NPASS drugs

Drug Information

Drug ID:	NPD6391
Drug Name:	Fosamprenavir Calcium
Molecular Formula:	C25H36N3O9PS.Ca
Canonical SMILES:	CC(CN(S(=O)(=O)c1ccc(cc1)N)C[C@H]([C@H](Cc1ccccc1)N=C(O[C@H]1CCOC1)[O-])OP(=O)(O)[O-])C.[Ca+2]
Standard InCHI:	InChI=1S/C25H36N3O9PS.Ca/c1-18(2)15-28(39(33,34)22-10-8-20(26)9-11-22)16-24(37-38(30,31)32)23(14-19-6-4-3-5-7-19)27-25(29)36-21-12-13-35-17-21;/h3-11,18,21,23-24H,12-17,26H2,1-2H3,(H,27,29)(H2,30,31,32);/q;+2/p-2/t21-,23-,24+;/m0./s1
Standard InCHIKey:	PMDQGYMGQKTCSX-HQROKSDRSA-L
Max Developmental Stage:	Approved
Max Developmental Stage Source:	ChEMBL

Structural Similarity Between NPASS Natural Products and NPD6391

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	122
0.1-0.2	933
0.2-0.3	5360
0.3-0.4	15862
0.4-0.5	7300
0.5-0.6	1300
0.6-0.7	13
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
Remote Similarity	0.6519	NPC101372
Remote Similarity	0.6429	NPC477556
Remote Similarity	0.6176	NPC472103
Remote Similarity	0.6045	NPC203424
Remote Similarity	0.6045	NPC206372
Remote Similarity	0.6024	NPC313352
Remote Similarity	0.6013	NPC477061
Remote Similarity	0.6013	NPC45777
Remote Similarity	0.6012	NPC477557
Remote Similarity	0.6	NPC32858
Remote Similarity	0.6	NPC218710
Remote Similarity	0.6	NPC194857
Remote Similarity	0.6	NPC101139
Remote Similarity	0.599	NPC313640
Remote Similarity	0.5988	NPC311330
Remote Similarity	0.5967	NPC85651
Remote Similarity	0.5966	NPC286551
Remote Similarity	0.5943	NPC7817
Remote Similarity	0.5943	NPC475168
Remote Similarity	0.5943	NPC321617
Remote Similarity	0.592	NPC472100
Remote Similarity	0.5917	NPC287358
Remote Similarity	0.5887	NPC315403
Remote Similarity	0.5876	NPC46413
Remote Similarity	0.5862	NPC116519
Remote Similarity	0.5858	NPC127741
Remote Similarity	0.5856	NPC471527
Remote Similarity	0.5848	NPC243162
Remote Similarity	0.5843	NPC470902
Remote Similarity	0.5839	NPC252878
Remote Similarity	0.5833	NPC36836
Remote Similarity	0.5833	NPC63370
Remote Similarity	0.5829	NPC264589
Remote Similarity	0.5823	NPC254088
Remote Similarity	0.5814	NPC316202
Remote Similarity	0.5814	NPC161069
Remote Similarity	0.5802	NPC35996
Remote Similarity	0.5802	NPC283130
Remote Similarity	0.5802	NPC46427
Remote Similarity	0.5802	NPC328683
Remote Similarity	0.58	NPC88267
Remote Similarity	0.58	NPC113326
Remote Similarity	0.58	NPC194390
Remote Similarity	0.58	NPC224610
Remote Similarity	0.5795	NPC254798
Remote Similarity	0.5792	NPC253667
Remote Similarity	0.5792	NPC35510
Remote Similarity	0.5792	NPC471053
Remote Similarity	0.5792	NPC471051
Remote Similarity	0.5792	NPC471052
Remote Similarity	0.5787	NPC122590
Remote Similarity	0.5786	NPC237420
Remote Similarity	0.5784	NPC300631
Remote Similarity	0.5781	NPC477159
Remote Similarity	0.5772	NPC291610
Remote Similarity	0.5771	NPC470824
Remote Similarity	0.5765	NPC68865
Remote Similarity	0.5761	NPC189116
Remote Similarity	0.5758	NPC105114
Remote Similarity	0.5758	NPC239990
Remote Similarity	0.5758	NPC152850
Remote Similarity	0.5758	NPC71933
Remote Similarity	0.5758	NPC476950
Remote Similarity	0.5758	NPC478079
Remote Similarity	0.5758	NPC89923
Remote Similarity	0.5747	NPC314287
Remote Similarity	0.5746	NPC477156
Remote Similarity	0.5746	NPC477157
Remote Similarity	0.5739	NPC105717
Remote Similarity	0.5732	NPC325013
Remote Similarity	0.5723	NPC328590
Remote Similarity	0.5723	NPC169328
Remote Similarity	0.5714	NPC316405
Remote Similarity	0.5714	NPC476990
Remote Similarity	0.5707	NPC475094
Remote Similarity	0.5707	NPC472121
Remote Similarity	0.5706	NPC212799
Remote Similarity	0.5698	NPC314223
Remote Similarity	0.5697	NPC136453
Remote Similarity	0.5692	NPC291759
Remote Similarity	0.5691	NPC473297
Remote Similarity	0.5687	NPC310467
Remote Similarity	0.5687	NPC314992
Remote Similarity	0.5682	NPC138775
Remote Similarity	0.5679	NPC71684
Remote Similarity	0.5679	NPC202521
Remote Similarity	0.5676	NPC311276
Remote Similarity	0.5676	NPC139506
Remote Similarity	0.5676	NPC292143
Remote Similarity	0.5668	NPC469462
Remote Similarity	0.5661	NPC285622
Remote Similarity	0.566	NPC2265
Remote Similarity	0.566	NPC470544
Remote Similarity	0.566	NPC147957
Remote Similarity	0.5657	NPC209509
Remote Similarity	0.5657	NPC322878
Remote Similarity	0.5655	NPC314473
Remote Similarity	0.5655	NPC157311
Remote Similarity	0.5652	NPC472102
Remote Similarity	0.5652	NPC309531
Remote Similarity	0.5646	NPC25565
Remote Similarity	0.5645	NPC52059
Remote Similarity	0.5645	NPC470069
Remote Similarity	0.5641	NPC133591
Remote Similarity	0.5636	NPC47667
Remote Similarity	0.5633	NPC470550
Remote Similarity	0.5633	NPC205652
Remote Similarity	0.5632	NPC329688
Remote Similarity	0.5632	NPC189812
Remote Similarity	0.5632	NPC477462
Remote Similarity	0.5632	NPC189724
Remote Similarity	0.5632	NPC212850
Remote Similarity	0.5632	NPC83289
Remote Similarity	0.5628	NPC153694
Remote Similarity	0.5628	NPC211525
Remote Similarity	0.5628	NPC316910
Remote Similarity	0.5625	NPC282578
Remote Similarity	0.5625	NPC262077
Remote Similarity	0.5625	NPC6974
Remote Similarity	0.5625	NPC470545
Remote Similarity	0.5622	NPC176983
Remote Similarity	0.5622	NPC286871
Remote Similarity	0.5621	NPC44805
Remote Similarity	0.5621	NPC476685
Remote Similarity	0.5621	NPC8761
Remote Similarity	0.5621	NPC476687
Remote Similarity	0.5621	NPC476689
Remote Similarity	0.5619	NPC139291
Remote Similarity	0.5619	NPC472108
Remote Similarity	0.5619	NPC472109
Remote Similarity	0.5619	NPC472110
Remote Similarity	0.5618	NPC2501
Remote Similarity	0.5613	NPC24777
Remote Similarity	0.5611	NPC475763
Remote Similarity	0.561	NPC311357
Remote Similarity	0.561	NPC6975
Remote Similarity	0.5608	NPC83241
Remote Similarity	0.5608	NPC473501
Remote Similarity	0.5608	NPC475439
Remote Similarity	0.5607	NPC163392
Remote Similarity	0.5607	NPC239762
Remote Similarity	0.5607	NPC319645
Remote Similarity	0.5604	NPC161827
Remote Similarity	0.5602	NPC477937
Remote Similarity	0.56	NPC476978
Remote Similarity	0.56	NPC477155

Drug Structure

NPD6391 OpenBabel08211709092D 43 44 0 0 1 0 0 0 0 0999 V2000 3.2679 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.8660 -8.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0000 -7.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.7321 -7.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0000 -6.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.7321 -6.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5000 -3.6340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5000 -5.3660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5000 -3.6340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5000 -5.3660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.1097 -4.9067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.7788 -4.1636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.8660 -5.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1340 -3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.8660 -3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.3007 -3.5055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1340 -2.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.8660 -6.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0000 -4.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.1962 -4.5000 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 4.0000 -4.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.7321 -4.5000 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 6.7321 -3.5000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 8.4641 -4.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0000 -4.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 7.5981 -5.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 5.0000 -3.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 8.4641 -3.5000 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0 6.5981 -2.0000 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0 7.5981 -1.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 8.5981 -2.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.0000 -5.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.0000 -4.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 11.2788 -3.2976 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 9.3301 -5.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.5981 -3.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.5981 -2.0000 0.0000 P 0 0 3 0 0 0 0 0 0 0 0 0 5.0000 -4.5000 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0 -1.7208 -6.1898 0.0000 Ca 0 2 0 0 0 15 0 0 0 0 0 0 0.5000 -3.6340 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5000 -5.3660 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 8.4641 -0.5000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 18 1 0 0 0 0 2 18 1 0 0 0 0 3 4 2 0 0 0 0 3 5 1 0 0 0 0 4 6 1 0 0 0 0 5 7 2 0 0 0 0 6 19 2 0 0 0 0 7 19 1 0 0 0 0 8 10 1 0 0 0 0 8 20 2 0 0 0 0 9 11 2 0 0 0 0 9 20 1 0 0 0 0 10 22 2 0 0 0 0 11 22 1 0 0 0 0 12 13 1 0 0 0 0 12 21 1 0 0 0 0 13 35 1 0 0 0 0 14 19 1 0 0 0 0 15 18 1 0 0 0 0 15 28 1 0 0 0 0 16 28 1 0 0 0 0 17 21 1 0 0 0 0 17 35 1 0 0 0 0 20 26 1 0 0 0 0 21 36 1 6 0 0 0 22 39 1 0 0 0 0 23 14 1 1 0 0 0 23 24 1 0 0 0 0 23 27 1 0 0 0 0 24 16 1 1 0 0 0 24 37 1 0 0 0 0 25 27 2 3 0 0 0 25 29 1 0 0 0 0 25 36 1 0 0 0 0 26 41 1 0 0 0 0 26 42 1 0 0 0 0 28 39 1 0 0 0 0 30 38 1 0 0 0 0 31 38 1 0 0 0 0 31 43 1 0 0 0 0 32 38 2 0 0 0 0 33 39 2 0 0 0 0 34 39 2 0 0 0 0 37 38 1 0 0 0 0 M CHG 3 29 -1 30 -1 40 2 M END $$$$

External Identifiers

TTD
DrugBank
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID
ChEBI
CAS Number

Drug Properties

Molecular Weight	583.18
ALogP	-2.9926
MLogP	2.67
XLogP	3.531
HDA	12
HBD	2
Rotatable Bonds	20
TPSA	205.06
RO5 Violation	2