Molecular Weight:   | 594.45 |
Volume:   | 644.505 |
LogP:   | 8.487 |
LogD:   | 4.669 |
LogS:   | -6.79 |
# Rotatable Bonds:   | 23 |
TPSA:   | 112.52 |
# H-Bond Aceptor:   | 7 |
# H-Bond Donor:   | 4 |
# Rings:   | 3 |
# Heavy Atoms:   | 7 |
QED Drug-Likeness Score:   | 0.096 |
Synthetic Accessibility Score:   | 4.641 |
Fsp3:   | 0.886 |
Lipinski Rule-of-5:   | Rejected |
Pfizer Rule:   | Accepted |
GSK Rule:   | Rejected |
BMS Rule:   | 1 |
Golden Triangle Rule:   | Rejected |
Chelating Alert:   | 0 |
PAINS Alert:   | 0 |
Caco-2 Permeability:   | -5.287 |
MDCK Permeability:   | 1.744816472637467e-05 |
Pgp-inhibitor:   | 0.075 |
Pgp-substrate:   | 0.983 |
Human Intestinal Absorption (HIA):   | 0.013 |
20% Bioavailability (F20%):   | 0.984 |
30% Bioavailability (F30%):   | 0.415 |
Blood-Brain-Barrier Penetration (BBB):   | 0.006 |
Plasma Protein Binding (PPB):   | 98.21916961669922% |
Volume Distribution (VD):   | 0.685 |
Pgp-substrate:   | 2.9729652404785156% |
CYP1A2-inhibitor:   | 0.017 |
CYP1A2-substrate:   | 0.515 |
CYP2C19-inhibitor:   | 0.069 |
CYP2C19-substrate:   | 0.059 |
CYP2C9-inhibitor:   | 0.058 |
CYP2C9-substrate:   | 0.963 |
CYP2D6-inhibitor:   | 0.006 |
CYP2D6-substrate:   | 0.104 |
CYP3A4-inhibitor:   | 0.115 |
CYP3A4-substrate:   | 0.029 |
Clearance (CL):   | 3.592 |
Half-life (T1/2):   | 0.096 |
hERG Blockers:   | 0.284 |
Human Hepatotoxicity (H-HT):   | 0.28 |
Drug-inuced Liver Injury (DILI):   | 0.161 |
AMES Toxicity:   | 0.023 |
Rat Oral Acute Toxicity:   | 0.408 |
Maximum Recommended Daily Dose:   | 0.77 |
Skin Sensitization:   | 0.967 |
Carcinogencity:   | 0.039 |
Eye Corrosion:   | 0.003 |
Eye Irritation:   | 0.019 |
Respiratory Toxicity:   | 0.194 |
Natural Product ID:   | NPC274443 |
Common Name*:   | Lapachol |
IUPAC Name:   | n.a. |
Synonyms:   | |
Standard InCHIKey:   | CIEYTVIYYGTCCI-UHFFFAOYSA-N |
Standard InCHI:   | InChI=1S/C15H14O3/c1-9(2)7-8-12-13(16)10-5-3-4-6-11(10)14(17)15(12)18/h3-7,18H,8H2,1-2H3 |
SMILES:   | CC(=CCC1=C(O)C(=O)c2c(C1=O)cccc2)C |
Synthetic Gene Cluster:   | n.a. |
ChEMBL Identifier:   | CHEMBL15193 |
PubChem CID:   |
NA |
Chemical Classification**:   |
|
*Note: the InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.
**Note: the Chemical Classification was calculated by NPClassifier Version 1.5. Reference: PMID:34662515.
Organism ID | Organism Name | Taxonomy Level | Family | SuperKingdom | Isolation Part | Collection Location | Collection Time | Reference |
---|---|---|---|---|---|---|---|---|
NPO6987 | Tolypothrix byssoidea | Species | Tolypothrichaceae | Bacteria | n.a. | n.a. | n.a. |
PMID[11429991] |
NPO3427 | Aglaia rubiginosa | Species | Meliaceae | Eukaryota | twigs and leaves | n.a. | n.a. |
PMID[15043407] |
NPO23838 | Kitasatospora kifunensis | Species | Streptomycetaceae | Bacteria | n.a. | n.a. | n.a. |
PMID[17191679] |
NPO1376 | Landsburgia quercifolia | Species | Sargassaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[1791483] |
NPO487 | Tabebuia avellanedae | Species | Bignoniaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[17950604] |
NPO487 | Tabebuia avellanedae | Species | Bignoniaceae | Eukaryota | n.a. | bark | n.a. |
PMID[17950604] |
NPO487 | Tabebuia avellanedae | Species | Bignoniaceae | Eukaryota | n.a. | Brazilian | n.a. |
PMID[19674905] |
NPO10199 | Leuconotis griffithii | n.a. | n.a. | n.a. | n.a. | n.a. | n.a. |
PMID[20153644] |
NPO10199 | Leuconotis griffithii | n.a. | n.a. | n.a. | n.a. | n.a. | n.a. |
PMID[23647487] |
NPO10199 | Leuconotis griffithii | n.a. | n.a. | n.a. | n.a. | n.a. | n.a. |
PMID[30362746] |
NPO487 | Tabebuia avellanedae | Species | Bignoniaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[32044231] |
NPO19293 | Tabebuia cassinoides | Species | Bignoniaceae | Eukaryota | n.a. | n.a. | n.a. |
PMID[7153777] |
NPO5788 | Millingtonia hortensis | Species | Bignoniaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
NPO228 | Physostigma venenosum | Species | Fabaceae | Eukaryota | n.a. | n.a. | n.a. | Database[HerDing] |
NPO5788 | Millingtonia hortensis | Species | Bignoniaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
NPO228 | Physostigma venenosum | Species | Fabaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCMID] |
NPO5788 | Millingtonia hortensis | Species | Bignoniaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCM_Taiwan] |
NPO228 | Physostigma venenosum | Species | Fabaceae | Eukaryota | n.a. | n.a. | n.a. | Database[TCM_Taiwan] |
NPO5788 | Millingtonia hortensis | Species | Bignoniaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
NPO856 | Helichrysum mimetes | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
NPO10196 | Echinocereus blanckii | Species | Cactaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
NPO3427 | Aglaia rubiginosa | Species | Meliaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
NPO4489 | Achillea serbica | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
NPO11724 | Vernonia venosissima | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
NPO11189 | Anabaena sphaerica | Species | 0stocaceae | Bacteria | n.a. | n.a. | n.a. | Database[UNPD] |
NPO8719 | Fusarium vasinfectum | Species | Nectriaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
NPO19293 | Tabebuia cassinoides | Species | Bignoniaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
NPO10826 | Rabdosia weisiensis | Species | Lamiaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
NPO3143 | Artemisia carruthii | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
NPO228 | Physostigma venenosum | Species | Fabaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
NPO23838 | Kitasatospora kifunensis | Species | Streptomycetaceae | Bacteria | n.a. | n.a. | n.a. | Database[UNPD] |
NPO449 | Trichocentrum cebolletum | Species | Orchidaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
NPO4214 | Centaurea collina | Species | Asteraceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
NPO6710 | Sinapis nigra | Species | Brassicaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
NPO12083 | Hydnellum zonatum | Species | Thelephoraceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
NPO5445 | Euonymus nanus | Species | Celastraceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
NPO487 | Tabebuia avellanedae | Species | Bignoniaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
NPO8231 | Jaspis digonoxea | Species | Ancorinidae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
NPO6987 | Tolypothrix byssoidea | Species | Tolypothrichaceae | Bacteria | n.a. | n.a. | n.a. | Database[UNPD] |
NPO12727 | Rufoplaca arenaria | Species | Teloschistaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
NPO11437 | Alluaudia ascendens | Species | Didiereaceae | Eukaryota | n.a. | n.a. | n.a. | Database[UNPD] |
NPO3751 | Orthantha lutea | n.a. | n.a. | n.a. | n.a. | n.a. | n.a. | Database[UNPD] |
NPO10199 | Leuconotis griffithii | n.a. | n.a. | n.a. | n.a. | n.a. | n.a. | Database[UNPD] |
☑ Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].
Organism ID | NP ID | Organism Material Preparation | Organism Part | NP Quantity (Standard) | NP Quantity (Minimum) | NP Quantity (Maximum) | Quantity Unit | Reference |
---|
☑ Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].
Target ID | Target Type | Target Name | Target Organism | Activity Type | Activity Relation | Value | Unit | Reference |
---|---|---|---|---|---|---|---|---|
NPT91 | Cell Line | KB | Homo sapiens | ED50 | = | 4.4 | ug ml-1 | PMID[510189] |
NPT1566 | Individual Protein | Glyoxalase I | Homo sapiens | Ki | = | 37153.52 | nM | PMID[510191] |
NPT116 | Cell Line | HL-60 | Homo sapiens | IC50 | = | 3180.0 | nM | PMID[510192] |
NPT80 | Cell Line | Raji | Homo sapiens | Activity | = | 50.0 | % | PMID[510193] |
NPT80 | Cell Line | Raji | Homo sapiens | Activity | = | 60.0 | % | PMID[510193] |
NPT80 | Cell Line | Raji | Homo sapiens | Activity | > | 80.0 | % | PMID[510193] |
NPT168 | Cell Line | P388 | Mus musculus | IC50 | = | 0.2 | ug.mL-1 | PMID[510196] |
NPT91 | Cell Line | KB | Homo sapiens | ED50 | = | 4.4 | ug ml-1 | PMID[510197] |
NPT90 | Cell Line | DU-145 | Homo sapiens | IC50 | = | 64.59 | nM | PMID[510199] |
NPT90 | Cell Line | DU-145 | Homo sapiens | Inhibition | = | 78.12 | % | PMID[510199] |
NPT941 | Cell Line | HaCaT | Homo sapiens | IC50 | > | 10000.0 | nM | PMID[510200] |
NPT306 | Cell Line | PC-3 | Homo sapiens | EC50 | = | 1970.0 | nM | PMID[510201] |
NPT81 | Cell Line | A549 | Homo sapiens | EC50 | = | 4780.0 | nM | PMID[510201] |
NPT83 | Cell Line | MCF7 | Homo sapiens | EC50 | = | 10150.0 | nM | PMID[510201] |
NPT80 | Cell Line | Raji | Homo sapiens | Activity | = | 50.0 | % | PMID[510201] |
NPT80 | Cell Line | Raji | Homo sapiens | Activity | = | 60.0 | % | PMID[510201] |
NPT179 | Cell Line | A2780 | Homo sapiens | GI50 | = | 1900.0 | nM | PMID[510202] |
NPT1723 | Cell Line | HBL-100 | Homo sapiens | GI50 | = | 7800.0 | nM | PMID[510202] |
NPT165 | Cell Line | HeLa | Homo sapiens | GI50 | = | 2300.0 | nM | PMID[510202] |
NPT1577 | Cell Line | SW1573 | Homo sapiens | GI50 | = | 34000.0 | nM | PMID[510202] |
NPT396 | Cell Line | T47D | Homo sapiens | GI50 | = | 76000.0 | nM | PMID[510202] |
NPT1183 | Cell Line | WiDr | Homo sapiens | GI50 | = | 36000.0 | nM | PMID[510202] |
NPT927 | Cell Line | PBMC | Homo sapiens | IC50 | = | 2100.0 | nM | PMID[510203] |
NPT48 | Individual Protein | Lysine-specific demethylase 4D-like | Homo sapiens | Potency | = | 31622.8 | nM | PMID[510204] |
NPT48 | Individual Protein | Lysine-specific demethylase 4D-like | Homo sapiens | Potency | = | 25118.9 | nM | PMID[510205] |
NPT51 | Individual Protein | Microtubule-associated protein tau | Homo sapiens | Potency | = | 19952.6 | nM | PMID[510205] |
NPT51 | Individual Protein | Microtubule-associated protein tau | Homo sapiens | Potency | = | 28183.8 | nM | PMID[510205] |
NPT51 | Individual Protein | Microtubule-associated protein tau | Homo sapiens | Potency | = | 19952.6 | nM | PMID[510204] |
NPT531 | Individual Protein | Nuclear receptor ROR-gamma | Mus musculus | Potency | = | 35481.3 | nM | PMID[510205] |
NPT531 | Individual Protein | Nuclear receptor ROR-gamma | Mus musculus | Potency | = | 35481.3 | nM | PMID[510204] |
NPT583 | Individual Protein | Inositol monophosphatase 1 | Rattus norvegicus | Potency | = | 12589.3 | nM | PMID[510204] |
NPT51 | Individual Protein | Microtubule-associated protein tau | Homo sapiens | Potency | = | 17782.8 | nM | PMID[510205] |
NPT55 | Individual Protein | Putative fructose-1,6-bisphosphate aldolase | Giardia intestinalis | Potency | = | 1774.1 | nM | PMID[510204] |
NPT55 | Individual Protein | Putative fructose-1,6-bisphosphate aldolase | Giardia intestinalis | Potency | = | 1119.4 | nM | PMID[510205] |
NPT539 | Individual Protein | Cellular tumor antigen p53 | Homo sapiens | Potency | = | 2511.9 | nM | PMID[510204] |
NPT531 | Individual Protein | Nuclear receptor ROR-gamma | Mus musculus | Potency | = | 3162.3 | nM | PMID[510205] |
NPT109 | Individual Protein | Cytochrome P450 3A4 | Homo sapiens | Potency | = | 25118.9 | nM | PMID[510204] |
NPT927 | Cell Line | PBMC | Homo sapiens | IC50 | > | 103190.0 | nM | PMID[510206] |
NPT198 | Individual Protein | Vitamin D receptor | Homo sapiens | Potency | n.a. | 35481.3 | nM | PMID[510204] |
NPT198 | Individual Protein | Vitamin D receptor | Homo sapiens | Potency | n.a. | 25118.9 | nM | PMID[510205] |
NPT444 | Individual Protein | Ubiquitin carboxyl-terminal hydrolase 1 | Homo sapiens | Potency | n.a. | 35481.3 | nM | PMID[510204] |
NPT368 | Cell Line | SN12C | Homo sapiens | GI50 | n.a. | 31332.86 | nM | PMID[510207] |
NPT367 | Cell Line | MDA-N | Homo sapiens | GI50 | n.a. | 17378.01 | nM | PMID[510207] |
NPT370 | Cell Line | NCI-H23 | Homo sapiens | GI50 | n.a. | 23442.29 | nM | PMID[510207] |
NPT369 | Cell Line | ACHN | Homo sapiens | GI50 | n.a. | 34914.03 | nM | PMID[510207] |
NPT371 | Cell Line | UO-31 | Homo sapiens | GI50 | n.a. | 48865.24 | nM | PMID[510207] |
NPT372 | Cell Line | HOP-92 | Homo sapiens | GI50 | n.a. | 79615.94 | nM | PMID[510207] |
NPT116 | Cell Line | HL-60 | Homo sapiens | GI50 | n.a. | 6501.3 | nM | PMID[510207] |
NPT374 | Cell Line | SF-539 | Homo sapiens | GI50 | n.a. | 7852.36 | nM | PMID[510207] |
NPT90 | Cell Line | DU-145 | Homo sapiens | GI50 | n.a. | 36897.76 | nM | PMID[510207] |
NPT373 | Cell Line | SK-MEL-5 | Homo sapiens | GI50 | n.a. | 11694.99 | nM | PMID[510207] |
NPT375 | Cell Line | Malme-3M | Homo sapiens | GI50 | n.a. | 35075.19 | nM | PMID[510207] |
NPT111 | Cell Line | K562 | Homo sapiens | GI50 | n.a. | 6622.17 | nM | PMID[510207] |
NPT376 | Cell Line | A498 | Homo sapiens | GI50 | n.a. | 60394.86 | nM | PMID[510207] |
NPT377 | Cell Line | OVCAR-3 | Homo sapiens | GI50 | n.a. | 24266.1 | nM | PMID[510207] |
NPT112 | Cell Line | MOLT-4 | Homo sapiens | GI50 | n.a. | 5807.64 | nM | PMID[510207] |
NPT379 | Cell Line | HOP-62 | Homo sapiens | GI50 | n.a. | 34833.73 | nM | PMID[510207] |
NPT378 | Cell Line | NCI/ADR-RES | Homo sapiens | GI50 | n.a. | 32284.94 | nM | PMID[510207] |
NPT380 | Cell Line | U-251 | Homo sapiens | GI50 | n.a. | 10864.26 | nM | PMID[510207] |
NPT382 | Cell Line | OVCAR-5 | Homo sapiens | GI50 | n.a. | 100000.0 | nM | PMID[510207] |
NPT381 | Cell Line | OVCAR-8 | Homo sapiens | GI50 | n.a. | 26730.06 | nM | PMID[510207] |
NPT572 | Cell Line | DMS-273 | Homo sapiens | GI50 | n.a. | 9141.13 | nM | PMID[510207] |
NPT82 | Cell Line | MDA-MB-231 | Homo sapiens | GI50 | n.a. | 8531.0 | nM | PMID[510207] |
NPT383 | Cell Line | SNB-19 | Homo sapiens | GI50 | n.a. | 16368.17 | nM | PMID[510207] |
NPT384 | Cell Line | TK-10 | Homo sapiens | GI50 | n.a. | 37757.22 | nM | PMID[510207] |
NPT385 | Cell Line | SR | Homo sapiens | GI50 | n.a. | 20606.3 | nM | PMID[510207] |
NPT573 | Cell Line | M19-MEL | Homo sapiens | GI50 | n.a. | 20796.97 | nM | PMID[510207] |
NPT323 | Cell Line | SW-620 | Homo sapiens | GI50 | n.a. | 34593.94 | nM | PMID[510207] |
NPT386 | Cell Line | KM12 | Homo sapiens | GI50 | n.a. | 9246.98 | nM | PMID[510207] |
NPT455 | Cell Line | NCI-H522 | Homo sapiens | GI50 | n.a. | 19724.23 | nM | PMID[510207] |
NPT574 | Cell Line | XF498 | Homo sapiens | GI50 | n.a. | 42364.3 | nM | PMID[510207] |
NPT387 | Cell Line | M14 | Homo sapiens | GI50 | n.a. | 45814.19 | nM | PMID[510207] |
NPT388 | Cell Line | NCI-H322M | Homo sapiens | GI50 | n.a. | 30408.85 | nM | PMID[510207] |
NPT389 | Cell Line | RPMI-8226 | Homo sapiens | GI50 | n.a. | 25763.21 | nM | PMID[510207] |
NPT456 | Cell Line | OVCAR-4 | Homo sapiens | GI50 | n.a. | 33651.16 | nM | PMID[510207] |
NPT390 | Cell Line | LOX IMVI | Homo sapiens | GI50 | n.a. | 8298.51 | nM | PMID[510207] |
NPT457 | Cell Line | BT-549 | Homo sapiens | GI50 | n.a. | 51760.68 | nM | PMID[510207] |
NPT147 | Cell Line | SK-MEL-2 | Homo sapiens | GI50 | n.a. | 35481.34 | nM | PMID[510207] |
NPT575 | Cell Line | KM-20L2 | Homo sapiens | GI50 | n.a. | 48865.24 | nM | PMID[510207] |
NPT81 | Cell Line | A549 | Homo sapiens | GI50 | n.a. | 17258.38 | nM | PMID[510207] |
NPT392 | Cell Line | SNB-75 | Homo sapiens | GI50 | n.a. | 57147.86 | nM | PMID[510207] |
NPT391 | Cell Line | HCC 2998 | Homo sapiens | GI50 | n.a. | 86297.85 | nM | PMID[510207] |
NPT148 | Cell Line | HCT-15 | Homo sapiens | GI50 | n.a. | 3681.29 | nM | PMID[510207] |
NPT393 | Cell Line | HCT-116 | Homo sapiens | GI50 | n.a. | 5023.43 | nM | PMID[510207] |
NPT395 | Cell Line | SF-268 | Homo sapiens | GI50 | n.a. | 11857.69 | nM | PMID[510207] |
NPT83 | Cell Line | MCF7 | Homo sapiens | GI50 | n.a. | 24378.11 | nM | PMID[510207] |
NPT394 | Cell Line | EKVX | Homo sapiens | GI50 | n.a. | 78704.58 | nM | PMID[510207] |
NPT306 | Cell Line | PC-3 | Homo sapiens | GI50 | n.a. | 2924.15 | nM | PMID[510207] |
NPT731 | Cell Line | LXFL 529 | Homo sapiens | GI50 | n.a. | 16180.8 | nM | PMID[510207] |
NPT576 | Cell Line | DMS-114 | Homo sapiens | GI50 | n.a. | 60255.96 | nM | PMID[510207] |
NPT146 | Cell Line | SK-OV-3 | Homo sapiens | GI50 | n.a. | 47752.93 | nM | PMID[510207] |
NPT396 | Cell Line | T47D | Homo sapiens | GI50 | n.a. | 61376.2 | nM | PMID[510207] |
NPT397 | Cell Line | NCI-H460 | Homo sapiens | GI50 | n.a. | 5000.35 | nM | PMID[510207] |
NPT398 | Cell Line | UACC-62 | Homo sapiens | GI50 | n.a. | 13396.77 | nM | PMID[510207] |
NPT308 | Cell Line | CAKI-1 | Homo sapiens | GI50 | n.a. | 54954.09 | nM | PMID[510207] |
NPT400 | Cell Line | MDA-MB-435 | Homo sapiens | GI50 | n.a. | 18535.32 | nM | PMID[510207] |
NPT399 | Cell Line | SF-295 | Homo sapiens | GI50 | n.a. | 22646.44 | nM | PMID[510207] |
NPT458 | Cell Line | IGROV-1 | Homo sapiens | GI50 | n.a. | 46131.76 | nM | PMID[510207] |
NPT402 | Cell Line | Hs-578T | Homo sapiens | GI50 | n.a. | 34833.73 | nM | PMID[510207] |
NPT577 | Cell Line | RXF 631 | Homo sapiens | GI50 | n.a. | 22181.96 | nM | PMID[510207] |
NPT578 | Cell Line | SNB-78 | Homo sapiens | GI50 | n.a. | 100000.0 | nM | PMID[510207] |
NPT403 | Cell Line | UACC-257 | Homo sapiens | GI50 | n.a. | 28641.78 | nM | PMID[510207] |
NPT401 | Cell Line | 786-0 | Homo sapiens | GI50 | n.a. | 21627.19 | nM | PMID[510207] |
NPT579 | Cell Line | DLD-1 | Homo sapiens | GI50 | n.a. | 25468.3 | nM | PMID[510207] |
NPT404 | Cell Line | CCRF-CEM | Homo sapiens | GI50 | n.a. | 18365.38 | nM | PMID[510207] |
NPT405 | Cell Line | NCI-H226 | Homo sapiens | GI50 | n.a. | 53826.98 | nM | PMID[510207] |
NPT139 | Cell Line | HT-29 | Homo sapiens | GI50 | n.a. | 22284.35 | nM | PMID[510207] |
NPT170 | Cell Line | SK-MEL-28 | Homo sapiens | GI50 | n.a. | 22961.49 | nM | PMID[510207] |
NPT406 | Cell Line | RXF 393 | Homo sapiens | GI50 | n.a. | 40738.03 | nM | PMID[510207] |
NPT407 | Cell Line | COLO 205 | Homo sapiens | GI50 | n.a. | 52360.04 | nM | PMID[510207] |
NPT732 | Cell Line | HOP-18 | Homo sapiens | GI50 | n.a. | 15240.53 | nM | PMID[510207] |
NPT1627 | Individual Protein | G-protein coupled receptor 35 | Homo sapiens | EC50 | = | 2840.0 | nM | PMID[510209] |
NPT1627 | Individual Protein | G-protein coupled receptor 35 | Homo sapiens | EC50 | = | 47900.0 | nM | PMID[510209] |
NPT1627 | Individual Protein | G-protein coupled receptor 35 | Homo sapiens | IC50 | = | 4660.0 | nM | PMID[510209] |
NPT1627 | Individual Protein | G-protein coupled receptor 35 | Homo sapiens | Efficacy | = | 328.0 | picometer | PMID[510209] |
NPT1627 | Individual Protein | G-protein coupled receptor 35 | Homo sapiens | Ratio | = | 8.7 | n.a. | PMID[510209] |
NPT1723 | Cell Line | HBL-100 | Homo sapiens | GI50 | = | 7800.0 | nM | PMID[510210] |
NPT165 | Cell Line | HeLa | Homo sapiens | GI50 | = | 2300.0 | nM | PMID[510210] |
NPT1577 | Cell Line | SW1573 | Homo sapiens | GI50 | = | 34000.0 | nM | PMID[510210] |
NPT1183 | Cell Line | WiDr | Homo sapiens | GI50 | = | 36000.0 | nM | PMID[510210] |
NPT50 | Individual Protein | Tyrosyl-DNA phosphodiesterase 1 | Homo sapiens | Potency | n.a. | 25929.0 | nM | PMID[510204] |
NPT50 | Individual Protein | Tyrosyl-DNA phosphodiesterase 1 | Homo sapiens | Potency | n.a. | 29092.9 | nM | PMID[510204] |
NPT114 | Cell Line | LoVo | Homo sapiens | IC50 | = | 9000.0 | nM | PMID[510219] |
NPT306 | Cell Line | PC-3 | Homo sapiens | IC50 | = | 4000.0 | nM | PMID[510219] |
NPT170 | Cell Line | SK-MEL-28 | Homo sapiens | IC50 | = | 8000.0 | nM | PMID[510219] |
NPT81 | Cell Line | A549 | Homo sapiens | IC50 | = | 8000.0 | nM | PMID[510219] |
NPT49 | Individual Protein | DNA-(apurinic or apyrimidinic site) lyase | Homo sapiens | Potency | n.a. | 4466.8 | nM | PMID[510205] |
NPT82 | Cell Line | MDA-MB-231 | Homo sapiens | IC50 | > | 10000.0 | nM | PMID[510222] |
NPT111 | Cell Line | K562 | Homo sapiens | IC50 | > | 10000.0 | nM | PMID[510222] |
NPT65 | Cell Line | HepG2 | Homo sapiens | CC50 | > | 4130700.0 | nM | PMID[510223] |
NPT3060 | Individual Protein | Dual specificity phosphatase Cdc25A | Homo sapiens | IC50 | = | 33200.0 | nM | PMID[510224] |
NPT82 | Cell Line | MDA-MB-231 | Homo sapiens | IC50 | > | 30000.0 | nM | PMID[510227] |
NPT83 | Cell Line | MCF7 | Homo sapiens | IC50 | > | 30000.0 | nM | PMID[510227] |
NPT81 | Cell Line | A549 | Homo sapiens | IC50 | > | 30000.0 | nM | PMID[510227] |
NPT1385 | Individual Protein | Histone-lysine N-methyltransferase SETD7 | Homo sapiens | Inhibition | = | 4.0 | % | PMID[510228] |
NPT1385 | Individual Protein | Histone-lysine N-methyltransferase SETD7 | Homo sapiens | Inhibition | = | 3.0 | % | PMID[510228] |
NPT153 | Individual Protein | Androgen Receptor | Homo sapiens | Potency | n.a. | 17280.4 | nM | PubChem BioAssay data set |
NPT152 | Individual Protein | Nuclear factor erythroid 2-related factor 2 | Homo sapiens | Potency | n.a. | 68171.3 | nM | PubChem BioAssay data set |
NPT32 | Organism | Mus musculus | Mus musculus | Lysis | = | 65.0 | % | PMID[510188] |
NPT474 | Organism | Plasmodium berghei | Plasmodium berghei | Inhibition | = | 0.0 | % | PMID[510190] |
NPT35 | Others | n.a. | LogP | = | 4.1 | n.a. | PMID[510192] | |
NPT164 | Organism | Human herpesvirus 4 | Human herpesvirus 4 | Inhibition | = | 65.2 | % | PMID[510193] |
NPT164 | Organism | Human herpesvirus 4 | Human herpesvirus 4 | Inhibition | = | 8.9 | % | PMID[510193] |
NPT164 | Organism | Human herpesvirus 4 | Human herpesvirus 4 | Inhibition | = | 32.8 | % | PMID[510193] |
NPT164 | Organism | Human herpesvirus 4 | Human herpesvirus 4 | Inhibition | = | 86.6 | % | PMID[510193] |
NPT164 | Organism | Human herpesvirus 4 | Human herpesvirus 4 | IC50 | = | 311400.0 | nM | PMID[510193] |
NPT580 | Organism | Trypanosoma cruzi | Trypanosoma cruzi | IC50 | = | 31300.0 | nM | PMID[510194] |
NPT580 | Organism | Trypanosoma cruzi | Trypanosoma cruzi | Activity | = | 51.8 | % | PMID[510194] |
NPT580 | Organism | Trypanosoma cruzi | Trypanosoma cruzi | Activity | = | 82.0 | % | PMID[510194] |
NPT580 | Organism | Trypanosoma cruzi | Trypanosoma cruzi | Activity | = | 41.7 | % | PMID[510194] |
NPT580 | Organism | Trypanosoma cruzi | Trypanosoma cruzi | IC50 | = | 410800.0 | nM | PMID[510195] |
NPT2 | Others | Unspecified | Activity | = | 8.9 | % | PMID[510201] | |
NPT2 | Others | Unspecified | Activity | = | 32.8 | % | PMID[510201] | |
NPT2 | Others | Unspecified | Activity | = | 65.2 | % | PMID[510201] | |
NPT2 | Others | Unspecified | Activity | = | 86.6 | % | PMID[510201] | |
NPT2 | Others | Unspecified | IC50 | = | 311400.0 | nM | PMID[510201] | |
NPT176 | Organism | Artemia salina | Artemia salina | Activity | = | 5.0 | ppm | PMID[510202] |
NPT580 | Organism | Trypanosoma cruzi | Trypanosoma cruzi | IC50 | = | 410800.0 | nM | PMID[510203] |
NPT93 | Individual Protein | Survival motor neuron protein | Homo sapiens | Potency | = | 3981.1 | nM | PMID[510205] |
NPT93 | Individual Protein | Survival motor neuron protein | Homo sapiens | Potency | = | 3162.3 | nM | PMID[510204] |
NPT94 | Individual Protein | Aldehyde dehydrogenase 1A1 | Homo sapiens | Potency | = | 28183.8 | nM | PMID[510205] |
NPT197 | Protein-Protein Interaction | Menin/Histone-lysine N-methyltransferase MLL | Homo sapiens | Potency | = | 25118.9 | nM | PMID[510205] |
NPT197 | Protein-Protein Interaction | Menin/Histone-lysine N-methyltransferase MLL | Homo sapiens | Potency | = | 19952.6 | nM | PMID[510204] |
NPT790 | Organism | Mycobacterium tuberculosis H37Rv | Mycobacterium tuberculosis H37Rv | MIC | = | 206600.0 | nM | PMID[510206] |
NPT88 | Organism | Mycobacterium tuberculosis | Mycobacterium tuberculosis | MIC | = | 206600.0 | nM | PMID[510206] |
NPT88 | Organism | Mycobacterium tuberculosis | Mycobacterium tuberculosis | MIC | = | 413200.0 | nM | PMID[510206] |
NPT580 | Organism | Trypanosoma cruzi | Trypanosoma cruzi | IC50 | = | 410800.0 | nM | PMID[510208] |
NPT614 | Tissue | Plasma | Rattus norvegicus | Drug metabolism | = | 0.7 | ug ml-1 | PMID[510211] |
NPT614 | Tissue | Plasma | Rattus norvegicus | Drug metabolism | = | 6.0 | ug ml-1 | PMID[510211] |
NPT614 | Tissue | Plasma | Rattus norvegicus | Drug metabolism | = | 1.4 | ug ml-1 | PMID[510211] |
NPT614 | Tissue | Plasma | Rattus norvegicus | Drug metabolism | = | 0.6 | ug ml-1 | PMID[510211] |
NPT614 | Tissue | Plasma | Rattus norvegicus | Cp | = | 2.0 | ug ml-1 | PMID[510211] |
NPT614 | Tissue | Plasma | Rattus norvegicus | Cp | = | 37.0 | ug ml-1 | PMID[510211] |
NPT1365 | Organism | Trichoplusia ni | Trichoplusia ni | mortality | = | 10.0 | % | PMID[510212] |
NPT1365 | Organism | Trichoplusia ni | Trichoplusia ni | FDI | = | 9.1 | % | PMID[510212] |
NPT314 | Organism | Bacillus cereus | Bacillus cereus | MIC | > | 78.12 | ug.mL-1 | PMID[510213] |
NPT16 | Organism | Staphylococcus aureus | Staphylococcus aureus | MIC | > | 78.12 | ug.mL-1 | PMID[510213] |
NPT19 | Organism | Escherichia coli | Escherichia coli | MIC | > | 78.12 | ug.mL-1 | PMID[510213] |
NPT88 | Organism | Mycobacterium tuberculosis | Mycobacterium tuberculosis | MBC | = | 645.66 | uM | PMID[510213] |
NPT88 | Organism | Mycobacterium tuberculosis | Mycobacterium tuberculosis | MIC | = | 161400.0 | nM | PMID[510213] |
NPT580 | Organism | Trypanosoma cruzi | Trypanosoma cruzi | IC50 | = | 410800.0 | nM | PMID[510215] |
NPT20529 | NON-MOLECULAR | NON-PROTEIN TARGET | n.a. | IC50 | = | 24100.0 | nM | PMID[510216] |
NPT2 | Others | Unspecified | Ratio CC50/IC50 | = | 0.94 | n.a. | PMID[510217] | |
NPT2 | Others | Unspecified | Ratio CC50/IC50 | = | 0.58 | n.a. | PMID[510217] | |
NPT2 | Others | Unspecified | Ratio CC50/IC50 | = | 0.59 | n.a. | PMID[510217] | |
NPT2 | Others | Unspecified | Ratio CC50/IC50 | = | 1.71 | n.a. | PMID[510217] | |
NPT27 | Others | Unspecified | CC50 | = | 59300.0 | nM | PMID[510217] | |
NPT634 | Organism | Leishmania amazonensis | Leishmania amazonensis | IC50 | = | 63280.0 | nM | PMID[510217] |
NPT634 | Organism | Leishmania amazonensis | Leishmania amazonensis | IC50 | = | 102050.0 | nM | PMID[510217] |
NPT1021 | Organism | Leishmania infantum | Leishmania infantum | IC50 | = | 99880.0 | nM | PMID[510217] |
NPT1021 | Organism | Leishmania infantum | Leishmania infantum | IC50 | = | 34720.0 | nM | PMID[510217] |
NPT73 | Individual Protein | Solute carrier organic anion transporter family member 1B1 | Homo sapiens | Inhibition | = | 115.5 | % | PMID[510218] |
NPT72 | Individual Protein | Solute carrier organic anion transporter family member 1B3 | Homo sapiens | Inhibition | = | 108.17 | % | PMID[510218] |
NPT20529 | NON-MOLECULAR | NON-PROTEIN TARGET | n.a. | IC50 | = | 11000.0 | nM | PMID[510219] |
NPT20529 | NON-MOLECULAR | NON-PROTEIN TARGET | n.a. | IC50 | = | 8000.0 | nM | PMID[510219] |
NPT2 | Others | Unspecified | Potency | n.a. | 3548.1 | nM | PMID[510204] | |
NPT2 | Others | Unspecified | Potency | n.a. | 25118.9 | nM | PMID[510205] | |
NPT2 | Others | Unspecified | Potency | n.a. | 5011.9 | nM | PMID[510204] | |
NPT2 | Others | Unspecified | Potency | n.a. | 35481.3 | nM | PMID[510205] | |
NPT20529 | NON-MOLECULAR | NON-PROTEIN TARGET | n.a. | IC50 | = | 12560.0 | nM | PMID[510221] |
NPT20529 | NON-MOLECULAR | NON-PROTEIN TARGET | n.a. | IC50 | = | 20360.0 | nM | PMID[510221] |
NPT20529 | NON-MOLECULAR | NON-PROTEIN TARGET | n.a. | IC50 | = | 20230.0 | nM | PMID[510221] |
NPT2 | Others | Unspecified | Ratio CC50/IC50 | > | 33.4 | n.a. | PMID[510223] | |
NPT6 | Organism | Plasmodium falciparum | Plasmodium falciparum | IC50 | = | 123500.0 | nM | PMID[510223] |
NPT911 | Individual Protein | Dual specificity phosphatase Cdc25B | Homo sapiens | IC50 | = | 42700.0 | nM | PMID[510224] |
NPT25570 | SINGLE PROTEIN | Dihydroorotate dehydrogenase (quinone), mitochondrial | Schistosoma mansoni | Activity | = | 0.0 | % | PMID[510225] |
NPT25570 | SINGLE PROTEIN | Dihydroorotate dehydrogenase (quinone), mitochondrial | Schistosoma mansoni | IC50 | = | 19.0 | nM | PMID[510225] |
NPT21852 | SINGLE PROTEIN | Dihydroorotate dehydrogenase | Homo sapiens | IC50 | = | 100.0 | nM | PMID[510225] |
NPT2 | Others | Unspecified | Ratio IC50 | = | 5.26 | n.a. | PMID[510225] | |
NPT21772 | PROTEIN COMPLEX | GroEL/GroES | Escherichia coli | Inhibition | = | 62.0 | % | PMID[510226] |
NPT21772 | PROTEIN COMPLEX | GroEL/GroES | Escherichia coli | Inhibition | = | 89.0 | % | PMID[510226] |
NPT20555 | ORGANISM | SARS-CoV-2 | Severe acute respiratory syndrome coronavirus 2 | IC50 | > | 20000.0 | nM | PMID[510229] |
NPT20555 | ORGANISM | SARS-CoV-2 | Severe acute respiratory syndrome coronavirus 2 | IC50 | > | 19952.62 | nM | PMID[510229] |
NPT2 | Others | Unspecified | IC50 | = | 19000.0 | nM | PMID[510230] | |
NPT2 | Others | Unspecified | Potency | n.a. | 4870.3 | nM | PubChem BioAssay data set | |
NPT2 | Others | Unspecified | Potency | n.a. | 38335.6 | nM | PubChem BioAssay data set | |
NPT2 | Others | Unspecified | Potency | n.a. | 217.5 | nM | PubChem BioAssay data set | |
NPT2 | Others | Unspecified | Potency | n.a. | 48702.7 | nM | PubChem BioAssay data set | |
NPT2 | Others | Unspecified | Potency | n.a. | 1090.3 | nM | PubChem BioAssay data set | |
NPT2 | Others | Unspecified | Potency | n.a. | 1526.2 | nM | PubChem BioAssay data set | |
NPT2 | Others | Unspecified | Potency | n.a. | 96294.6 | nM | PubChem BioAssay data set | |
NPT2 | Others | Unspecified | Potency | n.a. | 24188.1 | nM | PubChem BioAssay data set | |
NPT2 | Others | Unspecified | Potency | n.a. | 54150.4 | nM | PubChem BioAssay data set | |
NPT2 | Others | Unspecified | Potency | n.a. | 30451 | nM | PubChem BioAssay data set | |
NPT2 | Others | Unspecified | Potency | n.a. | 771.9 | nM | PubChem BioAssay data set | |
NPT2 | Others | Unspecified | Potency | n.a. | 171.2 | nM | PubChem BioAssay data set | |
NPT2 | Others | Unspecified | Potency | n.a. | 1540.1 | nM | PubChem BioAssay data set | |
NPT2 | Others | Unspecified | Potency | n.a. | 48261.6 | nM | PubChem BioAssay data set | |
NPT2 | Others | Unspecified | Potency | n.a. | 1938.9 | nM | PubChem BioAssay data set | |
NPT2 | Others | Unspecified | Potency | n.a. | 24409.2 | nM | PubChem BioAssay data set | |
NPT2 | Others | Unspecified | Potency | n.a. | 54.6 | nM | PubChem BioAssay data set | |
NPT2 | Others | Unspecified | Potency | n.a. | 60757.8 | nM | PubChem BioAssay data set | |
NPT2 | Others | Unspecified | Potency | n.a. | 76489.5 | nM | PubChem BioAssay data set | |
NPT74 | Individual Protein | Proto-oncogene c-JUN | Homo sapiens | Potency | n.a. | 30729.3 | nM | PubChem BioAssay data set |
NPT2 | Others | Unspecified | Potency | n.a. | 13602 | nM | PubChem BioAssay data set | |
NPT2 | Others | Unspecified | Potency | n.a. | 3447.9 | nM | PubChem BioAssay data set |
☑ Note for Activity Records:
☉ The quantitative biological activities were primarily integrated from ChEMBL (Version-30) database and were also directly collected from PubMed literature. PubMed PMID was provided as the reference link for each activity record.
Top-200 similar NPs were calculated against the active-NP-set (includes 4,3285 NPs with experimentally-derived bioactivity available in NPASS)
Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient
●  The left chart: Distribution of similarity level between NPC274443 and all remaining natural products in the NPASS database.
●  The right table: Most similar natural products (Tc>=0.56 or Top200).
Similarity Score | Similarity Level | Natural Product ID |
---|---|---|
0.9895 | High Similarity | NPC244427 |
0.9895 | High Similarity | NPC222390 |
0.9794 | High Similarity | NPC172483 |
0.9474 | High Similarity | NPC156021 |
0.9223 | High Similarity | NPC292834 |
0.901 | High Similarity | NPC134120 |
0.899 | High Similarity | NPC112552 |
0.8952 | High Similarity | NPC143768 |
0.8932 | High Similarity | NPC192577 |
0.8762 | High Similarity | NPC137315 |
0.8738 | High Similarity | NPC100767 |
0.8725 | High Similarity | NPC329282 |
0.8679 | High Similarity | NPC186128 |
0.8636 | High Similarity | NPC318173 |
0.8632 | High Similarity | NPC157778 |
0.8627 | High Similarity | NPC247976 |
0.8624 | High Similarity | NPC469843 |
0.8585 | High Similarity | NPC291799 |
0.8559 | High Similarity | NPC204784 |
0.8545 | High Similarity | NPC323440 |
0.8545 | High Similarity | NPC80605 |
0.8545 | High Similarity | NPC222968 |
0.8529 | High Similarity | NPC320891 |
0.8526 | High Similarity | NPC43945 |
0.8519 | High Similarity | NPC326664 |
0.8519 | High Similarity | NPC241851 |
0.8482 | Intermediate Similarity | NPC105709 |
0.8476 | Intermediate Similarity | NPC203732 |
0.8476 | Intermediate Similarity | NPC470391 |
0.8454 | Intermediate Similarity | NPC173413 |
0.844 | Intermediate Similarity | NPC470764 |
0.8411 | Intermediate Similarity | NPC474057 |
0.8367 | Intermediate Similarity | NPC284475 |
0.8367 | Intermediate Similarity | NPC110704 |
0.8283 | Intermediate Similarity | NPC155232 |
0.8283 | Intermediate Similarity | NPC1682 |
0.8283 | Intermediate Similarity | NPC188844 |
0.8269 | Intermediate Similarity | NPC329556 |
0.8261 | Intermediate Similarity | NPC65627 |
0.82 | Intermediate Similarity | NPC238219 |
0.82 | Intermediate Similarity | NPC34243 |
0.819 | Intermediate Similarity | NPC328107 |
0.819 | Intermediate Similarity | NPC318067 |
0.8182 | Intermediate Similarity | NPC67377 |
0.8182 | Intermediate Similarity | NPC133461 |
0.8182 | Intermediate Similarity | NPC471721 |
0.8182 | Intermediate Similarity | NPC196673 |
0.8165 | Intermediate Similarity | NPC218855 |
0.812 | Intermediate Similarity | NPC295664 |
0.8108 | Intermediate Similarity | NPC93181 |
0.8105 | Intermediate Similarity | NPC215008 |
0.81 | Intermediate Similarity | NPC153885 |
0.81 | Intermediate Similarity | NPC59677 |
0.8091 | Intermediate Similarity | NPC471481 |
0.8091 | Intermediate Similarity | NPC470253 |
0.8081 | Intermediate Similarity | NPC19256 |
0.8073 | Intermediate Similarity | NPC265513 |
0.8061 | Intermediate Similarity | NPC477704 |
0.8061 | Intermediate Similarity | NPC477693 |
0.8058 | Intermediate Similarity | NPC229242 |
0.8051 | Intermediate Similarity | NPC236405 |
0.8041 | Intermediate Similarity | NPC160339 |
0.8041 | Intermediate Similarity | NPC307 |
0.8037 | Intermediate Similarity | NPC83409 |
0.8037 | Intermediate Similarity | NPC185763 |
0.8037 | Intermediate Similarity | NPC37914 |
0.8036 | Intermediate Similarity | NPC62138 |
0.802 | Intermediate Similarity | NPC289883 |
0.8019 | Intermediate Similarity | NPC249067 |
0.8018 | Intermediate Similarity | NPC130591 |
0.8018 | Intermediate Similarity | NPC234637 |
0.8 | Intermediate Similarity | NPC25458 |
0.8 | Intermediate Similarity | NPC212415 |
0.8 | Intermediate Similarity | NPC476484 |
0.7983 | Intermediate Similarity | NPC81135 |
0.7983 | Intermediate Similarity | NPC231774 |
0.7966 | Intermediate Similarity | NPC310540 |
0.7965 | Intermediate Similarity | NPC158157 |
0.7963 | Intermediate Similarity | NPC112903 |
0.7941 | Intermediate Similarity | NPC260233 |
0.7928 | Intermediate Similarity | NPC13784 |
0.7928 | Intermediate Similarity | NPC93287 |
0.7925 | Intermediate Similarity | NPC255676 |
0.7913 | Intermediate Similarity | NPC476645 |
0.79 | Intermediate Similarity | NPC277277 |
0.789 | Intermediate Similarity | NPC318327 |
0.7885 | Intermediate Similarity | NPC145052 |
0.7885 | Intermediate Similarity | NPC134882 |
0.7885 | Intermediate Similarity | NPC49994 |
0.7885 | Intermediate Similarity | NPC75724 |
0.7879 | Intermediate Similarity | NPC267262 |
0.7864 | Intermediate Similarity | NPC12695 |
0.7857 | Intermediate Similarity | NPC477411 |
0.7857 | Intermediate Similarity | NPC196075 |
0.7845 | Intermediate Similarity | NPC206778 |
0.7845 | Intermediate Similarity | NPC285829 |
0.7838 | Intermediate Similarity | NPC66208 |
0.7833 | Intermediate Similarity | NPC15837 |
0.783 | Intermediate Similarity | NPC284477 |
0.783 | Intermediate Similarity | NPC304873 |
0.781 | Intermediate Similarity | NPC217621 |
0.781 | Intermediate Similarity | NPC54647 |
0.78 | Intermediate Similarity | NPC418308 |
0.7798 | Intermediate Similarity | NPC211439 |
0.7797 | Intermediate Similarity | NPC307174 |
0.7788 | Intermediate Similarity | NPC217111 |
0.7788 | Intermediate Similarity | NPC228936 |
0.7788 | Intermediate Similarity | NPC239185 |
0.7788 | Intermediate Similarity | NPC186933 |
0.7788 | Intermediate Similarity | NPC476357 |
0.7788 | Intermediate Similarity | NPC265220 |
0.7788 | Intermediate Similarity | NPC274839 |
0.7788 | Intermediate Similarity | NPC240042 |
0.7788 | Intermediate Similarity | NPC215419 |
0.7778 | Intermediate Similarity | NPC322387 |
0.7778 | Intermediate Similarity | NPC472981 |
0.7778 | Intermediate Similarity | NPC105899 |
0.7767 | Intermediate Similarity | NPC172925 |
0.7755 | Intermediate Similarity | NPC95965 |
0.775 | Intermediate Similarity | NPC123506 |
0.7748 | Intermediate Similarity | NPC210089 |
0.7736 | Intermediate Similarity | NPC109514 |
0.7736 | Intermediate Similarity | NPC476993 |
0.7736 | Intermediate Similarity | NPC282895 |
0.7724 | Intermediate Similarity | NPC27659 |
0.7723 | Intermediate Similarity | NPC67585 |
0.7723 | Intermediate Similarity | NPC274455 |
0.7723 | Intermediate Similarity | NPC303967 |
0.7723 | Intermediate Similarity | NPC110420 |
0.7723 | Intermediate Similarity | NPC70940 |
0.7723 | Intermediate Similarity | NPC86670 |
0.7719 | Intermediate Similarity | NPC226093 |
0.7719 | Intermediate Similarity | NPC135730 |
0.7712 | Intermediate Similarity | NPC120545 |
0.7708 | Intermediate Similarity | NPC145053 |
0.7705 | Intermediate Similarity | NPC237225 |
0.77 | Intermediate Similarity | NPC329064 |
0.7684 | Intermediate Similarity | NPC300205 |
0.7667 | Intermediate Similarity | NPC164014 |
0.7658 | Intermediate Similarity | NPC95172 |
0.7647 | Intermediate Similarity | NPC164947 |
0.7647 | Intermediate Similarity | NPC282577 |
0.7647 | Intermediate Similarity | NPC91478 |
0.7636 | Intermediate Similarity | NPC226699 |
0.7623 | Intermediate Similarity | NPC478162 |
0.7623 | Intermediate Similarity | NPC478165 |
0.7619 | Intermediate Similarity | NPC253423 |
0.7619 | Intermediate Similarity | NPC103048 |
0.7615 | Intermediate Similarity | NPC209632 |
0.7615 | Intermediate Similarity | NPC471186 |
0.7611 | Intermediate Similarity | NPC231717 |
0.7607 | Intermediate Similarity | NPC202015 |
0.7604 | Intermediate Similarity | NPC190567 |
0.7604 | Intermediate Similarity | NPC164086 |
0.76 | Intermediate Similarity | NPC69057 |
0.7596 | Intermediate Similarity | NPC472880 |
0.7586 | Intermediate Similarity | NPC471553 |
0.7583 | Intermediate Similarity | NPC135062 |
0.7581 | Intermediate Similarity | NPC198305 |
0.7579 | Intermediate Similarity | NPC36342 |
0.7579 | Intermediate Similarity | NPC285470 |
0.7579 | Intermediate Similarity | NPC2785 |
0.7573 | Intermediate Similarity | NPC323420 |
0.7568 | Intermediate Similarity | NPC85493 |
0.7563 | Intermediate Similarity | NPC167323 |
0.7563 | Intermediate Similarity | NPC269923 |
0.7551 | Intermediate Similarity | NPC285773 |
0.7551 | Intermediate Similarity | NPC273758 |
0.7547 | Intermediate Similarity | NPC329387 |
0.7547 | Intermediate Similarity | NPC317280 |
0.7545 | Intermediate Similarity | NPC6984 |
0.7544 | Intermediate Similarity | NPC242136 |
0.7544 | Intermediate Similarity | NPC11824 |
0.7542 | Intermediate Similarity | NPC232958 |
0.7541 | Intermediate Similarity | NPC51037 |
0.7541 | Intermediate Similarity | NPC1991 |
0.7541 | Intermediate Similarity | NPC306765 |
0.7541 | Intermediate Similarity | NPC3224 |
0.754 | Intermediate Similarity | NPC171968 |
0.7526 | Intermediate Similarity | NPC12936 |
0.7526 | Intermediate Similarity | NPC273033 |
0.7525 | Intermediate Similarity | NPC153308 |
0.7524 | Intermediate Similarity | NPC219573 |
0.7524 | Intermediate Similarity | NPC185208 |
0.7523 | Intermediate Similarity | NPC114594 |
0.7522 | Intermediate Similarity | NPC280789 |
0.7522 | Intermediate Similarity | NPC212718 |
0.7522 | Intermediate Similarity | NPC471189 |
0.7521 | Intermediate Similarity | NPC142956 |
0.752 | Intermediate Similarity | NPC205360 |
0.75 | Intermediate Similarity | NPC300274 |
0.75 | Intermediate Similarity | NPC171460 |
0.75 | Intermediate Similarity | NPC108288 |
0.75 | Intermediate Similarity | NPC471832 |
0.75 | Intermediate Similarity | NPC278928 |
0.748 | Intermediate Similarity | NPC324209 |
0.7479 | Intermediate Similarity | NPC144547 |
0.7478 | Intermediate Similarity | NPC306740 |
0.7478 | Intermediate Similarity | NPC474095 |
0.7477 | Intermediate Similarity | NPC141523 |
Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.
●  The left chart: Distribution of similarity level between NPC274443 and all drugs/candidates.
●  The right table: Most similar clinical/approved drugs (Tc>=0.56 or Top200).
Similarity Score | Similarity Level | Drug ID | Developmental Stage |
---|---|---|---|
0.8526 | High Similarity | NPD650 | Approved |
0.8367 | Intermediate Similarity | NPD7609 | Phase 3 |
0.8283 | Intermediate Similarity | NPD7631 | Approved |
0.8269 | Intermediate Similarity | NPD1931 | Clinical (unspecified phase) |
0.8269 | Intermediate Similarity | NPD1929 | Approved |
0.8269 | Intermediate Similarity | NPD1930 | Approved |
0.8246 | Intermediate Similarity | NPD4879 | Approved |
0.8155 | Intermediate Similarity | NPD2066 | Phase 3 |
0.8073 | Intermediate Similarity | NPD4141 | Clinical (unspecified phase) |
0.8019 | Intermediate Similarity | NPD1237 | Approved |
0.8 | Intermediate Similarity | NPD1609 | Clinical (unspecified phase) |
0.8 | Intermediate Similarity | NPD1932 | Approved |
0.7843 | Intermediate Similarity | NPD5122 | Clinical (unspecified phase) |
0.7788 | Intermediate Similarity | NPD3495 | Discontinued |
0.7767 | Intermediate Similarity | NPD1693 | Approved |
0.7767 | Intermediate Similarity | NPD688 | Clinical (unspecified phase) |
0.7727 | Intermediate Similarity | NPD6831 | Clinical (unspecified phase) |
0.7727 | Intermediate Similarity | NPD2329 | Discontinued |
0.7723 | Intermediate Similarity | NPD1086 | Approved |
0.7723 | Intermediate Similarity | NPD1089 | Approved |
0.7723 | Intermediate Similarity | NPD1090 | Approved |
0.7647 | Intermediate Similarity | NPD1239 | Approved |
0.7632 | Intermediate Similarity | NPD5951 | Approved |
0.7624 | Intermediate Similarity | NPD800 | Approved |
0.7573 | Intermediate Similarity | NPD1508 | Approved |
0.7573 | Intermediate Similarity | NPD1088 | Approved |
0.7551 | Intermediate Similarity | NPD9491 | Approved |
0.7526 | Intermediate Similarity | NPD942 | Approved |
0.75 | Intermediate Similarity | NPD4878 | Approved |
0.75 | Intermediate Similarity | NPD405 | Clinical (unspecified phase) |
0.7453 | Intermediate Similarity | NPD1565 | Approved |
0.7453 | Intermediate Similarity | NPD1564 | Approved |
0.7453 | Intermediate Similarity | NPD1566 | Phase 3 |
0.7426 | Intermediate Similarity | NPD1087 | Approved |
0.7395 | Intermediate Similarity | NPD7163 | Clinical (unspecified phase) |
0.7379 | Intermediate Similarity | NPD9256 | Approved |
0.7379 | Intermediate Similarity | NPD9258 | Approved |
0.7373 | Intermediate Similarity | NPD7009 | Phase 2 |
0.7364 | Intermediate Similarity | NPD164 | Approved |
0.7358 | Intermediate Similarity | NPD1843 | Approved |
0.7345 | Intermediate Similarity | NPD1317 | Discontinued |
0.7317 | Intermediate Similarity | NPD1470 | Approved |
0.7288 | Intermediate Similarity | NPD7610 | Discontinued |
0.7273 | Intermediate Similarity | NPD1201 | Approved |
0.725 | Intermediate Similarity | NPD3412 | Clinical (unspecified phase) |
0.7179 | Intermediate Similarity | NPD690 | Clinical (unspecified phase) |
0.7172 | Intermediate Similarity | NPD226 | Approved |
0.717 | Intermediate Similarity | NPD1563 | Approved |
0.717 | Intermediate Similarity | NPD1202 | Approved |
0.7167 | Intermediate Similarity | NPD4196 | Clinical (unspecified phase) |
0.7157 | Intermediate Similarity | NPD9259 | Approved |
0.7157 | Intermediate Similarity | NPD9257 | Approved |
0.7143 | Intermediate Similarity | NPD9490 | Approved |
0.713 | Intermediate Similarity | NPD2181 | Clinical (unspecified phase) |
0.7107 | Intermediate Similarity | NPD2345 | Approved |
0.7105 | Intermediate Similarity | NPD2182 | Approved |
0.7071 | Intermediate Similarity | NPD1507 | Clinical (unspecified phase) |
0.7064 | Intermediate Similarity | NPD9495 | Approved |
0.7037 | Intermediate Similarity | NPD1989 | Approved |
0.7034 | Intermediate Similarity | NPD1246 | Approved |
0.7025 | Intermediate Similarity | NPD1245 | Approved |
0.6967 | Remote Similarity | NPD2932 | Approved |
0.6952 | Remote Similarity | NPD5346 | Phase 2 |
0.6952 | Remote Similarity | NPD5347 | Phase 2 |
0.6923 | Remote Similarity | NPD4793 | Discontinued |
0.6923 | Remote Similarity | NPD506 | Clinical (unspecified phase) |
0.6911 | Remote Similarity | NPD7457 | Clinical (unspecified phase) |
0.6903 | Remote Similarity | NPD5909 | Discontinued |
0.688 | Remote Similarity | NPD182 | Clinical (unspecified phase) |
0.687 | Remote Similarity | NPD9265 | Clinical (unspecified phase) |
0.6869 | Remote Similarity | NPD227 | Approved |
0.6869 | Remote Similarity | NPD225 | Approved |
0.6847 | Remote Similarity | NPD1238 | Approved |
0.6846 | Remote Similarity | NPD7961 | Discontinued |
0.6842 | Remote Similarity | NPD1509 | Clinical (unspecified phase) |
0.6829 | Remote Similarity | NPD3019 | Approved |
0.6825 | Remote Similarity | NPD1876 | Approved |
0.6822 | Remote Similarity | NPD7008 | Discontinued |
0.6822 | Remote Similarity | NPD5952 | Clinical (unspecified phase) |
0.68 | Remote Similarity | NPD3972 | Approved |
0.6752 | Remote Similarity | NPD664 | Approved |
0.675 | Remote Similarity | NPD2629 | Approved |
0.6741 | Remote Similarity | NPD1471 | Phase 3 |
0.6724 | Remote Similarity | NPD9267 | Approved |
0.6724 | Remote Similarity | NPD9264 | Approved |
0.6724 | Remote Similarity | NPD9263 | Approved |
0.6723 | Remote Similarity | NPD7094 | Approved |
0.6723 | Remote Similarity | NPD6858 | Approved |
0.6696 | Remote Similarity | NPD1018 | Approved |
0.6667 | Remote Similarity | NPD6647 | Phase 2 |
0.6667 | Remote Similarity | NPD74 | Approved |
0.6667 | Remote Similarity | NPD9266 | Approved |
0.6667 | Remote Similarity | NPD1241 | Discontinued |
0.6667 | Remote Similarity | NPD9545 | Approved |
0.6641 | Remote Similarity | NPD1164 | Approved |
0.6639 | Remote Similarity | NPD9493 | Approved |
0.6639 | Remote Similarity | NPD9508 | Approved |
0.6636 | Remote Similarity | NPD9260 | Approved |
0.6619 | Remote Similarity | NPD3300 | Phase 2 |
0.6619 | Remote Similarity | NPD7236 | Approved |
0.6618 | Remote Similarity | NPD2346 | Discontinued |
0.6614 | Remote Similarity | NPD5157 | Phase 1 |
0.6614 | Remote Similarity | NPD5158 | Clinical (unspecified phase) |
0.6614 | Remote Similarity | NPD5159 | Phase 2 |
0.661 | Remote Similarity | NPD2067 | Discontinued |
0.6589 | Remote Similarity | NPD4980 | Approved |
0.6589 | Remote Similarity | NPD2798 | Approved |
0.6589 | Remote Similarity | NPD6007 | Clinical (unspecified phase) |
0.6583 | Remote Similarity | NPD5277 | Phase 2 |
0.6579 | Remote Similarity | NPD2193 | Phase 2 |
0.6579 | Remote Similarity | NPD2648 | Phase 3 |
0.6574 | Remote Similarity | NPD3673 | Approved |
0.6574 | Remote Similarity | NPD3672 | Approved |
0.6562 | Remote Similarity | NPD1283 | Approved |
0.6562 | Remote Similarity | NPD1574 | Approved |
0.6542 | Remote Similarity | NPD1101 | Approved |
0.6538 | Remote Similarity | NPD3971 | Phase 1 |
0.6522 | Remote Similarity | NPD9261 | Approved |
0.6515 | Remote Similarity | NPD3764 | Approved |
0.6512 | Remote Similarity | NPD1593 | Approved |
0.6508 | Remote Similarity | NPD3026 | Approved |
0.6508 | Remote Similarity | NPD3023 | Approved |
0.6491 | Remote Similarity | NPD3135 | Clinical (unspecified phase) |
0.648 | Remote Similarity | NPD3024 | Approved |
0.648 | Remote Similarity | NPD4102 | Approved |
0.648 | Remote Similarity | NPD3025 | Approved |
0.648 | Remote Similarity | NPD1651 | Approved |
0.648 | Remote Similarity | NPD4105 | Approved |
0.6471 | Remote Similarity | NPD651 | Clinical (unspecified phase) |
0.6471 | Remote Similarity | NPD3299 | Clinical (unspecified phase) |
0.646 | Remote Similarity | NPD253 | Approved |
0.6457 | Remote Similarity | NPD6287 | Discontinued |
0.6444 | Remote Similarity | NPD1607 | Approved |
0.6435 | Remote Similarity | NPD2196 | Discontinued |
0.6429 | Remote Similarity | NPD5206 | Clinical (unspecified phase) |
0.6429 | Remote Similarity | NPD5306 | Approved |
0.6429 | Remote Similarity | NPD5305 | Approved |
0.6423 | Remote Similarity | NPD5405 | Approved |
0.6423 | Remote Similarity | NPD5408 | Approved |
0.6423 | Remote Similarity | NPD5404 | Approved |
0.6423 | Remote Similarity | NPD3317 | Approved |
0.6423 | Remote Similarity | NPD5406 | Approved |
0.6418 | Remote Similarity | NPD1240 | Approved |
0.6396 | Remote Similarity | NPD719 | Approved |
0.6396 | Remote Similarity | NPD720 | Approved |
0.6396 | Remote Similarity | NPD845 | Approved |
0.6393 | Remote Similarity | NPD2650 | Approved |
0.6393 | Remote Similarity | NPD1280 | Clinical (unspecified phase) |
0.6393 | Remote Similarity | NPD2652 | Approved |
0.6393 | Remote Similarity | NPD6010 | Discontinued |
0.6391 | Remote Similarity | NPD2313 | Discontinued |
0.6389 | Remote Similarity | NPD7239 | Suspended |
0.6379 | Remote Similarity | NPD5700 | Clinical (unspecified phase) |
0.6378 | Remote Similarity | NPD4106 | Approved |
0.6378 | Remote Similarity | NPD4135 | Approved |
0.6378 | Remote Similarity | NPD4136 | Approved |
0.6377 | Remote Similarity | NPD2344 | Approved |
0.6377 | Remote Similarity | NPD2343 | Clinical (unspecified phase) |
0.6372 | Remote Similarity | NPD1099 | Approved |
0.6372 | Remote Similarity | NPD1100 | Approved |
0.6357 | Remote Similarity | NPD7003 | Approved |
0.6357 | Remote Similarity | NPD1755 | Approved |
0.635 | Remote Similarity | NPD2799 | Discontinued |
0.6345 | Remote Similarity | NPD3226 | Approved |
0.6341 | Remote Similarity | NPD9281 | Approved |
0.6339 | Remote Similarity | NPD6048 | Clinical (unspecified phase) |
0.6339 | Remote Similarity | NPD6049 | Phase 2 |
0.6328 | Remote Similarity | NPD4806 | Approved |
0.6328 | Remote Similarity | NPD4807 | Approved |
0.6328 | Remote Similarity | NPD518 | Clinical (unspecified phase) |
0.6328 | Remote Similarity | NPD1281 | Approved |
0.6328 | Remote Similarity | NPD1547 | Clinical (unspecified phase) |
0.6316 | Remote Similarity | NPD6966 | Discovery |
0.6306 | Remote Similarity | NPD752 | Approved |
0.6299 | Remote Similarity | NPD1362 | Clinical (unspecified phase) |
0.6296 | Remote Similarity | NPD943 | Approved |
0.6293 | Remote Similarity | NPD2171 | Approved |
0.6283 | Remote Similarity | NPD2860 | Approved |
0.6283 | Remote Similarity | NPD2859 | Approved |
0.6281 | Remote Similarity | NPD3642 | Approved |
0.6281 | Remote Similarity | NPD3644 | Approved |
0.6281 | Remote Similarity | NPD3643 | Approved |
0.6279 | Remote Similarity | NPD9717 | Approved |
0.6279 | Remote Similarity | NPD1608 | Approved |
0.6271 | Remote Similarity | NPD1677 | Discontinued |
0.6271 | Remote Similarity | NPD2197 | Approved |
0.6271 | Remote Similarity | NPD5048 | Discontinued |
0.6271 | Remote Similarity | NPD2192 | Approved |
0.6269 | Remote Similarity | NPD5422 | Clinical (unspecified phase) |
0.6262 | Remote Similarity | NPD5734 | Clinical (unspecified phase) |
0.6261 | Remote Similarity | NPD3020 | Approved |
0.6261 | Remote Similarity | NPD3097 | Clinical (unspecified phase) |
0.625 | Remote Similarity | NPD4695 | Discontinued |
0.625 | Remote Similarity | NPD1409 | Phase 3 |
0.6241 | Remote Similarity | NPD3750 | Approved |
0.6239 | Remote Similarity | NPD3357 | Discontinued |
0.6238 | Remote Similarity | NPD9716 | Approved |
0.6228 | Remote Similarity | NPD9566 | Approved |
0.6228 | Remote Similarity | NPD288 | Approved |
0.6224 | Remote Similarity | NPD8165 | Discontinued |
Bioactivity similarity was calculated based on bioactivity descriptors of compounds. The bioactivity descriptors were calculated by a recently developed AI algorithm Chemical Checker (CC) [Nature Biotechnology, 38:1087–1096, 2020; Nature Communications, 12:3932, 2021], which evaluated bioactivity similarities at five levels:
☉ A: chemistry similarity;
☉ B: biological targets similarity;
☉ C: networks similarity;
☉ D: cell-based bioactivity similarity;
☉ E: similarity based on clinical data.
Those 5 categories of CC bioactivity descriptors were calculated and then subjected to manifold projection using UMAP algorithm, to project all NPs on a 2-Dimensional space. The current NP was highlighted with a small circle in the 2-D map. Below figures: left-to-right, A-to-E.