NPASS drugs

Drug Information

Drug ID:	NPD2033
Drug Name:	CNS-5161
Molecular Formula:	C16H18ClN3S2
Canonical SMILES:	CSc1ccc(c(c1)NC(=N)N(c1cccc(c1)SC)C)Cl
Standard InCHI:	InChI=1S/C16H18ClN3S2/c1-20(11-5-4-6-12(9-11)21-2)16(18)19-15-10-13(22-3)7-8-14(15)17/h4-10H,1-3H3,(H2,18,19)
Standard InCHIKey:	JHVHEDNLONERHY-UHFFFAOYSA-N
Max Developmental Stage:	Phase 2
Max Developmental Stage Source:	DrugBank

Structural Similarity Between NPASS Natural Products and NPD2033

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	1588
0.1-0.2	11239
0.2-0.3	13025
0.3-0.4	3948
0.4-0.5	995
0.5-0.6	85
0.6-0.7	9
0.7-0.8	1
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
Intermediate Similarity	0.7769	NPC125416
Remote Similarity	0.6644	NPC321053
Remote Similarity	0.6591	NPC328877
Remote Similarity	0.6336	NPC317642
Remote Similarity	0.6269	NPC474430
Remote Similarity	0.6242	NPC469949
Remote Similarity	0.616	NPC229477
Remote Similarity	0.6129	NPC134825
Remote Similarity	0.6062	NPC320863
Remote Similarity	0.6056	NPC314141
Remote Similarity	0.5855	NPC252794
Remote Similarity	0.5846	NPC240134
Remote Similarity	0.5844	NPC473417
Remote Similarity	0.5839	NPC291610
Remote Similarity	0.5817	NPC145754
Remote Similarity	0.5753	NPC288232
Remote Similarity	0.5706	NPC314557
Remote Similarity	0.5649	NPC297532
Remote Similarity	0.5642	NPC315715

Drug Structure

NPD2033 OpenBabel08211701392D 24 25 0 0 0 0 0 0 0 0999 V2000 2.5981 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1962 -3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7321 -3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1962 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3301 0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1962 -1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7321 -1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7321 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4641 -1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4641 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3301 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8660 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8660 0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7321 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8660 1.5000 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0 1.7321 -1.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 0.8660 0.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 2.5981 0.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 4.3301 -2.5000 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0 -0.8660 -2.5000 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0 0.8660 -1.5000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8660 1.5000 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 20 1 0 0 0 0 2 21 1 0 0 0 0 3 22 1 0 0 0 0 4 5 2 0 0 0 0 4 6 1 0 0 0 0 5 11 1 0 0 0 0 6 12 2 0 0 0 0 7 8 2 0 0 0 0 7 13 1 0 0 0 0 8 14 1 0 0 0 0 9 11 2 0 0 0 0 9 12 1 0 0 0 0 10 13 2 0 0 0 0 10 15 1 0 0 0 0 11 20 1 0 0 0 0 12 21 1 0 0 0 0 13 22 1 0 0 0 0 14 15 2 0 0 0 0 14 17 1 0 0 0 0 15 19 1 0 0 0 0 16 18 2 0 0 0 0 16 19 1 0 0 0 0 16 20 1 0 0 0 0 18 23 1 0 0 0 0 19 24 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DCL000755
DrugBank	DB05824
ChEMBL	CHEMBL41306
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID	192711
ChEBI
CAS Number

Drug Properties

Molecular Weight	351.06
ALogP	1.7629
MLogP	2.56
XLogP	6.337
HDA	3
HBD	2
Rotatable Bonds	10
TPSA	89.72
RO5 Violation	1