Natural Product: NPC17244
Natural Product ID:   | NPC17244 |
Common Name:   | (R)-Aminocarnitine |
IUPAC Name:   | (3R)-3-amino-4-(trimethylazaniumyl)butanoate |
Synonyms:   | (R)-Aminocarnitine |
Molecular Formula:   | C7H16N2O2 |
Standard InCHIKey:   | DAWBGYHPBBDHMQ-ZCFIWIBFSA-N |
Standard InCHI:   | InChI=1S/C7H16N2O2/c1-9(2,3)5-6(8)4-7(10)11/h6H,4-5,8H2,1-3H3/t6-/m1/s1 |
Canonical SMILES:   | N[C@@H](C[N+](C)(C)C)CC(=O)[O-] |
First Find Year:   | |
Max Developmental Stage:   | |
Synthetic Gene Cluster:   |
; |
  Species Source
Organism ID |
Organism Name |
Taxonomy Level |
Family |
SuperKingdom |
Isolation Part |
Collection Location |
Collection Time |
Reference |
NPO568 |
Peganum nigellastrum |
Species |
Nitrariaceae |
Eukaryota |
|
|
|
UNPD* |
NPO4291 |
Laurencia brongniartii |
Species |
Rhodomelaceae |
Eukaryota |
|
|
|
UNPD* |
  Biological Activity
Activity Type |
# Activity |
IC50 |
11 |
Others |
10 |
Activity Type |
# Activity |
Cell Line |
1 |
Individual Protein |
6 |
Organism |
10 |
Others |
4 |
Target ID |
Target Type |
Target Name |
Target Organism |
Activity Type |
Activity Relation |
Value |
Unit |
Reference |
NPT29 |
Organism |
Rattus norvegicus |
Rattus norvegicus |
Inhibition |
= |
36 |
% |
3612690 |
NPT29 |
Organism |
Rattus norvegicus |
Rattus norvegicus |
Inhibition |
= |
11 |
% |
3612690 |
NPT29 |
Organism |
Rattus norvegicus |
Rattus norvegicus |
Inhibition |
= |
90 |
% |
3612690 |
NPT29 |
Organism |
Rattus norvegicus |
Rattus norvegicus |
Inhibition |
= |
59 |
% |
3612690 |
NPT91 |
Cell Line |
KB |
Homo sapiens |
IC50 |
= |
970 |
nM |
21504156 |
NPT1375 |
Individual Protein |
Carnitine palmitoyltransferase 2 |
Homo sapiens |
IC50 |
= |
3900 |
nM |
21504156 |
NPT1376 |
Individual Protein |
Carnitine palmitoyltransferase 1B |
Rattus norvegicus |
IC50 |
= |
27300 |
nM |
21504156 |
NPT1377 |
Individual Protein |
Carnitine palmitoyltransferase 2 |
Rattus norvegicus |
IC50 |
= |
5100 |
nM |
21504156 |
NPT1378 |
Individual Protein |
Carnitine O-palmitoyltransferase 1, muscle isoform |
Homo sapiens |
IC50 |
> |
100000 |
nM |
21504156 |
NPT1379 |
Individual Protein |
Carnitine O-palmitoyltransferase 1, liver isoform |
Homo sapiens |
IC50 |
= |
76400 |
nM |
21504156 |
NPT29 |
Organism |
Rattus norvegicus |
Rattus norvegicus |
Activity |
= |
16 |
% |
21504156 |
NPT29 |
Organism |
Rattus norvegicus |
Rattus norvegicus |
Activity |
= |
88 |
% |
21504156 |
NPT29 |
Organism |
Rattus norvegicus |
Rattus norvegicus |
Activity |
= |
1034 |
% |
21504156 |
NPT29 |
Organism |
Rattus norvegicus |
Rattus norvegicus |
Activity |
= |
244 |
% |
21504156 |
NPT29 |
Organism |
Rattus norvegicus |
Rattus norvegicus |
Activity |
= |
684 |
% |
21504156 |
NPT29 |
Organism |
Rattus norvegicus |
Rattus norvegicus |
Activity |
= |
68 |
% |
21504156 |
NPT1377 |
Individual Protein |
Carnitine palmitoyltransferase 2 |
Rattus norvegicus |
IC50 |
= |
800 |
nM |
21504156 |
NPT2 |
Others |
Unspecified |
|
IC50 |
= |
5400 |
nM |
21504156 |
NPT2 |
Others |
Unspecified |
|
IC50 |
= |
12000 |
nM |
21504156 |
NPT2 |
Others |
Unspecified |
|
IC50 |
= |
3200 |
nM |
21504156 |
  Similar Natural Products in NPASS
Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient
●  The left chart: Distribution of similarity level between NPC17244 and all remaining natural products in the NPASS database.
●  The right table: Most similar natural products (Tc>=0.56 or Top200).
range |
Tanimoto Coefficient |
0-0.1 | 1566 |
0.1-0.2 | 21903 |
0.2-0.3 | 5959 |
0.3-0.4 | 1005 |
0.4-0.5 | 290 |
0.5-0.6 | 140 |
0.6-0.7 | 24 |
0.7-0.8 | 2 |
0.8-0.85 | 0 |
0.85-0.9 | 0 |
0.9-0.95 | 0 |
0.95-1 | 0 |
  Similar Clinical/Approved Drugs
Similarity level is defined by Tanimoto coefficient (Tc) between two molecules.
●  The left chart: Distribution of similarity level between NPC17244 and all drugs/candidates.
●  The right table: Most similar clinical/approved drugs (Tc>=0.56 or Top200).
range |
Tanimoto Coefficient |
0-0.1 | 111 |
0.1-0.2 | 5121 |
0.2-0.3 | 2951 |
0.3-0.4 | 636 |
0.4-0.5 | 221 |
0.5-0.6 | 113 |
0.6-0.7 | 7 |
0.7-0.8 | 0 |
0.8-0.85 | 0 |
0.85-0.9 | 0 |
0.9-0.95 | 0 |
0.95-1 | 1 |
Similarity Score |
Similarity Level |
Drug ID |
Developmental Stage |
1.0 |
High Similarity |
NPD9230 |
Discontinued |
0.6923 |
Remote Similarity |
NPD5382 |
Phase 2 |
0.6667 |
Remote Similarity |
NPD8623 |
Phase 1 |
0.6275 |
Remote Similarity |
NPD8609 |
Approved |
0.6154 |
Remote Similarity |
NPD8804 |
Approved |
0.6154 |
Remote Similarity |
NPD8805 |
Approved |
0.6061 |
Remote Similarity |
NPD1429 |
Clinical (unspecified phase) |
0.6038 |
Remote Similarity |
NPD8798 |
Approved |
0.5968 |
Remote Similarity |
NPD9671 |
Phase 2 |
0.5968 |
Remote Similarity |
NPD9670 |
Phase 2 |
0.5965 |
Remote Similarity |
NPD8871 |
Approved |
0.5965 |
Remote Similarity |
NPD8872 |
Phase 3 |
0.5926 |
Remote Similarity |
NPD8610 |
Approved |
0.5893 |
Remote Similarity |
NPD8614 |
Approved |
0.5893 |
Remote Similarity |
NPD8808 |
Approved |
0.5893 |
Remote Similarity |
NPD8809 |
Approved |
0.5818 |
Remote Similarity |
NPD9020 |
Approved |
0.5806 |
Remote Similarity |
NPD9433 |
Approved |
0.5806 |
Remote Similarity |
NPD8784 |
Clinical (unspecified phase) |
0.5789 |
Remote Similarity |
NPD9044 |
Approved |
0.5789 |
Remote Similarity |
NPD9017 |
Approved |
0.5789 |
Remote Similarity |
NPD9016 |
Clinical (unspecified phase) |
0.5789 |
Remote Similarity |
NPD9018 |
Approved |
0.5763 |
Remote Similarity |
NPD8785 |
Approved |
0.5763 |
Remote Similarity |
NPD9660 |
Approved |
0.5763 |
Remote Similarity |
NPD8851 |
Phase 1 |
0.5714 |
Remote Similarity |
NPD398 |
Approved |
0.5714 |
Remote Similarity |
NPD400 |
Approved |
0.5714 |
Remote Similarity |
NPD399 |
Approved |
0.569 |
Remote Similarity |
NPD9225 |
Phase 3 |
0.569 |
Remote Similarity |
NPD9226 |
Approved |
0.5672 |
Remote Similarity |
NPD8952 |
Approved |
0.5636 |
Remote Similarity |
NPD9658 |
Clinical (unspecified phase) |
0.5625 |
Remote Similarity |
NPD902 |
Approved |
0.56 |
Remote Similarity |
NPD8211 |
Approved |
0.56
|
Remote Similarity |
NPD8210 |
Phase 3 |