NPASS drugs

Drug Information

Drug ID:	NPD3369
Drug Name:	Refametinib
Molecular Formula:	C19H20F3IN2O5S
Canonical SMILES:	OCC(CC1(CC1)[S+](=O)(Nc1c(OC)cc(c(c1Nc1ccc(cc1F)I)F)F)[O-])O
Standard InCHI:	InChI=1S/C19H20F3IN2O5S/c1-30-15-7-13(21)16(22)18(24-14-3-2-10(23)6-12(14)20)17(15)25-31(28,29)19(4-5-19)8-11(27)9-26/h2-3,6-7,11,24,26-27H,4-5,8-9H2,1H3,(H-,25,28,29)
Standard InCHIKey:	QXLZZQSWYQRQEM-UHFFFAOYSA-N
Max Developmental Stage:	Phase 2
Max Developmental Stage Source:	ChEMBL

Structural Similarity Between NPASS Natural Products and NPD3369

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	212
0.1-0.2	2767
0.2-0.3	10210
0.3-0.4	8272
0.4-0.5	8375
0.5-0.6	1035
0.6-0.7	19
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
Remote Similarity	0.6882	NPC473432
Remote Similarity	0.6508	NPC73280
Remote Similarity	0.6447	NPC110741
Remote Similarity	0.6392	NPC118776
Remote Similarity	0.6289	NPC226914
Remote Similarity	0.6263	NPC1527
Remote Similarity	0.6262	NPC111492
Remote Similarity	0.6238	NPC308392
Remote Similarity	0.622	NPC471736
Remote Similarity	0.6096	NPC315257
Remote Similarity	0.6089	NPC474059
Remote Similarity	0.6068	NPC314948
Remote Similarity	0.6059	NPC315632
Remote Similarity	0.6022	NPC168750
Remote Similarity	0.602	NPC262725
Remote Similarity	0.6019	NPC471080
Remote Similarity	0.6019	NPC469592
Remote Similarity	0.601	NPC70092
Remote Similarity	0.6	NPC285635
Remote Similarity	0.599	NPC478049
Remote Similarity	0.599	NPC472191
Remote Similarity	0.5982	NPC469594
Remote Similarity	0.5981	NPC477160
Remote Similarity	0.5978	NPC476475
Remote Similarity	0.5952	NPC470586
Remote Similarity	0.5949	NPC310894
Remote Similarity	0.5949	NPC258773
Remote Similarity	0.5943	NPC473987
Remote Similarity	0.5943	NPC87714
Remote Similarity	0.5938	NPC292143
Remote Similarity	0.5938	NPC139506
Remote Similarity	0.5909	NPC220560
Remote Similarity	0.5902	NPC260601
Remote Similarity	0.5869	NPC473422
Remote Similarity	0.5859	NPC194724
Remote Similarity	0.5859	NPC290069
Remote Similarity	0.5856	NPC47986
Remote Similarity	0.5842	NPC10730
Remote Similarity	0.5842	NPC10875
Remote Similarity	0.5841	NPC195787
Remote Similarity	0.5841	NPC246140
Remote Similarity	0.5838	NPC225381
Remote Similarity	0.5833	NPC469589
Remote Similarity	0.5824	NPC314113
Remote Similarity	0.5817	NPC230313
Remote Similarity	0.5817	NPC243626
Remote Similarity	0.5803	NPC57105
Remote Similarity	0.5803	NPC79911
Remote Similarity	0.5802	NPC214368
Remote Similarity	0.5792	NPC476462
Remote Similarity	0.5784	NPC314573
Remote Similarity	0.5783	NPC264782
Remote Similarity	0.5782	NPC128823
Remote Similarity	0.5782	NPC18487
Remote Similarity	0.5781	NPC301163
Remote Similarity	0.5767	NPC219383
Remote Similarity	0.5764	NPC62069
Remote Similarity	0.5762	NPC243834
Remote Similarity	0.5762	NPC70956
Remote Similarity	0.5759	NPC112766
Remote Similarity	0.5755	NPC315957
Remote Similarity	0.5755	NPC25897
Remote Similarity	0.5754	NPC297584
Remote Similarity	0.5753	NPC473769
Remote Similarity	0.5752	NPC122886
Remote Similarity	0.5751	NPC120798
Remote Similarity	0.5751	NPC231862
Remote Similarity	0.5749	NPC22476
Remote Similarity	0.5744	NPC299582
Remote Similarity	0.5735	NPC42591
Remote Similarity	0.5729	NPC469428
Remote Similarity	0.5728	NPC477186
Remote Similarity	0.5722	NPC72291
Remote Similarity	0.5721	NPC287152
Remote Similarity	0.5721	NPC14339
Remote Similarity	0.5714	NPC256838
Remote Similarity	0.5714	NPC475910
Remote Similarity	0.5702	NPC110151
Remote Similarity	0.5701	NPC66815
Remote Similarity	0.5701	NPC189661
Remote Similarity	0.57	NPC168153
Remote Similarity	0.5699	NPC37205
Remote Similarity	0.5699	NPC160931
Remote Similarity	0.5698	NPC208022
Remote Similarity	0.5697	NPC9336
Remote Similarity	0.5694	NPC279401
Remote Similarity	0.5694	NPC79293
Remote Similarity	0.5694	NPC476106
Remote Similarity	0.5687	NPC161804
Remote Similarity	0.5686	NPC84478
Remote Similarity	0.5682	NPC203168
Remote Similarity	0.5682	NPC119722
Remote Similarity	0.5678	NPC124300
Remote Similarity	0.5672	NPC283152
Remote Similarity	0.567	NPC473179
Remote Similarity	0.5663	NPC70172
Remote Similarity	0.5662	NPC219664
Remote Similarity	0.566	NPC100863
Remote Similarity	0.5654	NPC291609
Remote Similarity	0.5654	NPC316756
Remote Similarity	0.565	NPC95898
Remote Similarity	0.5648	NPC70549
Remote Similarity	0.5646	NPC79213
Remote Similarity	0.5642	NPC313466
Remote Similarity	0.5641	NPC85651
Remote Similarity	0.5637	NPC314659
Remote Similarity	0.5635	NPC314861
Remote Similarity	0.5635	NPC127362
Remote Similarity	0.5628	NPC135887
Remote Similarity	0.5628	NPC199277
Remote Similarity	0.5622	NPC204546
Remote Similarity	0.5616	NPC166169
Remote Similarity	0.5614	NPC19175
Remote Similarity	0.5611	NPC127996
Remote Similarity	0.561	NPC302235
Remote Similarity	0.5607	NPC310618
Remote Similarity	0.5607	NPC121772
Remote Similarity	0.5604	NPC469830
Remote Similarity	0.5602	NPC223427
Remote Similarity	0.5602	NPC473460

Drug Structure

NPD3369 OpenBabel08211703112D 35 37 0 0 1 0 0 0 0 0999 V2000 0.5000 -2.5981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5000 -0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.5000 -0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 2.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8660 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5000 0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5000 -2.5981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8660 0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5981 0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.0000 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7321 1.0000 0.0000 C 0 0 3 0 0 0 0 0 0 0 0 0 -4.5000 0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5000 -2.5981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0000 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0000 -1.7321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0000 -1.7321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5000 -0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5000 -0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0000 1.7321 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0 -3.0000 -3.4641 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0 -4.0000 -1.7321 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0 -7.0000 -0.0000 0.0000 I 0 0 0 0 0 0 0 0 0 0 0 0 -3.0000 -0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -1.0000 0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 3.4641 1.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.7321 2.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 -1.0000 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0 1.0000 -0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -1.7321 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 0.0000 0.0000 S 0 3 3 0 0 0 0 0 0 0 0 0 -2.5000 0.8660 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5000 0.8660 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3301 0.5000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5981 2.5000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 30 1 0 0 0 0 2 3 2 0 0 0 0 2 10 1 0 0 0 0 3 14 1 0 0 0 0 4 5 1 0 0 0 0 4 19 1 0 0 0 0 5 19 1 0 0 0 0 6 10 2 0 0 0 0 6 12 1 0 0 0 0 7 13 2 0 0 0 0 7 15 1 0 0 0 0 8 11 1 0 0 0 0 8 19 1 0 0 0 0 9 11 1 0 0 0 0 9 26 1 0 0 0 0 10 23 1 0 0 0 0 11 27 1 0 0 0 0 12 14 2 0 0 0 0 12 20 1 0 0 0 0 13 16 1 0 0 0 0 13 21 1 0 0 0 0 14 24 1 0 0 0 0 15 17 2 0 0 0 0 15 30 1 0 0 0 0 16 18 2 0 0 0 0 16 22 1 0 0 0 0 17 18 1 0 0 0 0 17 25 1 0 0 0 0 18 24 1 0 0 0 0 19 31 1 0 0 0 0 24 32 1 0 0 0 0 25 31 1 0 0 0 0 25 33 1 0 0 0 0 26 34 1 0 0 0 0 27 35 1 0 0 0 0 28 31 1 0 0 0 0 29 31 2 0 0 0 0 M CHG 2 28 -1 31 1 M END $$$$

External Identifiers

TTD
DrugBank
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID
ChEBI
CAS Number

Drug Properties

Molecular Weight	572.01
ALogP
MLogP	2.23
XLogP
HDA	7
HBD	4
Rotatable Bonds	17
TPSA	113.88
RO5 Violation	0