate Similarity	0.7067	NPC267811
Remote Similarity	0.6995	NPC470203
Remote Similarity	0.6965	NPC469308
Remote Similarity	0.694	NPC470204
Remote Similarity	0.6845	NPC116555
Remote Similarity	0.6789	NPC69843
Remote Similarity	0.6774	NPC317105
Remote Similarity	0.6721	NPC120070

Showing 1 to 10 of 200 entries

Previous1 2 3 4 5…20Next

Drug Structure

NPD2457 OpenBabel08211702172D 29 32 0 0 1 0 0 0 0 0999 V2000 0.9043 3.9351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4043 3.0691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6581 2.4781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3364 2.5827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2709 0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8660 -0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9921 3.8781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9432 2.5691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.4567 5.7392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4043 3.0691 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 2.9921 2.2601 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 0.8660 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6831 1.3090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7321 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7522 4.1569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.3702 5.3324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.9580 4.5234 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0 5.9635 4.4189 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0 7.1792 5.9202 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0 -0.7431 1.6691 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 2.6831 -0.3090 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 4.6477 5.1514 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 3.9432 3.5691 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 1.7321 1.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 5.6657 3.7501 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.7213 1.4612 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 5.7703 2.7556 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 0 0 0 3 4 2 0 0 0 0 3 12 1 0 0 0 0 4 21 1 0 0 0 0 5 13 2 0 0 0 0 5 22 1 0 0 0 0 6 14 1 0 0 0 0 6 23 2 0 0 0 0 7 10 1 0 0 0 0 7 25 1 0 0 0 0 8 11 1 0 0 0 0 8 25 1 0 0 0 0 9 17 1 0 0 0 0 9 24 1 0 0 0 0 10 2 1 6 0 0 0 10 11 1 0 0 0 0 11 13 1 6 0 0 0 12 15 2 0 0 0 0 12 26 1 0 0 0 0 13 26 1 0 0 0 0 14 22 2 0 0 0 0 14 26 1 0 0 0 0 15 21 1 0 0 0 0 15 23 1 0 0 0 0 16 24 2 3 0 0 0 16 25 1 0 0 0 0 16 27 1 0 0 0 0 17 18 1 0 0 0 0 17 19 1 0 0 0 0 17 20 1 0 0 0 0 21 28 1 0 0 0 0 27 29 1 0 0 0 0 M END $$$$

External Identifiers

TTD
DrugBank
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID
ChEBI
CAS Number

Drug Properties

Molecular Weight	380.16
ALogP	-0.4219
MLogP	2.23
XLogP	3.745
HDA	7
HBD	2
Rotatable Bonds	10
TPSA	81.81
RO5 Violation	0