NPASS Natural Product

Natural Product: NPC19497

Natural Product ID:	NPC19497
Common Name:	Hydrazidomycin B
IUPAC Name:	N-[(1Z,8Z)-hexadeca-1,8-dienyl]-N'-(2-methoxyacetyl)decanehydrazide
Synonyms:	Hydrazidomycin B
Molecular Formula:	C29H54N2O3
Standard InCHIKey:	SLWJBIZOZMCRQW-JYWRQANJSA-N
Standard InCHI:	InChI=1S/C29H54N2O3/c1-4-6-8-10-12-13-14-15-16-17-18-20-22-24-26-31(30-28(32)27-34-3)29(33)25-23-21-19-11-9-7-5-2/h14-15,24,26H,4-13,16-23,25,27H2,1-3H3,(H,30,32)/b15-14-,26-24-
Canonical SMILES:	CCCCCCCCCC(=O)N(N=C(COC)O)/C=CCCCCC/C=CCCCCCCC
First Find Year:
Max Developmental Stage:
Synthetic Gene Cluster:	;

Species Source

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Isolation Part	Collection Location	Collection Time	Reference
NPO9189	Streptomyces atratus	Species	Streptomycetaceae	Bacteria				PMID[21868221]

Biological Activity

Activity Type	# Activity
IC50	42

Activity Type	# Activity
Cell Line	15
Others	27

Target ID	Target Type	Target Name	Target Organism	Activity Type	Activity Relation	Value	Unit	Reference
NPT2405	Cell Line	SAOS-2	Homo sapiens	IC50	=	18000	nM	PubChem BioAssay data set
NPT2	Others	Unspecified		IC50	=	21200	nM	PubChem BioAssay data set
NPT2	Others	Unspecified		IC50	=	11000	nM	PubChem BioAssay data set
NPT2	Others	Unspecified		IC50	=	10200	nM	PubChem BioAssay data set
NPT2	Others	Unspecified		IC50	=	18200	nM	PubChem BioAssay data set
NPT672	Cell Line	TE-671	Homo sapiens	IC50	=	18200	nM	PubChem BioAssay data set
NPT2	Others	Unspecified		IC50	=	20400	nM	16933872
NPT2	Others	Unspecified		IC50	=	15100	nM	PubChem BioAssay data set
NPT550	Cell Line	T-24	Homo sapiens	IC50	=	9190	nM	PubChem BioAssay data set
NPT2	Others	Unspecified		IC50	=	10200	nM	22880631
NPT2	Others	Unspecified		IC50	=	17400	nM	16417306
NPT2	Others	Unspecified		IC50	=	1410	nM	16417306
NPT2	Others	Unspecified		IC50	=	7390	nM	16417306
NPT2	Others	Unspecified		IC50	=	1540	nM	16417306
NPT1097	Cell Line	MKN-45	Homo sapiens	IC50	=	11600	nM	17190441
NPT2170	Cell Line	RKO	Homo sapiens	IC50	=	13800	nM	20192236
NPT2	Others	Unspecified		IC50	=	876	nM	24571273
NPT83	Cell Line	MCF7	Homo sapiens	IC50	=	11000	nM	24571273
NPT2	Others	Unspecified		IC50	=	17300	nM	24571273
NPT397	Cell Line	NCI-H460	Homo sapiens	IC50	=	17200	nM	24571273
NPT2	Others	Unspecified		IC50	=	18300	nM	24571273
NPT2	Others	Unspecified		IC50	=	20400	nM	24571273
NPT82	Cell Line	MDA-MB-231	Homo sapiens	IC50	=	5530	nM	24571273
NPT2	Others	Unspecified		IC50	=	14900	nM	24571273
NPT2	Others	Unspecified		IC50	=	19100	nM	24571273
NPT2	Others	Unspecified		IC50	=	18500	nM	24571273
NPT393	Cell Line	HCT-116	Homo sapiens	IC50	=	19400	nM	24063567
NPT2	Others	Unspecified		IC50	=	5940	nM	16297615
NPT2290	Cell Line	CAL-27	Homo sapiens	IC50	=	12700	nM	25946116
NPT858	Cell Line	LNCaP	Homo sapiens	IC50	=	14100	nM	23571415
NPT90	Cell Line	DU-145	Homo sapiens	IC50	=	7220	nM	23571415
NPT2	Others	Unspecified		IC50	=	30000	nM	24468412
NPT2	Others	Unspecified		IC50	=	1730	nM	15646539
NPT2	Others	Unspecified		IC50	=	10800	nM	15646539
NPT1629	Cell Line	CWR22R	Homo sapiens	IC50	=	15600	nM	15646539
NPT461	Cell Line	PANC-1	Homo sapiens	IC50	=	10000	nM	15646539
NPT2	Others	Unspecified		IC50	=	14300	nM	15646539
NPT2	Others	Unspecified		IC50	=	12700	nM	15646539
NPT2	Others	Unspecified		IC50	=	7070	nM	15332839
NPT2	Others	Unspecified		IC50	=	12600	nM	10514317
NPT139	Cell Line	HT-29	Homo sapiens	IC50	=	6540	nM	18990572
NPT2	Others	Unspecified		IC50	=	19300	nM	10.6019/CHEMBL1201861

Similar Natural Products in NPASS

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient

● The left chart: Distribution of similarity level between NPC19497 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.56 or Top200).

range	Tanimoto Coefficient
0-0.1	38
0.1-0.2	306
0.2-0.3	16908
0.3-0.4	11458
0.4-0.5	1983
0.5-0.6	192
0.6-0.7	3
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	1

Similarity Score	Similarity Level	Natural Product ID
0.9595	High Similarity	NPC163537
0.6522	Remote Similarity	NPC470943
0.6495	Remote Similarity	NPC304897
0.6353	Remote Similarity	NPC97614
0.5882	Remote Similarity	NPC187315
0.5859	Remote Similarity	NPC159369
0.5859	Remote Similarity	NPC39290
0.5729	Remote Similarity	NPC178758
0.5729	Remote Similarity	NPC196102
0.5714	Remote Similarity	NPC477106
0.5699	Remote Similarity	NPC474833
0.5657	Remote Similarity	NPC324506
0.5625	Remote Similarity	NPC251122
0.5618	Remote Similarity	NPC328895

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC19497 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.56 or Top200).

range	Tanimoto Coefficient
0-0.1	56
0.1-0.2	201
0.2-0.3	4813
0.3-0.4	3626
0.4-0.5	442
0.5-0.6	23
0.6-0.7	0
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.5607	Remote Similarity	NPD7651	Approved
0.5603	Remote Similarity	NPD6935	Phase 3
0.5603	Remote Similarity	NPD6936	Clinical (unspecified phase)

Structure

NPC19497 OpenBabel07101718302D 34 33 0 0 0 0 0 0 0 0999 V2000 10.3923 3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 6.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8660 3.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.5263 3.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 5.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.6603 3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8660 4.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.6603 2.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8660 3.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.7942 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7321 3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.7942 0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.9282 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.9282 -1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0622 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1962 -1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3301 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4641 -1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7321 2.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5981 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5981 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7321 -1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5981 0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8660 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7321 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 -1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 2.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8660 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8660 0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8660 0.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 -0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -1.7321 2.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.8660 1.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 3.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1 4 1 0 0 0 0 2 5 1 0 0 0 0 3 34 1 0 0 0 0 4 6 1 0 0 0 0 5 7 1 0 0 0 0 6 8 1 0 0 0 0 7 9 1 0 0 0 0 8 10 1 0 0 0 0 9 11 1 0 0 0 0 10 12 1 0 0 0 0 11 19 1 0 0 0 0 12 13 1 0 0 0 0 13 14 1 0 0 0 0 14 15 2 0 0 0 0 15 16 1 0 0 0 0 16 17 1 0 0 0 0 17 18 1 0 0 0 0 18 20 1 0 0 0 0 19 21 1 0 0 0 0 20 22 1 0 0 0 0 21 23 1 0 0 0 0 22 24 1 0 0 0 0 23 25 1 0 0 0 0 24 26 2 0 0 0 0 25 29 1 0 0 0 0 26 31 1 0 0 0 0 27 28 1 0 0 0 0 27 34 1 0 0 0 0 28 30 2 3 0 0 0 28 32 1 0 0 0 0 29 31 1 0 0 0 0 29 33 2 0 0 0 0 30 31 1 0 0 0 0 M END $$$$

External Identifiers

PubChem CID	53483941
ChEMBL	CHEMBL1834208
ZINC

Physicochemical Properties

Molecular Weight:	478.41
ALogP:	-3.9712
MLogP:	4.1
XLogP:	11.633
# Rotatable Bonds:	29
Polar Surface Area:	62.13
# H-Bond Aceptor:	5
# H-Bond Donor:	1
# Rings:	0
# Heavy Atoms:	34

Download Data

Data Type	Select
General Info & Identifiers & Properties
Structure MOL file
Source Organisms
Biological Activities
Similar NPs/Drugs