NPASS drugs

Drug Information

Drug ID:	NPD2449
Drug Name:	Chlorpromazine
Molecular Formula:	C17H19ClN2S
Canonical SMILES:	CN(CCCN1c2ccccc2Sc2c1cc(Cl)cc2)C
Standard InCHI:	InChI=1S/C17H19ClN2S/c1-19(2)10-5-11-20-14-6-3-4-7-16(14)21-17-9-8-13(18)12-15(17)20/h3-4,6-9,12H,5,10-11H2,1-2H3
Standard InCHIKey:	ZPEIMTDSQAKGNT-UHFFFAOYSA-N
Max Developmental Stage:	Approved
Max Developmental Stage Source:	TTD; ChEMBL; IUPHAR/BPS

Structural Similarity Between NPASS Natural Products and NPD2449

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	889
0.1-0.2	11213
0.2-0.3	12945
0.3-0.4	4270
0.4-0.5	1402
0.5-0.6	157
0.6-0.7	11
0.7-0.8	3
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
Intermediate Similarity	0.7797	NPC328877
Intermediate Similarity	0.7537	NPC473417
Intermediate Similarity	0.7049	NPC291610
Remote Similarity	0.6835	NPC321053
Remote Similarity	0.6567	NPC125416
Remote Similarity	0.6533	NPC320863
Remote Similarity	0.6525	NPC469949
Remote Similarity	0.6356	NPC229477
Remote Similarity	0.6259	NPC313352
Remote Similarity	0.625	NPC218710
Remote Similarity	0.6051	NPC321617
Remote Similarity	0.605	NPC134825
Remote Similarity	0.6013	NPC315348
Remote Similarity	0.6013	NPC32002
Remote Similarity	0.596	NPC325599
Remote Similarity	0.5935	NPC297532
Remote Similarity	0.5929	NPC313449
Remote Similarity	0.5926	NPC476464
Remote Similarity	0.589	NPC273714
Remote Similarity	0.5887	NPC240134
Remote Similarity	0.5874	NPC475915
Remote Similarity	0.587	NPC296163
Remote Similarity	0.587	NPC187036
Remote Similarity	0.5852	NPC302790
Remote Similarity	0.5816	NPC192209
Remote Similarity	0.5786	NPC288232
Remote Similarity	0.5785	NPC125549
Remote Similarity	0.5782	NPC252794
Remote Similarity	0.5746	NPC313810
Remote Similarity	0.5714	NPC474430
Remote Similarity	0.5682	NPC326792
Remote Similarity	0.5669	NPC470926
Remote Similarity	0.5662	NPC434
Remote Similarity	0.5662	NPC79618
Remote Similarity	0.5662	NPC20322
Remote Similarity	0.563	NPC313362

Drug Structure

NPD2449 OpenBabel08211702172D 21 23 0 0 0 0 0 0 0 0999 V2000 2.5981 4.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7321 6.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5981 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5981 0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8660 3.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7321 2.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7321 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5981 0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7321 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8660 4.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7321 2.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5981 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8660 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8660 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8660 0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8660 0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4641 2.0000 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0 1.7321 5.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 2.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 -0.0000 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0 1 19 1 0 0 0 0 2 19 1 0 0 0 0 3 4 2 0 0 0 0 3 6 1 0 0 0 0 4 7 1 0 0 0 0 5 10 1 0 0 0 0 5 11 1 0 0 0 0 6 14 2 0 0 0 0 7 16 2 0 0 0 0 8 9 2 0 0 0 0 8 13 1 0 0 0 0 9 17 1 0 0 0 0 10 19 1 0 0 0 0 11 20 1 0 0 0 0 12 13 2 0 0 0 0 12 15 1 0 0 0 0 13 18 1 0 0 0 0 14 16 1 0 0 0 0 14 20 1 0 0 0 0 15 17 2 0 0 0 0 15 20 1 0 0 0 0 16 21 1 0 0 0 0 17 21 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DAP000374
DrugBank	DB00477
ChEMBL	CHEMBL71
IUPHAR/BPS	83
PharmaGKB	PA448964
KEGG Drug	D00270
PubChem CID	2726
ChEBI	3647
CAS Number	50-53-3

Drug Properties

Molecular Weight	318.10
ALogP	1.3011
MLogP	2.89
XLogP	4.457
HDA	2
HBD	0
Rotatable Bonds	7
TPSA	31.78
RO5 Violation	0