Drug Information| Drug ID: | NPD9643 |
| Drug Name: | Minoxidil |
| Molecular Formula: | C9H15N5O |
| Canonical SMILES: | Nc1cc([nH]c(=N)n1=O)N1CCCCC1 |
| Standard InCHI: | InChI=1S/C9H15N5O/c10-7-6-8(12-9(11)14(7)15)13-4-2-1-3-5-13/h6H,1-5,10H2,(H2,11,12) |
| Standard InCHIKey: | ZFMITUMMTDLWHR-UHFFFAOYSA-N |
| Max Developmental Stage: | Approved |
| Max Developmental Stage Source: | ChEMBL; IUPHAR/BPS |
Structural Similarity Between NPASS Natural Products and NPD9643Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient 
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
Similar Natural Products High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.6562 | NPC230087 |
| Remote Similarity | 0.597 | NPC212436 |
| Remote Similarity | 0.5904 | NPC293799 |
| Molecular Weight | 209.13 |
| ALogP | -1.5615 |
| MLogP | 1.79 |
| XLogP | 3.043 |
| HDA | 4 |
| HBD | 3 |
| Rotatable Bonds | 2 |
| TPSA | 93.89 |
| RO5 Violation | 0 |