NPASS Natural Product

Natural Product: NPC469345

Natural Product ID:	NPC469345
Common Name:	Secalonic Acid D
IUPAC Name:
Synonyms:	Secalonic Acid D
Molecular Formula:	C32H32O14
Standard InCHIKey:	IODWZVMVQOCZTC-NHBPCGONSA-N
Standard InCHI:	InChI=1S/C32H32O14/c1-11-9-15(33)21-25(37)19-17(45-31(21,27(11)39)29(41)43-3)7-5-13(23(19)35)14-6-8-18-20(24(14)36)26(38)22-16(34)10-12(2)28(40)32(22,46-18)30(42)44-4/h5-8,11-12,25,27-28,33-37,39-40H,9-10H2,1-4H3/t11-,12-,25?,27+,28+,31+,32+/m0/s1
Canonical SMILES:	COC(=O)[C@]12Oc3ccc(c(c3C(C2=C(C[C@@H]([C@H]1O)C)O)O)O)c1ccc2c(c1O)C(=O)C1=C(O)C[C@@H]([C@H]([C@@]1(O2)C(=O)OC)O)C
First Find Year:
Max Developmental Stage:
Synthetic Gene Cluster:	;

Species Source

Show entries

Search:

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO13590	Diploicia canescens	Species	Caliciaceae	Eukaryota				PMID[19919064]

Showing 1 to 1 of 1 entries

Previous1Next

Biological Activity

Activity Type	# Activity
IC50	2
MIC	1

Activity Type	# Activity
Cell Line	2
Organism	1

Show entries

Search:

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT115	Organism	Mycobacterium tuberculosis H37Ra	Mycobacterium tuberculosis H37Ra	MIC	>	100	ug/ml	10.6019/CHEMBL1201861
NPT319	Cell Line	B16	Mus musculus	IC50	=	280	nM	1336040
NPT941	Cell Line	HaCaT	Homo sapiens	IC50	=	3700	nM	22460024

Showing 1 to 3 of 3 entries

Previous1Next

Similar Natural Products in NPASS

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient

● The left chart: Distribution of similarity level between NPC469345 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.56 or Top200).

range	Tanimoto Coefficient
0-0.1	317
0.1-0.2	1181
0.2-0.3	2281
0.3-0.4	4749
0.4-0.5	7026
0.5-0.6	4566
0.6-0.7	3976
0.7-0.8	5057
0.8-0.85	1567
0.85-0.9	154
0.9-0.95	5
0.95-1	10

Show entries

Search:

Similarity Score	Similarity Level	Natural Product ID
0.8462	Intermediate Similarity	NPC282390
0.8462	Intermediate Similarity	NPC246466
0.8466	Intermediate Similarity	NPC68381
0.8466	Intermediate Similarity	NPC199533
0.8466	Intermediate Similarity	NPC470454

Showing 1 to 5 of 200 entries

Previous1 2 3 4 5…40Next

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC469345 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.56 or Top200).

range	Tanimoto Coefficient
0-0.1	329
0.1-0.2	886
0.2-0.3	1699
0.3-0.4	2568
0.4-0.5	2028
0.5-0.6	1067
0.6-0.7	403
0.7-0.8	144
0.8-0.85	33
0.85-0.9	4
0.9-0.95	0
0.95-1	0

Show entries

Search:

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.6936	Remote Similarity	NPD2438	Suspended
0.694	Remote Similarity	NPD4288	Approved
0.6948	Remote Similarity	NPD5619	Clinical (unspecified phase)
0.695	Remote Similarity	NPD7237	Clinical (unspecified phase)
0.6954	Remote Similarity	NPD6213	Phase 3

Showing 1 to 5 of 200 entries

Previous1 2 3 4 5…40Next

Structure

NPC469345 OpenBabel07101718302D 46 51 0 0 1 0 0 0 0 0999 V2000 -7.5001 6.2547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3334 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.3335 1.9245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8333 -1.4434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.1667 1.4434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5000 0.4811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0001 1.9245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6667 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.8334 6.2547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5000 1.4434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.6668 5.7736 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 2.5000 0.4811 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.3334 1.9245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5000 1.4434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0001 5.7736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6667 1.9245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0001 2.8868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8333 0.4811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.1667 3.3679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8333 1.4434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.0001 4.8113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8333 1.4434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3334 2.8868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6667 1.9245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.1667 4.3302 0.0000 C 0 0 3 0 0 0 0 0 0 0 0 0 -0.0000 1.9245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.6668 4.8113 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 1.6667 0.0000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.5001 3.3679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8333 -1.4434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.8334 4.3302 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 0.8333 0.4811 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.1667 6.2547 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.6667 2.8868 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.5000 3.3679 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.6667 2.8868 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.3334 4.8113 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 2.8868 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.5001 4.3302 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.6667 -0.9623 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.3335 3.8491 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.6667 -1.9245 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.5001 2.4057 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -1.9245 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.8334 3.3679 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 -0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3 43 1 0 0 0 0 4 44 1 0 0 0 0 5 7 2 0 0 0 0 5 13 1 0 0 0 0 6 8 2 0 0 0 0 6 14 1 0 0 0 0 7 17 1 0 0 0 0 8 18 1 0 0 0 0 9 11 1 0 0 0 0 9 15 1 0 0 0 0 10 12 1 0 0 0 0 10 16 1 0 0 0 0 11 1 1 1 0 0 0 11 27 1 0 0 0 0 12 2 1 6 0 0 0 12 28 1 0 0 0 0 13 14 1 0 0 0 0 13 23 2 0 0 0 0 14 24 2 0 0 0 0 15 21 2 0 0 0 0 15 33 1 0 0 0 0 16 22 2 0 0 0 0 16 34 1 0 0 0 0 17 19 2 0 0 0 0 17 45 1 0 0 0 0 18 20 2 0 0 0 0 18 46 1 0 0 0 0 19 23 1 0 0 0 0 19 25 1 0 0 0 0 20 24 1 0 0 0 0 20 26 1 0 0 0 0 21 25 1 0 0 0 0 21 31 1 0 0 0 0 22 26 1 0 0 0 0 22 32 1 0 0 0 0 23 35 1 0 0 0 0 24 36 1 0 0 0 0 25 37 1 0 0 0 0 26 38 2 0 0 0 0 27 31 1 6 0 0 0 27 39 1 0 0 0 0 28 32 1 1 0 0 0 28 40 1 0 0 0 0 29 41 2 0 0 0 0 29 43 1 0 0 0 0 30 42 2 0 0 0 0 30 44 1 0 0 0 0 31 29 1 6 0 0 0 31 45 1 0 0 0 0 32 30 1 1 0 0 0 32 46 1 0 0 0 0 M END $$$$

External Identifiers

PubChem CID
ChEMBL	CHEMBL1075971
ZINC

Physicochemical Properties

Molecular Weight:	640.18
ALogP:	-3.7623
MLogP:	3.44
XLogP:	-0.429
# Rotatable Bonds:	16
Polar Surface Area:	229.74
# H-Bond Aceptor:	10
# H-Bond Donor:	7
# Rings:	6
# Heavy Atoms:	46

Download Data

Data Type	Select
General Info & Identifiers & Properties
Structure MOL file
Source Organisms
Biological Activities
Similar NPs/Drugs