Drug Information| Drug ID: | NPD211 |
| Drug Name: | |
| Molecular Formula: | C10H12N4O3 |
| Canonical SMILES: | OC(=N)N/N=C/1C=C2C(O)CN(C2=CC1=O)C |
| Standard InCHI: | InChI=1S/C10H12N4O3/c1-14-4-9(16)5-2-6(12-13-10(11)17)8(15)3-7(5)14/h2-3,9,16H,4H2,1H3,(H3,11,13,17)/b12-6+ |
| Standard InCHIKey: | XSXCZNVKFKNLPR-WUXMJOGZSA-N |
| Max Developmental Stage: | Approved |
| Max Developmental Stage Source: | TTD |
Structural Similarity Between NPASS Natural Products and NPD211Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient 
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
Similar Natural Products High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.5794 | NPC475975 |
| Remote Similarity | 0.5769 | NPC472194 |
| Remote Similarity | 0.5688 | NPC476141 |
| Remote Similarity | 0.566 | NPC277341 |
| Remote Similarity | 0.566 | NPC226982 |