NPASS Natural Product

Natural Product: NPC30483

Natural Product ID:	NPC30483
Common Name:	Digitoxigenin Gentiobioside
IUPAC Name:	3-[(3S,5R,8R,9S,10S,13R,14S,17R)-14-hydroxy-10,13-dimethyl-3-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxy-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]-2H-furan-5-one
Synonyms:	Digitoxigenin Gentiobioside
Molecular Formula:	C35H54O14
Standard InCHIKey:	COIUWGNHAYDCDZ-NCZJMCBLSA-N
Standard InCHI:	InChI=1S/C35H54O14/c1-33-8-5-18(47-32-30(43)28(41)26(39)23(49-32)15-46-31-29(42)27(40)25(38)22(13-36)48-31)12-17(33)3-4-21-20(33)6-9-34(2)19(7-10-35(21,34)44)16-11-24(37)45-14-16/h11,17-23,25-32,36,38-44H,3-10,12-15H2,1-2H3/t17-,18+,19-,20+,21-,22-,23-,25-,26-,27+,28+,29-,30-,31-,32-,33+,34-,35+/m1/s1
Canonical SMILES:	OC[C@H]1O[C@@H](OC[C@H]2O[C@@H](O[C@H]3CC[C@]4([C@@H](C3)CC[C@@H]3[C@@H]4CC[C@]4([C@]3(O)CC[C@@H]4C3=CC(=O)OC3)C)C)[C@@H]([C@H]([C@@H]2O)O)O)[C@@H]([C@H]([C@@H]1O)O)O
First Find Year:
Max Developmental Stage:
Synthetic Gene Cluster:	;

Species Source

Show entries

Search:

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO32958	streptocaulon juventas	Species	Apocynaceae	Eukaryota		Vietnam		PMID[14640513]

Showing 1 to 1 of 1 entries

Previous1Next

Biological Activity

Activity Type	# Activity
IC50	1

Activity Type	# Activity
Cell Line	1

Show entries

Search:

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT453	Cell Line	HT-1080	Homo sapiens	IC50	=	1600	nM	23398496

Showing 1 to 1 of 1 entries

Previous1Next

Similar Natural Products in NPASS

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient

● The left chart: Distribution of similarity level between NPC30483 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.56 or Top200).

range	Tanimoto Coefficient
0-0.1	171
0.1-0.2	1073
0.2-0.3	3107
0.3-0.4	5829
0.4-0.5	9075
0.5-0.6	5301
0.6-0.7	3765
0.7-0.8	1863
0.8-0.85	427
0.85-0.9	177
0.9-0.95	35
0.95-1	66

Show entries

Search:

Similarity Score	Similarity Level	Natural Product ID
0.8661	High Similarity	NPC472901
0.8673	High Similarity	NPC13190
0.8678	High Similarity	NPC311534
0.8684	High Similarity	NPC44298
0.8684	High Similarity	NPC40133

Showing 1 to 5 of 200 entries

Previous1 2 3 4 5…40Next

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC30483 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.56 or Top200).

range	Tanimoto Coefficient
0-0.1	175
0.1-0.2	1451
0.2-0.3	3883
0.3-0.4	2460
0.4-0.5	670
0.5-0.6	317
0.6-0.7	151
0.7-0.8	38
0.8-0.85	2
0.85-0.9	3
0.9-0.95	1
0.95-1	10

Show entries

Search:

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.6033	Remote Similarity	NPD5281	Approved
0.6034	Remote Similarity	NPD3670	Clinical (unspecified phase)
0.6034	Remote Similarity	NPD3669	Approved
0.6036	Remote Similarity	NPD6942	Approved
0.6036	Remote Similarity	NPD7339	Approved

Showing 1 to 5 of 200 entries

Previous1 2 3 4 5…40Next

Structure

NPC30483 OpenBabel07101718222D 49 55 0 0 1 0 0 0 0 0999 V2000 2.5981 -0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4067 -1.9135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7321 2.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8660 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3301 0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7321 -1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5388 -0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4641 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8660 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9511 0.3090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2111 -2.5691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4641 2.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.2583 4.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6723 -3.0691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.6603 2.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2601 -2.2601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5981 1.5000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 4.3301 1.5000 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.9511 -1.3090 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 1.7321 -0.0000 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 0.8660 0.5000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 11.2583 3.5000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 7.7942 1.5000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.2111 -3.5691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.1244 3.0000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 7.7942 0.5000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 12.1244 2.0000 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 6.9282 -0.0000 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 11.2583 1.5000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 6.0622 0.5000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 10.3923 2.0000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 6.0622 1.5000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 2.5981 0.5000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.0000 -1.0000 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 0.0000 -0.0000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 12.1244 5.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.0201 -4.1569 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 12.9904 3.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 8.6603 -0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 12.9904 1.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.9282 -1.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 11.2583 0.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.1962 -0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.4067 0.9135 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.2601 -3.8781 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 9.5263 1.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.1962 2.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 10.3923 3.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.9282 2.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2 34 1 0 0 0 0 3 4 1 0 0 0 0 3 17 1 0 0 0 0 4 21 1 0 0 0 0 5 8 1 0 0 0 0 5 18 1 0 0 0 0 6 9 1 0 0 0 0 6 20 1 0 0 0 0 7 10 1 0 0 0 0 7 19 1 0 0 0 0 8 33 1 0 0 0 0 9 34 1 0 0 0 0 10 35 1 0 0 0 0 11 16 2 0 0 0 0 11 24 1 0 0 0 0 12 17 1 0 0 0 0 12 18 1 0 0 0 0 13 36 1 0 0 0 0 14 16 1 0 0 0 0 14 45 1 0 0 0 0 15 46 1 0 0 0 0 16 19 1 0 0 0 0 17 33 1 6 0 0 0 18 47 1 1 0 0 0 19 34 1 1 0 0 0 20 21 1 0 0 0 0 20 33 1 1 0 0 0 21 35 1 6 0 0 0 22 13 1 6 0 0 0 22 25 1 0 0 0 0 22 48 1 0 0 0 0 23 15 1 6 0 0 0 23 26 1 0 0 0 0 23 49 1 0 0 0 0 24 37 2 0 0 0 0 24 45 1 0 0 0 0 25 27 1 0 0 0 0 25 38 1 1 0 0 0 26 28 1 0 0 0 0 26 39 1 1 0 0 0 27 29 1 0 0 0 0 27 40 1 6 0 0 0 28 30 1 0 0 0 0 28 41 1 6 0 0 0 29 31 1 0 0 0 0 29 42 1 1 0 0 0 30 32 1 0 0 0 0 30 43 1 1 0 0 0 31 46 1 6 0 0 0 31 48 1 0 0 0 0 32 47 1 6 0 0 0 32 49 1 0 0 0 0 33 1 1 1 0 0 0 34 35 1 1 0 0 0 35 44 1 1 0 0 0 M END $$$$

External Identifiers

PubChem CID	11479526
ChEMBL	CHEMBL499216
ZINC

Physicochemical Properties

Molecular Weight:	698.35
ALogP:	-3.5263
MLogP:	3.77
XLogP:	1.04
# Rotatable Bonds:	17
Polar Surface Area:	225.06
# H-Bond Aceptor:	14
# H-Bond Donor:	8
# Rings:	7
# Heavy Atoms:	49

Download Data

Data Type	Select
General Info & Identifiers & Properties
Structure MOL file
Source Organisms
Biological Activities
Similar NPs/Drugs