NPASS drugs

Drug Information

Drug ID:	NPD5621
Drug Name:	Thiopropazate Hydrochloride
Molecular Formula:	C23H28ClN3O2S.ClH
Canonical SMILES:	CC(=O)OCCN1CCN(CC1)CCCN1c2ccccc2Sc2c1cc(Cl)cc2.Cl
Standard InCHI:	InChI=1S/C23H28ClN3O2S.ClH/c1-18(28)29-16-15-26-13-11-25(12-14-26)9-4-10-27-20-5-2-3-6-22(20)30-23-8-7-19(24)17-21(23)27;/h2-3,5-8,17H,4,9-16H2,1H3;1H
Standard InCHIKey:	UVZCSDSYVKDPQP-UHFFFAOYSA-N
Max Developmental Stage:	Approved
Max Developmental Stage Source:	ChEMBL

Structural Similarity Between NPASS Natural Products and NPD5621

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	149
0.1-0.2	4262
0.2-0.3	16722
0.3-0.4	7055
0.4-0.5	2527
0.5-0.6	169
0.6-0.7	5
0.7-0.8	1
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
Intermediate Similarity	0.7067	NPC473417
Remote Similarity	0.6619	NPC328877
Remote Similarity	0.6545	NPC321617
Remote Similarity	0.625	NPC313352
Remote Similarity	0.6139	NPC321053
Remote Similarity	0.6014	NPC291610
Remote Similarity	0.5975	NPC469949
Remote Similarity	0.5879	NPC325599
Remote Similarity	0.5817	NPC218710
Remote Similarity	0.5782	NPC313810
Remote Similarity	0.574	NPC470301
Remote Similarity	0.5738	NPC116961
Remote Similarity	0.5732	NPC316582
Remote Similarity	0.5731	NPC320863
Remote Similarity	0.5677	NPC125416
Remote Similarity	0.5644	NPC314930
Remote Similarity	0.5644	NPC214827
Remote Similarity	0.56	NPC20322

Drug Structure

NPD5621 OpenBabel08211708292D 31 33 0 0 0 0 0 0 0 0999 V2000 11.7583 -3.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3660 -5.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5000 -5.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8301 -3.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2321 -5.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5000 -4.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0981 -0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2321 -1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6962 -4.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9641 -4.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.5622 -2.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.4282 -4.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.4282 -2.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.2942 -3.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.1603 -2.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.0263 -2.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9641 -2.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.7583 -2.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9641 -1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2321 -4.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0981 -2.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3660 -3.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2321 -2.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8301 -0.5000 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0 6.5622 -3.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 8.2942 -2.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 3.0981 -3.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 12.6244 -2.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 10.8923 -2.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.3660 -2.5000 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0 -1.6770 -4.2610 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0 1 18 1 0 0 0 0 2 3 2 0 0 0 0 2 5 1 0 0 0 0 3 6 1 0 0 0 0 4 9 1 0 0 0 0 4 10 1 0 0 0 0 5 20 2 0 0 0 0 6 22 2 0 0 0 0 7 8 2 0 0 0 0 7 19 1 0 0 0 0 8 23 1 0 0 0 0 9 25 1 0 0 0 0 10 27 1 0 0 0 0 11 13 1 0 0 0 0 11 25 1 0 0 0 0 12 14 1 0 0 0 0 12 25 1 0 0 0 0 13 26 1 0 0 0 0 14 26 1 0 0 0 0 15 16 1 0 0 0 0 15 26 1 0 0 0 0 16 29 1 0 0 0 0 17 19 2 0 0 0 0 17 21 1 0 0 0 0 18 28 2 0 0 0 0 18 29 1 0 0 0 0 19 24 1 0 0 0 0 20 22 1 0 0 0 0 20 27 1 0 0 0 0 21 23 2 0 0 0 0 21 27 1 0 0 0 0 22 30 1 0 0 0 0 23 30 1 0 0 0 0 M END $$$$

External Identifiers

TTD
DrugBank
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID
ChEBI
CAS Number

Drug Properties

Molecular Weight	445.16
ALogP	1.0981
MLogP	3.22
XLogP	4.131
HDA	5
HBD	0
Rotatable Bonds	10
TPSA	61.32
RO5 Violation	0