Molecular Weight:   | 282.15 |
Volume:   | 275.085 |
LogP:   | 3.276 |
LogD:   | 2.785 |
LogS:   | -4.774 |
# Rotatable Bonds:   | 0 |
TPSA:   | 53.99 |
# H-Bond Aceptor:   | 5 |
# H-Bond Donor:   | 0 |
# Rings:   | 5 |
# Heavy Atoms:   | 5 |
QED Drug-Likeness Score:   | 0.504 |
Synthetic Accessibility Score:   | 5.668 |
Fsp3:   | 0.933 |
Lipinski Rule-of-5:   | Accepted |
Pfizer Rule:   | Rejected |
GSK Rule:   | Accepted |
BMS Rule:   | 1 |
Golden Triangle Rule:   | Accepted |
Chelating Alert:   | 0 |
PAINS Alert:   | 0 |
Caco-2 Permeability:   | -4.638 |
MDCK Permeability:   | 6.001018118695356e-05 |
Pgp-inhibitor:   | 0.76 |
Pgp-substrate:   | 0.001 |
Human Intestinal Absorption (HIA):   | 0.002 |
20% Bioavailability (F20%):   | 0.004 |
30% Bioavailability (F30%):   | 0.038 |
Blood-Brain-Barrier Penetration (BBB):   | 0.465 |
Plasma Protein Binding (PPB):   | 71.63699340820312% |
Volume Distribution (VD):   | 1.342 |
Pgp-substrate:   | 20.10067367553711% |
CYP1A2-inhibitor:   | 0.361 |
CYP1A2-substrate:   | 0.972 |
CYP2C19-inhibitor:   | 0.049 |
CYP2C19-substrate:   | 0.888 |
CYP2C9-inhibitor:   | 0.032 |
CYP2C9-substrate:   | 0.059 |
CYP2D6-inhibitor:   | 0.014 |
CYP2D6-substrate:   | 0.793 |
CYP3A4-inhibitor:   | 0.205 |
CYP3A4-substrate:   | 0.397 |
Clearance (CL):   | 10.559 |
Half-life (T1/2):   | 0.317 |
hERG Blockers:   | 0.775 |
Human Hepatotoxicity (H-HT):   | 0.966 |
Drug-inuced Liver Injury (DILI):   | 0.915 |
AMES Toxicity:   | 0.896 |
Rat Oral Acute Toxicity:   | 0.775 |
Maximum Recommended Daily Dose:   | 0.039 |
Skin Sensitization:   | 0.66 |
Carcinogencity:   | 0.877 |
Eye Corrosion:   | 0.615 |
Eye Irritation:   | 0.593 |
Respiratory Toxicity:   | 0.975 |
Natural Product ID:   | NPC30443 |
Common Name*:   | BLUAFEHZUWYNDE-NNWCWBAJSA-N |
IUPAC Name:   | n.a. |
Synonyms:   | |
Standard InCHIKey:   | BLUAFEHZUWYNDE-NNWCWBAJSA-N |
Standard InCHI:   | InChI=1S/C15H22O5/c1-8-4-5-11-9(2)12(16)17-13-15(11)10(8)6-7-14(3,18-13)19-20-15/h8-11,13H,4-7H2,1-3H3/t8-,9-,10+,11+,13-,14-,15-/m1/s1 |
SMILES:   | C[C@@H]1CC[C@H]2[C@@H](C)C(=O)O[C@H]3[C@]42[C@H]1CC[C@](C)(O3)OO4 |
Synthetic Gene Cluster:   | n.a. |
ChEMBL Identifier:   | CHEMBL269671 |
PubChem CID:   |
68827 |
Chemical Classification**:   |
|
*Note: the InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.
**Note: the Chemical Classification was calculated by NPClassifier Version 1.5. Reference: PMID:34662515.
Organism ID | Organism Name | Taxonomy Level | Family | SuperKingdom | Isolation Part | Collection Location | Collection Time | Reference |
---|---|---|---|---|---|---|---|---|
NPO26589 | Artemisia annua L. | Strain | Asteraceae | Eukaryota | n.a. | leaf | n.a. | DOI[10.1007/s11418-006-0112-9] |
NPO26589 | Artemisia annua L. | Strain | Asteraceae | Eukaryota | n.a. | stem | n.a. | DOI[10.1007/s11418-006-0112-9] |
NPO26589 | Artemisia annua L. | Strain | Asteraceae | Eukaryota | n.a. | flower | n.a. | DOI[10.1007/s11418-006-0112-9] |
NPO41731 | 0dulisporium sylviform rearrangement strain [n.a.] | Strain | Xylariaceae | Eukaryota | n.a. | n.a. | n.a. | DOI[10.1007/s11427-008-0037-5] |
NPO41734 | Penicillium expansum FS8486 [n.a.] | Strain | Aspergillaceae | Eukaryota | n.a. | n.a. | n.a. | DOI[10.1016/S1872-2075(07)60044-2] |
NPO2669 | Bowdichia virgilioides | Species | Fabaceae | Eukaryota | n.a. | xylem | n.a. |
PMID[16286304] |
NPO14263 | Cipadessa baccifera | Species | Meliaceae | Eukaryota | leaves | n.a. | n.a. |
PMID[20666364] |
NPO3099 | Euphorbia esula | Species | Euphorbiaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[21612217] |
NPO3099 | Euphorbia esula | Species | Euphorbiaceae | Eukaryota | n.a. | whole plant | n.a. |
PMID[21612217] |
NPO24632 | Salvia hydrangea | Species | Lamiaceae | Eukaryota | n.a. | aerial part | n.a. |
PMID[21967089] |
NPO3099 | Euphorbia esula | Species | Euphorbiaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[27447736] |
NPO15190 | Chloranthus fortunei | Species | Chloranthaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[27997206] |
NPO5401 | Monanchora unguiculata | Species | Crambeidae | Eukaryota | n.a. | n.a. | n.a. |
PMID[28368118] |
NPO40386 | Trichospira verticillata | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[28463001] |
NPO40300 | Poupartia borbonica | Species | Anacardiaceae | Eukaryota | Leaves | n.a. | n.a. |
PMID[28557449] |
NPO40176 | Koeberlinia spinosa | Species | Koeberliniaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[29048892] |
NPO2669 | Bowdichia virgilioides | Species | Fabaceae | Eukaryota | Seeds | n.a. | n.a. |
PMID[29182338] |
NPO40282 | Petradoria pumila | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[29738243] |
NPO8257 | Carpha glomerata | Species | Cyperaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[30219526] |
NPO40851 | Garcinia dauphinensis | Species | Clusiaceae | Eukaryota | Roots | n.a. | n.a. |
PMID[30354100] |
NPO24632 | Salvia hydrangea | Species | Lamiaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[30565934] |
NPO40306 | Psiadia arguta | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[30943031] |
NPO27735 | Aniba citrifolia | Species | Lauraceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[31577436] |
NPO40850 | Galtonia regalis | Species | n.a. | n.a. | n.a. | n.a. | n.a. |
PMID[32227943] |
NPO3099 | Euphorbia esula | Species | Euphorbiaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[32233482] |
NPO40107 | Dobinea delavayi | Species | Anacardiaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[32233487] |
NPO14263 | Cipadessa baccifera | Species | Meliaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[32468815] |
NPO41695 | Escherichia coli PLH-5 [n.a.] | Strain | Enterobacteriaceae | Bacteria | n.a. | n.a. | n.a. |
PMID[34824227] |
NPO26589 | Artemisia annua L. | Strain | Asteraceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[6387056] |
NPO14263 | Cipadessa baccifera | Species | Meliaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
NPO10506 | Artemisia apiacea | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
NPO3099 | Euphorbia esula | Species | Euphorbiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
NPO26589 | Artemisia annua L. | Strain | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
NPO24632 | Salvia hydrangea | Species | Lamiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
NPO3099 | Euphorbia esula | Species | Euphorbiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
NPO26589 | Artemisia annua L. | Strain | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
NPO14263 | Cipadessa baccifera | Species | Meliaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
NPO10506 | Artemisia apiacea | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
NPO14263 | Cipadessa baccifera | Species | Meliaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCM_Taiwan] |
NPO26589 | Artemisia annua L. | Strain | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCM_Taiwan] |
NPO10506 | Artemisia apiacea | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCM_Taiwan] |
NPO26589 | Artemisia annua L. | Strain | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[TM-MC] |
NPO10506 | Artemisia apiacea | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[TM-MC] |
NPO8257 | Carpha glomerata | Species | Cyperaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
NPO14263 | Cipadessa baccifera | Species | Meliaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
NPO10506 | Artemisia apiacea | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
NPO24632 | Salvia hydrangea | Species | Lamiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
NPO2669 | Bowdichia virgilioides | Species | Fabaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
NPO5401 | Monanchora unguiculata | Species | Crambeidae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
NPO27735 | Aniba citrifolia | Species | Lauraceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
NPO26589 | Artemisia annua L. | Strain | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
NPO15190 | Chloranthus fortunei | Species | Chloranthaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
NPO3099 | Euphorbia esula | Species | Euphorbiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
☑ Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].
Organism ID | NP ID | Organism Material Preparation | Organism Part | NP Quantity (Standard) | NP Quantity (Minimum) | NP Quantity (Maximum) | Quantity Unit | Reference |
---|
☑ Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].
Target ID | Target Type | Target Name | Target Organism | Activity Type | Activity Relation | Value | Unit | Reference |
---|---|---|---|---|---|---|---|---|
NPT71 | Cell Line | HEK293 | Homo sapiens | IC50 | > | 120.0 | nM | PMID[484420] |
NPT839 | Cell Line | L6 | Rattus norvegicus | IC50 | = | 450500.0 | nM | PMID[484421] |
NPT189 | Cell Line | Vero | Chlorocebus aethiops | IC50 | > | 16860.0 | nM | PMID[484425] |
NPT839 | Cell Line | L6 | Rattus norvegicus | IC50 | = | 450000.0 | nM | PMID[484429] |
NPT612 | Individual Protein | Canalicular multispecific organic anion transporter 1 | Homo sapiens | IC50 | > | 133000.0 | nM | PMID[484432] |
NPT1249 | Individual Protein | Canalicular multispecific organic anion transporter 2 | Homo sapiens | IC50 | > | 133000.0 | nM | PMID[484432] |
NPT1028 | Individual Protein | Multidrug resistance-associated protein 4 | Homo sapiens | IC50 | > | 133000.0 | nM | PMID[484432] |
NPT83 | Cell Line | MCF7 | Homo sapiens | IC50 | = | 0.14 | nM | PMID[484436] |
NPT83 | Cell Line | MCF7 | Homo sapiens | Efficacy | = | 14.0 | % | PMID[484436] |
NPT737 | Cell Line | HUVEC | Homo sapiens | IC50 | = | 1100.0 | nM | PMID[484436] |
NPT737 | Cell Line | HUVEC | Homo sapiens | Efficacy | = | 22.0 | % | PMID[484436] |
NPT1166 | Individual Protein | Angiotensin-converting enzyme | Homo sapiens | Inhibition | = | 17.05 | % | PMID[484438] |
NPT1535 | Cell Line | U-87 MG | Homo sapiens | IC50 | > | 50000.0 | nM | PMID[484441] |
NPT519 | Cell Line | SH-SY5Y | Homo sapiens | IC50 | > | 50000.0 | nM | PMID[484441] |
NPT83 | Cell Line | MCF7 | Homo sapiens | IC50 | > | 50000.0 | nM | PMID[484441] |
NPT82 | Cell Line | MDA-MB-231 | Homo sapiens | IC50 | > | 50000.0 | nM | PMID[484441] |
NPT81 | Cell Line | A549 | Homo sapiens | IC50 | > | 50000.0 | nM | PMID[484441] |
NPT1083 | Cell Line | A-375 | Homo sapiens | IC50 | > | 50000.0 | nM | PMID[484441] |
NPT404 | Cell Line | CCRF-CEM | Homo sapiens | EC50 | = | 36900.0 | nM | PMID[484442] |
NPT2251 | Cell Line | ADR5000 cell line | EC50 | = | 26900.0 | nM | PMID[484442] | |
NPT859 | Cell Line | HFF | Homo sapiens | TD50 | >= | 320.0 | uM | PMID[484458] |
NPT1083 | Cell Line | A-375 | Homo sapiens | IC50 | > | 50000.0 | nM | PMID[484460] |
NPT81 | Cell Line | A549 | Homo sapiens | IC50 | > | 50000.0 | nM | PMID[484460] |
NPT519 | Cell Line | SH-SY5Y | Homo sapiens | IC50 | > | 50000.0 | nM | PMID[484460] |
NPT393 | Cell Line | HCT-116 | Homo sapiens | IC50 | > | 50000.0 | nM | PMID[484460] |
NPT681 | Cell Line | PC-12 | Rattus norvegicus | IC50 | > | 50000.0 | nM | PMID[484460] |
NPT83 | Cell Line | MCF7 | Homo sapiens | IC50 | > | 50000.0 | nM | PMID[484468] |
NPT81 | Cell Line | A549 | Homo sapiens | IC50 | > | 50000.0 | nM | PMID[484468] |
NPT65 | Cell Line | HepG2 | Homo sapiens | IC50 | > | 50000.0 | nM | PMID[484468] |
NPT82 | Cell Line | MDA-MB-231 | Homo sapiens | IC50 | > | 100000.0 | nM | PMID[484468] |
NPT111 | Cell Line | K562 | Homo sapiens | IC50 | = | 39030.0 | nM | PMID[484471] |
NPT306 | Cell Line | PC-3 | Homo sapiens | IC50 | = | 39030.0 | nM | PMID[484471] |
NPT762 | Cell Line | A-431 | Homo sapiens | IC50 | = | 39030.0 | nM | PMID[484471] |
NPT82 | Cell Line | MDA-MB-231 | Homo sapiens | IC50 | = | 39030.0 | nM | PMID[484471] |
NPT407 | Cell Line | COLO 205 | Homo sapiens | IC50 | = | 39030.0 | nM | PMID[484471] |
NPT81 | Cell Line | A549 | Homo sapiens | IC50 | = | 39030.0 | nM | PMID[484471] |
NPT2027 | Cell Line | SK-N-DZ | Homo sapiens | Activity | = | 40.0 | % | PMID[484472] |
NPT2380 | Cell Line | SK-N-AS | Homo sapiens | Activity | = | 22.0 | % | PMID[484472] |
NPT109 | Individual Protein | Cytochrome P450 3A4 | Homo sapiens | Drug metabolism | = | 10.0 | % | PMID[484472] |
NPT240 | Individual Protein | Cytochrome P450 2A6 | Homo sapiens | Drug metabolism | = | 15.0 | % | PMID[484472] |
NPT139 | Cell Line | HT-29 | Homo sapiens | ED50 | = | 1.25 | ug ml-1 | PMID[484472] |
NPT168 | Cell Line | P388 | Mus musculus | ED50 | = | 1.25 | ug ml-1 | PMID[484472] |
NPT83 | Cell Line | MCF7 | Homo sapiens | ED50 | = | 1.25 | ug ml-1 | PMID[484472] |
NPT91 | Cell Line | KB | Homo sapiens | ED50 | = | 1.25 | ug ml-1 | PMID[484472] |
NPT306 | Cell Line | PC-3 | Homo sapiens | Activity | = | 33.48 | % | PMID[484474] |
NPT306 | Cell Line | PC-3 | Homo sapiens | Activity | = | 44.42 | % | PMID[484474] |
NPT306 | Cell Line | PC-3 | Homo sapiens | Activity | = | 22.1 | % | PMID[484474] |
NPT306 | Cell Line | PC-3 | Homo sapiens | Activity | = | 35.55 | % | PMID[484474] |
NPT306 | Cell Line | PC-3 | Homo sapiens | Activity | = | 48.38 | % | PMID[484474] |
NPT306 | Cell Line | PC-3 | Homo sapiens | Activity | = | 16.07 | % | PMID[484474] |
NPT839 | Cell Line | L6 | Rattus norvegicus | IC50 | = | 450500.0 | nM | PMID[484480] |
NPT839 | Cell Line | L6 | Rattus norvegicus | CC50 | > | 350000.0 | nM | PMID[484484] |
NPT839 | Cell Line | L6 | Rattus norvegicus | IC50 | = | 450500.0 | nM | PMID[484506] |
NPT189 | Cell Line | Vero | Chlorocebus aethiops | CC50 | = | 130000.0 | nM | PMID[484508] |
NPT659 | Cell Line | SMMC-7721 | Homo sapiens | IC50 | = | 630.0 | nM | PMID[484509] |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 29.0 | nM | PMID[484413] |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 12.0 | nM | PMID[484413] |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 7.0 | nM | PMID[484414] |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 13.0 | nM | PMID[484414] |
NPT1666 | Organism | Plasmodium falciparum D6 | Plasmodium falciparum D6 | IC50 | = | 9.0 | nM | PMID[484414] |
NPT474 | Organism | Plasmodium berghei | Plasmodium berghei | IC50 | = | 12000.0 | nM | PMID[484414] |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | EC50 | = | 9.3 | nM | PMID[484415] |
NPT757 | Organism | Plasmodium falciparum 3D7 | Plasmodium falciparum 3D7 | IC50 | = | 0.001117 | ug.mL-1 | PMID[484417] |
NPT27 | Others | Unspecified | CC50 | > | 100.0 | ug.mL-1 | PMID[484417] | |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 140.0 | nM | PMID[484418] |
NPT1666 | Organism | Plasmodium falciparum D6 | Plasmodium falciparum D6 | IC50 | = | 71.0 | nM | PMID[484418] |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 6.2 | nM | PMID[484419] |
NPT757 | Organism | Plasmodium falciparum 3D7 | Plasmodium falciparum 3D7 | IC50 | = | 7.75 | nM | PMID[484420] |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 9.0 | nM | PMID[484420] |
NPT27 | Others | Unspecified | Ratio IC50 | > | 10000.0 | n.a. | PMID[484420] | |
NPT485 | Organism | Plasmodium falciparum (isolate K1 / Thailand) | Plasmodium falciparum K1 | IC50 | = | 6.4 | nM | PMID[484421] |
NPT2 | Others | Unspecified | Ratio IC50 | = | 70390.0 | n.a. | PMID[484421] | |
NPT20529 | NON-MOLECULAR | NON-PROTEIN TARGET | n.a. | IC50 | = | 6.0 | nM | PMID[484422] |
NPT20529 | NON-MOLECULAR | NON-PROTEIN TARGET | n.a. | GI | = | 19.8 | % | PMID[484423] |
NPT20529 | NON-MOLECULAR | NON-PROTEIN TARGET | n.a. | GI | = | 14.4 | % | PMID[484423] |
NPT20529 | NON-MOLECULAR | NON-PROTEIN TARGET | n.a. | GI | = | 13.0 | % | PMID[484423] |
NPT20529 | NON-MOLECULAR | NON-PROTEIN TARGET | n.a. | GI | = | 18.0 | % | PMID[484423] |
NPT20529 | NON-MOLECULAR | NON-PROTEIN TARGET | n.a. | GI | = | 16.0 | % | PMID[484423] |
NPT20529 | NON-MOLECULAR | NON-PROTEIN TARGET | n.a. | GI | = | 17.6 | % | PMID[484423] |
NPT20529 | NON-MOLECULAR | NON-PROTEIN TARGET | n.a. | GI | = | 10.5 | % | PMID[484423] |
NPT20529 | NON-MOLECULAR | NON-PROTEIN TARGET | n.a. | GI | = | 13.4 | % | PMID[484423] |
NPT20529 | NON-MOLECULAR | NON-PROTEIN TARGET | n.a. | GI | = | 18.5 | % | PMID[484423] |
NPT20529 | NON-MOLECULAR | NON-PROTEIN TARGET | n.a. | IC50 | = | 7.0 | nM | PMID[484424] |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 25.0 | nM | PMID[484425] |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 14.0 | nM | PMID[484425] |
NPT2 | Others | Unspecified | Ratio IC50 | > | 674.4 | n.a. | PMID[484425] | |
NPT2 | Others | Unspecified | Ratio IC50 | > | 1204.0 | n.a. | PMID[484425] | |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | EC50 | = | 6.0 | nM | PMID[484426] |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | EC50 | = | 13.0 | nM | PMID[484426] |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | EC50 | = | 5.0 | nM | PMID[484426] |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | EC50 | = | 2.0 | nM | PMID[484426] |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | EC50 | = | 8.0 | nM | PMID[484426] |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 4.0 | nM | PMID[484427] |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 45.0 | nM | PMID[484428] |
NPT2 | Others | Unspecified | Ratio IC50 | > | 222.22 | n.a. | PMID[484428] | |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 23.0 | nM | PMID[484428] |
NPT2 | Others | Unspecified | Ratio IC50 | = | 434.78 | n.a. | PMID[484428] | |
NPT2 | Others | Unspecified | Ratio IC50 | = | 0.511 | n.a. | PMID[484428] | |
NPT485 | Organism | Plasmodium falciparum (isolate K1 / Thailand) | Plasmodium falciparum K1 | IC50 | = | 6.4 | nM | PMID[484429] |
NPT2 | Others | Unspecified | Ratio IC50 | = | 70312.0 | n.a. | PMID[484429] | |
NPT1173 | Organism | Candida albicans SC5314 | Candida albicans SC5314 | FICI | = | 0.186 | n.a. | PMID[484430] |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 15.0 | nM | PMID[484431] |
NPT713 | Individual Protein | Bile salt export pump | Homo sapiens | IC50 | > | 133000.0 | nM | PMID[484432] |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 6.0 | nM | PMID[484433] |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | TIME | = | 0.0 | hr | PMID[484433] |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | log(ratio) | > | 4.8 | n.a. | PMID[484433] |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | T99.9% | < | 24.0 | hr | PMID[484433] |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | EC50 | = | 23.0 | nM | PMID[484434] |
NPT485 | Organism | Plasmodium falciparum (isolate K1 / Thailand) | Plasmodium falciparum K1 | GI | = | 80.0 | % | PMID[484435] |
NPT485 | Organism | Plasmodium falciparum (isolate K1 / Thailand) | Plasmodium falciparum K1 | GI | = | 100.0 | % | PMID[484435] |
NPT3901 | Tissue | Chorioallantoic membrane | Gallus gallus | Activity | = | 6.3 | % | PMID[484436] |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 9.0 | nM | PMID[484437] |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 5.9 | nM | PMID[484437] |
NPT2 | Others | Unspecified | Ratio IC50 | = | 4987.0 | n.a. | PMID[484437] | |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 4.0 | nM | PMID[484439] |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 7.0 | nM | PMID[484440] |
NPT21742 | CELL-LINE | L02 | Homo sapiens | IC50 | > | 50000.0 | nM | PMID[484441] |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 74.0 | nM | PMID[484443] |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 32.1 | nM | PMID[484444] |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 25.0 | nM | PMID[484445] |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 9.0 | nM | PMID[484446] |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 7.0 | nM | PMID[484447] |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 94.0 | nM | PMID[484448] |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 8.5 | nM | PMID[484449] |
NPT2262 | Organism | Human herpesvirus 5 strain AD169 | Human herpesvirus 5 strain AD169 | EC50 | > | 10000.0 | nM | PMID[484450] |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 4.1 | nM | PMID[484451] |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 5.2 | nM | PMID[484451] |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 2.2 | nM | PMID[484451] |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 12.1 | nM | PMID[484452] |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 16.3 | nM | PMID[484453] |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 10.0 | nM | PMID[484454] |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 4.0 | nM | PMID[484454] |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 19.0 | nM | PMID[484455] |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | EC50 | = | 10.0 | nM | PMID[484456] |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 10.4 | nM | PMID[484457] |
NPT486 | Organism | Toxoplasma gondii | Toxoplasma gondii | IC50 | = | 2000.0 | nM | PMID[484458] |
NPT27 | Others | Unspecified | TI | = | 160.0 | n.a. | PMID[484458] | |
NPT486 | Organism | Toxoplasma gondii | Toxoplasma gondii | IC90 | = | 19000.0 | nM | PMID[484458] |
NPT2 | Others | Unspecified | IC50 | = | 430.0 | nM | PMID[484459] | |
NPT21742 | CELL-LINE | L02 | Homo sapiens | IC50 | > | 50000.0 | nM | PMID[484460] |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 0.013 | ug.mL-1 | PMID[484461] |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 0.014 | ug.mL-1 | PMID[484461] |
NPT21851 | SINGLE PROTEIN | Dihydroorotate dehydrogenase (fumarate) | Leishmania major | IC50 | = | 171900.0 | nM | PMID[484462] |
NPT21851 | SINGLE PROTEIN | Dihydroorotate dehydrogenase (fumarate) | Leishmania major | IC50 | = | 158489.32 | nM | PMID[484462] |
NPT21851 | SINGLE PROTEIN | Dihydroorotate dehydrogenase (fumarate) | Leishmania major | Inhibition | = | 44.0 | % | PMID[484462] |
NPT21852 | SINGLE PROTEIN | Dihydroorotate dehydrogenase | Homo sapiens | Inhibition | = | 0.0 | % | PMID[484462] |
NPT21851 | SINGLE PROTEIN | Dihydroorotate dehydrogenase (fumarate) | Leishmania major | Delta Tm | = | -0.13 | degrees C | PMID[484462] |
NPT21851 | SINGLE PROTEIN | Dihydroorotate dehydrogenase (fumarate) | Leishmania major | Delta Tm | = | -0.35 | degrees C | PMID[484462] |
NPT21851 | SINGLE PROTEIN | Dihydroorotate dehydrogenase (fumarate) | Leishmania major | Delta Tm | = | -0.4 | degrees C | PMID[484462] |
NPT21851 | SINGLE PROTEIN | Dihydroorotate dehydrogenase (fumarate) | Leishmania major | Delta Tm | = | -0.14 | degrees C | PMID[484462] |
NPT21851 | SINGLE PROTEIN | Dihydroorotate dehydrogenase (fumarate) | Leishmania major | Delta Tm | = | -0.22 | degrees C | PMID[484462] |
NPT21851 | SINGLE PROTEIN | Dihydroorotate dehydrogenase (fumarate) | Leishmania major | Delta Tm | = | -0.52 | degrees C | PMID[484462] |
NPT841 | Organism | Leishmania major | Leishmania major | IC50 | = | 750.0 | nM | PMID[484462] |
NPT841 | Organism | Leishmania major | Leishmania major | IC50 | = | 300.0 | nM | PMID[484462] |
NPT633 | Organism | Leishmania donovani | Leishmania donovani | IC50 | = | 30800.0 | nM | PMID[484462] |
NPT844 | Organism | Trypanosoma brucei rhodesiense | Trypanosoma brucei rhodesiense | IC50 | = | 20400.0 | nM | PMID[484462] |
NPT580 | Organism | Trypanosoma cruzi | Trypanosoma cruzi | IC50 | = | 13400.0 | nM | PMID[484462] |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 12.0 | nM | PMID[484463] |
NPT2262 | Organism | Human herpesvirus 5 strain AD169 | Human herpesvirus 5 strain AD169 | EC50 | > | 10000.0 | nM | PMID[484464] |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 15.0 | nM | PMID[484465] |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 13.0 | nM | PMID[484465] |
NPT2 | Others | Unspecified | Ratio IC50 | = | 1.0 | n.a. | PMID[484465] | |
NPT2 | Others | Unspecified | Ratio IC50 | = | 0.87 | n.a. | PMID[484465] | |
NPT2 | Others | Unspecified | Ratio IC50 | > | 200.0 | n.a. | PMID[484465] | |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | Ratio IC50 | = | 1.7 | n.a. | PMID[484465] |
NPT20555 | ORGANISM | SARS-CoV-2 | Severe acute respiratory syndrome coronavirus 2 | Inhibition index | = | 0.09655 | n.a. | PMID[484466] |
NPT20555 | ORGANISM | SARS-CoV-2 | Severe acute respiratory syndrome coronavirus 2 | Inhibition | = | -3.9 | % | PMID[484467] |
NPT21742 | CELL-LINE | L02 | Homo sapiens | IC50 | > | 100000.0 | nM | PMID[484468] |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 10.0 | nM | PMID[484469] |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 17.1 | nM | PMID[484470] |
NPT2 | Others | Unspecified | Ratio IC50 | > | 49.2 | n.a. | PMID[484470] | |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 16.2 | nM | PMID[484470] |
NPT2 | Others | Unspecified | Ratio IC50 | > | 52.0 | n.a. | PMID[484470] | |
NPT2 | Others | Unspecified | GI | = | 60.0 | % | PMID[484472] | |
NPT2 | Others | Unspecified | GI | = | 68.0 | % | PMID[484472] | |
NPT2 | Others | Unspecified | IC50 | = | 45000.0 | nM | PMID[484472] | |
NPT2 | Others | Unspecified | Activity | = | 70.0 | % | PMID[484472] | |
NPT2 | Others | Unspecified | Activity | = | 23.0 | % | PMID[484472] | |
NPT25804 | CELL-LINE | BE(2)-C | Homo sapiens | Activity | = | 42.0 | % | PMID[484472] |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 32.0 | nM | PMID[484473] |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 21.0 | nM | PMID[484473] |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 80.0 | nM | PMID[484475] |
NPT474 | Organism | Plasmodium berghei | Plasmodium berghei | Activity | = | 25.0 | % | PMID[484476] |
NPT474 | Organism | Plasmodium berghei | Plasmodium berghei | IC50 | = | 8.9 | nM | PMID[484476] |
NPT474 | Organism | Plasmodium berghei | Plasmodium berghei | IC90 | = | 14.5 | nM | PMID[484476] |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 80.0 | nM | PMID[484477] |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | EC50 | = | 20.0 | nM | PMID[484478] |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 54.0 | nM | PMID[484479] |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 6.4 | nM | PMID[484480] |
NPT2 | Others | Unspecified | Ratio IC50 | = | 70390.0 | n.a. | PMID[484480] | |
NPT633 | Organism | Leishmania donovani | Leishmania donovani | IC50 | = | 100000.0 | nM | PMID[484481] |
NPT633 | Organism | Leishmania donovani | Leishmania donovani | IC50 | > | 40000.0 | nM | PMID[484481] |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 8.5 | nM | PMID[484482] |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 4.0 | nM | PMID[484483] |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 2.5 | nM | PMID[484483] |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 7.0 | nM | PMID[484484] |
NPT2 | Others | Unspecified | Ratio IC50 | > | 50000.0 | n.a. | PMID[484484] | |
NPT27 | Others | Unspecified | TI | = | 100000000.0 | n.a. | PMID[484485] | |
NPT20950 | CELL-LINE | Erythrocyte | n.a. | MHC | = | 1.0 | 10'-4M | PMID[484485] |
NPT20950 | CELL-LINE | Erythrocyte | n.a. | Activity | = | 1.5 | % | PMID[484485] |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | Inhibition | = | 38.5 | % | PMID[484485] |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | Inhibition | = | 43.1 | % | PMID[484485] |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | Inhibition | = | 52.3 | % | PMID[484485] |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | Inhibition | = | 63.4 | % | PMID[484485] |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | Inhibition | = | 82.2 | % | PMID[484485] |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | Inhibition | = | 99.0 | % | PMID[484485] |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | Inhibition | = | 100.0 | % | PMID[484485] |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 10.0 | nM | PMID[484485] |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | MIC | = | 0.001 | nM | PMID[484485] |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | Activity | = | 5.58 | % | PMID[484485] |
NPT20556 | SINGLE PROTEIN | Replicase polyprotein 1ab | Severe acute respiratory syndrome coronavirus 2 | Inhibition | = | 0.41 | % | PMID[484486] |
NPT20556 | SINGLE PROTEIN | Replicase polyprotein 1ab | Severe acute respiratory syndrome coronavirus 2 | Inhibition | = | -4.514 | % | PMID[484487] |
NPT20555 | ORGANISM | SARS-CoV-2 | Severe acute respiratory syndrome coronavirus 2 | Inhibition | = | 0.16 | % | PMID[484488] |
NPT20555 | ORGANISM | SARS-CoV-2 | Severe acute respiratory syndrome coronavirus 2 | Inhibition | = | -0.08 | % | PMID[484489] |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 30.0 | nM | PMID[484490] |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 250.0 | nM | PMID[484490] |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 6.5 | nM | PMID[484491] |
NPT475 | Organism | Plasmodium yoelii | Plasmodium yoelii | Inhibition | = | 54.4 | % | PMID[484492] |
NPT475 | Organism | Plasmodium yoelii | Plasmodium yoelii | Ratio | = | 1.43 | n.a. | PMID[484492] |
NPT475 | Organism | Plasmodium yoelii | Plasmodium yoelii | Ratio | = | 1.33 | n.a. | PMID[484492] |
NPT475 | Organism | Plasmodium yoelii | Plasmodium yoelii | Ratio | = | 1.18 | n.a. | PMID[484492] |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 6.5 | nM | PMID[484493] |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 55.0 | nM | PMID[484494] |
NPT2 | Others | Unspecified | Ratio IC50 | > | 4545.0 | n.a. | PMID[484494] | |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 13.0 | nM | PMID[484496] |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 25.0 | nM | PMID[484497] |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 21.0 | nM | PMID[484497] |
NPT20555 | ORGANISM | SARS-CoV-2 | Severe acute respiratory syndrome coronavirus 2 | IC50 | > | 20000.0 | nM | PMID[484498] |
NPT20555 | ORGANISM | SARS-CoV-2 | Severe acute respiratory syndrome coronavirus 2 | IC50 | > | 19952.62 | nM | PMID[484498] |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 33.0 | nM | PMID[484499] |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 6.0 | nM | PMID[484500] |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | EC50 | = | 0.8 | nM | PMID[484501] |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 7.0 | nM | PMID[484502] |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 10.0 | nM | PMID[484502] |
NPT633 | Organism | Leishmania donovani | Leishmania donovani | IC50 | > | 40000.0 | nM | PMID[484503] |
NPT633 | Organism | Leishmania donovani | Leishmania donovani | IC50 | > | 100000.0 | nM | PMID[484505] |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 3.4 | nM | PMID[484506] |
NPT2 | Others | Unspecified | Ratio IC50 | = | 132500.0 | n.a. | PMID[484506] | |
NPT474 | Organism | Plasmodium berghei | Plasmodium berghei | Activity | = | 94.9 | % | PMID[484507] |
NPT474 | Organism | Plasmodium berghei | Plasmodium berghei | Activity | = | 96.64 | % | PMID[484507] |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 18.0 | nM | PMID[484508] |
NPT2 | Others | Unspecified | Ratio CC50/IC50 | = | 7222.0 | n.a. | PMID[484508] | |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | TIME | = | 216.0 | hr | PMID[484508] |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | TIME | = | 528.0 | hr | PMID[484508] |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | TIME | = | 300.0 | hr | PMID[484508] |
NPT21742 | CELL-LINE | L02 | Homo sapiens | IC50 | = | 430.0 | nM | PMID[484509] |
☑ Note for Activity Records:
☉ The quantitative biological activities were primarily integrated from ChEMBL (Version-30) database and were also directly collected from PubMed literature. PubMed PMID was provided as the reference link for each activity record.
Top-200 similar NPs were calculated against the active-NP-set (includes 4,3285 NPs with experimentally-derived bioactivity available in NPASS)
Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient
●  The left chart: Distribution of similarity level between NPC30443 and all remaining natural products in the NPASS database.
●  The right table: Most similar natural products (Tc>=0.56 or Top200).
Similarity Score | Similarity Level | Natural Product ID |
---|---|---|
1.0 | High Similarity | NPC285480 |
1.0 | High Similarity | NPC45256 |
1.0 | High Similarity | NPC260977 |
0.9351 | High Similarity | NPC60568 |
0.8765 | High Similarity | NPC30102 |
0.8765 | High Similarity | NPC128816 |
0.8765 | High Similarity | NPC67158 |
0.8427 | Intermediate Similarity | NPC148872 |
0.8421 | Intermediate Similarity | NPC29005 |
0.8421 | Intermediate Similarity | NPC51956 |
0.8421 | Intermediate Similarity | NPC5209 |
0.8101 | Intermediate Similarity | NPC200167 |
0.8101 | Intermediate Similarity | NPC31046 |
0.8101 | Intermediate Similarity | NPC209666 |
0.8101 | Intermediate Similarity | NPC53868 |
0.764 | Intermediate Similarity | NPC221993 |
0.7553 | Intermediate Similarity | NPC266417 |
0.7529 | Intermediate Similarity | NPC125366 |
0.7442 | Intermediate Similarity | NPC329490 |
0.7442 | Intermediate Similarity | NPC328639 |
0.7317 | Intermediate Similarity | NPC123122 |
0.7273 | Intermediate Similarity | NPC476721 |
0.7263 | Intermediate Similarity | NPC475785 |
0.7263 | Intermediate Similarity | NPC475765 |
0.7229 | Intermediate Similarity | NPC55508 |
0.7222 | Intermediate Similarity | NPC476717 |
0.7204 | Intermediate Similarity | NPC475878 |
0.7191 | Intermediate Similarity | NPC51135 |
0.7191 | Intermediate Similarity | NPC82492 |
0.7191 | Intermediate Similarity | NPC25802 |
0.7191 | Intermediate Similarity | NPC101138 |
0.7191 | Intermediate Similarity | NPC79308 |
0.7188 | Intermediate Similarity | NPC472273 |
0.7129 | Intermediate Similarity | NPC203974 |
0.7126 | Intermediate Similarity | NPC471216 |
0.7126 | Intermediate Similarity | NPC471217 |
0.7126 | Intermediate Similarity | NPC134227 |
0.7111 | Intermediate Similarity | NPC476715 |
0.7045 | Intermediate Similarity | NPC71541 |
0.7033 | Intermediate Similarity | NPC471410 |
0.7033 | Intermediate Similarity | NPC471411 |
0.7033 | Intermediate Similarity | NPC474008 |
0.7033 | Intermediate Similarity | NPC470657 |
0.7024 | Intermediate Similarity | NPC96759 |
0.7011 | Intermediate Similarity | NPC474754 |
0.7 | Intermediate Similarity | NPC65133 |
0.699 | Remote Similarity | NPC228190 |
0.699 | Remote Similarity | NPC236753 |
0.6979 | Remote Similarity | NPC215570 |
0.6977 | Remote Similarity | NPC143250 |
0.6977 | Remote Similarity | NPC70996 |
0.6961 | Remote Similarity | NPC126753 |
0.6957 | Remote Similarity | NPC31349 |
0.6923 | Remote Similarity | NPC470622 |
0.6923 | Remote Similarity | NPC477205 |
0.6907 | Remote Similarity | NPC193785 |
0.6905 | Remote Similarity | NPC109510 |
0.6905 | Remote Similarity | NPC476718 |
0.69 | Remote Similarity | NPC471254 |
0.69 | Remote Similarity | NPC80640 |
0.6897 | Remote Similarity | NPC177343 |
0.6893 | Remote Similarity | NPC469826 |
0.6893 | Remote Similarity | NPC207693 |
0.6857 | Remote Similarity | NPC469824 |
0.6854 | Remote Similarity | NPC476494 |
0.6848 | Remote Similarity | NPC244174 |
0.6842 | Remote Similarity | NPC474631 |
0.6837 | Remote Similarity | NPC74466 |
0.6837 | Remote Similarity | NPC471241 |
0.6832 | Remote Similarity | NPC34562 |
0.6832 | Remote Similarity | NPC107385 |
0.6832 | Remote Similarity | NPC471253 |
0.6827 | Remote Similarity | NPC22709 |
0.6792 | Remote Similarity | NPC157571 |
0.6792 | Remote Similarity | NPC477489 |
0.6786 | Remote Similarity | NPC478227 |
0.6782 | Remote Similarity | NPC474003 |
0.6778 | Remote Similarity | NPC248415 |
0.6774 | Remote Similarity | NPC470920 |
0.6774 | Remote Similarity | NPC239938 |
0.6771 | Remote Similarity | NPC474379 |
0.6765 | Remote Similarity | NPC470167 |
0.6765 | Remote Similarity | NPC267637 |
0.6765 | Remote Similarity | NPC469827 |
0.6762 | Remote Similarity | NPC471431 |
0.6762 | Remote Similarity | NPC475501 |
0.6742 | Remote Similarity | NPC475456 |
0.6742 | Remote Similarity | NPC1882 |
0.6739 | Remote Similarity | NPC478111 |
0.6737 | Remote Similarity | NPC18536 |
0.6737 | Remote Similarity | NPC50443 |
0.6733 | Remote Similarity | NPC213528 |
0.6733 | Remote Similarity | NPC244969 |
0.6733 | Remote Similarity | NPC470172 |
0.6706 | Remote Similarity | NPC474755 |
0.6703 | Remote Similarity | NPC15091 |
0.6702 | Remote Similarity | NPC471221 |
0.6702 | Remote Similarity | NPC236459 |
0.6702 | Remote Similarity | NPC476379 |
0.6701 | Remote Similarity | NPC476722 |
0.6701 | Remote Similarity | NPC477495 |
0.67 | Remote Similarity | NPC80417 |
0.67 | Remote Similarity | NPC20028 |
0.6699 | Remote Similarity | NPC158051 |
0.6699 | Remote Similarity | NPC158367 |
0.6699 | Remote Similarity | NPC119628 |
0.6699 | Remote Similarity | NPC184805 |
0.6699 | Remote Similarity | NPC273189 |
0.6699 | Remote Similarity | NPC41681 |
0.6667 | Remote Similarity | NPC475743 |
0.6667 | Remote Similarity | NPC216137 |
0.6667 | Remote Similarity | NPC473406 |
0.6667 | Remote Similarity | NPC474020 |
0.6667 | Remote Similarity | NPC470632 |
0.6667 | Remote Similarity | NPC471046 |
0.6667 | Remote Similarity | NPC79193 |
0.6667 | Remote Similarity | NPC248216 |
0.6667 | Remote Similarity | NPC87393 |
0.6667 | Remote Similarity | NPC469825 |
0.6636 | Remote Similarity | NPC470543 |
0.6635 | Remote Similarity | NPC40716 |
0.6635 | Remote Similarity | NPC475234 |
0.6635 | Remote Similarity | NPC475630 |
0.6635 | Remote Similarity | NPC138219 |
0.6635 | Remote Similarity | NPC293512 |
0.6635 | Remote Similarity | NPC471430 |
0.6634 | Remote Similarity | NPC478181 |
0.6634 | Remote Similarity | NPC477172 |
0.6633 | Remote Similarity | NPC57964 |
0.6633 | Remote Similarity | NPC94582 |
0.6632 | Remote Similarity | NPC200580 |
0.663 | Remote Similarity | NPC9060 |
0.663 | Remote Similarity | NPC181871 |
0.663 | Remote Similarity | NPC473299 |
0.663 | Remote Similarity | NPC18953 |
0.6628 | Remote Similarity | NPC166250 |
0.6604 | Remote Similarity | NPC66513 |
0.6602 | Remote Similarity | NPC100078 |
0.6602 | Remote Similarity | NPC88469 |
0.66 | Remote Similarity | NPC472144 |
0.6598 | Remote Similarity | NPC475307 |
0.6593 | Remote Similarity | NPC148740 |
0.6593 | Remote Similarity | NPC102156 |
0.6591 | Remote Similarity | NPC476719 |
0.6591 | Remote Similarity | NPC307865 |
0.6588 | Remote Similarity | NPC96322 |
0.6585 | Remote Similarity | NPC84562 |
0.6582 | Remote Similarity | NPC478126 |
0.6574 | Remote Similarity | NPC189884 |
0.6574 | Remote Similarity | NPC47063 |
0.6574 | Remote Similarity | NPC204458 |
0.6574 | Remote Similarity | NPC138334 |
0.6571 | Remote Similarity | NPC473688 |
0.6571 | Remote Similarity | NPC472079 |
0.6571 | Remote Similarity | NPC471626 |
0.6571 | Remote Similarity | NPC231566 |
0.6571 | Remote Similarity | NPC94942 |
0.6571 | Remote Similarity | NPC262567 |
0.6569 | Remote Similarity | NPC310031 |
0.6569 | Remote Similarity | NPC80191 |
0.6566 | Remote Similarity | NPC238796 |
0.6566 | Remote Similarity | NPC237071 |
0.6566 | Remote Similarity | NPC476728 |
0.6566 | Remote Similarity | NPC203434 |
0.6566 | Remote Similarity | NPC235109 |
0.6562 | Remote Similarity | NPC472146 |
0.6562 | Remote Similarity | NPC470114 |
0.6562 | Remote Similarity | NPC327183 |
0.6562 | Remote Similarity | NPC328935 |
0.6562 | Remote Similarity | NPC185529 |
0.6559 | Remote Similarity | NPC474572 |
0.6548 | Remote Similarity | NPC178541 |
0.6545 | Remote Similarity | NPC179429 |
0.6542 | Remote Similarity | NPC477073 |
0.6538 | Remote Similarity | NPC103172 |
0.6538 | Remote Similarity | NPC166079 |
0.6538 | Remote Similarity | NPC215408 |
0.6538 | Remote Similarity | NPC56656 |
0.6538 | Remote Similarity | NPC306776 |
0.6538 | Remote Similarity | NPC164600 |
0.6535 | Remote Similarity | NPC41843 |
0.6531 | Remote Similarity | NPC476716 |
0.6531 | Remote Similarity | NPC41649 |
0.6531 | Remote Similarity | NPC96736 |
0.6531 | Remote Similarity | NPC178949 |
0.6531 | Remote Similarity | NPC151214 |
0.6531 | Remote Similarity | NPC191915 |
0.6531 | Remote Similarity | NPC470424 |
0.6526 | Remote Similarity | NPC191221 |
0.6526 | Remote Similarity | NPC476435 |
0.6526 | Remote Similarity | NPC33398 |
0.6526 | Remote Similarity | NPC470872 |
0.6526 | Remote Similarity | NPC470009 |
0.6522 | Remote Similarity | NPC241959 |
0.6522 | Remote Similarity | NPC474346 |
0.6522 | Remote Similarity | NPC474253 |
0.6522 | Remote Similarity | NPC474284 |
0.6522 | Remote Similarity | NPC475820 |
0.6522 | Remote Similarity | NPC213737 |
0.6522 | Remote Similarity | NPC269684 |
Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.
●  The left chart: Distribution of similarity level between NPC30443 and all drugs/candidates.
●  The right table: Most similar clinical/approved drugs (Tc>=0.56 or Top200).
Similarity Score | Similarity Level | Drug ID | Developmental Stage |
---|---|---|---|
1.0 | High Similarity | NPD1780 | Approved |
1.0 | High Similarity | NPD1779 | Approved |
0.8765 | High Similarity | NPD3669 | Approved |
0.8765 | High Similarity | NPD3670 | Clinical (unspecified phase) |
0.8421 | Intermediate Similarity | NPD2687 | Approved |
0.8421 | Intermediate Similarity | NPD2686 | Approved |
0.8421 | Intermediate Similarity | NPD2254 | Approved |
0.8101 | Intermediate Similarity | NPD1810 | Approved |
0.8101 | Intermediate Similarity | NPD1811 | Approved |
0.6509 | Remote Similarity | NPD8132 | Clinical (unspecified phase) |
0.6442 | Remote Similarity | NPD8170 | Clinical (unspecified phase) |
0.6396 | Remote Similarity | NPD8295 | Clinical (unspecified phase) |
0.6364 | Remote Similarity | NPD3702 | Approved |
0.6273 | Remote Similarity | NPD8133 | Approved |
0.6154 | Remote Similarity | NPD6115 | Approved |
0.6154 | Remote Similarity | NPD6697 | Approved |
0.6154 | Remote Similarity | NPD6114 | Approved |
0.6154 | Remote Similarity | NPD6118 | Approved |
0.6111 | Remote Similarity | NPD5345 | Clinical (unspecified phase) |
0.6095 | Remote Similarity | NPD8085 | Approved |
0.6095 | Remote Similarity | NPD8086 | Approved |
0.6095 | Remote Similarity | NPD8138 | Approved |
0.6095 | Remote Similarity | NPD8139 | Approved |
0.6095 | Remote Similarity | NPD8083 | Approved |
0.6095 | Remote Similarity | NPD8084 | Approved |
0.6095 | Remote Similarity | NPD8082 | Approved |
0.6068 | Remote Similarity | NPD8328 | Phase 3 |
0.6044 | Remote Similarity | NPD6116 | Phase 1 |
0.6038 | Remote Similarity | NPD8276 | Approved |
0.6038 | Remote Similarity | NPD8275 | Approved |
0.6023 | Remote Similarity | NPD5777 | Approved |
0.6 | Remote Similarity | NPD1700 | Approved |
0.5981 | Remote Similarity | NPD8081 | Approved |
0.5981 | Remote Similarity | NPD3710 | Phase 2 |
0.5963 | Remote Similarity | NPD6686 | Approved |
0.5943 | Remote Similarity | NPD8300 | Approved |
0.5943 | Remote Similarity | NPD8301 | Approved |
0.5934 | Remote Similarity | NPD6117 | Approved |
0.5926 | Remote Similarity | NPD8393 | Approved |
0.5877 | Remote Similarity | NPD6940 | Discontinued |
0.5872 | Remote Similarity | NPD6412 | Phase 2 |
0.5872 | Remote Similarity | NPD5954 | Clinical (unspecified phase) |
0.5833 | Remote Similarity | NPD7507 | Approved |
0.5824 | Remote Similarity | NPD3703 | Phase 2 |
0.5806 | Remote Similarity | NPD4802 | Phase 2 |
0.5806 | Remote Similarity | NPD4238 | Approved |
0.5784 | Remote Similarity | NPD8171 | Discontinued |
0.578 | Remote Similarity | NPD6008 | Approved |
0.5765 | Remote Similarity | NPD371 | Approved |
0.5763 | Remote Similarity | NPD8517 | Approved |
0.5763 | Remote Similarity | NPD8515 | Approved |
0.5763 | Remote Similarity | NPD8516 | Approved |
0.5763 | Remote Similarity | NPD8513 | Phase 3 |
0.573 | Remote Similarity | NPD7532 | Clinical (unspecified phase) |
0.5727 | Remote Similarity | NPD8140 | Approved |
0.5727 | Remote Similarity | NPD8307 | Discontinued |
0.5714 | Remote Similarity | NPD5955 | Clinical (unspecified phase) |
0.5714 | Remote Similarity | NPD6113 | Clinical (unspecified phase) |
0.5698 | Remote Similarity | NPD9496 | Clinical (unspecified phase) |
0.5691 | Remote Similarity | NPD7319 | Approved |
0.569 | Remote Similarity | NPD6009 | Approved |
0.5686 | Remote Similarity | NPD8035 | Phase 2 |
0.5686 | Remote Similarity | NPD8034 | Phase 2 |
0.5682 | Remote Similarity | NPD229 | Approved |
0.5656 | Remote Similarity | NPD8293 | Discontinued |
0.5632 | Remote Similarity | NPD4224 | Phase 2 |
0.5625 | Remote Similarity | NPD615 | Clinical (unspecified phase) |
0.5625 | Remote Similarity | NPD8305 | Approved |
0.5625 | Remote Similarity | NPD4061 | Clinical (unspecified phase) |
0.5625 | Remote Similarity | NPD8306 | Approved |
0.561 | Remote Similarity | NPD7736 | Approved |
0.56 | Remote Similarity | NPD3573 | Approved |
Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.