Natural Product: NPC75435
Natural Product ID:   | NPC75435 |
Common Name:   | n.a. |
IUPAC Name:   | |
Synonyms:   | Alpha-Homonojirimycin |
Molecular Formula:   | C7H15NO5 |
Standard InCHIKey:   | CLVUFWXGNIFGNC-OVHBTUCOSA-N |
Standard InCHI:   | InChI=1S/C7H15NO5/c9-1-3-5(11)7(13)6(12)4(2-10)8-3/h3-13H,1-2H2/t3-,4-,5-,6+,7+/m1/s1 |
Canonical SMILES:   | OC[C@H]1N[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O |
First Find Year:   | |
Max Developmental Stage:   | |
Synthetic Gene Cluster:   |
; |
  Species Source
Organism ID |
Organism Name |
Taxonomy Level |
Family |
SuperKingdom |
Isolation Part |
Collection Location |
Collection Time |
Reference |
NPO33446 |
aglaonema treubii |
Species |
Araceae |
Eukaryota |
|
|
|
PMID[10560746] |
NPO21156 |
Xanthocercis zambesiaca |
Species |
Fabaceae |
Eukaryota |
|
|
|
PMID[9544568] |
NPO16194 |
Morus bombycis |
Species |
Moraceae |
Eukaryota |
|
|
|
PMID[9544568] |
NPO33446 |
aglaonema treubii |
Species |
Araceae |
Eukaryota |
|
|
|
PMID[9544568] |
NPO12473 |
Castanospermum australe |
Species |
Fabaceae |
Eukaryota |
|
|
|
PMID[9544568] |
NPO25280 |
Suregada glomerulata |
Species |
Euphorbiaceae |
Eukaryota |
Leaves |
|
|
PMID[23993676] |
  Biological Activity
Activity Type |
# Activity |
IC50 |
15 |
Others |
17 |
Activity Type |
# Activity |
Individual Protein |
22 |
Organism |
6 |
Others |
4 |
Target ID |
Target Type |
Target Name |
Target Organism |
Activity Type |
Activity Relation |
Value |
Unit |
Reference |
NPT2 |
Others |
Unspecified |
|
IC50 |
= |
90 |
nM |
1791472 |
NPT671 |
Individual Protein |
Acidic alpha-glucosidase |
Rattus norvegicus |
IC50 |
= |
340 |
nM |
15911254 |
NPT32 |
Organism |
Mus musculus |
Mus musculus |
Activity |
= |
136.4 |
mg/dl |
22018878 |
NPT497 |
Individual Protein |
Maltase-glucoamylase |
Homo sapiens |
IC50 |
= |
40 |
nM |
10.6019/CHEMBL1201861 |
NPT462 |
Individual Protein |
Sucrase-isomaltase |
Rattus norvegicus |
IC50 |
= |
700 |
nM |
26003344 |
NPT671 |
Individual Protein |
Acidic alpha-glucosidase |
Rattus norvegicus |
IC50 |
= |
80 |
nM |
26003344 |
NPT60 |
Individual Protein |
Lysosomal alpha-glucosidase |
Homo sapiens |
IC50 |
= |
100 |
nM |
PubChem BioAssay data set |
NPT32 |
Organism |
Mus musculus |
Mus musculus |
Activity |
= |
149.9 |
mg/dl |
10514323 |
NPT2 |
Others |
Unspecified |
|
Inhibition |
< |
50 |
% |
18605717 |
NPT503 |
Individual Protein |
Alpha-L-fucosidase I |
Homo sapiens |
Inhibition |
< |
50 |
% |
PubChem BioAssay data set |
NPT1055 |
Individual Protein |
Neutral alpha-glucosidase C |
Mus musculus |
IC50 |
= |
340 |
nM |
PubChem BioAssay data set |
NPT61 |
Individual Protein |
Beta-glucocerebrosidase |
Homo sapiens |
Inhibition |
< |
50 |
% |
19128055 |
NPT3906 |
Individual Protein |
Glycogen debranching enzyme |
Oryctolagus cuniculus |
IC50 |
= |
110 |
nM |
15332848 |
NPT671 |
Individual Protein |
Acidic alpha-glucosidase |
Rattus norvegicus |
IC50 |
= |
700 |
nM |
22934537 |
NPT5153 |
Individual Protein |
Alpha-L-fucosidase I |
Rattus norvegicus |
Inhibition |
< |
50 |
% |
22934537 |
NPT1050 |
Individual Protein |
Trehalase |
Rattus norvegicus |
IC50 |
= |
34000 |
nM |
22934537 |
NPT671 |
Individual Protein |
Acidic alpha-glucosidase |
Rattus norvegicus |
IC50 |
= |
260 |
nM |
22934537 |
NPT671 |
Individual Protein |
Acidic alpha-glucosidase |
Rattus norvegicus |
IC50 |
= |
170 |
nM |
22934537 |
NPT503 |
Individual Protein |
Alpha-L-fucosidase I |
Homo sapiens |
Inhibition |
< |
50 |
% |
22934537 |
NPT2 |
Others |
Unspecified |
|
Inhibition |
< |
50 |
% |
22934537 |
NPT501 |
Individual Protein |
Alpha-galactosidase A |
Homo sapiens |
Inhibition |
< |
50 |
% |
17286431 |
NPT462 |
Individual Protein |
Sucrase-isomaltase |
Rattus norvegicus |
IC50 |
= |
170 |
nM |
16274989 |
NPT6631 |
Individual Protein |
Neutral alpha-glucosidase C |
Homo sapiens |
Inhibition |
< |
50 |
% |
23398362 |
NPT509 |
Individual Protein |
Beta-galactosidase |
Bos taurus |
Inhibition |
< |
50 |
% |
23398362 |
NPT6372 |
Individual Protein |
Alpha-galactosidase A |
Rattus norvegicus |
Inhibition |
< |
50 |
% |
23398362 |
NPT60 |
Individual Protein |
Lysosomal alpha-glucosidase |
Homo sapiens |
IC50 |
= |
1000 |
nM |
10869195 |
NPT32 |
Organism |
Mus musculus |
Mus musculus |
Activity |
= |
161.2 |
mg/dl |
21070010 |
NPT671 |
Individual Protein |
Acidic alpha-glucosidase |
Rattus norvegicus |
IC50 |
= |
8400 |
nM |
22506638 |
NPT32 |
Organism |
Mus musculus |
Mus musculus |
Activity |
= |
129.3 |
mg/dl |
10514305 |
NPT32 |
Organism |
Mus musculus |
Mus musculus |
Activity |
= |
176.4 |
mg/dl |
10514305 |
NPT32 |
Organism |
Mus musculus |
Mus musculus |
Activity |
= |
126 |
mg/dl |
17958396 |
  Similar Natural Products in NPASS
Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient
●  The left chart: Distribution of similarity level between NPC75435 and all remaining natural products in the NPASS database.
●  The right table: Most similar natural products (Tc>=0.56 or Top200).
range |
Tanimoto Coefficient |
0-0.1 | 57 |
0.1-0.2 | 9795 |
0.2-0.3 | 16366 |
0.3-0.4 | 3661 |
0.4-0.5 | 725 |
0.5-0.6 | 163 |
0.6-0.7 | 51 |
0.7-0.8 | 29 |
0.8-0.85 | 5 |
0.85-0.9 | 9 |
0.9-0.95 | 14 |
0.95-1 | 14 |
  Similar Clinical/Approved Drugs
Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.
●  The left chart: Distribution of similarity level between NPC75435 and all drugs/candidates.
●  The right table: Most similar clinical/approved drugs (Tc>=0.56 or Top200).
range |
Tanimoto Coefficient |
0-0.1 | 62 |
0.1-0.2 | 2838 |
0.2-0.3 | 4589 |
0.3-0.4 | 1126 |
0.4-0.5 | 408 |
0.5-0.6 | 105 |
0.6-0.7 | 14 |
0.7-0.8 | 10 |
0.8-0.85 | 5 |
0.85-0.9 | 0 |
0.9-0.95 | 0 |
0.95-1 | 4 |
Similarity Score |
Similarity Level |
Drug ID |
Developmental Stage |
0.9661 |
High Similarity |
NPD9027 |
Phase 3 |
0.9661 |
High Similarity |
NPD9029 |
Phase 3 |
0.9661 |
High Similarity |
NPD9028 |
Phase 2 |
0.9661 |
High Similarity |
NPD9026 |
Phase 2 |
0.8387 |
Intermediate Similarity |
NPD9455 |
Approved |
0.8254 |
Intermediate Similarity |
NPD393 |
Approved |
0.8095 |
Intermediate Similarity |
NPD9239 |
Approved |
0.8095 |
Intermediate Similarity |
NPD9240 |
Approved |
0.806 |
Intermediate Similarity |
NPD9443 |
Clinical (unspecified phase) |
0.7692 |
Intermediate Similarity |
NPD9022 |
Phase 2 |
0.7692 |
Intermediate Similarity |
NPD9024 |
Phase 2 |
0.7612 |
Intermediate Similarity |
NPD9440 |
Discontinued |
0.7143 |
Intermediate Similarity |
NPD9033 |
Approved |
0.7143 |
Intermediate Similarity |
NPD9030 |
Approved |
0.7143 |
Intermediate Similarity |
NPD9032 |
Approved |
0.7143 |
Intermediate Similarity |
NPD9031 |
Approved |
0.7125 |
Intermediate Similarity |
NPD9401 |
Discovery |
0.7042 |
Intermediate Similarity |
NPD9444 |
Discontinued |
0.7037 |
Intermediate Similarity |
NPD394 |
Phase 3 |
0.6667 |
Remote Similarity |
NPD883 |
Phase 2 |
0.6667 |
Remote Similarity |
NPD882 |
Phase 2 |
0.6579 |
Remote Similarity |
NPD67 |
Phase 2 |
0.6579 |
Remote Similarity |
NPD9034 |
Approved |
0.6462 |
Remote Similarity |
NPD3215 |
Phase 1 |
0.6184 |
Remote Similarity |
NPD9445 |
Approved |
0.6154 |
Remote Similarity |
NPD3214 |
Discontinued |
0.6125 |
Remote Similarity |
NPD372 |
Clinical (unspecified phase) |
0.6064 |
Remote Similarity |
NPD4836 |
Approved |
0.6064 |
Remote Similarity |
NPD4837 |
Approved |
0.6064 |
Remote Similarity |
NPD4835 |
Approved |
0.6064 |
Remote Similarity |
NPD4838 |
Approved |
0.6026 |
Remote Similarity |
NPD6704 |
Discontinued |
0.6 |
Remote Similarity |
NPD8868 |
Approved |
0.5854 |
Remote Similarity |
NPD9434 |
Approved |
0.5854 |
Remote Similarity |
NPD9435 |
Approved |
0.5851 |
Remote Similarity |
NPD4282 |
Approved |
0.5816 |
Remote Similarity |
NPD2700 |
Approved |
0.5714 |
Remote Similarity |
NPD9429 |
Discontinued |
0.5714 |
Remote Similarity |
NPD8045 |
Clinical (unspecified phase) |
0.5692 |
Remote Similarity |
NPD399 |
Approved |
0.5692 |
Remote Similarity |
NPD398 |
Approved |
0.5692 |
Remote Similarity |
NPD400 |
Approved |
0.5658 |
Remote Similarity |
NPD9442 |
Clinical (unspecified phase) |
0.5618 |
Remote Similarity |
NPD3200 |
Clinical (unspecified phase) |
0.561 |
Remote Similarity |
NPD9407 |
Approved |
0.56
|
Remote Similarity |
NPD9211 |
Clinical (unspecified phase) |