Drug Information| Drug ID: | NPD8969 |
| Drug Name: | Propatyl Nitrate |
| Molecular Formula: | C6H11N3O9 |
| Canonical SMILES: | CCC(CON(=O)=O)(CON(=O)=O)CON(=O)=O |
| Standard InCHI: | InChI=1S/C6H11N3O9/c1-2-6(3-16-7(10)11,4-17-8(12)13)5-18-9(14)15/h2-5H2,1H3 |
| Standard InCHIKey: | YZZCJYJBCUJISI-UHFFFAOYSA-N |
| Max Developmental Stage: | Phase 3 |
| Max Developmental Stage Source: | ChEMBL |
Structural Similarity Between NPASS Natural Products and NPD8969Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient 
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.