NPASS Natural Product

Natural Product: NPC146563

Natural Product ID:	NPC146563
Common Name:	Acankoreoside A
IUPAC Name:	(1R,3aS,5aR,5bR,7aR,8S,9R,11aR,11bR,13aR,13bR)-3a-[(2S,3R,4S,5S,6R)-6-[[(2R,3R,4R,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxymethyl]-3,4,5-trihydroxyoxan-2-yl]oxycarbonyl-9-hydroxy-5a,5b,8,11a-tetramethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysene-8-carboxylic acid
Synonyms:	Acankoreoside A
Molecular Formula:	C48H76O19
Standard InCHIKey:	OSXJYFIVZQMFMF-ATHBPGJJSA-N
Standard InCHI:	InChI=1S/C48H76O19/c1-20(2)22-10-15-48(17-16-45(5)23(29(22)48)8-9-26-44(4)13-12-28(50)47(7,42(59)60)27(44)11-14-46(26,45)6)43(61)67-41-36(57)33(54)31(52)25(65-41)19-62-39-37(58)34(55)38(24(18-49)64-39)66-40-35(56)32(53)30(51)21(3)63-40/h21-41,49-58H,1,8-19H2,2-7H3,(H,59,60)/t21-,22-,23+,24+,25+,26+,27+,28+,29+,30-,31+,32+,33-,34+,35+,36+,37+,38+,39+,40-,41-,44+,45+,46+,47-,48-/m0/s1
Canonical SMILES:	OC[C@H]1O[C@@H](OC[C@H]2O[C@@H](OC(=O)[C@@]34CC[C@H]([C@@H]4[C@@H]4[C@](CC3)(C)[C@]3(C)CC[C@@H]5[C@]([C@H]3CC4)(C)CC[C@H]([C@@]5(C)C(=O)O)O)C(=C)C)[C@@H]([C@H]([C@@H]2O)O)O)[C@@H]([C@H]([C@@H]1O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O)O)O)O
First Find Year:
Max Developmental Stage:
Synthetic Gene Cluster:	;

Species Source

Show entries

Search:

Organism ID	Organism Name	Taxonomy Level	Family	SuperKingdom	Reference
NPO10670	Bidens frondosa	Species	Asteraceae	Eukaryota	UNPD*
NPO10814	Ilex latifolia	Species	Aquifoliaceae	Eukaryota	UNPD*
NPO12019	Orontium japonicum	Species	Araceae	Eukaryota	UNPD*
NPO12610	Diospyros dendo	Species	Ebenaceae	Eukaryota	UNPD*
NPO12781	Schefflera heptaphylla	Species	Araliaceae	Eukaryota	UNPD*
NPO12836	Mentha javanica	Species	Lamiaceae	Eukaryota	UNPD*
NPO13061	Balanocarpus zeylanicus	NA	NA	NA	UNPD*
NPO1349	Zanthoxylum zanthoxyloides	Species	Rutaceae	Eukaryota	UNPD*
NPO14426	Halictus sexcinctus	Species	Halictidae	Eukaryota	UNPD*
NPO15495	Narcissus cantabricus	Species	Amaryllidaceae	Eukaryota	UNPD*

Showing 1 to 10 of 21 entries

Previous1 2 3Next

Biological Activity

Activity Type	# Activity
Others	7

Activity Type	# Activity
Others	7

Show entries

Search:

Target ID	Target Type	Target Name	Activity Type	Activity Relation	Value	Unit	Reference
NPT2	Others	Unspecified	Activity	=	2.89	ug/ml	20621475
NPT2	Others	Unspecified	Activity	=	4.62	ug/ml	20621475
NPT2	Others	Unspecified	Activity	=	4.57	ug/ml	20621475
NPT2	Others	Unspecified	Activity	=	17.04	ug/ml	20621475
NPT2	Others	Unspecified	Activity	=	24.87	ug/ml	20621475
NPT2	Others	Unspecified	Activity	=	29.78	ug/ml	20621475
NPT2	Others	Unspecified	Inhibition	<	50	%	20932756

Showing 1 to 7 of 7 entries

Previous1Next

Similar Natural Products in NPASS

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient

● The left chart: Distribution of similarity level between NPC146563 and all remaining natural products in the NPASS database.
● The right table: Most similar natural products (Tc>=0.56 or Top200).

range	Tanimoto Coefficient
0-0.1	188
0.1-0.2	1242
0.2-0.3	3706
0.3-0.4	7546
0.4-0.5	8101
0.5-0.6	4291
0.6-0.7	3354
0.7-0.8	1698
0.8-0.85	414
0.85-0.9	289
0.9-0.95	43
0.95-1	17

Show entries

Search:

Similarity Score	Similarity Level	Natural Product ID
0.8727	High Similarity	NPC285410
0.8727	High Similarity	NPC65167
0.8727	High Similarity	NPC473481
0.8739	High Similarity	NPC477074
0.8739	High Similarity	NPC251309

Showing 1 to 5 of 200 entries

Previous1 2 3 4 5…40Next

Similar Clinical/Approved Drugs

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.

● The left chart: Distribution of similarity level between NPC146563 and all drugs/candidates.
● The right table: Most similar clinical/approved drugs (Tc>=0.56 or Top200).

range	Tanimoto Coefficient
0-0.1	194
0.1-0.2	2072
0.2-0.3	3901
0.3-0.4	1929
0.4-0.5	562
0.5-0.6	315
0.6-0.7	147
0.7-0.8	36
0.8-0.85	4
0.85-0.9	0
0.9-0.95	1
0.95-1	0

Show entries

Search:

Similarity Score	Similarity Level	Drug ID	Developmental Stage
0.5966	Remote Similarity	NPD5778	Approved
0.5968	Remote Similarity	NPD8084	Approved
0.5968	Remote Similarity	NPD8086	Approved
0.5968	Remote Similarity	NPD8139	Approved
0.5968	Remote Similarity	NPD8083	Approved

Showing 1 to 5 of 200 entries

Previous1 2 3 4 5…40Next

Structure

CID146563 OpenBabel06191715502D 67 74 0 0 1 0 0 0 0 0999 V2000 2.8879 5.8372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9060 4.4359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.1502 -3.4364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3639 1.5565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5107 0.6295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5107 0.6295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0002 -2.0200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.8776 2.8948 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6207 2.2256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2323 4.5639 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9970 -0.7088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.8502 0.2183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.1070 0.8874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2539 -0.0397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6446 3.7549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7676 1.2986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0244 1.9677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6679 -0.9630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8340 1.4444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9924 4.8427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.1991 -3.7454 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 2.1834 4.2549 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 2.9265 2.5858 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.6679 -0.0000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.8340 0.4815 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 4.4128 1.2475 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 4.9481 -0.3998 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 6.6423 -0.7599 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 2.1834 3.2549 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.9912 -4.7236 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 1.6679 0.0000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.0401 -5.0326 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 1.6679 -0.9630 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.5019 1.4444 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.2970 -4.3635 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.8340 -1.4444 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.6679 1.9259 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.5019 0.4815 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.8340 1.4444 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.5049 -3.3853 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 0.0000 -0.9630 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 5.0221 -1.8121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8340 -1.4444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1560 0.5784 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 2.7186 1.6076 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 3.4618 0.9385 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 5.6912 -1.0689 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 1.2323 2.9459 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.5019 -1.4444 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.3854 -1.4290 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.7343 -5.3927 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.5019 0.4815 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.8322 -6.0107 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.5019 -1.4444 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.3358 1.9259 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.3459 -4.6725 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.8340 -2.4074 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.6679 2.8889 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.3311 -2.7631 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.0439 -1.6041 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.8340 -0.4815 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 1.9259 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.4560 -3.0763 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.8340 0.4815 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.3358 -0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.6679 -1.9259 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1 20 2 0 0 0 0 2 20 1 0 0 0 0 5 45 1 0 0 0 0 8 9 1 0 0 0 0 8 23 1 0 0 0 0 9 26 1 0 0 0 0 10 15 1 0 0 0 0 10 22 1 0 0 0 0 11 14 1 0 0 0 0 11 27 1 0 0 0 0 12 13 1 0 0 0 0 12 28 1 0 0 0 0 13 44 1 0 0 0 0 14 46 1 0 0 0 0 15 48 1 0 0 0 0 16 17 1 0 0 0 0 16 45 1 0 0 0 0 17 48 1 0 0 0 0 18 49 1 0 0 0 0 19 62 1 0 0 0 0 21 3 1 6 0 0 0 21 30 1 0 0 0 0 21 63 1 0 0 0 0 22 20 1 1 0 0 0 22 29 1 0 0 0 0 23 29 1 0 0 0 0 23 45 1 1 0 0 0 24 18 1 6 0 0 0 24 38 1 0 0 0 0 24 64 1 0 0 0 0 25 19 1 6 0 0 0 25 31 1 0 0 0 0 25 65 1 0 0 0 0 26 44 1 6 0 0 0 26 46 1 0 0 0 0 27 44 1 6 0 0 0 27 47 1 0 0 0 0 28 47 1 1 0 0 0 28 50 1 0 0 0 0 29 48 1 6 0 0 0 30 32 1 0 0 0 0 30 51 1 1 0 0 0 31 33 1 0 0 0 0 31 52 1 1 0 0 0 32 35 1 0 0 0 0 32 53 1 6 0 0 0 33 36 1 0 0 0 0 33 54 1 6 0 0 0 34 37 1 0 0 0 0 34 38 1 0 0 0 0 34 55 1 6 0 0 0 35 40 1 0 0 0 0 35 56 1 6 0 0 0 36 41 1 0 0 0 0 36 57 1 1 0 0 0 37 39 1 0 0 0 0 37 58 1 1 0 0 0 38 66 1 1 0 0 0 39 62 1 6 0 0 0 39 64 1 0 0 0 0 40 63 1 0 0 0 0 40 66 1 1 0 0 0 41 65 1 0 0 0 0 41 67 1 6 0 0 0 42 47 1 0 0 0 0 42 59 2 0 0 0 0 42 60 1 0 0 0 0 43 61 2 0 0 0 0 43 67 1 0 0 0 0 44 4 1 6 0 0 0 45 46 1 6 0 0 0 46 6 1 6 0 0 0 47 7 1 6 0 0 0 48 43 1 6 0 0 0 M END $$$$

External Identifiers

PubChem CID	10795959
ChEMBL	CHEMBL1269324
ZINC

Physicochemical Properties

Molecular Weight:	956.50
ALogP:	-3.4305
MLogP:	4.65
XLogP:	4.291
# Rotatable Bonds:	28
Polar Surface Area:	312.05
# H-Bond Aceptor:	19
# H-Bond Donor:	11
# Rings:	8
# Heavy Atoms:	67

Download Data

Data Type	Select
General Info & Identifiers & Properties
Structure MOL file
Source Organisms
Biological Activities
Similar NPs/Drugs