Drug Information| Drug ID: | NPD9215 |
| Drug Name: | Methylpropylpropanediol Dinitrate |
| Molecular Formula: | C7H14N2O6 |
| Canonical SMILES: | CCCC(ON(=O)=O)(CCON(=O)=O)C |
| Standard InCHI: | InChI=1S/C7H14N2O6/c1-3-4-7(2,15-9(12)13)5-6-14-8(10)11/h3-6H2,1-2H3 |
| Standard InCHIKey: | SNMKANWYFGWYCK-UHFFFAOYSA-N |
| Max Developmental Stage: | Approved |
| Max Developmental Stage Source: | ChEMBL |
Structural Similarity Between NPASS Natural Products and NPD9215Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient 
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
Similar Natural Products High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Remote Similarity | 0.6571 | NPC190117 |
| Remote Similarity | 0.6 | NPC84750 |
| Remote Similarity | 0.5957 | NPC85078 |
| Remote Similarity | 0.5676 | NPC474048 |