Drug Information| Drug ID: | NPD1094 |
| Drug Name: | Mefruside |
| Molecular Formula: | C13H19ClN2O5S2 |
| Canonical SMILES: | Clc1ccc(cc1S(=O)(=O)N)S(=O)(=O)N(CC1(C)CCCO1)C |
| Standard InCHI: | InChI=1S/C13H19ClN2O5S2/c1-13(6-3-7-21-13)9-16(2)23(19,20)10-4-5-11(14)12(8-10)22(15,17)18/h4-5,8H,3,6-7,9H2,1-2H3,(H2,15,17,18) |
| Standard InCHIKey: | SMNOERSLNYGGOU-UHFFFAOYSA-N |
| Max Developmental Stage: | Approved |
| Max Developmental Stage Source: | ChEMBL |
Structural Similarity Between NPASS Natural Products and NPD1094Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient 
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
Similar Natural Products High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.5929 | NPC35599 |
| Remote Similarity | 0.592 | NPC317400 |
| Remote Similarity | 0.5826 | NPC67863 |
| Remote Similarity | 0.5755 | NPC476440 |
| Remote Similarity | 0.5753 | NPC321053 |
| Remote Similarity | 0.5714 | NPC125549 |