NPASS drugs

Drug Information

Drug ID:	NPD1011
Drug Name:	Genaconazole
Molecular Formula:	C13H15F2N3O3S
Canonical SMILES:	Fc1ccc(c(c1)F)[C@]([C@H](S(=O)(=O)C)C)(Cn1cncn1)O
Standard InCHI:	InChI=1S/C13H15F2N3O3S/c1-9(22(2,20)21)13(19,6-18-8-16-7-17-18)11-4-3-10(14)5-12(11)15/h3-5,7-9,19H,6H2,1-2H3/t9-,13-/m1/s1
Standard InCHIKey:	HFGZFHCWKKQGIS-NOZJJQNGSA-N
Max Developmental Stage:	Discontinued
Max Developmental Stage Source:	TTD

Structural Similarity Between NPASS Natural Products and NPD1011

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	214
0.1-0.2	1926
0.2-0.3	10083
0.3-0.4	12839
0.4-0.5	5563
0.5-0.6	264
0.6-0.7	1
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
Remote Similarity	0.6306	NPC52764
Remote Similarity	0.5886	NPC326232
Remote Similarity	0.5782	NPC228400
Remote Similarity	0.5782	NPC214200
Remote Similarity	0.575	NPC273830
Remote Similarity	0.5743	NPC327226
Remote Similarity	0.5738	NPC475998
Remote Similarity	0.5667	NPC150254
Remote Similarity	0.5667	NPC147000
Remote Similarity	0.5667	NPC304761
Remote Similarity	0.5667	NPC226778

Drug Structure

NPD1011 OpenBabel08201723592D 23 24 0 0 1 0 0 0 0 0999 V2000 -1.5000 0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0981 -0.3660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.2321 -0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.2321 1.1340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6340 -1.3660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1340 -3.9049 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1750 -2.9538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0000 0.0000 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.0981 0.6340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3660 -0.3660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3660 0.6340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5000 -0.8660 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.9641 1.1340 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0 -1.5000 1.1340 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0 -0.1340 -3.9049 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -1.4430 -2.9538 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -0.6340 -2.3660 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -2.0000 -1.7321 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.0000 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -1.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -0.0000 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0 -3.0000 -1.7321 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 2 22 1 0 0 0 0 3 4 2 0 0 0 0 3 10 1 0 0 0 0 4 11 1 0 0 0 0 5 10 2 0 0 0 0 5 12 1 0 0 0 0 6 18 1 0 0 0 0 7 16 1 0 0 0 0 7 17 2 0 0 0 0 8 16 2 0 0 0 0 8 18 1 0 0 0 0 9 1 1 1 0 0 0 9 13 1 0 0 0 0 9 22 1 0 0 0 0 10 14 1 0 0 0 0 11 12 2 0 0 0 0 11 13 1 0 0 0 0 12 15 1 0 0 0 0 13 6 1 6 0 0 0 13 19 1 0 0 0 0 17 18 1 0 0 0 0 19 23 1 0 0 0 0 20 22 2 0 0 0 0 21 22 2 0 0 0 0 M END $$$$

External Identifiers

TTD	DIB008751
DrugBank
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID
ChEBI
CAS Number

Drug Properties

Molecular Weight	331.08
ALogP	-0.083
MLogP	1.9
XLogP	1.358
HDA	6
HBD	1
Rotatable Bonds	10
TPSA	93.46
RO5 Violation	0