NPASS drugs

Drug Information

Drug ID:	NPD1944
Drug Name:	Atreleuton
Molecular Formula:	C16H15FN2O2S
Canonical SMILES:	Fc1ccc(cc1)Cc1ccc(s1)C#C[C@H](N(C(=N)O)O)C
Standard InCHI:	InChI=1S/C16H15FN2O2S/c1-11(19(21)16(18)20)2-7-14-8-9-15(22-14)10-12-3-5-13(17)6-4-12/h3-6,8-9,11,21H,10H2,1H3,(H2,18,20)/t11-/m1/s1
Standard InCHIKey:	MMSNEKOTSJRTRI-LLVKDONJSA-N
Max Developmental Stage:	Phase 2
Max Developmental Stage Source:	ChEMBL

Structural Similarity Between NPASS Natural Products and NPD1944

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	138
0.1-0.2	2359
0.2-0.3	11968
0.3-0.4	13880
0.4-0.5	2338
0.5-0.6	201
0.6-0.7	6
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
Remote Similarity	0.6404	NPC148231
Remote Similarity	0.6333	NPC317400
Remote Similarity	0.6167	NPC300455
Remote Similarity	0.6066	NPC471319
Remote Similarity	0.6066	NPC471320
Remote Similarity	0.605	NPC166487
Remote Similarity	0.5982	NPC299367
Remote Similarity	0.5929	NPC8981
Remote Similarity	0.5862	NPC472169
Remote Similarity	0.5859	NPC469974
Remote Similarity	0.5854	NPC108339
Remote Similarity	0.5826	NPC231986
Remote Similarity	0.5826	NPC471376
Remote Similarity	0.578	NPC105991
Remote Similarity	0.5753	NPC194857
Remote Similarity	0.5753	NPC32858
Remote Similarity	0.5676	NPC244738
Remote Similarity	0.5667	NPC471638
Remote Similarity	0.5645	NPC469330
Remote Similarity	0.5641	NPC14326
Remote Similarity	0.5639	NPC190955
Remote Similarity	0.563	NPC3210
Remote Similarity	0.5625	NPC113000
Remote Similarity	0.5625	NPC122327
Remote Similarity	0.5625	NPC112609
Remote Similarity	0.5614	NPC290638
Remote Similarity	0.5603	NPC475573
Remote Similarity	0.5603	NPC475289

Drug Structure

NPD1944 OpenBabel08211701392D 25 26 0 0 1 0 0 0 0 0999 V2000 3.1929 3.0531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7916 2.0350 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7026 -1.4945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.8366 0.0055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5686 -0.9945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7026 0.5055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3849 1.1215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4781 -0.6581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8090 -1.4013 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9706 -1.4945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1984 2.9485 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.8366 -0.9945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5686 0.0055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9781 0.2079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1045 -0.9945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0173 4.6711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4347 0.5055 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0 3.0118 4.7756 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 1.6106 3.7576 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 1.4295 5.4801 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.6161 3.6530 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 -0.0000 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0 3.4186 5.6892 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8363 6.3937 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0283 4.4621 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2 7 3 0 0 0 0 2 11 1 0 0 0 0 3 5 1 0 0 0 0 3 12 2 0 0 0 0 4 6 2 0 0 0 0 4 12 1 0 0 0 0 5 13 2 0 0 0 0 6 13 1 0 0 0 0 7 14 1 0 0 0 0 8 9 1 0 0 0 0 8 14 2 0 0 0 0 9 15 2 0 0 0 0 10 12 1 0 0 0 0 10 15 1 0 0 0 0 11 1 1 6 0 0 0 11 19 1 0 0 0 0 13 17 1 0 0 0 0 14 22 1 0 0 0 0 15 22 1 0 0 0 0 16 18 2 0 0 0 0 16 19 1 0 0 0 0 16 20 1 0 0 0 0 18 23 1 0 0 0 0 19 21 1 0 0 0 0 20 24 1 0 0 0 0 21 25 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DCL000315
DrugBank
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID	3086671
ChEBI
CAS Number

Drug Properties

Molecular Weight	318.08
ALogP	1.448
MLogP	2.56
XLogP	4.2
HDA	2
HBD	3
Rotatable Bonds	8
TPSA	95.79
RO5 Violation	0