NPASS Natural Product

Natural Product: NPC231787

Natural Product ID:	NPC231787
Common Name:	Kaempferol 3-O-Alpha-L-Rhamnopyranosyl(1->6)-[(4-O-Trans-P-Coumaroyl)-Alpha-L-Rhamnopyranosyl(1-> 2)]-(4-O-Trans-P-Coumaroyl)-Beta-D-Galactopyranoside
IUPAC Name:	[(2S,3R,4S,5R,6S)-6-[(2S,3R,4S,5R,6R)-2-[5,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxochromen-3-yl]oxy-4-hydroxy-5-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxy-6-[[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxymethyl]oxan-3-yl]oxy-4,5-dihydroxy-2-methyloxan-3-yl] (E)-3-(4-hydroxyphenyl)prop-2-enoate
Synonyms:
Molecular Formula:	C51H52O23
Standard InCHIKey:	VHDYGKCMNQFOEX-HIIJJAAKSA-N
Standard InCHI:	InChI=1S/C51H52O23/c1-22-37(59)39(61)41(63)49(67-22)66-21-33-46(72-35(58)18-8-25-5-13-28(53)14-6-25)43(65)48(74-50-42(64)40(62)44(23(2)68-50)71-34(57)17-7-24-3-11-27(52)12-4-24)51(70-33)73-47-38(60)36-31(56)19-30(55)20-32(36)69-45(47)26-9-15-29(54)16-10-26/h3-20,22-23,33,37,39-44,46,48-56,59,61-65H,21H2,1-2H3/b17-7+,18-8+/t22-,23-,33+,37-,39+,40-,41+,42+,43-,44-,46-,48+,49+,50-,51-/m0/s1
Canonical SMILES:	Oc1ccc(cc1)c1oc2cc(O)cc(c2c(=O)c1O[C@@H]1O[C@H](CO[C@@H]2O[C@@H](C)[C@@H]([C@H]([C@H]2O)O)O)[C@@H]([C@@H]([C@H]1O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O)OC(=O)/C=C/c1ccc(cc1)O)O)OC(=O)/C=C/c1ccc(cc1)O)O
First Find Year:
Max Developmental Stage:
Synthetic Gene Cluster:	;

Species Source

Show entries

Search:

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO10828	Adina racemosa	Species	Rubiaceae	Eukaryota				PMID[15043423]

Showing 1 to 1 of 1 entries

Previous1Next

Biological Activity

Activity Type	# Activity
Others	1

Activity Type	# Activity
Others	1

Show entries

Search:

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT2	Others	Unspecified		FC	=	5		20192239

Showing 1 to 1 of 1 entries

Previous1Next

Similar Natural Products in NPASS

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient

● The left chart: Distribution of similarity level between NPC231787 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.56 or Top200).

range	Tanimoto Coefficient
0-0.1	308
0.1-0.2	1272
0.2-0.3	2722
0.3-0.4	5923
0.4-0.5	6533
0.5-0.6	3973
0.6-0.7	4347
0.7-0.8	4249
0.8-0.85	932
0.85-0.9	404
0.9-0.95	178
0.95-1	48

Show entries

Search:

Similarity Score	Similarity Level	Natural Product ID
0.9053	High Similarity	NPC199079
0.9053	High Similarity	NPC210808
0.9059	High Similarity	NPC168789
0.9064	High Similarity	NPC144097
0.9064	High Similarity	NPC61904

Showing 1 to 5 of 200 entries

Previous1 2 3 4 5…40Next

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC231787 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.56 or Top200).

range	Tanimoto Coefficient
0-0.1	326
0.1-0.2	869
0.2-0.3	1797
0.3-0.4	2676
0.4-0.5	2008
0.5-0.6	1014
0.6-0.7	322
0.7-0.8	111
0.8-0.85	25
0.85-0.9	9
0.9-0.95	4
0.95-1	0

Show entries

Search:

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.6744	Remote Similarity	NPD943	Approved
0.6748	Remote Similarity	NPD9545	Approved
0.6748	Remote Similarity	NPD1548	Phase 1
0.6755	Remote Similarity	NPD8127	Discontinued
0.6757	Remote Similarity	NPD4288	Approved

Showing 1 to 5 of 200 entries

Previous1 2 3 4 5…40Next

Structure

NPC231787 OpenBabel07101719512D 74 81 0 0 1 0 0 0 0 0999 V2000 5.1962 1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.3301 2.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.9282 -2.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.6603 -2.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.3301 4.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5981 4.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.7942 -0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4641 3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7321 -3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8660 -4.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.9282 -3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.6603 -3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.3301 5.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5981 5.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5981 -3.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7321 -5.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.9282 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5981 2.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4641 -2.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5981 -3.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8660 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3301 1.5000 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.3301 1.5000 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.7942 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4641 4.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8660 -3.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.7942 -3.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4641 6.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5981 -4.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4641 -3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5981 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7321 -3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 1.0000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -6.9282 1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7321 3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7321 -2.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3301 2.5000 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 0.8660 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4641 3.0000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.1962 0.0000 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 2.5981 2.5000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.3301 -0.5000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.7321 1.0000 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.1962 1.0000 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.0000 -3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8660 1.5000 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.0000 -2.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7321 0.0000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 2.5981 1.5000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.4641 0.0000 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.8660 -0.5000 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -7.7942 -4.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.4641 7.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.4641 -5.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.3301 -3.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.5981 -0.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.7942 1.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.7321 4.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.1962 3.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.8660 -0.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.4641 4.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.0622 -0.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.7321 3.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.3301 -1.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.5981 1.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.7321 1.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.4641 1.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.4641 1.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.8660 -3.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.0622 1.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.8660 2.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.8660 -1.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.5981 -0.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3 11 1 0 0 0 0 3 24 2 0 0 0 0 4 12 2 0 0 0 0 4 24 1 0 0 0 0 5 13 1 0 0 0 0 5 25 2 0 0 0 0 6 14 2 0 0 0 0 6 25 1 0 0 0 0 7 17 2 0 0 0 0 7 24 1 0 0 0 0 8 18 2 0 0 0 0 8 25 1 0 0 0 0 9 15 1 0 0 0 0 9 26 2 0 0 0 0 10 16 2 0 0 0 0 10 26 1 0 0 0 0 11 27 2 0 0 0 0 12 27 1 0 0 0 0 13 28 2 0 0 0 0 14 28 1 0 0 0 0 15 29 2 0 0 0 0 16 29 1 0 0 0 0 17 34 1 0 0 0 0 18 35 1 0 0 0 0 19 30 2 0 0 0 0 19 31 1 0 0 0 0 20 30 1 0 0 0 0 20 32 2 0 0 0 0 21 66 1 0 0 0 0 22 1 1 6 0 0 0 22 37 1 0 0 0 0 22 67 1 0 0 0 0 23 2 1 6 0 0 0 23 44 1 0 0 0 0 23 68 1 0 0 0 0 26 45 1 0 0 0 0 27 52 1 0 0 0 0 28 53 1 0 0 0 0 29 54 1 0 0 0 0 30 55 1 0 0 0 0 31 36 2 0 0 0 0 31 56 1 0 0 0 0 32 36 1 0 0 0 0 32 69 1 0 0 0 0 33 21 1 1 0 0 0 33 46 1 0 0 0 0 33 70 1 0 0 0 0 34 57 2 0 0 0 0 34 71 1 0 0 0 0 35 58 2 0 0 0 0 35 72 1 0 0 0 0 36 38 1 0 0 0 0 37 39 1 0 0 0 0 37 59 1 1 0 0 0 38 47 1 0 0 0 0 38 60 2 0 0 0 0 39 41 1 0 0 0 0 39 61 1 6 0 0 0 40 42 1 0 0 0 0 40 44 1 0 0 0 0 40 62 1 6 0 0 0 41 49 1 0 0 0 0 41 63 1 6 0 0 0 42 50 1 0 0 0 0 42 64 1 6 0 0 0 43 46 1 0 0 0 0 43 48 1 0 0 0 0 43 65 1 1 0 0 0 44 71 1 1 0 0 0 45 47 2 0 0 0 0 45 69 1 0 0 0 0 46 72 1 1 0 0 0 47 73 1 0 0 0 0 48 51 1 0 0 0 0 48 74 1 6 0 0 0 49 66 1 1 0 0 0 49 67 1 0 0 0 0 50 68 1 0 0 0 0 50 74 1 1 0 0 0 51 70 1 0 0 0 0 51 73 1 1 0 0 0 M END $$$$

External Identifiers

PubChem CID	21576261
ChEMBL	CHEMBL449412
ZINC

Physicochemical Properties

Molecular Weight:	1032.29
ALogP:	-6.3856
MLogP:	4.54
XLogP:	3.066
# Rotatable Bonds:	29
Polar Surface Area:	356.81
# H-Bond Aceptor:	17
# H-Bond Donor:	11
# Rings:	8
# Heavy Atoms:	74

Download Data

Data Type	Select
General Info & Identifiers & Properties
Structure MOL file
Source Organisms
Biological Activities
Similar NPs/Drugs