Drug Information| Drug ID: | NPD9664 |
| Drug Name: | Meprobamate |
| Molecular Formula: | C9H18N2O4 |
| Canonical SMILES: | CCCC(COC(=N)O)(COC(=N)O)C |
| Standard InCHI: | InChI=1S/C9H18N2O4/c1-3-4-9(2,5-14-7(10)12)6-15-8(11)13/h3-6H2,1-2H3,(H2,10,12)(H2,11,13) |
| Standard InCHIKey: | NPPQSCRMBWNHMW-UHFFFAOYSA-N |
| Max Developmental Stage: | Approved |
| Max Developmental Stage Source: | TTD; ChEMBL; IUPHAR/BPS |
Structural Similarity Between NPASS Natural Products and NPD9664Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient 
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
Similar Natural Products High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.5932 | NPC471129 |
| Remote Similarity | 0.5918 | NPC325102 |
| Remote Similarity | 0.5897 | NPC51414 |
| Remote Similarity | 0.5652 | NPC61665 |
| Molecular Weight | 218.13 |
| ALogP | 1.0595 |
| MLogP | 1.79 |
| XLogP | 2.972 |
| HDA | 6 |
| HBD | 4 |
| Rotatable Bonds | 12 |
| TPSA | 106.62 |
| RO5 Violation | 0 |