NPASS drugs

Drug Information

Drug ID:	NPD4592
Drug Name:	Perphenazine
Molecular Formula:	C21H26ClN3OS
Canonical SMILES:	OCCN1CCN(CC1)CCCN1c2ccccc2Sc2c1cc(Cl)cc2
Standard InCHI:	InChI=1S/C21H26ClN3OS/c22-17-6-7-21-19(16-17)25(18-4-1-2-5-20(18)27-21)9-3-8-23-10-12-24(13-11-23)14-15-26/h1-2,4-7,16,26H,3,8-15H2
Standard InCHIKey:	RGCVKNLCSQQDEP-UHFFFAOYSA-N
Max Developmental Stage:	Approved
Max Developmental Stage Source:	TTD; ChEMBL; IUPHAR/BPS

Structural Similarity Between NPASS Natural Products and NPD4592

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	285
0.1-0.2	8045
0.2-0.3	15141
0.3-0.4	5174
0.4-0.5	2097
0.5-0.6	141
0.6-0.7	6
0.7-0.8	1
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
Intermediate Similarity	0.7292	NPC473417
Remote Similarity	0.697	NPC328877
Remote Similarity	0.673	NPC321617
Remote Similarity	0.6323	NPC313352
Remote Similarity	0.6316	NPC321053
Remote Similarity	0.6204	NPC291610
Remote Similarity	0.6144	NPC469949
Remote Similarity	0.5986	NPC218710
Remote Similarity	0.5946	NPC125416
Remote Similarity	0.589	NPC470301
Remote Similarity	0.5879	NPC320863
Remote Similarity	0.5855	NPC475915
Remote Similarity	0.5845	NPC313810
Remote Similarity	0.5839	NPC325599
Remote Similarity	0.5682	NPC229477
Remote Similarity	0.5602	NPC186284
Remote Similarity	0.5602	NPC22082

Drug Structure

NPD4592 OpenBabel08211705262D 28 31 0 0 0 0 0 0 0 0999 V2000 -2.5981 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7321 2.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4641 -1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5981 0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8660 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8660 -2.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8660 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4641 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5981 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.3301 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.1962 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.1962 2.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.0622 0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.9282 2.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.9282 3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8660 -2.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7321 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8660 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8660 0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -4.0000 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0 -4.3301 0.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -6.0622 1.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -1.7321 -1.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -7.7942 3.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -0.0000 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0 -7.7942 4.5000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 2 0 0 0 0 1 4 1 0 0 0 0 2 5 1 0 0 0 0 3 8 1 0 0 0 0 3 9 1 0 0 0 0 4 18 2 0 0 0 0 5 20 2 0 0 0 0 6 7 2 0 0 0 0 6 17 1 0 0 0 0 7 21 1 0 0 0 0 8 23 1 0 0 0 0 9 25 1 0 0 0 0 10 12 1 0 0 0 0 10 23 1 0 0 0 0 11 13 1 0 0 0 0 11 23 1 0 0 0 0 12 24 1 0 0 0 0 13 24 1 0 0 0 0 14 15 1 0 0 0 0 14 24 1 0 0 0 0 15 26 1 0 0 0 0 16 17 2 0 0 0 0 16 19 1 0 0 0 0 17 22 1 0 0 0 0 18 20 1 0 0 0 0 18 25 1 0 0 0 0 19 21 2 0 0 0 0 19 25 1 0 0 0 0 20 27 1 0 0 0 0 21 27 1 0 0 0 0 26 28 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DPR000023; DAP000100
DrugBank	DB00850
ChEMBL	CHEMBL567
IUPHAR/BPS	209
PharmaGKB	PA450882
KEGG Drug	D00503
PubChem CID	4748; 44154447
ChEBI	8028
CAS Number	58-39-9

Drug Properties

Molecular Weight	403.15
ALogP	0.719
MLogP	3.11
XLogP	3.391
HDA	4
HBD	1
Rotatable Bonds	8
TPSA	55.25
RO5 Violation	0