NPASS drugs

Drug Information

Drug ID:	NPD2100
Drug Name:
Molecular Formula:	C16H19N3O5S
Canonical SMILES:	COC1=C(C(=O)O)N2[C@H](SC1)[C@@H](C2=O)N=C(C(C1C=CCC=C1)N)O
Standard InCHI:	InChI=1S/C16H19N3O5S/c1-24-9-7-25-15-11(14(21)19(15)12(9)16(22)23)18-13(20)10(17)8-5-3-2-4-6-8/h3-6,8,10-11,15H,2,7,17H2,1H3,(H,18,20)(H,22,23)/t10?,11-,15-/m1/s1
Standard InCHIKey:	QBHQOFVJNUQDCO-HUFXEGEASA-N
Max Developmental Stage:	Approved
Max Developmental Stage Source:	TTD

Structural Similarity Between NPASS Natural Products and NPD2100

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	57
0.1-0.2	1217
0.2-0.3	18983
0.3-0.4	9301
0.4-0.5	1229
0.5-0.6	95
0.6-0.7	6
0.7-0.8	2
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
Intermediate Similarity	0.7321	NPC144780
Intermediate Similarity	0.7295	NPC288109
Remote Similarity	0.6829	NPC59249
Remote Similarity	0.669	NPC13470
Remote Similarity	0.6325	NPC38172
Remote Similarity	0.6266	NPC315388
Remote Similarity	0.6218	NPC117829
Remote Similarity	0.6198	NPC473364
Remote Similarity	0.5986	NPC476158
Remote Similarity	0.5946	NPC55732
Remote Similarity	0.5887	NPC474985
Remote Similarity	0.5847	NPC320057
Remote Similarity	0.5839	NPC468984
Remote Similarity	0.582	NPC469739
Remote Similarity	0.5746	NPC473819
Remote Similarity	0.5703	NPC205176
Remote Similarity	0.5672	NPC474984
Remote Similarity	0.5672	NPC103391
Remote Similarity	0.5672	NPC472536
Remote Similarity	0.5664	NPC41162
Remote Similarity	0.5662	NPC470300
Remote Similarity	0.5643	NPC97580
Remote Similarity	0.5635	NPC475791
Remote Similarity	0.5635	NPC13175
Remote Similarity	0.563	NPC473495

Drug Structure

NPD2100 OpenBabel08211701392D 29 31 0 0 1 0 0 0 0 0999 V2000 -4.4641 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.2779 -1.3789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.5708 -0.6718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0191 -2.3449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6049 -0.9306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.0532 -2.6037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7321 -1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3461 -1.8966 0.0000 C 0 0 3 0 0 0 0 0 0 0 0 0 -2.7321 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3801 -2.1554 0.0000 C 0 0 3 0 0 0 0 0 0 0 0 0 0.0000 -1.0000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.8660 0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6730 -1.4483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0000 -1.0000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.8660 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1213 -3.1213 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 0.7071 -1.7071 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -1.0000 -0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 1.9319 -0.4824 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.7071 0.7071 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.7321 2.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.0000 2.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.5981 0.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.8660 -1.5000 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0 2.8284 -3.8284 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1554 -3.3801 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8978 -0.2235 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1340 1.5000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 24 1 0 0 0 0 2 3 1 0 0 0 0 2 4 1 0 0 0 0 3 5 2 0 0 0 0 4 6 2 0 0 0 0 5 8 1 0 0 0 0 6 8 1 0 0 0 0 7 9 1 0 0 0 0 7 25 1 0 0 0 0 8 10 1 0 0 0 0 9 12 2 0 0 0 0 9 24 1 0 0 0 0 10 13 1 0 0 0 0 10 17 1 0 0 0 0 11 14 1 0 0 0 0 11 15 1 0 0 0 0 11 18 1 1 0 0 0 12 16 1 0 0 0 0 12 19 1 0 0 0 0 13 18 2 3 0 0 0 13 20 1 0 0 0 0 14 19 1 0 0 0 0 14 21 2 0 0 0 0 15 19 1 0 0 0 0 15 25 1 1 0 0 0 16 22 2 0 0 0 0 16 23 1 0 0 0 0 17 26 1 0 0 0 0 17 27 1 0 0 0 0 20 28 1 0 0 0 0 23 29 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DNAP001657
DrugBank
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID	443991
ChEBI
CAS Number

Drug Properties

Molecular Weight	365.10
ALogP	-1.0716
MLogP	2.23
XLogP	-2.149
HDA	8
HBD	3
Rotatable Bonds	9
TPSA	150.75
RO5 Violation	0