Drug Information| Drug ID: | NPD540 |
| Drug Name: | Narcobarbital |
| Molecular Formula: | C11H15BrN2O3 |
| Canonical SMILES: | BrC(=C)CC1(C(C)C)C(=NC(=O)N(C1=O)C)O |
| Standard InCHI: | InChI=1S/C11H15BrN2O3/c1-6(2)11(5-7(3)12)8(15)13-10(17)14(4)9(11)16/h6H,3,5H2,1-2,4H3,(H,13,15,17) |
| Standard InCHIKey: | WGMASVSHOSNKMF-UHFFFAOYSA-N |
| Max Developmental Stage: | Approved |
| Max Developmental Stage Source: | ChEMBL |
Structural Similarity Between NPASS Natural Products and NPD540Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient 
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.