Drug Information| Drug ID: | NPD8218 |
| Drug Name: | Fosfomycin |
| Molecular Formula: | C3H7O4P |
| Canonical SMILES: | C[C@@H]1O[C@@H]1P(=O)(O)O |
| Standard InCHI: | InChI=1S/C3H7O4P/c1-2-3(7-2)8(4,5)6/h2-3H,1H3,(H2,4,5,6)/t2-,3+/m0/s1 |
| Standard InCHIKey: | YMDXZJFXQJVXBF-STHAYSLISA-N |
| Max Developmental Stage: | Approved |
| Max Developmental Stage Source: | ChEMBL |
Structural Similarity Between NPASS Natural Products and NPD8218Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient 
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
Similar Natural Products High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| High Similarity | 1.0 | NPC306022 |
| Remote Similarity | 0.6897 | NPC314978 |
| Remote Similarity | 0.6774 | NPC68114 |
| Remote Similarity | 0.6 | NPC266566 |
| Remote Similarity | 0.6 | NPC31433 |
| Remote Similarity | 0.6 | NPC321170 |
| Remote Similarity | 0.5758 | NPC120097 |
| Remote Similarity | 0.5625 | NPC317545 |
| TTD | DAP000767 |
| DrugBank | DB00828 |
| ChEMBL | CHEMBL1757 |
| IUPHAR/BPS | |
| PharmaGKB | PA164748039 |
| KEGG Drug | D04253 |
| PubChem CID | 446987 |
| ChEBI | 28915 |
| CAS Number | 23155-02-4 |
| Molecular Weight | 138.01 |
| ALogP | -0.6449 |
| MLogP | 1.24 |
| XLogP | -1.578 |
| HDA | 4 |
| HBD | 2 |
| Rotatable Bonds | 4 |
| TPSA | 79.87 |
| RO5 Violation | 0 |