Drug Information| Drug ID: | NPD9228 |
| Drug Name: | Bethanechol Chloride |
| Molecular Formula: | C7H16N2O2.ClH |
| Canonical SMILES: | CC(C[N+](C)(C)C)OC(=N)[O-].Cl |
| Standard InCHI: | InChI=1S/C7H16N2O2.ClH/c1-6(11-7(8)10)5-9(2,3)4;/h6H,5H2,1-4H3,(H-,8,10);1H |
| Standard InCHIKey: | XXRMYXBSBOVVBH-UHFFFAOYSA-N |
| Max Developmental Stage: | Approved |
| Max Developmental Stage Source: | ChEMBL |
Structural Similarity Between NPASS Natural Products and NPD9228Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient 
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
Similar Natural Products High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.6512 | NPC1591 |
| Remote Similarity | 0.5926 | NPC325180 |
| Remote Similarity | 0.5926 | NPC35816 |
| Remote Similarity | 0.5714 | NPC325909 |
| Remote Similarity | 0.561 | NPC136014 |