Drug Information| Drug ID: | NPD9575 |
| Drug Name: | Etallobarbital |
| Molecular Formula: | C9H12N2O3 |
| Canonical SMILES: | C=CCC1(CC)C(=NC(=O)N=C1O)O |
| Standard InCHI: | InChI=1S/C9H12N2O3/c1-3-5-9(4-2)6(12)10-8(14)11-7(9)13/h3H,1,4-5H2,2H3,(H2,10,11,12,13,14) |
| Standard InCHIKey: | QPADNTZLUBYNEN-UHFFFAOYSA-N |
| Max Developmental Stage: | Approved |
| Max Developmental Stage Source: | ChEMBL |
Structural Similarity Between NPASS Natural Products and NPD9575Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient 
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
Similar Natural Products High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| High Similarity | 0.8596 | NPC21848 |
| High Similarity | 0.8596 | NPC124849 |
| Remote Similarity | 0.5641 | NPC471597 |
| Remote Similarity | 0.5625 | NPC242930 |
| Remote Similarity | 0.5606 | NPC325734 |
| Remote Similarity | 0.5606 | NPC210999 |