Natural Product: NPC148163
Natural Product ID:   | NPC148163 |
Common Name*:   | Perillyl Alcohol |
IUPAC Name:   | [(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]methanol |
Synonyms:   | Perillyl Alcohol |
Standard InCHIKey:   | NDTYTMIUWGWIMO-SNVBAGLBSA-N |
Standard InCHI:   | InChI=1S/C10H16O/c1-8(2)10-5-3-9(7-11)4-6-10/h3,10-11H,1,4-7H2,2H3/t10-/m1/s1 |
SMILES:   | OCC1=CC[C@H](CC1)C(=C)C
|
Synthetic Gene Cluster:   |
n.a. |
ChEMBL Identifier:   |
CHEMBL236687 |
PubChem CID:   |
369312 |
Chemical Classification**:   |
-
CHEMONTID:0000000 [Organic compounds]
-
[CHEMONTID:0000012] Lipids and lipid-like molecules
-
[CHEMONTID:0000259] Prenol lipids
[CHEMONTID:0001549] Monoterpenoids[CHEMONTID:0001401] Menthane monoterpenoids
|
*Note: the InCHIKey will be temporarily assigned as the "Common Name" if no IUPAC name or alternative short name is available.
**Note: the Chemical Classification was calculated by NPClassifier Version 1.5. Reference: PMID:34662515.
  Species Source
Organism ID |
Organism Name |
Taxonomy Level |
Family |
SuperKingdom |
Isolation Part |
Collection Location |
Collection Time |
Reference |
NPO28276 |
Artemisia argyi |
Species |
Asteraceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
DOI[10.1016/j.jep.2005.01.054] |
NPO27288 |
Citrus maxima |
Species |
Rutaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
DOI[10.1016/S0031-9422(99)00119-3] |
NPO25443 |
Citrus reticulata |
Species |
Rutaceae |
Eukaryota |
n.a. |
fruit |
n.a. |
PMID[10606547] |
NPO6473.1 |
Perilla frutescens var. acuta |
Strain |
Lamiaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
PMID[10757731] |
NPO29463 |
Pogostemon cablin |
Species |
Lamiaceae |
Eukaryota |
n.a. |
leaf |
n.a. |
PMID[12575075] |
NPO29463 |
Pogostemon cablin |
Species |
Lamiaceae |
Eukaryota |
n.a. |
stem |
n.a. |
PMID[12575075] |
NPO29463 |
Pogostemon cablin |
Species |
Lamiaceae |
Eukaryota |
n.a. |
whole plant |
n.a. |
PMID[15577255] |
NPO25094 |
Artemisia princeps |
Species |
Asteraceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
PMID[17996677] |
NPO11100 |
Artemisia capillaris |
Species |
Asteraceae |
Eukaryota |
n.a. |
whole plant |
n.a. |
PMID[21428416] |
NPO8650 |
Perilla frutescens |
Species |
Lamiaceae |
Eukaryota |
leaves |
n.a. |
n.a. |
PMID[22272932] |
NPO11100 |
Artemisia capillaris |
Species |
Asteraceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
PMID[22870812] |
NPO11100 |
Artemisia capillaris |
Species |
Asteraceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
PMID[23435948] |
NPO2715 |
Murraya paniculata |
Species |
Rutaceae |
Eukaryota |
n.a. |
twig |
n.a. |
PMID[24354205] |
NPO2715 |
Murraya paniculata |
Species |
Rutaceae |
Eukaryota |
n.a. |
leaf |
n.a. |
PMID[24354205] |
NPO8650 |
Perilla frutescens |
Species |
Lamiaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
PMID[25320841] |
NPO11100 |
Artemisia capillaris |
Species |
Asteraceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
PMID[25737008] |
NPO29463 |
Pogostemon cablin |
Species |
Lamiaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
PMID[30188125] |
NPO28276 |
Artemisia argyi |
Species |
Asteraceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
PMID[31181920] |
NPO28276 |
Artemisia argyi |
Species |
Asteraceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
PMID[31418264] |
NPO21355 |
Elsholtzia ciliata |
Species |
Lamiaceae |
Eukaryota |
Aerial Parts |
n.a. |
n.a. |
PMID[32991171] |
NPO25443 |
Citrus reticulata |
Species |
Rutaceae |
Eukaryota |
|
n.a. |
n.a. |
Database[FooDB] |
NPO7698 |
Elettaria cardamomum |
Species |
Zingiberaceae |
Eukaryota |
Fruit |
n.a. |
n.a. |
Database[FooDB] |
NPO25443 |
Citrus reticulata |
Species |
Rutaceae |
Eukaryota |
Fruit |
n.a. |
n.a. |
Database[FooDB] |
NPO7698 |
Elettaria cardamomum |
Species |
Zingiberaceae |
Eukaryota |
Plant |
n.a. |
n.a. |
Database[FooDB] |
NPO7698 |
Elettaria cardamomum |
Species |
Zingiberaceae |
Eukaryota |
Seed |
n.a. |
n.a. |
Database[FooDB] |
NPO27288 |
Citrus maxima |
Species |
Rutaceae |
Eukaryota |
|
n.a. |
n.a. |
Database[FooDB] |
NPO7698 |
Elettaria cardamomum |
Species |
Zingiberaceae |
Eukaryota |
|
n.a. |
n.a. |
Database[FooDB] |
NPO25443 |
Citrus reticulata |
Species |
Rutaceae |
Eukaryota |
n.a. |
n.a. |
|
Database[FooDB] |
NPO7698 |
Elettaria cardamomum |
Species |
Zingiberaceae |
Eukaryota |
n.a. |
n.a. |
|
Database[FooDB] |
NPO2715 |
Murraya paniculata |
Species |
Rutaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[HerDing] |
NPO8650.2 |
Perilla frutescens var. crispa |
Varieties |
Lamiaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[HerDing] |
NPO8650 |
Perilla frutescens |
Species |
Lamiaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[HerDing] |
NPO25094 |
Artemisia princeps |
Species |
Asteraceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[HerDing] |
NPO6473.1 |
Perilla frutescens var. acuta |
Strain |
Lamiaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[HerDing] |
NPO18046 |
Mosla chinensis |
Species |
Lamiaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[HerDing] |
NPO10082 |
Citrus unshiu |
Species |
Rutaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[HerDing] |
NPO29463 |
Pogostemon cablin |
Species |
Lamiaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[HerDing] |
NPO11100 |
Artemisia capillaris |
Species |
Asteraceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[HerDing] |
NPO8650.1 |
Perilla frutescens var. arguta |
Varieties |
Lamiaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[HerDing] |
NPO25443 |
Citrus reticulata |
Species |
Rutaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[HerDing] |
NPO28276 |
Artemisia argyi |
Species |
Asteraceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[HerDing] |
NPO21355 |
Elsholtzia ciliata |
Species |
Lamiaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[HerDing] |
NPO25443 |
Citrus reticulata |
Species |
Rutaceae |
Eukaryota |
Fruits |
n.a. |
|
Database[Phenol-Explorer] |
NPO25443 |
Citrus reticulata |
Species |
Rutaceae |
Eukaryota |
n.a. |
n.a. |
|
Database[Phenol-Explorer] |
NPO27288 |
Citrus maxima |
Species |
Rutaceae |
Eukaryota |
n.a. |
n.a. |
|
Database[Phenol-Explorer] |
NPO7698 |
Elettaria cardamomum |
Species |
Zingiberaceae |
Eukaryota |
n.a. |
n.a. |
|
Database[Phenol-Explorer] |
NPO8650.1 |
Perilla frutescens var. arguta |
Varieties |
Lamiaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[TCMID] |
NPO25443 |
Citrus reticulata |
Species |
Rutaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[TCMID] |
NPO10082 |
Citrus unshiu |
Species |
Rutaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[TCMID] |
NPO28276 |
Artemisia argyi |
Species |
Asteraceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[TCMID] |
NPO18046 |
Mosla chinensis |
Species |
Lamiaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[TCMID] |
NPO6473.1 |
Perilla frutescens var. acuta |
Strain |
Lamiaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[TCMID] |
NPO27288 |
Citrus maxima |
Species |
Rutaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[TCMID] |
NPO29463 |
Pogostemon cablin |
Species |
Lamiaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[TCMID] |
NPO11100 |
Artemisia capillaris |
Species |
Asteraceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[TCMID] |
NPO21355 |
Elsholtzia ciliata |
Species |
Lamiaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[TCMID] |
NPO8650.2 |
Perilla frutescens var. crispa |
Varieties |
Lamiaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[TCMID] |
NPO25094 |
Artemisia princeps |
Species |
Asteraceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[TCMID] |
NPO2715 |
Murraya paniculata |
Species |
Rutaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[TCMID] |
NPO8650 |
Perilla frutescens |
Species |
Lamiaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[TCMID] |
NPO2715 |
Murraya paniculata |
Species |
Rutaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[TCM_Taiwan] |
NPO18046 |
Mosla chinensis |
Species |
Lamiaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[TCM_Taiwan] |
NPO11100 |
Artemisia capillaris |
Species |
Asteraceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[TCM_Taiwan] |
NPO28276 |
Artemisia argyi |
Species |
Asteraceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[TCM_Taiwan] |
NPO21355 |
Elsholtzia ciliata |
Species |
Lamiaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[TCM_Taiwan] |
NPO8650 |
Perilla frutescens |
Species |
Lamiaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[TCM_Taiwan] |
NPO25443 |
Citrus reticulata |
Species |
Rutaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[TCM_Taiwan] |
NPO10082 |
Citrus unshiu |
Species |
Rutaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[TCM_Taiwan] |
NPO29463 |
Pogostemon cablin |
Species |
Lamiaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[TCM_Taiwan] |
NPO18046 |
Mosla chinensis |
Species |
Lamiaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[TM-MC] |
NPO10492 |
Artemisia montana |
Species |
Asteraceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[TM-MC] |
NPO8650 |
Perilla frutescens |
Species |
Lamiaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[TM-MC] |
NPO2715 |
Murraya paniculata |
Species |
Rutaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[TM-MC] |
NPO10082 |
Citrus unshiu |
Species |
Rutaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[TM-MC] |
NPO21355 |
Elsholtzia ciliata |
Species |
Lamiaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[TM-MC] |
NPO11100 |
Artemisia capillaris |
Species |
Asteraceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[TM-MC] |
NPO29463 |
Pogostemon cablin |
Species |
Lamiaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[TM-MC] |
NPO7698 |
Elettaria cardamomum |
Species |
Zingiberaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[TM-MC] |
NPO28276 |
Artemisia argyi |
Species |
Asteraceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[TM-MC] |
NPO27288 |
Citrus maxima |
Species |
Rutaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[TM-MC] |
NPO25443 |
Citrus reticulata |
Species |
Rutaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[TM-MC] |
NPO25094 |
Artemisia princeps |
Species |
Asteraceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[TM-MC] |
NPO8650 |
Perilla frutescens |
Species |
Lamiaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[UNPD] |
NPO25094 |
Artemisia princeps |
Species |
Asteraceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[UNPD] |
NPO21355 |
Elsholtzia ciliata |
Species |
Lamiaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[UNPD] |
NPO7698 |
Elettaria cardamomum |
Species |
Zingiberaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[UNPD] |
NPO10082 |
Citrus unshiu |
Species |
Rutaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[UNPD] |
NPO10492 |
Artemisia montana |
Species |
Asteraceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[UNPD] |
NPO8650.1 |
Perilla frutescens var. arguta |
Varieties |
Lamiaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[UNPD] |
NPO11100 |
Artemisia capillaris |
Species |
Asteraceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[UNPD] |
NPO2715 |
Murraya paniculata |
Species |
Rutaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[UNPD] |
NPO27288 |
Citrus maxima |
Species |
Rutaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[UNPD] |
NPO28276 |
Artemisia argyi |
Species |
Asteraceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[UNPD] |
NPO29463 |
Pogostemon cablin |
Species |
Lamiaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[UNPD] |
NPO18046 |
Mosla chinensis |
Species |
Lamiaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[UNPD] |
NPO25443 |
Citrus reticulata |
Species |
Rutaceae |
Eukaryota |
n.a. |
n.a. |
n.a. |
Database[UNPD] |
☑ Note for Reference:
In addition to directly collecting NP source organism data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated them from below databases:
☉ UNPD: Universal Natural Products Database [PMID: 23638153].
☉ StreptomeDB: a database of streptomycetes natural products [PMID: 33051671].
☉ TM-MC: a database of medicinal materials and chemical compounds in Northeast Asian traditional medicine [PMID: 26156871].
☉ TCM@Taiwan: a Traditional Chinese Medicine database [PMID: 21253603].
☉ TCMID: a Traditional Chinese Medicine database [PMID: 29106634].
☉ TCMSP: The traditional Chinese medicine systems pharmacology database and analysis platform [PMID: 24735618].
☉ HerDing: a herb recommendation system to treat diseases using genes and chemicals [PMID: 26980517].
☉ MetaboLights: a metabolomics database [PMID: 27010336].
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].
  NP Quantity Composition/Concentration
Organism ID |
NP ID |
Organism Material Preparation |
Organism Part |
NP Quantity (Standard) |
NP Quantity (Minimum) |
NP Quantity (Maximum) |
Quantity Unit |
Reference |
☑ Note for Reference:
In addition to directly collecting NP quantitative data from primary literature (where reference will provided as NCBI PMID or DOI links), NPASS also integrated NP quantitative records for specific NP domains (e.g., NPS from foods or herbs) from domain-specific databases. These databases include:
☉ DUKE: Dr. Duke's Phytochemical and Ethnobotanical Databases.
☉ PHENOL EXPLORER: is the first comprehensive database on polyphenol content in foods [PMID: 24103452], its homepage can be accessed at here.
☉ FooDB: a database of constituents, chemistry and biology of food species [www.foodb.ca].
  Biological Activity
Activity Type |
# Activity |
GI50 |
68 |
IC50 |
9 |
MIC |
2 |
Others |
9 |
Potency |
4 |
Activity Type |
# Activity |
Cell Line |
74 |
Individual Protein |
6 |
LIPID |
1 |
NON-MOLECULAR |
3 |
Organism |
6 |
Others |
1 |
SINGLE PROTEIN |
1 |
Target ID |
Target Type |
Target Name |
Target Organism |
Activity Type |
Activity Relation |
Value |
Unit |
Reference |
NPT306 |
Cell Line |
PC-3 |
Homo sapiens |
Activity |
= |
10.0 |
% |
PMID[512265] |
NPT368 |
Cell Line |
SN12C |
Homo sapiens |
GI50 |
n.a. |
554625.71 |
nM |
PMID[512266] |
NPT367 |
Cell Line |
MDA-N |
Homo sapiens |
GI50 |
n.a. |
10000.0 |
nM |
PMID[512266] |
NPT369 |
Cell Line |
ACHN |
Homo sapiens |
GI50 |
n.a. |
120503.59 |
nM |
PMID[512266] |
NPT370 |
Cell Line |
NCI-H23 |
Homo sapiens |
GI50 |
n.a. |
464515.28 |
nM |
PMID[512266] |
NPT371 |
Cell Line |
UO-31 |
Homo sapiens |
GI50 |
n.a. |
410204.1 |
nM |
PMID[512266] |
NPT372 |
Cell Line |
HOP-92 |
Homo sapiens |
GI50 |
n.a. |
117489.76 |
nM |
PMID[512266] |
NPT116 |
Cell Line |
HL-60 |
Homo sapiens |
GI50 |
n.a. |
50118.72 |
nM |
PMID[512266] |
NPT90 |
Cell Line |
DU-145 |
Homo sapiens |
GI50 |
n.a. |
10000.0 |
nM |
PMID[512266] |
NPT373 |
Cell Line |
SK-MEL-5 |
Homo sapiens |
GI50 |
n.a. |
110407.86 |
nM |
PMID[512266] |
NPT374 |
Cell Line |
SF-539 |
Homo sapiens |
GI50 |
n.a. |
501187.23 |
nM |
PMID[512266] |
NPT375 |
Cell Line |
Malme-3M |
Homo sapiens |
GI50 |
n.a. |
324339.62 |
nM |
PMID[512266] |
NPT111 |
Cell Line |
K562 |
Homo sapiens |
GI50 |
n.a. |
30478.95 |
nM |
PMID[512266] |
NPT376 |
Cell Line |
A498 |
Homo sapiens |
GI50 |
n.a. |
548276.96 |
nM |
PMID[512266] |
NPT377 |
Cell Line |
OVCAR-3 |
Homo sapiens |
GI50 |
n.a. |
149623.57 |
nM |
PMID[512266] |
NPT112 |
Cell Line |
MOLT-4 |
Homo sapiens |
GI50 |
n.a. |
72276.98 |
nM |
PMID[512266] |
NPT378 |
Cell Line |
NCI/ADR-RES |
Homo sapiens |
GI50 |
n.a. |
10000.0 |
nM |
PMID[512266] |
NPT379 |
Cell Line |
HOP-62 |
Homo sapiens |
GI50 |
n.a. |
184077.2 |
nM |
PMID[512266] |
NPT381 |
Cell Line |
OVCAR-8 |
Homo sapiens |
GI50 |
n.a. |
145211.16 |
nM |
PMID[512266] |
NPT380 |
Cell Line |
U-251 |
Homo sapiens |
GI50 |
n.a. |
124738.35 |
nM |
PMID[512266] |
NPT382 |
Cell Line |
OVCAR-5 |
Homo sapiens |
GI50 |
n.a. |
169433.78 |
nM |
PMID[512266] |
NPT82 |
Cell Line |
MDA-MB-231 |
Homo sapiens |
GI50 |
n.a. |
10000.0 |
nM |
PMID[512266] |
NPT383 |
Cell Line |
SNB-19 |
Homo sapiens |
GI50 |
n.a. |
347536.16 |
nM |
PMID[512266] |
NPT385 |
Cell Line |
SR |
Homo sapiens |
GI50 |
n.a. |
151705.04 |
nM |
PMID[512266] |
NPT384 |
Cell Line |
TK-10 |
Homo sapiens |
GI50 |
n.a. |
324339.62 |
nM |
PMID[512266] |
NPT573 |
Cell Line |
M19-MEL |
Homo sapiens |
GI50 |
n.a. |
182389.57 |
nM |
PMID[512266] |
NPT323 |
Cell Line |
SW-620 |
Homo sapiens |
GI50 |
n.a. |
636795.52 |
nM |
PMID[512266] |
NPT386 |
Cell Line |
KM12 |
Homo sapiens |
GI50 |
n.a. |
315500.46 |
nM |
PMID[512266] |
NPT455 |
Cell Line |
NCI-H522 |
Homo sapiens |
GI50 |
n.a. |
344349.93 |
nM |
PMID[512266] |
NPT387 |
Cell Line |
M14 |
Homo sapiens |
GI50 |
n.a. |
709577.77 |
nM |
PMID[512266] |
NPT574 |
Cell Line |
XF498 |
Homo sapiens |
GI50 |
n.a. |
123310.48 |
nM |
PMID[512266] |
NPT388 |
Cell Line |
NCI-H322M |
Homo sapiens |
GI50 |
n.a. |
292415.24 |
nM |
PMID[512266] |
NPT389 |
Cell Line |
RPMI-8226 |
Homo sapiens |
GI50 |
n.a. |
10000.0 |
nM |
PMID[512266] |
NPT456 |
Cell Line |
OVCAR-4 |
Homo sapiens |
GI50 |
n.a. |
515228.64 |
nM |
PMID[512266] |
NPT390 |
Cell Line |
LOX IMVI |
Homo sapiens |
GI50 |
n.a. |
194984.46 |
nM |
PMID[512266] |
NPT457 |
Cell Line |
BT-549 |
Homo sapiens |
GI50 |
n.a. |
10000.0 |
nM |
PMID[512266] |
NPT147 |
Cell Line |
SK-MEL-2 |
Homo sapiens |
GI50 |
n.a. |
121898.96 |
nM |
PMID[512266] |
NPT575 |
Cell Line |
KM-20L2 |
Homo sapiens |
GI50 |
n.a. |
264850.01 |
nM |
PMID[512266] |
NPT391 |
Cell Line |
HCC 2998 |
Homo sapiens |
GI50 |
n.a. |
753355.56 |
nM |
PMID[512266] |
NPT81 |
Cell Line |
A549 |
Homo sapiens |
GI50 |
n.a. |
126182.75 |
nM |
PMID[512266] |
NPT392 |
Cell Line |
SNB-75 |
Homo sapiens |
GI50 |
n.a. |
55975.76 |
nM |
PMID[512266] |
NPT393 |
Cell Line |
HCT-116 |
Homo sapiens |
GI50 |
n.a. |
96161.23 |
nM |
PMID[512266] |
NPT148 |
Cell Line |
HCT-15 |
Homo sapiens |
GI50 |
n.a. |
166724.72 |
nM |
PMID[512266] |
NPT394 |
Cell Line |
EKVX |
Homo sapiens |
GI50 |
n.a. |
616595.0 |
nM |
PMID[512266] |
NPT395 |
Cell Line |
SF-268 |
Homo sapiens |
GI50 |
n.a. |
84139.51 |
nM |
PMID[512266] |
NPT306 |
Cell Line |
PC-3 |
Homo sapiens |
GI50 |
n.a. |
10000.0 |
nM |
PMID[512266] |
NPT83 |
Cell Line |
MCF7 |
Homo sapiens |
GI50 |
n.a. |
10000.0 |
nM |
PMID[512266] |
NPT576 |
Cell Line |
DMS-114 |
Homo sapiens |
GI50 |
n.a. |
123594.74 |
nM |
PMID[512266] |
NPT731 |
Cell Line |
LXFL 529 |
Homo sapiens |
GI50 |
n.a. |
668343.92 |
nM |
PMID[512266] |
NPT146 |
Cell Line |
SK-OV-3 |
Homo sapiens |
GI50 |
n.a. |
748169.5 |
nM |
PMID[512266] |
NPT397 |
Cell Line |
NCI-H460 |
Homo sapiens |
GI50 |
n.a. |
453941.62 |
nM |
PMID[512266] |
NPT396 |
Cell Line |
T47D |
Homo sapiens |
GI50 |
n.a. |
10000.0 |
nM |
PMID[512266] |
NPT398 |
Cell Line |
UACC-62 |
Homo sapiens |
GI50 |
n.a. |
235504.93 |
nM |
PMID[512266] |
NPT308 |
Cell Line |
CAKI-1 |
Homo sapiens |
GI50 |
n.a. |
10000.0 |
nM |
PMID[512266] |
NPT399 |
Cell Line |
SF-295 |
Homo sapiens |
GI50 |
n.a. |
266072.51 |
nM |
PMID[512266] |
NPT400 |
Cell Line |
MDA-MB-435 |
Homo sapiens |
GI50 |
n.a. |
10000.0 |
nM |
PMID[512266] |
NPT458 |
Cell Line |
IGROV-1 |
Homo sapiens |
GI50 |
n.a. |
574116.46 |
nM |
PMID[512266] |
NPT401 |
Cell Line |
786-0 |
Homo sapiens |
GI50 |
n.a. |
194984.46 |
nM |
PMID[512266] |
NPT402 |
Cell Line |
Hs-578T |
Homo sapiens |
GI50 |
n.a. |
10000.0 |
nM |
PMID[512266] |
NPT577 |
Cell Line |
RXF 631 |
Homo sapiens |
GI50 |
n.a. |
564936.97 |
nM |
PMID[512266] |
NPT578 |
Cell Line |
SNB-78 |
Homo sapiens |
GI50 |
n.a. |
199526.23 |
nM |
PMID[512266] |
NPT403 |
Cell Line |
UACC-257 |
Homo sapiens |
GI50 |
n.a. |
533334.9 |
nM |
PMID[512266] |
NPT404 |
Cell Line |
CCRF-CEM |
Homo sapiens |
GI50 |
n.a. |
101157.95 |
nM |
PMID[512266] |
NPT579 |
Cell Line |
DLD-1 |
Homo sapiens |
GI50 |
n.a. |
220292.65 |
nM |
PMID[512266] |
NPT139 |
Cell Line |
HT-29 |
Homo sapiens |
GI50 |
n.a. |
135831.34 |
nM |
PMID[512266] |
NPT405 |
Cell Line |
NCI-H226 |
Homo sapiens |
GI50 |
n.a. |
250610.93 |
nM |
PMID[512266] |
NPT406 |
Cell Line |
RXF 393 |
Homo sapiens |
GI50 |
n.a. |
93756.2 |
nM |
PMID[512266] |
NPT170 |
Cell Line |
SK-MEL-28 |
Homo sapiens |
GI50 |
n.a. |
200909.28 |
nM |
PMID[512266] |
NPT407 |
Cell Line |
COLO 205 |
Homo sapiens |
GI50 |
n.a. |
198609.49 |
nM |
PMID[512266] |
NPT10 |
Individual Protein |
Geminin |
Homo sapiens |
Potency |
n.a. |
163.6 |
nM |
PMID[512268] |
NPT10 |
Individual Protein |
Geminin |
Homo sapiens |
Potency |
n.a. |
3264.3 |
nM |
PMID[512268] |
NPT160 |
Individual Protein |
TAR DNA-binding protein 43 |
Homo sapiens |
Potency |
n.a. |
31622.8 |
nM |
PMID[512268] |
NPT170 |
Cell Line |
SK-MEL-28 |
Homo sapiens |
IC50 |
> |
1000000.0 |
nM |
PMID[512269] |
NPT306 |
Cell Line |
PC-3 |
Homo sapiens |
IC50 |
> |
1000000.0 |
nM |
PMID[512269] |
NPT81 |
Cell Line |
A549 |
Homo sapiens |
IC50 |
> |
1000000.0 |
nM |
PMID[512269] |
NPT83 |
Cell Line |
MCF7 |
Homo sapiens |
IC50 |
> |
1000000.0 |
nM |
PMID[512269] |
NPT81 |
Cell Line |
A549 |
Homo sapiens |
IC50 |
= |
350000.0 |
nM |
PMID[512271] |
NPT6 |
Organism |
Plasmodium falciparum |
Plasmodium falciparum |
IC50 |
= |
184000.0 |
nM |
PMID[512264] |
NPT20 |
Organism |
Candida albicans |
Candida albicans |
MIC |
> |
200.0 |
ug.mL-1 |
PMID[512264] |
NPT35 |
Others |
n.a. |
|
Ko |
= |
305.0 |
/M |
PMID[512267] |
NPT21750 |
LIPID |
Lipid bilayer |
n.a. |
T |
= |
19.4 |
degrees C |
PMID[512267] |
NPT20529 |
NON-MOLECULAR |
NON-PROTEIN TARGET |
n.a. |
IC50 |
> |
1000000.0 |
nM |
PMID[512269] |
NPT73 |
Individual Protein |
Solute carrier organic anion transporter family member 1B1 |
Homo sapiens |
Inhibition |
= |
84.39 |
% |
PMID[512270] |
NPT72 |
Individual Protein |
Solute carrier organic anion transporter family member 1B3 |
Homo sapiens |
Inhibition |
= |
91.29 |
% |
PMID[512270] |
NPT831 |
Individual Protein |
Serine/threonine-protein kinase PLK1 |
Homo sapiens |
Potency |
n.a. |
23778.1 |
nM |
PMID[512268] |
NPT20529 |
NON-MOLECULAR |
NON-PROTEIN TARGET |
n.a. |
IC50 |
= |
380000.0 |
nM |
PMID[512271] |
NPT20555 |
ORGANISM |
SARS-CoV-2 |
Severe acute respiratory syndrome coronavirus 2 |
Inhibition |
= |
-9.64 |
% |
PMID[512272] |
NPT20556 |
SINGLE PROTEIN |
Replicase polyprotein 1ab |
Severe acute respiratory syndrome coronavirus 2 |
Inhibition |
= |
-0.4844 |
% |
PMID[512273] |
NPT20555 |
ORGANISM |
SARS-CoV-2 |
Severe acute respiratory syndrome coronavirus 2 |
Inhibition |
= |
0.28 |
% |
PMID[512274] |
☑ Note for Activity Records:
☉ The quantitative biological activities were primarily integrated from ChEMBL (Version-30) database and were also directly collected from PubMed literature. PubMed PMID was provided as the reference link for each activity record.
  Chemically structural similarity: I. Similar Active Natural Products in NPASS
Top-200 similar NPs were calculated against the active-NP-set (includes 4,3285 NPs with experimentally-derived bioactivity available in NPASS)
Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient
●  The left chart: Distribution of similarity level between NPC148163 and all remaining natural products in the NPASS database.
●  The right table: Most similar natural products (Tc>=0.56 or Top200).
range |
Tanimoto Coefficient |
0-0.1 | 134 |
0.1-0.2 | 2362 |
0.2-0.3 | 13573 |
0.3-0.4 | 15084 |
0.4-0.5 | 7616 |
0.5-0.6 | 3149 |
0.6-0.7 | 624 |
0.7-0.8 | 130 |
0.8-0.85 | 17 |
0.85-0.9 | 4 |
0.9-0.95 | 1 |
0.95-1 | 3 |
  Chemically structural similarity: II. Similar Clinical/Approved Drugs
Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.
●  The left chart: Distribution of similarity level between NPC148163 and all drugs/candidates.
●  The right table: Most similar clinical/approved drugs (Tc>=0.56 or Top200).
range |
Tanimoto Coefficient |
0-0.1 | 144 |
0.1-0.2 | 2762 |
0.2-0.3 | 4047 |
0.3-0.4 | 1689 |
0.4-0.5 | 368 |
0.5-0.6 | 130 |
0.6-0.7 | 5 |
0.7-0.8 | 3 |
0.8-0.85 | 1 |
0.85-0.9 | 0 |
0.9-0.95 | 0 |
0.95-1 | 1 |
Similarity Score |
Similarity Level |
Drug ID |
Developmental Stage |
1.0 |
High Similarity |
NPD342 |
Phase 1 |
0.8305 |
Intermediate Similarity |
NPD368 |
Approved |
0.7222 |
Intermediate Similarity |
NPD4265 |
Approved |
0.7167 |
Intermediate Similarity |
NPD4219 |
Approved |
0.6667 |
Remote Similarity |
NPD8264 |
Approved |
0.6667 |
Remote Similarity |
NPD319 |
Phase 1 |
0.6667 |
Remote Similarity |
NPD6942 |
Approved |
0.6667 |
Remote Similarity |
NPD7339 |
Approved |
0.6575 |
Remote Similarity |
NPD3701 |
Clinical (unspecified phase) |
0.6389 |
Remote Similarity |
NPD4732 |
Discontinued |
0.6316 |
Remote Similarity |
NPD7645 |
Phase 2 |
0.6316 |
Remote Similarity |
NPD6929 |
Approved |
0.6301 |
Remote Similarity |
NPD6926 |
Approved |
0.6301 |
Remote Similarity |
NPD6924 |
Approved |
0.6296 |
Remote Similarity |
NPD4751 |
Clinical (unspecified phase) |
0.625 |
Remote Similarity |
NPD4243 |
Approved |
0.6234 |
Remote Similarity |
NPD6931 |
Approved |
0.6234 |
Remote Similarity |
NPD6930 |
Phase 2 |
0.6197 |
Remote Similarity |
NPD6922 |
Approved |
0.6197 |
Remote Similarity |
NPD6923 |
Approved |
0.6184 |
Remote Similarity |
NPD7322 |
Clinical (unspecified phase) |
0.6133 |
Remote Similarity |
NPD6933 |
Approved |
0.6111 |
Remote Similarity |
NPD7143 |
Approved |
0.6111 |
Remote Similarity |
NPD7144 |
Approved |
0.6081 |
Remote Similarity |
NPD4785 |
Approved |
0.6081 |
Remote Similarity |
NPD4784 |
Approved |
0.6076 |
Remote Similarity |
NPD3667 |
Approved |
0.6053 |
Remote Similarity |
NPD6925 |
Approved |
0.6053 |
Remote Similarity |
NPD5776 |
Phase 2 |
0.6027 |
Remote Similarity |
NPD7152 |
Approved |
0.6027 |
Remote Similarity |
NPD7150 |
Approved |
0.6027 |
Remote Similarity |
NPD7151 |
Approved |
0.6026 |
Remote Similarity |
NPD7332 |
Phase 2 |
0.6026 |
Remote Similarity |
NPD7514 |
Phase 3 |
0.6026 |
Remote Similarity |
NPD7525 |
Registered |
0.6 |
Remote Similarity |
NPD5275 |
Approved |
0.6 |
Remote Similarity |
NPD7331 |
Phase 2 |
0.6 |
Remote Similarity |
NPD4190 |
Phase 3 |
0.6 |
Remote Similarity |
NPD6695 |
Phase 3 |
0.5974 |
Remote Similarity |
NPD4268 |
Approved |
0.5974 |
Remote Similarity |
NPD4271 |
Approved |
0.5974 |
Remote Similarity |
NPD7145 |
Approved |
0.597 |
Remote Similarity |
NPD4246 |
Clinical (unspecified phase) |
0.5949 |
Remote Similarity |
NPD6902 |
Approved |
0.5932 |
Remote Similarity |
NPD384 |
Approved |
0.5932 |
Remote Similarity |
NPD385 |
Approved |
0.5926 |
Remote Similarity |
NPD7338 |
Clinical (unspecified phase) |
0.5926 |
Remote Similarity |
NPD3665 |
Phase 1 |
0.5926 |
Remote Similarity |
NPD4786 |
Approved |
0.5926 |
Remote Similarity |
NPD3666 |
Approved |
0.5926 |
Remote Similarity |
NPD3133 |
Approved |
0.5882 |
Remote Similarity |
NPD4191 |
Approved |
0.5882 |
Remote Similarity |
NPD4193 |
Approved |
0.5882 |
Remote Similarity |
NPD4194 |
Approved |
0.5882 |
Remote Similarity |
NPD4192 |
Approved |
0.5857 |
Remote Similarity |
NPD7341 |
Phase 2 |
0.5854 |
Remote Similarity |
NPD6893 |
Approved |
0.5854 |
Remote Similarity |
NPD1696 |
Phase 3 |
0.5823 |
Remote Similarity |
NPD4819 |
Approved |
0.5823 |
Remote Similarity |
NPD4821 |
Approved |
0.5823 |
Remote Similarity |
NPD5790 |
Clinical (unspecified phase) |
0.5823 |
Remote Similarity |
NPD7509 |
Discontinued |
0.5823 |
Remote Similarity |
NPD4820 |
Approved |
0.5823 |
Remote Similarity |
NPD4822 |
Approved |
0.5802 |
Remote Similarity |
NPD5332 |
Approved |
0.5802 |
Remote Similarity |
NPD7154 |
Phase 3 |
0.5802 |
Remote Similarity |
NPD5362 |
Discontinued |
0.5802 |
Remote Similarity |
NPD5331 |
Approved |
0.5802 |
Remote Similarity |
NPD6110 |
Phase 1 |
0.5783 |
Remote Similarity |
NPD3618 |
Phase 1 |
0.5783 |
Remote Similarity |
NPD4623 |
Approved |
0.5783 |
Remote Similarity |
NPD4519 |
Discontinued |
0.5769 |
Remote Similarity |
NPD5784 |
Clinical (unspecified phase) |
0.5753 |
Remote Similarity |
NPD791 |
Approved |
0.5753 |
Remote Similarity |
NPD15 |
Approved |
0.575 |
Remote Similarity |
NPD6898 |
Phase 1 |
0.575 |
Remote Similarity |
NPD4790 |
Discontinued |
0.5747 |
Remote Similarity |
NPD5779 |
Approved |
0.5747 |
Remote Similarity |
NPD5778 |
Approved |
0.5738 |
Remote Similarity |
NPD9410 |
Clinical (unspecified phase) |
0.5735 |
Remote Similarity |
NPD1145 |
Discontinued |
0.5714 |
Remote Similarity |
NPD7750 |
Discontinued |
0.5714 |
Remote Similarity |
NPD7524 |
Approved |
0.5714 |
Remote Similarity |
NPD1346 |
Approved |
0.5696 |
Remote Similarity |
NPD4195 |
Approved |
0.5679 |
Remote Similarity |
NPD4270 |
Approved |
0.5679 |
Remote Similarity |
NPD4269 |
Approved |
0.5641 |
Remote Similarity |
NPD9294 |
Approved |
0.5641 |
Remote Similarity |
NPD6932 |
Approved |
0.5634 |
Remote Similarity |
NPD2685 |
Clinical (unspecified phase) |
0.5625 |
Remote Similarity |
NPD4748 |
Discontinued |
0.5625
|
Remote Similarity |
NPD4252 |
Approved |