Drug Information| Drug ID: | NPD1266 |
| Drug Name: | |
| Molecular Formula: | C14H14ClNS |
| Canonical SMILES: | C=Cc1sc2c3c1CN(C)CCc3c(cc2)Cl |
| Standard InCHI: | InChI=1S/C14H14ClNS/c1-3-12-10-8-16(2)7-6-9-11(15)4-5-13(17-12)14(9)10/h3-5H,1,6-8H2,2H3 |
| Standard InCHIKey: | WKXSXFYQPCWZOS-UHFFFAOYSA-N |
| Max Developmental Stage: | Clinical (unspecified phase) |
| Max Developmental Stage Source: | TTD |
Structural Similarity Between NPASS Natural Products and NPD1266Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient 
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
Similar Natural Products High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.6333 | NPC148231 |
| Remote Similarity | 0.6083 | NPC104070 |
| Remote Similarity | 0.5952 | NPC470926 |
| Remote Similarity | 0.5915 | NPC320656 |
| Remote Similarity | 0.5812 | NPC98976 |
| Remote Similarity | 0.5763 | NPC271642 |
| Remote Similarity | 0.568 | NPC258046 |
| Remote Similarity | 0.5672 | NPC239854 |