NPASS drugs

Drug Information

Drug ID:	NPD9282
Drug Name:	Hydrochlorothiazide
Molecular Formula:	C7H8ClN3O4S2
Canonical SMILES:	Clc1cc2NCNS(=O)(=O)c2cc1S(=O)(=O)N
Standard InCHI:	InChI=1S/C7H8ClN3O4S2/c8-4-1-5-7(2-6(4)16(9,12)13)17(14,15)11-3-10-5/h1-2,10-11H,3H2,(H2,9,12,13)
Standard InCHIKey:	JZUFKLXOESDKRF-UHFFFAOYSA-N
Max Developmental Stage:	Approved
Max Developmental Stage Source:	TTD; ChEMBL; IUPHAR/BPS

Structural Similarity Between NPASS Natural Products and NPD9282

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	1876
0.1-0.2	12158
0.2-0.3	12904
0.3-0.4	3381
0.4-0.5	532
0.5-0.6	31
0.6-0.7	7
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	1

Similar Natural Products

High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
High Similarity	1.0	NPC321053
Remote Similarity	0.6639	NPC315403
Remote Similarity	0.6403	NPC125416
Remote Similarity	0.6241	NPC328877
Remote Similarity	0.621	NPC43655
Remote Similarity	0.6111	NPC107135
Remote Similarity	0.6099	NPC218710
Remote Similarity	0.6016	NPC134825
Remote Similarity	0.5781	NPC297532
Remote Similarity	0.5736	NPC240134
Remote Similarity	0.5669	NPC229477

Drug Structure

NPD9282 OpenBabel08211713262D 21 22 0 0 0 0 0 0 0 0999 V2000 2.5000 -0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5000 0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.5000 0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5000 -0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0000 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0000 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5000 0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0000 -1.7321 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 1.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 4.0000 -0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 4.0000 1.7321 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -1.0000 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 -1.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.0000 2.7321 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.1340 2.2321 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 -0.0000 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0 3.0000 1.7321 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0 0.8660 1.5000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8660 1.5000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5000 -0.8660 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5000 2.5981 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 4 2 0 0 0 0 1 5 1 0 0 0 0 2 6 2 0 0 0 0 2 7 1 0 0 0 0 3 10 1 0 0 0 0 3 11 1 0 0 0 0 4 6 1 0 0 0 0 4 8 1 0 0 0 0 5 7 2 0 0 0 0 5 10 1 0 0 0 0 6 16 1 0 0 0 0 7 17 1 0 0 0 0 9 16 1 0 0 0 0 9 18 1 0 0 0 0 9 19 1 0 0 0 0 10 20 1 0 0 0 0 11 17 1 0 0 0 0 11 21 1 0 0 0 0 12 16 2 0 0 0 0 13 16 2 0 0 0 0 14 17 2 0 0 0 0 15 17 2 0 0 0 0 M END $$$$

External Identifiers

TTD	DAP000750
DrugBank	DB00999
ChEMBL	CHEMBL435
IUPHAR/BPS	4836
PharmaGKB	PA449899
KEGG Drug	D00340
PubChem CID	3639
ChEBI	5778
CAS Number	58-93-5

Drug Properties

Molecular Weight	296.96
ALogP	-1.5436
MLogP	1.13
XLogP	-1.263
HDA	7
HBD	3
Rotatable Bonds	3
TPSA	135.12
RO5 Violation	0