NPASS drugs

Drug Information

Drug ID:	NPD2396
Drug Name:	Sertraline
Molecular Formula:	C17H17Cl2N
Canonical SMILES:	CN[C@H]1CC[C@H](c2c1cccc2)c1ccc(c(c1)Cl)Cl
Standard InCHI:	InChI=1S/C17H17Cl2N/c1-20-17-9-7-12(13-4-2-3-5-14(13)17)11-6-8-15(18)16(19)10-11/h2-6,8,10,12,17,20H,7,9H2,1H3/t12-,17-/m0/s1
Standard InCHIKey:	VGKDLMBJGBXTGI-SJCJKPOMSA-N
Max Developmental Stage:	Approved
Max Developmental Stage Source:	TTD; ChEMBL; IUPHAR/BPS

Structural Similarity Between NPASS Natural Products and NPD2396

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	469
0.1-0.2	3119
0.2-0.3	11109
0.3-0.4	12688
0.4-0.5	3095
0.5-0.6	373
0.6-0.7	33
0.7-0.8	3
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	1

Similar Natural Products

High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7

Show entries

Search:

Similarity Level	Similarity Score	Natural Product ID
High Similarity	1.0	NPC320656
Intermediate Similarity	0.7522	NPC329430
Intermediate Similarity	0.7288	NPC239854
Intermediate Similarity	0.7105	NPC470926
Remote Similarity	0.6937	NPC169016
Remote Similarity	0.6829	NPC474695
Remote Similarity	0.6814	NPC258046
Remote Similarity	0.68	NPC77294
Remote Similarity	0.6786	NPC133162
Remote Similarity	0.6696	NPC119677

Showing 1 to 10 of 83 entries

Previous1 2 3 4 5…9Next

Drug Structure

NPD2396 OpenBabel08211702172D 21 23 0 0 1 0 0 0 0 0999 V2000 5.1962 3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3301 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1962 -1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4641 -1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1962 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7321 -1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5981 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8660 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4641 2.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8660 0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7321 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5981 0.5000 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 3.4641 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3301 0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3301 1.5000 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.8660 -1.5000 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0 -0.8660 0.5000 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0 5.1962 2.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 6.0622 1.5000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 20 1 0 0 0 0 2 3 2 0 0 0 0 2 4 1 0 0 0 0 3 5 1 0 0 0 0 4 13 2 0 0 0 0 5 14 2 0 0 0 0 6 8 2 0 0 0 0 6 11 1 0 0 0 0 7 9 1 0 0 0 0 7 12 1 0 0 0 0 8 15 1 0 0 0 0 9 17 1 0 0 0 0 10 11 2 0 0 0 0 10 16 1 0 0 0 0 12 11 1 6 0 0 0 12 13 1 0 0 0 0 13 14 1 0 0 0 0 14 17 1 0 0 0 0 15 16 2 0 0 0 0 15 18 1 0 0 0 0 16 19 1 0 0 0 0 17 20 1 6 0 0 0 20 21 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DAP000051
DrugBank	DB08567
ChEMBL
IUPHAR/BPS	4798
PharmaGKB
KEGG Drug
PubChem CID	68617
ChEBI
CAS Number

Drug Properties

Molecular Weight	305.07
ALogP	0.9568
MLogP	3
XLogP	5.874
HDA	1
HBD	1
Rotatable Bonds	5
TPSA	12.03
RO5 Violation	1