Drug Information| Drug ID: | NPD7384 |
| Drug Name: | Etidronate Disodium |
| Molecular Formula: | C2H8O7P2.2Na |
| Canonical SMILES: | CC(P(=O)(O)O)(P(=O)([O-])[O-])O.[Na+].[Na+] |
| Standard InCHI: | InChI=1S/C2H8O7P2.2Na/c1-2(3,10(4,5)6)11(7,8)9;;/h3H,1H3,(H2,4,5,6)(H2,7,8,9);;/q;2*+1/p-2 |
| Standard InCHIKey: | GWBBVOVXJZATQQ-UHFFFAOYSA-L |
| Max Developmental Stage: | Approved |
| Max Developmental Stage Source: | ChEMBL |
Structural Similarity Between NPASS Natural Products and NPD7384Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient 
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
Similar Natural Products High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Intermediate Similarity | 0.75 | NPC314978 |
| Remote Similarity | 0.6538 | NPC317545 |
| Remote Similarity | 0.6207 | NPC306022 |
| Remote Similarity | 0.5909 | NPC317825 |