Drug Information| Drug ID: | NPD9262 |
| Drug Name: | Choline Salicylate |
| Molecular Formula: | C7H6O3.C5H14NO |
| Canonical SMILES: | OC(=O)c1ccccc1[O-].OCC[N+](C)(C)C |
| Standard InCHI: | InChI=1S/C7H6O3.C5H14NO/c8-6-4-2-1-3-5(6)7(9)10;1-6(2,3)4-5-7/h1-4,8H,(H,9,10);7H,4-5H2,1-3H3/q;+1/p-1 |
| Standard InCHIKey: | UDKCHVLMFQVBAA-UHFFFAOYSA-M |
| Max Developmental Stage: | Approved |
| Max Developmental Stage Source: | ChEMBL |
Structural Similarity Between NPASS Natural Products and NPD9262Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient 
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
Similar Natural Products High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| High Similarity | 1.0 | NPC136014 |
| High Similarity | 0.9286 | NPC325909 |
| Intermediate Similarity | 0.7273 | NPC328729 |
| Remote Similarity | 0.6562 | NPC326044 |
| Remote Similarity | 0.6452 | NPC322649 |
| Remote Similarity | 0.6389 | NPC1591 |
| Remote Similarity | 0.6364 | NPC141902 |
| Remote Similarity | 0.6333 | NPC262962 |
| Remote Similarity | 0.6176 | NPC59650 |
| Remote Similarity | 0.6176 | NPC84444 |
| Remote Similarity | 0.6176 | NPC145217 |
| Remote Similarity | 0.6047 | NPC81384 |
| Remote Similarity | 0.5806 | NPC166294 |
| Remote Similarity | 0.5652 | NPC198398 |
| Remote Similarity | 0.5652 | NPC27359 |
| Remote Similarity | 0.5652 | NPC295832 |