NPASS Natural Product

Natural Product: NPC475590

Natural Product ID:	NPC475590
Common Name:	Digitoxigenin3-O-[O-Beta-D-Glucopyranosyl-(1->6)-O-Beta-D-Glucopyranosyl-(1->4)-Beta-D-Digitoxopyranoside]
IUPAC Name:	3-[(3S,5R,8R,9S,10S,13R,14S,17R)-14-hydroxy-3-[(2R,4R,5S,6R)-4-hydroxy-6-methyl-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxyoxan-2-yl]oxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]-2H-furan-5-one
Synonyms:
Molecular Formula:	C41H64O17
Standard InCHIKey:	NQKAYUABNWNCPK-LCAOPRJFSA-N
Standard InCHI:	InChI=1S/C41H64O17/c1-18-36(58-38-35(50)33(48)31(46)27(57-38)17-53-37-34(49)32(47)30(45)26(15-42)56-37)25(43)14-29(54-18)55-21-6-9-39(2)20(13-21)4-5-24-23(39)7-10-40(3)22(8-11-41(24,40)51)19-12-28(44)52-16-19/h12,18,20-27,29-38,42-43,45-51H,4-11,13-17H2,1-3H3/t18-,20-,21+,22-,23+,24-,25-,26-,27-,29+,30-,31-,32+,33+,34-,35-,36-,37-,38+,39+,40-,41+/m1/s1
Canonical SMILES:	OC[C@H]1O[C@@H](OC[C@H]2O[C@@H](O[C@H]3[C@H](O)C[C@@H](O[C@@H]3C)O[C@H]3CC[C@]4([C@@H](C3)CC[C@@H]3[C@@H]4CC[C@]4([C@]3(O)CC[C@@H]4C3=CC(=O)OC3)C)C)[C@@H]([C@H]([C@@H]2O)O)O)[C@@H]([C@H]([C@@H]1O)O)O
First Find Year:
Max Developmental Stage:
Synthetic Gene Cluster:	;

Species Source

Show entries

Search:

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO32958	streptocaulon juventas	Species	Apocynaceae	Eukaryota		Vietnam		PMID[14640513]

Showing 1 to 1 of 1 entries

Previous1Next

Biological Activity

Activity Type	# Activity
IC50	1

Activity Type	# Activity
Cell Line	1

Show entries

Search:

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT453	Cell Line	HT-1080	Homo sapiens	IC50	=	54	nM	20483615

Showing 1 to 1 of 1 entries

Previous1Next

Similar Natural Products in NPASS

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient

● The left chart: Distribution of similarity level between NPC475590 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.56 or Top200).

range	Tanimoto Coefficient
0-0.1	178
0.1-0.2	1124
0.2-0.3	3154
0.3-0.4	6229
0.4-0.5	8926
0.5-0.6	5391
0.6-0.7	3502
0.7-0.8	1665
0.8-0.85	466
0.85-0.9	166
0.9-0.95	54
0.95-1	34

Show entries

Search:

Similarity Score	Similarity Level	Natural Product ID
0.8618	High Similarity	NPC251866
0.8618	High Similarity	NPC469752
0.8618	High Similarity	NPC471359
0.8618	High Similarity	NPC180079
0.8618	High Similarity	NPC469754

Showing 1 to 5 of 200 entries

Previous1 2 3 4 5…40Next

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC475590 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.56 or Top200).

range	Tanimoto Coefficient
0-0.1	183
0.1-0.2	1498
0.2-0.3	3950
0.3-0.4	2400
0.4-0.5	633
0.5-0.6	310
0.6-0.7	141
0.7-0.8	31
0.8-0.85	0
0.85-0.9	4
0.9-0.95	3
0.95-1	8

Show entries

Search:

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.5931	Remote Similarity	NPD7260	Phase 2
0.5932	Remote Similarity	NPD3670	Clinical (unspecified phase)
0.5932	Remote Similarity	NPD3669	Approved
0.5935	Remote Similarity	NPD5284	Approved
0.5935	Remote Similarity	NPD5281	Approved

Showing 1 to 5 of 200 entries

Previous1 2 3 4 5…40Next

Structure

NPC475590 OpenBabel07101718302D 58 65 0 0 1 0 0 0 0 0999 V2000 2.5981 -6.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8660 -2.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4538 -1.3090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5981 -0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7321 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5981 -3.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -2.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2024 1.0827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7321 -3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8660 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2079 0.9781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3305 0.6303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4641 -2.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1962 -5.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.1244 -8.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9941 -0.9523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.7942 -7.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4641 -6.0000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.5873 -0.0388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5981 -1.5000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 3.4641 -3.0000 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.6092 0.1691 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.8660 -1.5000 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 0.8660 -0.5000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 5.1962 -6.0000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 11.2583 -7.5000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 6.9282 -8.0000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.1965 0.1303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3301 -4.5000 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 11.2583 -6.5000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 6.9282 -9.0000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 10.3923 -6.0000 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 6.0622 -9.5000 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 9.5263 -6.5000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 5.1962 -9.0000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 4.3301 -6.5000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 9.5263 -7.5000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 5.1962 -8.0000 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 1.7321 -2.0000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.8660 -0.5000 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 0.0000 -0.0000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 12.9904 -7.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.0622 -6.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.1100 0.5371 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 12.1244 -6.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.7942 -9.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 10.3923 -5.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.0622 -10.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 8.6603 -6.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.3301 -9.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.9945 0.1045 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.9886 -0.8478 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 8.6603 -8.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.4641 -5.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.3301 -3.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 10.3923 -8.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.0622 -7.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.3301 -7.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3 40 1 0 0 0 0 4 5 1 0 0 0 0 4 20 1 0 0 0 0 5 24 1 0 0 0 0 6 9 1 0 0 0 0 6 21 1 0 0 0 0 7 10 1 0 0 0 0 7 23 1 0 0 0 0 8 11 1 0 0 0 0 8 22 1 0 0 0 0 9 39 1 0 0 0 0 10 40 1 0 0 0 0 11 41 1 0 0 0 0 12 19 2 0 0 0 0 12 28 1 0 0 0 0 13 20 1 0 0 0 0 13 21 1 0 0 0 0 14 25 1 0 0 0 0 14 29 1 0 0 0 0 15 42 1 0 0 0 0 16 19 1 0 0 0 0 16 52 1 0 0 0 0 17 53 1 0 0 0 0 18 1 1 1 0 0 0 18 36 1 0 0 0 0 18 54 1 0 0 0 0 19 22 1 0 0 0 0 20 39 1 6 0 0 0 21 55 1 1 0 0 0 22 40 1 1 0 0 0 23 24 1 0 0 0 0 23 39 1 1 0 0 0 24 41 1 6 0 0 0 25 36 1 0 0 0 0 25 43 1 1 0 0 0 26 15 1 1 0 0 0 26 30 1 0 0 0 0 26 56 1 0 0 0 0 27 17 1 6 0 0 0 27 31 1 0 0 0 0 27 57 1 0 0 0 0 28 44 2 0 0 0 0 28 52 1 0 0 0 0 29 54 1 0 0 0 0 29 55 1 1 0 0 0 30 32 1 0 0 0 0 30 45 1 6 0 0 0 31 33 1 0 0 0 0 31 46 1 1 0 0 0 32 34 1 0 0 0 0 32 47 1 1 0 0 0 33 35 1 0 0 0 0 33 48 1 6 0 0 0 34 37 1 0 0 0 0 34 49 1 6 0 0 0 35 38 1 0 0 0 0 35 50 1 1 0 0 0 36 58 1 6 0 0 0 37 53 1 1 0 0 0 37 56 1 0 0 0 0 38 57 1 0 0 0 0 38 58 1 6 0 0 0 39 2 1 1 0 0 0 40 41 1 1 0 0 0 41 51 1 1 0 0 0 M END $$$$

External Identifiers

PubChem CID	44566919
ChEMBL	CHEMBL508792
ZINC

Physicochemical Properties

Molecular Weight:	828.41
ALogP:	-4.5505
MLogP:	4.1
XLogP:	0.807
# Rotatable Bonds:	21
Polar Surface Area:	263.75
# H-Bond Aceptor:	17
# H-Bond Donor:	9
# Rings:	8
# Heavy Atoms:	58

Download Data

Data Type	Select
General Info & Identifiers & Properties
Structure MOL file
Source Organisms
Biological Activities
Similar NPs/Drugs