Natural Product: NPC230942| Natural Product ID: | NPC230942 |
| Common Name: | Physostigmine |
| IUPAC Name: | [(3aR,8bS)-3,4,8b-trimethyl-2,3a-dihydro-1H-pyrrolo[2,3-b]indol-7-yl] N-methylcarbamate |
| Synonyms: | Eserine; Physostigmine |
| Molecular Formula: | C15H21N3O2 |
| Standard InCHIKey: | PIJVFDBKTWXHHD-HIFRSBDPSA-N |
| Standard InCHI: | InChI=1S/C15H21N3O2/c1-15-7-8-17(3)13(15)18(4)12-6-5-10(9-11(12)15)20-14(19)16-2/h5-6,9,13H,7-8H2,1-4H3,(H,16,19)/t13-,15+/m1/s1 |
| Canonical SMILES: | CN=C(Oc1ccc2c(c1)[C@]1(C)CCN([C@@H]1N2C)C)O |
| First Find Year: | |
| Max Developmental Stage: | |
| Synthetic Gene Cluster: | BGC0000820 ; |
Species Source| Organism ID | Organism Name | Taxonomy Level | Family | SuperKingdom | Isolation Part | Collection Location | Collection Time | Reference |
|---|
Organism ID | Organism Name | Taxonomy Level | Family | SuperKingdom | Isolation Part | Collection Location | Collection Time | Reference |
|---|---|---|---|---|---|---|---|---|
| NPO228 | Physostigma venenosum | Species | Fabaceae | Eukaryota | TCM_Taiwan* |
Biological Activity| Activity Type | # Activity |
|---|---|
| AC50 | 3 |
| ED50 | 4 |
| IC50 | 142 |
| Ki | 4 |
| LD50 | 4 |
| MIC | 2 |
| Others | 55 |
| Potency | 52 |
| Activity Type | # Activity |
|---|---|
| Individual Protein | 188 |
| Organism | 22 |
| Others | 56 |
| Target ID | Target Type | Target Name | Target Organism | Activity Type | Activity Relation | Value | Unit | Reference |
|---|
Target ID | Target Type | Target Name | Target Organism | Activity Type | Activity Relation | Value | Unit | Reference |
|---|---|---|---|---|---|---|---|---|
| NPT10 | Individual Protein | Geminin | Homo sapiens | Potency | 1458.1 | nM | PubChem BioAssay data set | |
| NPT100 | Individual Protein | Glutaminase kidney isoform, mitochondrial | Homo sapiens | Potency | 12589.3 | nM | PubChem BioAssay data set | |
| NPT100 | Individual Protein | Glutaminase kidney isoform, mitochondrial | Homo sapiens | Potency | 19952.6 | nM | PubChem BioAssay data set | |
| NPT104 | Individual Protein | Cerebroside-sulfatase | Homo sapiens | Potency | 37933 | nM | PubChem BioAssay data set | |
| NPT110 | Individual Protein | Cytochrome P450 2D6 | Homo sapiens | IC50 | = | 200 | nM | DrugMatrix in vitro pharmacology data |
| NPT1295 | Individual Protein | Muscarinic acetylcholine receptor M1 | Mus musculus | IC50 | = | 37000 | nM | 1507203 |
| NPT1295 | Individual Protein | Muscarinic acetylcholine receptor M1 | Mus musculus | IC50 | = | 37000 | nM | 1552502 |
| NPT1296 | Individual Protein | Muscarinic acetylcholine receptor M2 | Mus musculus | IC50 | = | 160000 | nM | 1552502 |
| NPT1296 | Individual Protein | Muscarinic acetylcholine receptor M2 | Mus musculus | Ratio | = | 4.4 | 1552502 | |
| NPT1301 | Individual Protein | Muscarinic acetylcholine receptor M2 | Rattus norvegicus | IC50 | = | 160000 | nM | 1507203 |
Similar Natural Products in NPASSSimilarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient 
● The left chart: Distribution of similarity level between NPC230942 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.56 or Top200).
| range | Tanimoto Coefficient |
|---|---|
| 0-0.1 | 241 |
| 0.1-0.2 | 1265 |
| 0.2-0.3 | 8502 |
| 0.3-0.4 | 4266 |
| 0.4-0.5 | 11062 |
| 0.5-0.6 | 4523 |
| 0.6-0.7 | 1000 |
| 0.7-0.8 | 27 |
| 0.8-0.85 | 0 |
| 0.85-0.9 | 0 |
| 0.9-0.95 | 1 |
| 0.95-1 | 2 |
| Similarity Score | Similarity Level | Natural Product ID |
|---|
Similar Clinical/Approved DrugsSimilarity level is defined by Tanimoto coefficient (Tc) between two molecules.
● The left chart: Distribution of similarity level between NPC230942 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.56 or Top200).
| range | Tanimoto Coefficient |
|---|---|
| 0-0.1 | 181 |
| 0.1-0.2 | 553 |
| 0.2-0.3 | 1101 |
| 0.3-0.4 | 694 |
| 0.4-0.5 | 3066 |
| 0.5-0.6 | 2932 |
| 0.6-0.7 | 607 |
| 0.7-0.8 | 19 |
| 0.8-0.85 | 0 |
| 0.85-0.9 | 1 |
| 0.9-0.95 | 1 |
| 0.95-1 | 6 |
| Similarity Score | Similarity Level | Drug ID | Developmental Stage |
|---|
Similarity Score | Similarity Level | Drug ID | Developmental Stage |
|---|---|---|---|
| 0.6417 | Remote Similarity | NPD3920 | Phase 2 |
| 0.6418 | Remote Similarity | NPD7174 | Clinical (unspecified phase) |
| 0.6418 | Remote Similarity | NPD5530 | Phase 1 |
| 0.6418 | Remote Similarity | NPD3003 | Approved |
| 0.6421 | Remote Similarity | NPD6021 | Clinical (unspecified phase) |
| Molecular Weight: | 275.16 |
| ALogP: | 1.1378 |
| MLogP: | 2.56 |
| XLogP: | 2.677 |
| # Rotatable Bonds: | 7 |
| Polar Surface Area: | 48.3 |
| # H-Bond Aceptor: | 4 |
| # H-Bond Donor: | 1 |
| # Rings: | 3 |
| # Heavy Atoms: | 20 |