Drug Information| Drug ID: | NPD1098 |
| Drug Name: | Pinacidil |
| Molecular Formula: | C13H19N5 |
| Canonical SMILES: | CC(C(C)(C)C)NC(=NC#N)N=c1cc[nH]cc1 |
| Standard InCHI: | InChI=1S/C13H19N5/c1-10(13(2,3)4)17-12(16-9-14)18-11-5-7-15-8-6-11/h5-8,10H,1-4H3,(H2,15,16,17,18) |
| Standard InCHIKey: | IVVNZDGDKPTYHK-UHFFFAOYSA-N |
| Max Developmental Stage: | Approved |
| Max Developmental Stage Source: | TTD; ChEMBL; IUPHAR/BPS |
Structural Similarity Between NPASS Natural Products and NPD1098Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient 
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
Similar Natural Products High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.6667 | NPC230087 |
| Remote Similarity | 0.6441 | NPC57565 |
| Remote Similarity | 0.5897 | NPC472735 |
| Remote Similarity | 0.5821 | NPC212436 |
| Remote Similarity | 0.5758 | NPC32934 |
| Remote Similarity | 0.5733 | NPC325268 |
| Remote Similarity | 0.5696 | NPC93070 |