Molecular Weight:   | 270.08 |
Volume:   | 281.521 |
LogP:   | 4.24 |
LogD:   | 3.585 |
LogS:   | -6.403 |
# Rotatable Bonds:   | 0 |
TPSA:   | 34.89 |
# H-Bond Aceptor:   | 3 |
# H-Bond Donor:   | 0 |
# Rings:   | 5 |
# Heavy Atoms:   | 3 |
QED Drug-Likeness Score:   | 0.43 |
Synthetic Accessibility Score:   | 2.271 |
Fsp3:   | 0.0 |
Lipinski Rule-of-5:   | Accepted |
Pfizer Rule:   | Rejected |
GSK Rule:   | Rejected |
BMS Rule:   | 0 |
Golden Triangle Rule:   | Accepted |
Chelating Alert:   | 0 |
PAINS Alert:   | 0 |
Caco-2 Permeability:   | -4.879 |
MDCK Permeability:   | 1.601392614247743e-05 |
Pgp-inhibitor:   | 0.797 |
Pgp-substrate:   | 0.001 |
Human Intestinal Absorption (HIA):   | 0.004 |
20% Bioavailability (F20%):   | 0.047 |
30% Bioavailability (F30%):   | 0.111 |
Blood-Brain-Barrier Penetration (BBB):   | 0.75 |
Plasma Protein Binding (PPB):   | 98.01622009277344% |
Volume Distribution (VD):   | 0.569 |
Pgp-substrate:   | 1.1876922845840454% |
CYP1A2-inhibitor:   | 0.97 |
CYP1A2-substrate:   | 0.399 |
CYP2C19-inhibitor:   | 0.682 |
CYP2C19-substrate:   | 0.141 |
CYP2C9-inhibitor:   | 0.711 |
CYP2C9-substrate:   | 0.625 |
CYP2D6-inhibitor:   | 0.085 |
CYP2D6-substrate:   | 0.447 |
CYP3A4-inhibitor:   | 0.739 |
CYP3A4-substrate:   | 0.344 |
Clearance (CL):   | 2.102 |
Half-life (T1/2):   | 0.121 |
hERG Blockers:   | 0.135 |
Human Hepatotoxicity (H-HT):   | 0.732 |
Drug-inuced Liver Injury (DILI):   | 0.86 |
AMES Toxicity:   | 0.869 |
Rat Oral Acute Toxicity:   | 0.296 |
Maximum Recommended Daily Dose:   | 0.867 |
Skin Sensitization:   | 0.046 |
Carcinogencity:   | 0.868 |
Eye Corrosion:   | 0.003 |
Eye Irritation:   | 0.369 |
Respiratory Toxicity:   | 0.111 |
Natural Product ID:   | NPC471574 |
Common Name*:   | Fascaplysin Chloride |
IUPAC Name:   | n.a. |
Synonyms:   | GNF-Pf-1458; NSC-622398 |
Standard InCHIKey:   | PWUOOJVYZQILBG-UHFFFAOYSA-N |
Standard InCHI:   | InChI=1S/C18H10N2O.ClH/c21-18-13-6-2-4-8-15(13)20-10-9-12-11-5-1-3-7-14(11)19-16(12)17(18)20;/h1-10H;1H |
SMILES:   | O=C1c2c3nc4c(c3ccn2c2c1cccc2)cccc4.Cl |
Synthetic Gene Cluster:   | n.a. |
ChEMBL Identifier:   | CHEMBL258765 |
PubChem CID:   |
73292 |
Chemical Classification**:   |
|
*Note: the InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.
**Note: the Chemical Classification was calculated by NPClassifier Version 1.5. Reference: PMID:34662515.
Organism ID | Organism Name | Taxonomy Level | Family | SuperKingdom | Isolation Part | Collection Location | Collection Time | Reference |
---|---|---|---|---|---|---|---|---|
NPO32964 | hyrtios cf. erecta | Species | Thorectidae | Eukaryota | n.a. | n.a. | n.a. |
PMID[10869210] |
☑ Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].
Organism ID | NP ID | Organism Material Preparation | Organism Part | NP Quantity (Standard) | NP Quantity (Minimum) | NP Quantity (Maximum) | Quantity Unit | Reference |
---|
☑ Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].
Target ID | Target Type | Target Name | Target Organism | Activity Type | Activity Relation | Value | Unit | Reference |
---|---|---|---|---|---|---|---|---|
NPT839 | Cell Line | L6 | Rattus norvegicus | MIC | = | 2.5 | ug.mL-1 | PMID[501174] |
NPT13 | Individual Protein | Tyrosine-protein kinase LCK | Homo sapiens | Activity | = | 10.0 | % | PMID[501174] |
NPT459 | Individual Protein | Human immunodeficiency virus type 1 reverse transcriptase | Human immunodeficiency virus 1 | Activity | = | 10.0 | % | PMID[501174] |
NPT393 | Cell Line | HCT-116 | Homo sapiens | IC50 | = | 600.0 | nM | PMID[501175] |
NPT148 | Cell Line | HCT-15 | Homo sapiens | IC50 | > | 10000.0 | nM | PMID[501175] |
NPT139 | Cell Line | HT-29 | Homo sapiens | IC50 | > | 10000.0 | nM | PMID[501175] |
NPT386 | Cell Line | KM12 | Homo sapiens | IC50 | = | 4600.0 | nM | PMID[501175] |
NPT323 | Cell Line | SW-620 | Homo sapiens | IC50 | = | 3700.0 | nM | PMID[501175] |
NPT395 | Cell Line | SF-268 | Homo sapiens | IC50 | > | 10000.0 | nM | PMID[501175] |
NPT399 | Cell Line | SF-295 | Homo sapiens | IC50 | = | 3900.0 | nM | PMID[501175] |
NPT374 | Cell Line | SF-539 | Homo sapiens | IC50 | = | 4200.0 | nM | PMID[501175] |
NPT383 | Cell Line | SNB-19 | Homo sapiens | IC50 | = | 6100.0 | nM | PMID[501175] |
NPT392 | Cell Line | SNB-75 | Homo sapiens | IC50 | = | 5400.0 | nM | PMID[501175] |
NPT380 | Cell Line | U-251 | Homo sapiens | IC50 | = | 3600.0 | nM | PMID[501175] |
NPT390 | Cell Line | LOX IMVI | Homo sapiens | IC50 | > | 10000.0 | nM | PMID[501175] |
NPT375 | Cell Line | Malme-3M | Homo sapiens | IC50 | = | 360.0 | nM | PMID[501175] |
NPT387 | Cell Line | M14 | Homo sapiens | IC50 | = | 920.0 | nM | PMID[501175] |
NPT170 | Cell Line | SK-MEL-28 | Homo sapiens | IC50 | = | 9300.0 | nM | PMID[501175] |
NPT373 | Cell Line | SK-MEL-5 | Homo sapiens | IC50 | = | 2000.0 | nM | PMID[501175] |
NPT403 | Cell Line | UACC-257 | Homo sapiens | IC50 | > | 10000.0 | nM | PMID[501175] |
NPT398 | Cell Line | UACC-62 | Homo sapiens | IC50 | = | 4900.0 | nM | PMID[501175] |
NPT458 | Cell Line | IGROV-1 | Homo sapiens | IC50 | = | 4500.0 | nM | PMID[501175] |
NPT377 | Cell Line | OVCAR-3 | Homo sapiens | IC50 | = | 1500.0 | nM | PMID[501175] |
NPT456 | Cell Line | OVCAR-4 | Homo sapiens | IC50 | = | 5300.0 | nM | PMID[501175] |
NPT382 | Cell Line | OVCAR-5 | Homo sapiens | IC50 | = | 4400.0 | nM | PMID[501175] |
NPT381 | Cell Line | OVCAR-8 | Homo sapiens | IC50 | > | 10000.0 | nM | PMID[501175] |
NPT146 | Cell Line | SK-OV-3 | Homo sapiens | IC50 | > | 10000.0 | nM | PMID[501175] |
NPT376 | Cell Line | A498 | Homo sapiens | IC50 | = | 5200.0 | nM | PMID[501175] |
NPT369 | Cell Line | ACHN | Homo sapiens | IC50 | > | 10000.0 | nM | PMID[501175] |
NPT308 | Cell Line | CAKI-1 | Homo sapiens | IC50 | = | 6100.0 | nM | PMID[501175] |
NPT406 | Cell Line | RXF 393 | Homo sapiens | IC50 | = | 3500.0 | nM | PMID[501175] |
NPT368 | Cell Line | SN12C | Homo sapiens | IC50 | = | 4200.0 | nM | PMID[501175] |
NPT384 | Cell Line | TK-10 | Homo sapiens | IC50 | = | 5400.0 | nM | PMID[501175] |
NPT371 | Cell Line | UO-31 | Homo sapiens | IC50 | > | 10000.0 | nM | PMID[501175] |
NPT306 | Cell Line | PC-3 | Homo sapiens | IC50 | > | 10000.0 | nM | PMID[501175] |
NPT90 | Cell Line | DU-145 | Homo sapiens | IC50 | = | 4900.0 | nM | PMID[501175] |
NPT83 | Cell Line | MCF7 | Homo sapiens | IC50 | > | 10000.0 | nM | PMID[501175] |
NPT82 | Cell Line | MDA-MB-231 | Homo sapiens | IC50 | > | 10000.0 | nM | PMID[501175] |
NPT400 | Cell Line | MDA-MB-435 | Homo sapiens | IC50 | = | 560.0 | nM | PMID[501175] |
NPT367 | Cell Line | MDA-N | Homo sapiens | IC50 | = | 560.0 | nM | PMID[501175] |
NPT457 | Cell Line | BT-549 | Homo sapiens | IC50 | > | 10000.0 | nM | PMID[501175] |
NPT396 | Cell Line | T47D | Homo sapiens | IC50 | > | 10000.0 | nM | PMID[501175] |
NPT137 | Cell Line | L1210 | Mus musculus | Activity | = | 400.0 | Zone units | PMID[501175] |
NPT730 | Cell Line | MC-38 | Mus musculus | Activity | = | 500.0 | Zone units | PMID[501175] |
NPT404 | Cell Line | CCRF-CEM | Homo sapiens | Activity | = | 300.0 | Zone units | PMID[501175] |
NPT404 | Cell Line | CCRF-CEM | Homo sapiens | IC50 | > | 10000.0 | nM | PMID[501175] |
NPT116 | Cell Line | HL-60 | Homo sapiens | IC50 | > | 10000.0 | nM | PMID[501175] |
NPT111 | Cell Line | K562 | Homo sapiens | IC50 | > | 10000.0 | nM | PMID[501175] |
NPT112 | Cell Line | MOLT-4 | Homo sapiens | IC50 | > | 10000.0 | nM | PMID[501175] |
NPT389 | Cell Line | RPMI-8226 | Homo sapiens | IC50 | > | 10000.0 | nM | PMID[501175] |
NPT385 | Cell Line | SR | Homo sapiens | IC50 | > | 10000.0 | nM | PMID[501175] |
NPT81 | Cell Line | A549 | Homo sapiens | IC50 | = | 4200.0 | nM | PMID[501175] |
NPT394 | Cell Line | EKVX | Homo sapiens | IC50 | = | 5100.0 | nM | PMID[501175] |
NPT379 | Cell Line | HOP-62 | Homo sapiens | IC50 | = | 4700.0 | nM | PMID[501175] |
NPT405 | Cell Line | NCI-H226 | Homo sapiens | IC50 | = | 9600.0 | nM | PMID[501175] |
NPT370 | Cell Line | NCI-H23 | Homo sapiens | IC50 | = | 4500.0 | nM | PMID[501175] |
NPT388 | Cell Line | NCI-H322M | Homo sapiens | IC50 | = | 5000.0 | nM | PMID[501175] |
NPT397 | Cell Line | NCI-H460 | Homo sapiens | IC50 | = | 4200.0 | nM | PMID[501175] |
NPT455 | Cell Line | NCI-H522 | Homo sapiens | IC50 | = | 4500.0 | nM | PMID[501175] |
NPT407 | Cell Line | COLO 205 | Homo sapiens | IC50 | = | 1200.0 | nM | PMID[501175] |
NPT391 | Cell Line | HCC 2998 | Homo sapiens | IC50 | = | 1700.0 | nM | PMID[501175] |
NPT2213 | Individual Protein | Cyclin-dependent kinase 4 | Homo sapiens | IC50 | = | 350.0 | nM | PMID[501176] |
NPT1571 | Individual Protein | Cyclin-dependent kinase 6 | Homo sapiens | IC50 | = | 3400.0 | nM | PMID[501176] |
NPT1371 | Individual Protein | Cyclin-dependent kinase 2 | Homo sapiens | IC50 | = | 500000.0 | nM | PMID[501177] |
NPT1371 | Individual Protein | Cyclin-dependent kinase 2 | Homo sapiens | IC50 | = | 500000.0 | nM | PMID[501178] |
NPT1229 | Cell Line | Huh-7 | Homo sapiens | CC50 | = | 589.0 | nM | PMID[501179] |
NPT839 | Cell Line | L6 | Rattus norvegicus | Activity | = | 2.5 | ug ml-1 | PMID[501181] |
NPT368 | Cell Line | SN12C | Homo sapiens | GI50 | n.a. | 230.67 | nM | PMID[501182] |
NPT367 | Cell Line | MDA-N | Homo sapiens | GI50 | n.a. | 190.55 | nM | PMID[501182] |
NPT370 | Cell Line | NCI-H23 | Homo sapiens | GI50 | n.a. | 309.74 | nM | PMID[501182] |
NPT369 | Cell Line | ACHN | Homo sapiens | GI50 | n.a. | 557.19 | nM | PMID[501182] |
NPT371 | Cell Line | UO-31 | Homo sapiens | GI50 | n.a. | 682.34 | nM | PMID[501182] |
NPT116 | Cell Line | HL-60 | Homo sapiens | GI50 | n.a. | 403.65 | nM | PMID[501182] |
NPT372 | Cell Line | HOP-92 | Homo sapiens | GI50 | n.a. | 1655.77 | nM | PMID[501182] |
NPT374 | Cell Line | SF-539 | Homo sapiens | GI50 | n.a. | 349.14 | nM | PMID[501182] |
NPT90 | Cell Line | DU-145 | Homo sapiens | GI50 | n.a. | 1145.51 | nM | PMID[501182] |
NPT375 | Cell Line | Malme-3M | Homo sapiens | GI50 | n.a. | 58.61 | nM | PMID[501182] |
NPT373 | Cell Line | SK-MEL-5 | Homo sapiens | GI50 | n.a. | 140.28 | nM | PMID[501182] |
NPT111 | Cell Line | K562 | Homo sapiens | GI50 | n.a. | 924.7 | nM | PMID[501182] |
NPT377 | Cell Line | OVCAR-3 | Homo sapiens | GI50 | n.a. | 144.54 | nM | PMID[501182] |
NPT376 | Cell Line | A498 | Homo sapiens | GI50 | n.a. | 1581.25 | nM | PMID[501182] |
NPT379 | Cell Line | HOP-62 | Homo sapiens | GI50 | n.a. | 1142.88 | nM | PMID[501182] |
NPT112 | Cell Line | MOLT-4 | Homo sapiens | GI50 | n.a. | 285.1 | nM | PMID[501182] |
NPT378 | Cell Line | NCI/ADR-RES | Homo sapiens | GI50 | n.a. | 1205.04 | nM | PMID[501182] |
NPT380 | Cell Line | U-251 | Homo sapiens | GI50 | n.a. | 274.16 | nM | PMID[501182] |
NPT381 | Cell Line | OVCAR-8 | Homo sapiens | GI50 | n.a. | 438.53 | nM | PMID[501182] |
NPT382 | Cell Line | OVCAR-5 | Homo sapiens | GI50 | n.a. | 479.73 | nM | PMID[501182] |
NPT383 | Cell Line | SNB-19 | Homo sapiens | GI50 | n.a. | 615.18 | nM | PMID[501182] |
NPT82 | Cell Line | MDA-MB-231 | Homo sapiens | GI50 | n.a. | 219.79 | nM | PMID[501182] |
NPT385 | Cell Line | SR | Homo sapiens | GI50 | n.a. | 131.52 | nM | PMID[501182] |
NPT384 | Cell Line | TK-10 | Homo sapiens | GI50 | n.a. | 1140.25 | nM | PMID[501182] |
NPT323 | Cell Line | SW-620 | Homo sapiens | GI50 | n.a. | 295.8 | nM | PMID[501182] |
NPT455 | Cell Line | NCI-H522 | Homo sapiens | GI50 | n.a. | 489.78 | nM | PMID[501182] |
NPT387 | Cell Line | M14 | Homo sapiens | GI50 | n.a. | 158.85 | nM | PMID[501182] |
NPT386 | Cell Line | KM12 | Homo sapiens | GI50 | n.a. | 179.89 | nM | PMID[501182] |
NPT388 | Cell Line | NCI-H322M | Homo sapiens | GI50 | n.a. | 612.35 | nM | PMID[501182] |
NPT389 | Cell Line | RPMI-8226 | Homo sapiens | GI50 | n.a. | 186.21 | nM | PMID[501182] |
NPT456 | Cell Line | OVCAR-4 | Homo sapiens | GI50 | n.a. | 628.06 | nM | PMID[501182] |
NPT457 | Cell Line | BT-549 | Homo sapiens | GI50 | n.a. | 2264.64 | nM | PMID[501182] |
NPT390 | Cell Line | LOX IMVI | Homo sapiens | GI50 | n.a. | 244.91 | nM | PMID[501182] |
NPT147 | Cell Line | SK-MEL-2 | Homo sapiens | GI50 | n.a. | 226.46 | nM | PMID[501182] |
NPT81 | Cell Line | A549 | Homo sapiens | GI50 | n.a. | 564.94 | nM | PMID[501182] |
NPT391 | Cell Line | HCC 2998 | Homo sapiens | GI50 | n.a. | 189.67 | nM | PMID[501182] |
NPT392 | Cell Line | SNB-75 | Homo sapiens | GI50 | n.a. | 451.86 | nM | PMID[501182] |
NPT148 | Cell Line | HCT-15 | Homo sapiens | GI50 | n.a. | 851.14 | nM | PMID[501182] |
NPT395 | Cell Line | SF-268 | Homo sapiens | GI50 | n.a. | 246.6 | nM | PMID[501182] |
NPT393 | Cell Line | HCT-116 | Homo sapiens | GI50 | n.a. | 194.98 | nM | PMID[501182] |
NPT83 | Cell Line | MCF7 | Homo sapiens | GI50 | n.a. | 184.08 | nM | PMID[501182] |
NPT394 | Cell Line | EKVX | Homo sapiens | GI50 | n.a. | 273.53 | nM | PMID[501182] |
NPT306 | Cell Line | PC-3 | Homo sapiens | GI50 | n.a. | 269.15 | nM | PMID[501182] |
NPT146 | Cell Line | SK-OV-3 | Homo sapiens | GI50 | n.a. | 1555.97 | nM | PMID[501182] |
NPT396 | Cell Line | T47D | Homo sapiens | GI50 | n.a. | 755.09 | nM | PMID[501182] |
NPT397 | Cell Line | NCI-H460 | Homo sapiens | GI50 | n.a. | 263.03 | nM | PMID[501182] |
NPT398 | Cell Line | UACC-62 | Homo sapiens | GI50 | n.a. | 242.1 | nM | PMID[501182] |
NPT308 | Cell Line | CAKI-1 | Homo sapiens | GI50 | n.a. | 659.17 | nM | PMID[501182] |
NPT400 | Cell Line | MDA-MB-435 | Homo sapiens | GI50 | n.a. | 178.65 | nM | PMID[501182] |
NPT399 | Cell Line | SF-295 | Homo sapiens | GI50 | n.a. | 232.27 | nM | PMID[501182] |
NPT402 | Cell Line | Hs-578T | Homo sapiens | GI50 | n.a. | 1244.51 | nM | PMID[501182] |
NPT458 | Cell Line | IGROV-1 | Homo sapiens | GI50 | n.a. | 196.34 | nM | PMID[501182] |
NPT401 | Cell Line | 786-0 | Homo sapiens | GI50 | n.a. | 426.58 | nM | PMID[501182] |
NPT403 | Cell Line | UACC-257 | Homo sapiens | GI50 | n.a. | 327.34 | nM | PMID[501182] |
NPT404 | Cell Line | CCRF-CEM | Homo sapiens | GI50 | n.a. | 337.29 | nM | PMID[501182] |
NPT405 | Cell Line | NCI-H226 | Homo sapiens | GI50 | n.a. | 963.83 | nM | PMID[501182] |
NPT139 | Cell Line | HT-29 | Homo sapiens | GI50 | n.a. | 369.83 | nM | PMID[501182] |
NPT170 | Cell Line | SK-MEL-28 | Homo sapiens | GI50 | n.a. | 340.41 | nM | PMID[501182] |
NPT406 | Cell Line | RXF 393 | Homo sapiens | GI50 | n.a. | 383.71 | nM | PMID[501182] |
NPT407 | Cell Line | COLO 205 | Homo sapiens | GI50 | n.a. | 209.89 | nM | PMID[501182] |
NPT81 | Cell Line | A549 | Homo sapiens | IC50 | = | 690.0 | nM | PMID[501183] |
NPT1671 | Individual Protein | AMP-activated protein kinase, alpha-2 subunit | Homo sapiens | Thermal melting change | = | 0.0 | degrees C | PMID[501184] |
NPT1672 | Individual Protein | CaM kinase I delta | Homo sapiens | Thermal melting change | = | -4.3 | degrees C | PMID[501184] |
NPT1673 | Individual Protein | CaM kinase I gamma | Homo sapiens | Thermal melting change | = | -3.5 | degrees C | PMID[501184] |
NPT1674 | Individual Protein | CaM kinase II alpha | Homo sapiens | Thermal melting change | = | -0.5 | degrees C | PMID[501184] |
NPT1630 | Individual Protein | CaM kinase II beta | Homo sapiens | Thermal melting change | = | -2.0 | degrees C | PMID[501184] |
NPT1675 | Individual Protein | CaM kinase II delta | Homo sapiens | Thermal melting change | = | -2.9 | degrees C | PMID[501184] |
NPT1676 | Individual Protein | CaM kinase II gamma | Homo sapiens | Thermal melting change | = | -1.8 | degrees C | PMID[501184] |
NPT1677 | Individual Protein | CaM kinase IV | Homo sapiens | Thermal melting change | = | 0.7 | degrees C | PMID[501184] |
NPT1678 | Individual Protein | CaM-kinase kinase beta | Homo sapiens | Thermal melting change | = | -2.1 | degrees C | PMID[501184] |
NPT1371 | Individual Protein | Cyclin-dependent kinase 2 | Homo sapiens | Thermal melting change | = | 0.0 | degrees C | PMID[501184] |
NPT1571 | Individual Protein | Cyclin-dependent kinase 6 | Homo sapiens | Thermal melting change | = | 0.2 | degrees C | PMID[501184] |
NPT1679 | Individual Protein | Cyclin-dependent kinase-like 1 | Homo sapiens | Thermal melting change | = | -0.5 | degrees C | PMID[501184] |
NPT1680 | Individual Protein | Serine/threonine-protein kinase Chk2 | Homo sapiens | Thermal melting change | = | 4.9 | degrees C | PMID[501184] |
NPT1681 | Individual Protein | Dual specificty protein kinase CLK1 | Homo sapiens | Thermal melting change | = | -1.9 | degrees C | PMID[501184] |
NPT1682 | Individual Protein | Dual specificity protein kinase CLK2 | Homo sapiens | Thermal melting change | = | -0.4 | degrees C | PMID[501184] |
NPT1683 | Individual Protein | Dual specificity protein kinase CLK3 | Homo sapiens | Thermal melting change | = | -0.9 | degrees C | PMID[501184] |
NPT1684 | Individual Protein | Casein kinase I gamma 1 | Homo sapiens | Thermal melting change | = | -0.6 | degrees C | PMID[501184] |
NPT1685 | Individual Protein | Casein kinase I gamma 2 | Homo sapiens | Thermal melting change | = | -0.3 | degrees C | PMID[501184] |
NPT1686 | Individual Protein | Casein kinase I isoform gamma-3 | Homo sapiens | Thermal melting change | = | -0.8 | degrees C | PMID[501184] |
NPT1687 | Individual Protein | Death-associated protein kinase 3 | Homo sapiens | Thermal melting change | = | -0.5 | degrees C | PMID[501184] |
NPT1688 | Individual Protein | Myotonin-protein kinase | Homo sapiens | Thermal melting change | = | -0.9 | degrees C | PMID[501184] |
NPT591 | Individual Protein | Glycogen synthase kinase-3 beta | Homo sapiens | Thermal melting change | = | 0.1 | degrees C | PMID[501184] |
NPT1689 | Individual Protein | Tyrosine-protein kinase JAK1 | Homo sapiens | Thermal melting change | = | -1.5 | degrees C | PMID[501184] |
NPT1690 | Individual Protein | Dual specificity mitogen-activated protein kinase kinase 2 | Homo sapiens | Thermal melting change | = | -0.8 | degrees C | PMID[501184] |
NPT1691 | Individual Protein | Dual specificity mitogen-activated protein kinase kinase 6 | Homo sapiens | Thermal melting change | = | -0.8 | degrees C | PMID[501184] |
NPT1431 | Individual Protein | Mitogen-activated protein kinase kinase kinase 5 | Homo sapiens | Thermal melting change | = | -2.6 | degrees C | PMID[501184] |
NPT1616 | Individual Protein | MAP kinase p38 beta | Homo sapiens | Thermal melting change | = | -1.3 | degrees C | PMID[501184] |
NPT281 | Individual Protein | MAP kinase ERK1 | Homo sapiens | Thermal melting change | = | 0.3 | degrees C | PMID[501184] |
NPT1692 | Individual Protein | Mitogen-activated protein kinase 6 | Homo sapiens | Thermal melting change | = | -1.9 | degrees C | PMID[501184] |
NPT1693 | Individual Protein | Serine/threonine-protein kinase MST4 | Homo sapiens | Thermal melting change | = | -0.8 | degrees C | PMID[501184] |
NPT1658 | Individual Protein | Serine/threonine-protein kinase NEK2 | Homo sapiens | Thermal melting change | = | -2.0 | degrees C | PMID[501184] |
NPT1657 | Individual Protein | Serine/threonine-protein kinase NEK6 | Homo sapiens | Thermal melting change | = | -0.1 | degrees C | PMID[501184] |
NPT1694 | Individual Protein | Serine/threonine-protein kinase OSR1 | Homo sapiens | Thermal melting change | = | -1.5 | degrees C | PMID[501184] |
NPT1695 | Individual Protein | Serine/threonine-protein kinase PAK 4 | Homo sapiens | Thermal melting change | = | -0.6 | degrees C | PMID[501184] |
NPT1696 | Individual Protein | Serine/threonine-protein kinase PAK7 | Homo sapiens | Thermal melting change | = | 0.3 | degrees C | PMID[501184] |
NPT1697 | Individual Protein | Serine/threonine-protein kinase PAK6 | Homo sapiens | Thermal melting change | = | -0.9 | degrees C | PMID[501184] |
NPT1698 | Individual Protein | Serine/threonine-protein kinase PCTAIRE-1 | Homo sapiens | Thermal melting change | = | -0.6 | degrees C | PMID[501184] |
NPT1699 | Individual Protein | 3-phosphoinositide dependent protein kinase-1 | Homo sapiens | Thermal melting change | = | -2.7 | degrees C | PMID[501184] |
NPT1265 | Individual Protein | Serine/threonine-protein kinase PIM1 | Homo sapiens | Thermal melting change | = | -0.8 | degrees C | PMID[501184] |
NPT1700 | Individual Protein | Serine/threonine-protein kinase PIM2 | Homo sapiens | Thermal melting change | = | -2.4 | degrees C | PMID[501184] |
NPT1701 | Individual Protein | Serine/threonine-protein kinase PIM3 | Homo sapiens | Thermal melting change | = | 0.0 | degrees C | PMID[501184] |
NPT1702 | Individual Protein | Serine/threonine-protein kinase PLK4 | Homo sapiens | Thermal melting change | = | -0.1 | degrees C | PMID[501184] |
NPT1703 | Individual Protein | cAMP-dependent protein kinase alpha-catalytic subunit | Homo sapiens | Thermal melting change | = | 0.6 | degrees C | PMID[501184] |
NPT1704 | Individual Protein | Serine/threonine-protein kinase RIO2 | Homo sapiens | Thermal melting change | = | -0.9 | degrees C | PMID[501184] |
NPT1705 | Individual Protein | Ribosomal protein S6 kinase alpha 3 | Homo sapiens | Thermal melting change | = | -0.1 | degrees C | PMID[501184] |
NPT1705 | Individual Protein | Ribosomal protein S6 kinase alpha 3 | Homo sapiens | Thermal melting change | = | 0.7 | degrees C | PMID[501184] |
NPT1706 | Individual Protein | Serine/threonine-protein kinase 2 | Homo sapiens | Thermal melting change | = | -0.9 | degrees C | PMID[501184] |
NPT1707 | Individual Protein | Serine/threonine-protein kinase 10 | Homo sapiens | Thermal melting change | = | -1.8 | degrees C | PMID[501184] |
NPT1708 | Individual Protein | Serine/threonine-protein kinase 16 | Homo sapiens | Thermal melting change | = | -0.1 | degrees C | PMID[501184] |
NPT1709 | Individual Protein | Serine/threonine-protein kinase 17A | Homo sapiens | Thermal melting change | = | 1.5 | degrees C | PMID[501184] |
NPT1710 | Individual Protein | Serine/threonine-protein kinase 38 | Homo sapiens | Thermal melting change | = | -0.5 | degrees C | PMID[501184] |
NPT1693 | Individual Protein | Serine/threonine-protein kinase MST4 | Homo sapiens | Thermal melting change | = | -2.5 | degrees C | PMID[501184] |
NPT1711 | Individual Protein | Serine/threonine-protein kinase MST1 | Homo sapiens | Thermal melting change | = | -1.6 | degrees C | PMID[501184] |
NPT1712 | Individual Protein | TRAF2- and NCK-interacting kinase | Homo sapiens | Thermal melting change | = | -0.9 | degrees C | PMID[501184] |
NPT1713 | Individual Protein | PDZ-binding kinase | Homo sapiens | Thermal melting change | = | 0.6 | degrees C | PMID[501184] |
NPT1715 | Individual Protein | Serine/threonine-protein kinase VRK2 | Homo sapiens | Thermal melting change | = | -0.8 | degrees C | PMID[501184] |
NPT1717 | Individual Protein | Serine/threonine-protein kinase 25 | Homo sapiens | Thermal melting change | = | -1.5 | degrees C | PMID[501184] |
NPT2213 | Individual Protein | Cyclin-dependent kinase 4 | Homo sapiens | IC50 | = | 350.0 | nM | PMID[501185] |
NPT2 | Others | Unspecified | IC50 | = | 350.0 | nM | PMID[501173] | |
NPT2 | Others | Unspecified | IC50 | = | 3400.0 | nM | PMID[501173] | |
NPT2 | Others | Unspecified | IC50 | > | 10000.0 | nM | PMID[501173] | |
NPT2 | Others | Unspecified | IC50 | > | 20000.0 | nM | PMID[501173] | |
NPT485 | Organism | Plasmodium falciparum (isolate K1 / Thailand) | Plasmodium falciparum K1 | IC50 | = | 0.05 | ug.mL-1 | PMID[501174] |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 0.034 | ug.mL-1 | PMID[501174] |
NPT1230 | Organism | Bacillus megaterium | Bacillus megaterium | IZ | = | 10.0 | mm | PMID[501174] |
NPT19 | Organism | Escherichia coli | Escherichia coli | IZ | = | 6.0 | mm | PMID[501174] |
NPT844 | Organism | Trypanosoma brucei rhodesiense | Trypanosoma brucei rhodesiense | IC50 | = | 630.0 | nM | PMID[501174] |
NPT20529 | NON-MOLECULAR | NON-PROTEIN TARGET | n.a. | IC50 | = | 6700.0 | nM | PMID[501175] |
NPT20529 | NON-MOLECULAR | NON-PROTEIN TARGET | n.a. | IC50 | > | 10000.0 | nM | PMID[501175] |
NPT27 | Others | Unspecified | Activity | = | 200.0 | Zone units | PMID[501175] | |
NPT20529 | NON-MOLECULAR | NON-PROTEIN TARGET | n.a. | Activity | = | 500.0 | Zone units | PMID[501175] |
NPT20529 | NON-MOLECULAR | NON-PROTEIN TARGET | n.a. | Activity | = | 400.0 | Zone units | PMID[501175] |
NPT1560 | Protein Complex | Cyclin-dependent kinase 4/cyclin D1 | Homo sapiens | IC50 | = | 550.0 | nM | PMID[501177] |
NPT1560 | Protein Complex | Cyclin-dependent kinase 4/cyclin D1 | Homo sapiens | IC50 | = | 550.0 | nM | PMID[501178] |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | EC50 | = | 74.9 | nM | PMID[501179] |
NPT2 | Others | Unspecified | IFI | = | 41.22 | % | PMID[501179] | |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | EC50 | = | 46.4 | nM | PMID[501179] |
NPT485 | Organism | Plasmodium falciparum (isolate K1 / Thailand) | Plasmodium falciparum K1 | IC50 | = | 184.0 | nM | PMID[501180] |
NPT27 | Others | Unspecified | Ratio IC50 | = | 50.0 | n.a. | PMID[501180] | |
NPT485 | Organism | Plasmodium falciparum (isolate K1 / Thailand) | Plasmodium falciparum K1 | IC50 | = | 160.0 | nM | PMID[501181] |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 48.2 | nM | PMID[501181] |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 7.82 | nM | PMID[501181] |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 401.0 | nM | PMID[501181] |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 65.2 | nM | PMID[501181] |
NPT2 | Others | Unspecified | Ratio | = | 50.0 | n.a. | PMID[501181] | |
NPT1560 | Protein Complex | Cyclin-dependent kinase 4/cyclin D1 | Homo sapiens | IC50 | = | 410.0 | nM | PMID[501183] |
NPT4158 | Protein Complex | CDK2/Cyclin A | Homo sapiens | IC50 | > | 250000.0 | nM | PMID[501183] |
NPT3944 | Protein Complex | Cyclin-dependent kinase 2/cyclin E1 | Homo sapiens | IC50 | > | 250000.0 | nM | PMID[501183] |
NPT1561 | Protein Complex | Cyclin-dependent kinase 1/cyclin B1 | Homo sapiens | IC50 | > | 250000.0 | nM | PMID[501183] |
NPT4092 | Protein Complex | CDK9/cyclin T1 | Homo sapiens | IC50 | > | 250000.0 | nM | PMID[501183] |
NPT20529 | NON-MOLECULAR | NON-PROTEIN TARGET | n.a. | IC50 | = | 880.0 | nM | PMID[501183] |
NPT20529 | NON-MOLECULAR | NON-PROTEIN TARGET | n.a. | IC50 | = | 920.0 | nM | PMID[501183] |
NPT20529 | NON-MOLECULAR | NON-PROTEIN TARGET | n.a. | IC50 | = | 1300.0 | nM | PMID[501183] |
NPT2 | Others | Unspecified | IC50 | = | 5000.0 | nM | PMID[501183] | |
NPT831 | Individual Protein | Serine/threonine-protein kinase PLK1 | Homo sapiens | Thermal melting change | = | 0.8 | degrees C | PMID[501184] |
NPT22960 | SINGLE PROTEIN | Serine/threonine-protein kinase VRK1 | Homo sapiens | Thermal melting change | = | -1.2 | degrees C | PMID[501184] |
NPT22961 | SINGLE PROTEIN | Inactive serine/threonine-protein kinase VRK3 | Homo sapiens | Thermal melting change | = | -0.4 | degrees C | PMID[501184] |
NPT35 | Others | n.a. | Solubility | > | 1500.0 | ug.mL-1 | PMID[501185] | |
NPT2 | Others | Unspecified | Activity | = | 57.58 | % | PMID[501185] | |
NPT2 | Others | Unspecified | Activity | = | 42.89 | % | PMID[501185] | |
NPT2 | Others | Unspecified | Activity | = | 39.28 | % | PMID[501185] | |
NPT2 | Others | Unspecified | Activity | = | 43.71 | % | PMID[501185] | |
NPT2 | Others | Unspecified | Activity | = | 34.54 | % | PMID[501185] | |
NPT2 | Others | Unspecified | FC | = | 4.0 | n.a. | PMID[501185] | |
NPT27 | Others | Unspecified | Activity | = | 57.5 | % | PMID[501185] | |
NPT27 | Others | Unspecified | IC50 | = | 4000.0 | nM | PMID[501185] | |
NPT27 | Others | Unspecified | Solubility | > | 1500.0 | ug.mL-1 | PMID[501185] | |
NPT2 | Others | Unspecified | IC50 | = | 350.0 | nM | PMID[501186] |
☑ Note for Activity Records:
☉ The quantitative biological activities were primarily integrated from ChEMBL (Version-30) database and were also directly collected from PubMed literature. PubMed PMID was provided as the reference link for each activity record.
Top-200 similar NPs were calculated against the active-NP-set (includes 4,3285 NPs with experimentally-derived bioactivity available in NPASS)
Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient
●  The left chart: Distribution of similarity level between NPC471574 and all remaining natural products in the NPASS database.
●  The right table: Most similar natural products (Tc>=0.56 or Top200).
Similarity Score | Similarity Level | Natural Product ID |
---|---|---|
0.9776 | High Similarity | NPC136002 |
0.8485 | Intermediate Similarity | NPC257490 |
0.838 | Intermediate Similarity | NPC207554 |
0.8227 | Intermediate Similarity | NPC300299 |
0.8195 | Intermediate Similarity | NPC177684 |
0.8195 | Intermediate Similarity | NPC291962 |
0.8188 | Intermediate Similarity | NPC209389 |
0.8134 | Intermediate Similarity | NPC112373 |
0.8134 | Intermediate Similarity | NPC258531 |
0.8134 | Intermediate Similarity | NPC161956 |
0.8133 | Intermediate Similarity | NPC117032 |
0.8079 | Intermediate Similarity | NPC295021 |
0.8054 | Intermediate Similarity | NPC300596 |
0.8054 | Intermediate Similarity | NPC237649 |
0.7945 | Intermediate Similarity | NPC471164 |
0.7887 | Intermediate Similarity | NPC207428 |
0.7862 | Intermediate Similarity | NPC471943 |
0.7826 | Intermediate Similarity | NPC469529 |
0.7744 | Intermediate Similarity | NPC187036 |
0.7737 | Intermediate Similarity | NPC279385 |
0.7737 | Intermediate Similarity | NPC179605 |
0.7703 | Intermediate Similarity | NPC2823 |
0.7681 | Intermediate Similarity | NPC103292 |
0.7667 | Intermediate Similarity | NPC470822 |
0.7626 | Intermediate Similarity | NPC39818 |
0.7626 | Intermediate Similarity | NPC268534 |
0.7622 | Intermediate Similarity | NPC284775 |
0.7612 | Intermediate Similarity | NPC296163 |
0.7571 | Intermediate Similarity | NPC254698 |
0.7568 | Intermediate Similarity | NPC83214 |
0.7547 | Intermediate Similarity | NPC476231 |
0.7536 | Intermediate Similarity | NPC226143 |
0.753 | Intermediate Similarity | NPC73994 |
0.7518 | Intermediate Similarity | NPC192209 |
0.7397 | Intermediate Similarity | NPC40364 |
0.7394 | Intermediate Similarity | NPC192533 |
0.7389 | Intermediate Similarity | NPC281094 |
0.7338 | Intermediate Similarity | NPC324445 |
0.7337 | Intermediate Similarity | NPC117027 |
0.731 | Intermediate Similarity | NPC150863 |
0.7279 | Intermediate Similarity | NPC53044 |
0.7267 | Intermediate Similarity | NPC122553 |
0.726 | Intermediate Similarity | NPC194562 |
0.7246 | Intermediate Similarity | NPC288232 |
0.7241 | Intermediate Similarity | NPC476950 |
0.7229 | Intermediate Similarity | NPC252572 |
0.7225 | Intermediate Similarity | NPC473666 |
0.7222 | Intermediate Similarity | NPC88970 |
0.7202 | Intermediate Similarity | NPC83774 |
0.7193 | Intermediate Similarity | NPC21429 |
0.7181 | Intermediate Similarity | NPC162417 |
0.7181 | Intermediate Similarity | NPC316104 |
0.716 | Intermediate Similarity | NPC27904 |
0.7159 | Intermediate Similarity | NPC326422 |
0.7159 | Intermediate Similarity | NPC304203 |
0.7152 | Intermediate Similarity | NPC70949 |
0.7151 | Intermediate Similarity | NPC133003 |
0.7143 | Intermediate Similarity | NPC476460 |
0.7143 | Intermediate Similarity | NPC313449 |
0.7143 | Intermediate Similarity | NPC280807 |
0.7143 | Intermediate Similarity | NPC314431 |
0.7143 | Intermediate Similarity | NPC472245 |
0.7134 | Intermediate Similarity | NPC471130 |
0.7134 | Intermediate Similarity | NPC115232 |
0.7118 | Intermediate Similarity | NPC61011 |
0.7117 | Intermediate Similarity | NPC242116 |
0.7093 | Intermediate Similarity | NPC477003 |
0.7091 | Intermediate Similarity | NPC114637 |
0.7089 | Intermediate Similarity | NPC144691 |
0.7086 | Intermediate Similarity | NPC324091 |
0.7078 | Intermediate Similarity | NPC238499 |
0.7076 | Intermediate Similarity | NPC191415 |
0.7067 | Intermediate Similarity | NPC184437 |
0.7066 | Intermediate Similarity | NPC355 |
0.7037 | Intermediate Similarity | NPC172170 |
0.7027 | Intermediate Similarity | NPC9856 |
0.7027 | Intermediate Similarity | NPC187231 |
0.7018 | Intermediate Similarity | NPC475685 |
0.7006 | Intermediate Similarity | NPC65080 |
0.6994 | Remote Similarity | NPC46895 |
0.6993 | Remote Similarity | NPC469560 |
0.6983 | Remote Similarity | NPC472293 |
0.6982 | Remote Similarity | NPC475594 |
0.698 | Remote Similarity | NPC316746 |
0.697 | Remote Similarity | NPC265100 |
0.6961 | Remote Similarity | NPC81535 |
0.6959 | Remote Similarity | NPC475761 |
0.6941 | Remote Similarity | NPC475607 |
0.6941 | Remote Similarity | NPC151635 |
0.6928 | Remote Similarity | NPC42372 |
0.6919 | Remote Similarity | NPC88110 |
0.6918 | Remote Similarity | NPC100726 |
0.6914 | Remote Similarity | NPC17273 |
0.6914 | Remote Similarity | NPC135601 |
0.6914 | Remote Similarity | NPC141612 |
0.691 | Remote Similarity | NPC472292 |
0.6909 | Remote Similarity | NPC214106 |
0.6905 | Remote Similarity | NPC472118 |
0.6901 | Remote Similarity | NPC474081 |
0.6899 | Remote Similarity | NPC467188 |
0.689 | Remote Similarity | NPC80681 |
0.6885 | Remote Similarity | NPC471944 |
0.6871 | Remote Similarity | NPC84317 |
0.6868 | Remote Similarity | NPC472296 |
0.6868 | Remote Similarity | NPC472297 |
0.686 | Remote Similarity | NPC474041 |
0.686 | Remote Similarity | NPC475094 |
0.6857 | Remote Similarity | NPC57051 |
0.6857 | Remote Similarity | NPC476341 |
0.6853 | Remote Similarity | NPC264580 |
0.6852 | Remote Similarity | NPC200743 |
0.6851 | Remote Similarity | NPC167710 |
0.6839 | Remote Similarity | NPC102755 |
0.6839 | Remote Similarity | NPC470205 |
0.6829 | Remote Similarity | NPC477887 |
0.6815 | Remote Similarity | NPC478040 |
0.6815 | Remote Similarity | NPC277157 |
0.6811 | Remote Similarity | NPC317701 |
0.6802 | Remote Similarity | NPC237188 |
0.6802 | Remote Similarity | NPC157583 |
0.6796 | Remote Similarity | NPC102592 |
0.6796 | Remote Similarity | NPC472116 |
0.6796 | Remote Similarity | NPC79356 |
0.6795 | Remote Similarity | NPC301760 |
0.6792 | Remote Similarity | NPC478039 |
0.679 | Remote Similarity | NPC70406 |
0.679 | Remote Similarity | NPC217021 |
0.679 | Remote Similarity | NPC470679 |
0.6788 | Remote Similarity | NPC154478 |
0.6784 | Remote Similarity | NPC293216 |
0.6779 | Remote Similarity | NPC478079 |
0.6772 | Remote Similarity | NPC314186 |
0.6766 | Remote Similarity | NPC113056 |
0.6766 | Remote Similarity | NPC138293 |
0.6766 | Remote Similarity | NPC21174 |
0.6766 | Remote Similarity | NPC271797 |
0.6765 | Remote Similarity | NPC318183 |
0.6758 | Remote Similarity | NPC471199 |
0.6757 | Remote Similarity | NPC470343 |
0.6757 | Remote Similarity | NPC472244 |
0.6748 | Remote Similarity | NPC251391 |
0.6747 | Remote Similarity | NPC93653 |
0.6744 | Remote Similarity | NPC471743 |
0.6743 | Remote Similarity | NPC159125 |
0.674 | Remote Similarity | NPC202812 |
0.6739 | Remote Similarity | NPC164802 |
0.6739 | Remote Similarity | NPC121327 |
0.6731 | Remote Similarity | NPC130251 |
0.6731 | Remote Similarity | NPC472243 |
0.6731 | Remote Similarity | NPC315051 |
0.6728 | Remote Similarity | NPC471655 |
0.6727 | Remote Similarity | NPC104345 |
0.6727 | Remote Similarity | NPC76982 |
0.6723 | Remote Similarity | NPC150308 |
0.6722 | Remote Similarity | NPC272458 |
0.6722 | Remote Similarity | NPC216550 |
0.6708 | Remote Similarity | NPC105811 |
0.6703 | Remote Similarity | NPC128244 |
0.6688 | Remote Similarity | NPC316202 |
0.6687 | Remote Similarity | NPC293487 |
0.6686 | Remote Similarity | NPC470548 |
0.6685 | Remote Similarity | NPC106118 |
0.6667 | Remote Similarity | NPC478182 |
0.6667 | Remote Similarity | NPC130797 |
0.6667 | Remote Similarity | NPC143977 |
0.6646 | Remote Similarity | NPC478186 |
0.6645 | Remote Similarity | NPC325599 |
0.6645 | Remote Similarity | NPC471123 |
0.6631 | Remote Similarity | NPC295548 |
0.663 | Remote Similarity | NPC47190 |
0.663 | Remote Similarity | NPC474916 |
0.6629 | Remote Similarity | NPC477042 |
0.6628 | Remote Similarity | NPC161861 |
0.6627 | Remote Similarity | NPC299582 |
0.6626 | Remote Similarity | NPC473878 |
0.6626 | Remote Similarity | NPC313889 |
0.6619 | Remote Similarity | NPC302790 |
0.6615 | Remote Similarity | NPC470702 |
0.6615 | Remote Similarity | NPC473218 |
0.6614 | Remote Similarity | NPC471155 |
0.6612 | Remote Similarity | NPC472539 |
0.6612 | Remote Similarity | NPC470787 |
0.6612 | Remote Similarity | NPC472540 |
0.6607 | Remote Similarity | NPC293458 |
0.6607 | Remote Similarity | NPC469741 |
0.6607 | Remote Similarity | NPC194881 |
0.6606 | Remote Similarity | NPC209362 |
0.6604 | Remote Similarity | NPC314287 |
0.6595 | Remote Similarity | NPC237414 |
0.6595 | Remote Similarity | NPC477004 |
0.6593 | Remote Similarity | NPC269886 |
0.6593 | Remote Similarity | NPC81802 |
0.6593 | Remote Similarity | NPC247735 |
0.6593 | Remote Similarity | NPC472210 |
0.6593 | Remote Similarity | NPC472295 |
0.6591 | Remote Similarity | NPC470677 |
0.6588 | Remote Similarity | NPC478183 |
0.6582 | Remote Similarity | NPC43477 |
0.658 | Remote Similarity | NPC470703 |
0.6579 | Remote Similarity | NPC270241 |
Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.
●  The left chart: Distribution of similarity level between NPC471574 and all drugs/candidates.
●  The right table: Most similar clinical/approved drugs (Tc>=0.56 or Top200).
Similarity Score | Similarity Level | Drug ID | Developmental Stage |
---|---|---|---|
0.8219 | Intermediate Similarity | NPD6017 | Discontinued |
0.8133 | Intermediate Similarity | NPD3248 | Phase 1 |
0.7887 | Intermediate Similarity | NPD1920 | Approved |
0.7887 | Intermediate Similarity | NPD1919 | Approved |
0.7832 | Intermediate Similarity | NPD1527 | Phase 2 |
0.7817 | Intermediate Similarity | NPD486 | Clinical (unspecified phase) |
0.7569 | Intermediate Similarity | NPD4300 | Clinical (unspecified phase) |
0.7466 | Intermediate Similarity | NPD441 | Approved |
0.7451 | Intermediate Similarity | NPD1524 | Phase 1 |
0.7368 | Intermediate Similarity | NPD4988 | Discontinued |
0.7355 | Intermediate Similarity | NPD4939 | Clinical (unspecified phase) |
0.7353 | Intermediate Similarity | NPD1175 | Approved |
0.7347 | Intermediate Similarity | NPD2949 | Approved |
0.7347 | Intermediate Similarity | NPD1541 | Approved |
0.7347 | Intermediate Similarity | NPD2950 | Approved |
0.7303 | Intermediate Similarity | NPD6512 | Approved |
0.7303 | Intermediate Similarity | NPD6513 | Approved |
0.7278 | Intermediate Similarity | NPD4011 | Clinical (unspecified phase) |
0.7278 | Intermediate Similarity | NPD2790 | Discontinued |
0.7273 | Intermediate Similarity | NPD5933 | Phase 3 |
0.7273 | Intermediate Similarity | NPD5932 | Phase 3 |
0.7273 | Intermediate Similarity | NPD5931 | Phase 3 |
0.7267 | Intermediate Similarity | NPD6342 | Discontinued |
0.7244 | Intermediate Similarity | NPD4942 | Approved |
0.723 | Intermediate Similarity | NPD6740 | Clinical (unspecified phase) |
0.7214 | Intermediate Similarity | NPD1668 | Clinical (unspecified phase) |
0.719 | Intermediate Similarity | NPD6566 | Discontinued |
0.7188 | Intermediate Similarity | NPD951 | Approved |
0.7175 | Intermediate Similarity | NPD4848 | Phase 1 |
0.7143 | Intermediate Similarity | NPD7481 | Approved |
0.7143 | Intermediate Similarity | NPD7480 | Approved |
0.7143 | Intermediate Similarity | NPD4464 | Clinical (unspecified phase) |
0.7134 | Intermediate Similarity | NPD979 | Approved |
0.7114 | Intermediate Similarity | NPD1874 | Clinical (unspecified phase) |
0.7107 | Intermediate Similarity | NPD1854 | Approved |
0.7081 | Intermediate Similarity | NPD2351 | Discontinued |
0.7055 | Intermediate Similarity | NPD2840 | Approved |
0.7019 | Intermediate Similarity | NPD7072 | Phase 2 |
0.7018 | Intermediate Similarity | NPD5473 | Discontinued |
0.6994 | Remote Similarity | NPD1630 | Approved |
0.6993 | Remote Similarity | NPD6655 | Clinical (unspecified phase) |
0.6987 | Remote Similarity | NPD5918 | Discontinued |
0.6982 | Remote Similarity | NPD7662 | Clinical (unspecified phase) |
0.6975 | Remote Similarity | NPD6855 | Clinical (unspecified phase) |
0.6975 | Remote Similarity | NPD7091 | Discontinued |
0.6923 | Remote Similarity | NPD4524 | Discontinued |
0.6919 | Remote Similarity | NPD1291 | Clinical (unspecified phase) |
0.6914 | Remote Similarity | NPD4045 | Phase 2 |
0.6914 | Remote Similarity | NPD4042 | Phase 2 |
0.6909 | Remote Similarity | NPD5400 | Approved |
0.6905 | Remote Similarity | NPD1573 | Approved |
0.6905 | Remote Similarity | NPD1575 | Approved |
0.6903 | Remote Similarity | NPD3434 | Clinical (unspecified phase) |
0.6897 | Remote Similarity | NPD3607 | Clinical (unspecified phase) |
0.6867 | Remote Similarity | NPD1631 | Approved |
0.6859 | Remote Similarity | NPD3482 | Approved |
0.6859 | Remote Similarity | NPD6768 | Approved |
0.6854 | Remote Similarity | NPD6180 | Clinical (unspecified phase) |
0.6848 | Remote Similarity | NPD6454 | Clinical (unspecified phase) |
0.6845 | Remote Similarity | NPD1343 | Approved |
0.6824 | Remote Similarity | NPD1593 | Approved |
0.6821 | Remote Similarity | NPD2479 | Phase 3 |
0.6821 | Remote Similarity | NPD2481 | Approved |
0.6818 | Remote Similarity | NPD5809 | Phase 3 |
0.6818 | Remote Similarity | NPD4940 | Approved |
0.6815 | Remote Similarity | NPD5527 | Clinical (unspecified phase) |
0.6815 | Remote Similarity | NPD5526 | Phase 2 |
0.6813 | Remote Similarity | NPD1270 | Approved |
0.6803 | Remote Similarity | NPD1640 | Clinical (unspecified phase) |
0.6797 | Remote Similarity | NPD2470 | Clinical (unspecified phase) |
0.6788 | Remote Similarity | NPD6299 | Approved |
0.6788 | Remote Similarity | NPD6300 | Approved |
0.6786 | Remote Similarity | NPD4643 | Clinical (unspecified phase) |
0.6781 | Remote Similarity | NPD4775 | Clinical (unspecified phase) |
0.678 | Remote Similarity | NPD3246 | Discontinued |
0.6772 | Remote Similarity | NPD4046 | Approved |
0.6772 | Remote Similarity | NPD3481 | Approved |
0.6772 | Remote Similarity | NPD4043 | Approved |
0.6763 | Remote Similarity | NPD3078 | Approved |
0.6763 | Remote Similarity | NPD3079 | Approved |
0.6763 | Remote Similarity | NPD2590 | Clinical (unspecified phase) |
0.6763 | Remote Similarity | NPD3076 | Approved |
0.6763 | Remote Similarity | NPD3077 | Approved |
0.676 | Remote Similarity | NPD2336 | Approved |
0.6757 | Remote Similarity | NPD4985 | Clinical (unspecified phase) |
0.6755 | Remote Similarity | NPD1619 | Phase 3 |
0.6752 | Remote Similarity | NPD2365 | Approved |
0.6739 | Remote Similarity | NPD8248 | Clinical (unspecified phase) |
0.6739 | Remote Similarity | NPD477 | Phase 1 |
0.6738 | Remote Similarity | NPD5181 | Approved |
0.6738 | Remote Similarity | NPD5180 | Approved |
0.6738 | Remote Similarity | NPD5179 | Approved |
0.6733 | Remote Similarity | NPD4549 | Discontinued |
0.6726 | Remote Similarity | NPD2915 | Discontinued |
0.6723 | Remote Similarity | NPD4426 | Clinical (unspecified phase) |
0.6715 | Remote Similarity | NPD993 | Approved |
0.6715 | Remote Similarity | NPD990 | Approved |
0.6715 | Remote Similarity | NPD1064 | Approved |
0.6715 | Remote Similarity | NPD1065 | Approved |
0.6711 | Remote Similarity | NPD797 | Clinical (unspecified phase) |
0.671 | Remote Similarity | NPD4077 | Clinical (unspecified phase) |
0.6709 | Remote Similarity | NPD2820 | Phase 3 |
0.6707 | Remote Similarity | NPD7220 | Approved |
0.6706 | Remote Similarity | NPD3376 | Clinical (unspecified phase) |
0.6706 | Remote Similarity | NPD2369 | Discontinued |
0.669 | Remote Similarity | NPD1306 | Clinical (unspecified phase) |
0.669 | Remote Similarity | NPD5631 | Phase 3 |
0.6688 | Remote Similarity | NPD569 | Clinical (unspecified phase) |
0.6688 | Remote Similarity | NPD4461 | Discontinued |
0.6686 | Remote Similarity | NPD4736 | Clinical (unspecified phase) |
0.6685 | Remote Similarity | NPD2770 | Discontinued |
0.6647 | Remote Similarity | NPD4385 | Clinical (unspecified phase) |
0.6647 | Remote Similarity | NPD2506 | Approved |
0.6645 | Remote Similarity | NPD1883 | Approved |
0.6642 | Remote Similarity | NPD2197 | Approved |
0.6642 | Remote Similarity | NPD2192 | Approved |
0.6629 | Remote Similarity | NPD5820 | Clinical (unspecified phase) |
0.6628 | Remote Similarity | NPD3868 | Phase 1 |
0.6623 | Remote Similarity | NPD1781 | Discontinued |
0.6612 | Remote Similarity | NPD1851 | Clinical (unspecified phase) |
0.6612 | Remote Similarity | NPD2307 | Discontinued |
0.6611 | Remote Similarity | NPD1905 | Clinical (unspecified phase) |
0.661 | Remote Similarity | NPD5923 | Phase 1 |
0.6609 | Remote Similarity | NPD5840 | Discontinued |
0.6609 | Remote Similarity | NPD3792 | Approved |
0.6609 | Remote Similarity | NPD5755 | Clinical (unspecified phase) |
0.6605 | Remote Similarity | NPD4432 | Discontinued |
0.6604 | Remote Similarity | NPD6301 | Phase 2 |
0.6604 | Remote Similarity | NPD5020 | Approved |
0.6595 | Remote Similarity | NPD8050 | Clinical (unspecified phase) |
0.6593 | Remote Similarity | NPD4348 | Clinical (unspecified phase) |
0.6592 | Remote Similarity | NPD4948 | Discontinued |
0.659 | Remote Similarity | NPD1586 | Approved |
0.6588 | Remote Similarity | NPD4645 | Clinical (unspecified phase) |
0.6587 | Remote Similarity | NPD33 | Approved |
0.6587 | Remote Similarity | NPD4393 | Approved |
0.6585 | Remote Similarity | NPD5965 | Clinical (unspecified phase) |
0.6582 | Remote Similarity | NPD1222 | Discontinued |
0.6581 | Remote Similarity | NPD3385 | Approved |
0.6579 | Remote Similarity | NPD5131 | Approved |
0.6579 | Remote Similarity | NPD2918 | Clinical (unspecified phase) |
0.6579 | Remote Similarity | NPD2919 | Clinical (unspecified phase) |
0.6578 | Remote Similarity | NPD2881 | Approved |
0.6578 | Remote Similarity | NPD2879 | Approved |
0.6576 | Remote Similarity | NPD1952 | Discontinued |
0.6571 | Remote Similarity | NPD3782 | Discontinued |
0.6571 | Remote Similarity | NPD3239 | Clinical (unspecified phase) |
0.6568 | Remote Similarity | NPD2288 | Clinical (unspecified phase) |
0.6564 | Remote Similarity | NPD2737 | Clinical (unspecified phase) |
0.6564 | Remote Similarity | NPD5748 | Phase 2 |
0.6561 | Remote Similarity | NPD1626 | Approved |
0.6561 | Remote Similarity | NPD2733 | Approved |
0.6558 | Remote Similarity | NPD941 | Approved |
0.6556 | Remote Similarity | NPD5016 | Approved |
0.6554 | Remote Similarity | NPD3319 | Phase 1 |
0.6554 | Remote Similarity | NPD7401 | Clinical (unspecified phase) |
0.6554 | Remote Similarity | NPD3320 | Approved |
0.6554 | Remote Similarity | NPD3318 | Approved |
0.6552 | Remote Similarity | NPD3004 | Clinical (unspecified phase) |
0.6545 | Remote Similarity | NPD737 | Phase 2 |
0.6544 | Remote Similarity | NPD708 | Approved |
0.6543 | Remote Similarity | NPD4402 | Clinical (unspecified phase) |
0.6543 | Remote Similarity | NPD7441 | Clinical (unspecified phase) |
0.6543 | Remote Similarity | NPD7088 | Discontinued |
0.6538 | Remote Similarity | NPD4922 | Phase 2 |
0.6538 | Remote Similarity | NPD7192 | Discontinued |
0.6534 | Remote Similarity | NPD4329 | Approved |
0.6534 | Remote Similarity | NPD4330 | Approved |
0.6534 | Remote Similarity | NPD7014 | Clinical (unspecified phase) |
0.6532 | Remote Similarity | NPD7443 | Clinical (unspecified phase) |
0.6529 | Remote Similarity | NPD1568 | Clinical (unspecified phase) |
0.6527 | Remote Similarity | NPD4326 | Phase 2 |
0.6526 | Remote Similarity | NPD3905 | Phase 3 |
0.6519 | Remote Similarity | NPD1864 | Clinical (unspecified phase) |
0.6519 | Remote Similarity | NPD2304 | Approved |
0.6519 | Remote Similarity | NPD3276 | Approved |
0.6519 | Remote Similarity | NPD1866 | Approved |
0.6519 | Remote Similarity | NPD1870 | Approved |
0.6517 | Remote Similarity | NPD4412 | Phase 2 |
0.6517 | Remote Similarity | NPD8241 | Phase 2 |
0.6517 | Remote Similarity | NPD7564 | Discontinued |
0.6516 | Remote Similarity | NPD1627 | Clinical (unspecified phase) |
0.651 | Remote Similarity | NPD478 | Approved |
0.6508 | Remote Similarity | NPD6987 | Phase 1 |
0.6497 | Remote Similarity | NPD3864 | Clinical (unspecified phase) |
0.6495 | Remote Similarity | NPD6787 | Phase 2 |
0.6493 | Remote Similarity | NPD1100 | Approved |
0.6493 | Remote Similarity | NPD1099 | Approved |
0.6491 | Remote Similarity | NPD6446 | Discontinued |
0.6488 | Remote Similarity | NPD2427 | Approved |
0.6486 | Remote Similarity | NPD1079 | Discontinued |
0.6486 | Remote Similarity | NPD1124 | Approved |
0.6486 | Remote Similarity | NPD678 | Discontinued |
0.6486 | Remote Similarity | NPD1123 | Approved |
0.6484 | Remote Similarity | NPD5592 | Clinical (unspecified phase) |
0.6484 | Remote Similarity | NPD1658 | Discontinued |
0.6483 | Remote Similarity | NPD2464 | Approved |
0.6483 | Remote Similarity | NPD2463 | Approved |
0.6483 | Remote Similarity | NPD2467 | Approved |
0.6481 | Remote Similarity | NPD5839 | Clinical (unspecified phase) |
Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.