17 Known Ingredients in Total
Unique ingredients have been isolated from this plant.
Plant-Ingredients Associations were manually curated from publications or collected from other databases.
7 Ingredients with Available Activity
Unique ingredients have activity data available.
Ingredient Structrual Cards
Ingredient ID: NPC97716
Formula: C20H16O5
Ingredient ID: NPC97716
| Common Name | Alpinumisoflavone |
| IUPAC Name | 5-hydroxy-7-(4-hydroxyphenyl)-2,2-dimethylpyrano[3,2-g]chromen-6-one |
| Canonical SMILES | Oc1ccc(cc1)c1coc2c(c1=O)c(O)c1c(c2)OC(C=C1)(C)C |
| Standard InCHI | InChI=1S/C20H16O5/c1-20(2)8-7-13-15(25-20)9-16-17(18(13)22)19(23)14(10-24-16)11-3-5-12(21)6-4-11/h3-10,21-22H,1-2H3 |
| Standard InCHIKey | RQAMSFTXEFSBPK-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 5490139 ZINC ID: ZINC000014417338 ChEMBL ID: CHEMBL238628 |
| Plant-Ingredient Association Reference |
Database: UNPD [] Database: NPASS [NPC97716] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Piper dilatatum | Piper | Piperaceae |
 |
| Erysimum leptophyllum | Erysimum | Brassicaceae | |
| Chondrodendron tomentosum | Chondrodendron | Menispermaceae |
 |
| Haplophyllum obtusifolium | Haplophyllum | Rutaceae | |
| Syzygium polycephaloides | Syzygium | Myrtaceae |
|
| Ficus mucuso | Ficus | Moraceae |
|
| Piper regnellii | Piper | Piperaceae |
|
| Gymnocalycium schickendantzii | Gymnocalycium | Cactaceae | |
| Onopordum acanthium | Onopordum | Asteraceae |
|
| Pancratium sickenbergeri | Pancratium | Amaryllidaceae | |
| Centaurea maculosa | Centaurea | Asteraceae | |
| Ephedra sinica | Ephedra | Ephedraceae |
|
| Plathymenia reticulata | Plathymenia | Fabaceae | |
| Asimina parviflora | Asimina | Annonaceae |
|
| Pteridium esculentum | Pteridium | Dennstaedtiaceae |
|
| Esenbeckia leiocarpa | Esenbeckia | Rutaceae | |
| Sophora flavescens | Sophora | Fabaceae |
|
| Hypericum styphelioides | Hypericum | Hypericaceae | |
| Vellozia nanuzae | Vellozia | Velloziaceae | |
| Baccharis neglecta | Baccharis | Asteraceae | |
| Atraphaxis spinosa | Atraphaxis | Polygonaceae |
|
| Embelia schimperi | Embelia | Primulaceae |
|
| Epilobium hirsutum | Epilobium | Onagraceae |
|
| Lythrum salicaria | Lythrum | Lythraceae |
|
| Simarouba glauca | Simarouba | Simaroubaceae |
|
| Erythrina melanacantha | Erythrina | Fabaceae |
|
| Monsonia senegalensis | Monsonia | Geraniaceae |
|
| Clerodendrum bungei | Clerodendrum | Lamiaceae |
|
| Lemaireocereus longispinus | Lemaireocereus | Cactaceae | |
| Eria anomala | Eria | Orchidaceae | |
| Embelia parviflora | Embelia | Primulaceae |
|
| Euphorbia nematocypha | Euphorbia | Euphorbiaceae |
|
| Abelia chinensis | Abelia | Caprifoliaceae | |
| Diospyros assimilis | Diospyros | Ebenaceae |
|
| Faramea salicifolia | Faramea | Rubiaceae | |
| Vernonia fagifolia | Vernonia | Asteraceae | |
| Cordia leucocephala | Cordia | Cordiaceae | |
| Maclura cochinchinensis | Maclura | Moraceae |
|
| Erycibe expansa | Erycibe | Convolvulaceae |
|
| Helichrysum tenuifolium | Helichrysum | Asteraceae | |
| Ulex airensis | Ulex | Fabaceae | |
| Morella rubra | Morella | Myricaceae | |
| Amaranthus spinosus | Amaranthus | Amaranthaceae |
|
Ingredient ID: NPC77890
Formula: C11H14N2O
Ingredient ID: NPC77890
| Common Name | Cytisine |
| IUPAC Name | n.a. |
| Canonical SMILES | O=c1cccc2n1C[C@@H]1CNC[C@H]2C1 |
| Standard InCHI | InChI=1S/C11H14N2O/c14-11-3-1-2-10-9-4-8(5-12-6-9)7-13(10)11/h1-3,8-9,12H,4-7H2/t8-,9+/m0/s1 |
| Standard InCHIKey | ANJTVLIZGCUXLD-DTWKUNHWSA-N |
| Ingredient External Links |
PubChem CID: 10235 ZINC ID: ZINC000001599730 ChEMBL ID: CHEMBL497939 |
| Plant-Ingredient Association Reference |
Database: UNPD [] Database: NPASS [NPC77890] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Piper dilatatum | Piper | Piperaceae |
|
| Inulanthera calva | Inulanthera | Asteraceae | |
| Nicotiana raimondii | Nicotiana | Solanaceae | |
| Scolopia chinensis | Scolopia | Salicaceae | |
| Sophora flavescens | Sophora | Fabaceae |
|
| Heliotropium hirsutissimum | Heliotropium | Heliotropiaceae | |
| Trollius europaeus | Trollius | Ranunculaceae |
|
| Amaranthus spinosus | Amaranthus | Amaranthaceae |
|
| Arum maximum | Arum | Araceae |
Ingredient ID: NPC7013
Formula: C16H12O5
Ingredient ID: NPC7013
| Common Name | 7-Hydroxy-3-(4-Hydroxyphenyl)-5-Methoxychromen-4-One |
| IUPAC Name | 7-hydroxy-3-(4-hydroxyphenyl)-5-methoxychromen-4-one |
| Canonical SMILES | COc1cc(O)cc2c1c(=O)c(co2)c1ccc(cc1)O |
| Standard InCHI | InChI=1S/C16H12O5/c1-20-13-6-11(18)7-14-15(13)16(19)12(8-21-14)9-2-4-10(17)5-3-9/h2-8,17-18H,1H3 |
| Standard InCHIKey | YSINCDVRUMTOPK-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 5748551 ZINC ID: ZINC000013124366 ChEMBL ID: CHEMBL1479463 |
| Plant-Ingredient Association Reference |
Database: UNPD [] Database: NPASS [NPC7013] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Piper dilatatum | Piper | Piperaceae |
|
| Inulanthera calva | Inulanthera | Asteraceae | |
| Garcinia oblongifolia | Garcinia | Clusiaceae |
|
| Neomeris annulata | Neomeris | Dasycladaceae | |
| Nicotiana raimondii | Nicotiana | Solanaceae | |
| Scolopia chinensis | Scolopia | Salicaceae | |
| Trifolium pratense | Trifolium | Fabaceae |
  |
| Trifolium resupinatum | Trifolium | Fabaceae |
 |
| Heliotropium hirsutissimum | Heliotropium | Heliotropiaceae | |
| Trollius europaeus | Trollius | Ranunculaceae |
|
| Zanthoxylum decaryi | Zanthoxylum | Rutaceae |
|
| Amaranthus spinosus | Amaranthus | Amaranthaceae |
|
| Cistanche salsa | Cistanche | Orobanchaceae |
|
| Piper wightii | Piper | Piperaceae | |
| Arum maximum | Arum | Araceae |
Ingredient ID: NPC61321
Formula: C15H20N2O
Ingredient ID: NPC61321
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | O=c1cccc2n1C[C@H]1C[C@@H]2CN2[C@@H]1CCCC2 |
| Standard InCHI | InChI=1S/C15H20N2O/c18-15-6-3-5-14-11-8-12(10-17(14)15)13-4-1-2-7-16(13)9-11/h3,5-6,11-13H,1-2,4,7-10H2/t11-,12-,13-/m1/s1 |
| Standard InCHIKey | FQEQMASDZFXSJI-JHJVBQTASA-N |
| Ingredient External Links |
PubChem CID: 5351589 ZINC ID: ZINC000000900282 |
| Plant-Ingredient Association Reference |
Database: UNPD [] Database: NPASS [NPC61321] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Piper dilatatum | Piper | Piperaceae |
|
| Erysimum leptophyllum | Erysimum | Brassicaceae | |
| Chondrodendron tomentosum | Chondrodendron | Menispermaceae |
|
| Haplophyllum obtusifolium | Haplophyllum | Rutaceae | |
| Syzygium polycephaloides | Syzygium | Myrtaceae |
|
| Piper regnellii | Piper | Piperaceae |
|
| Gymnocalycium schickendantzii | Gymnocalycium | Cactaceae | |
| Thermopsis lanceolata | Thermopsis | Fabaceae |
|
| Onopordum acanthium | Onopordum | Asteraceae |
|
| Pancratium sickenbergeri | Pancratium | Amaryllidaceae | |
| Centaurea maculosa | Centaurea | Asteraceae | |
| Ephedra sinica | Ephedra | Ephedraceae |
|
| Plathymenia reticulata | Plathymenia | Fabaceae | |
| Asimina parviflora | Asimina | Annonaceae |
|
| Pteridium esculentum | Pteridium | Dennstaedtiaceae |
|
| Esenbeckia leiocarpa | Esenbeckia | Rutaceae | |
| Sophora flavescens | Sophora | Fabaceae |
|
| Hypericum styphelioides | Hypericum | Hypericaceae | |
| Vellozia nanuzae | Vellozia | Velloziaceae | |
| Baccharis neglecta | Baccharis | Asteraceae | |
| Atraphaxis spinosa | Atraphaxis | Polygonaceae |
|
| Embelia schimperi | Embelia | Primulaceae |
|
| Epilobium hirsutum | Epilobium | Onagraceae |
|
| Lythrum salicaria | Lythrum | Lythraceae |
|
| Simarouba glauca | Simarouba | Simaroubaceae |
|
| Erythrina melanacantha | Erythrina | Fabaceae |
|
| Monsonia senegalensis | Monsonia | Geraniaceae |
|
| Clerodendrum bungei | Clerodendrum | Lamiaceae |
|
| Lemaireocereus longispinus | Lemaireocereus | Cactaceae | |
| Eria anomala | Eria | Orchidaceae | |
| Embelia parviflora | Embelia | Primulaceae |
|
| Euphorbia nematocypha | Euphorbia | Euphorbiaceae |
|
| Abelia chinensis | Abelia | Caprifoliaceae | |
| Diospyros assimilis | Diospyros | Ebenaceae |
|
| Faramea salicifolia | Faramea | Rubiaceae | |
| Vernonia fagifolia | Vernonia | Asteraceae | |
| Cordia leucocephala | Cordia | Cordiaceae | |
| Thermopsis alpina | Thermopsis | Fabaceae |
|
| Helichrysum tenuifolium | Helichrysum | Asteraceae | |
| Morella rubra | Morella | Myricaceae | |
| Amaranthus spinosus | Amaranthus | Amaranthaceae |
|
Ingredient ID: NPC56212
Formula: C39H66N2O29
Ingredient ID: NPC56212
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H]([C@@H]([C@H]2O[C@@H]2O[C@@H](C)[C@H]([C@H]([C@@H]2O)O)O)N=C(O)C)O)[C@@H]([C@H]([C@@H]1O[C@@H]1O[C@H](CO[C@H]2O[C@H](CO)[C@H]([C@@H]([C@@H]2O)O)O)[C@H]([C@@H]([C@@H]1O[C@@H]1OC[C@H]([C@@H]([C@H]1O)O)O)O)O)O)N=C(O)C |
| Standard InCHI | InChI=1S/C39H66N2O29/c1-9-19(48)24(53)29(58)38(62-9)69-32-18(41-11(3)46)34(59)63-15(6-44)31(32)68-35-17(40-10(2)45)23(52)30(14(5-43)65-35)67-39-33(70-37-27(56)20(49)12(47)7-60-37)26(55)22(51)16(66-39)8-61-36-28(57)25(54)21(50)13(4-42)64-36/h9,12-39,42-44,47-59H,4-8H2,1-3H3,(H,40,45)(H,41,46)/t9-,12+,13+,14+,15+,16+,17+,18+,19+,20-,21+,22+,23+,24+,25-,26-,27+,28-,29-,30+,31+,32+,33-,34-,35-,36-,37-,38-,39-/m0/s1 |
| Standard InCHIKey | UNMLVGNWZDHBRA-GZQLXHBESA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD197361] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Piper dilatatum | Piper | Piperaceae |
|
| Amaranthus spinosus | Amaranthus | Amaranthaceae |
|
Ingredient ID: NPC39426
Formula: C15H10O5
Ingredient ID: NPC39426
| Common Name | Genistein |
| IUPAC Name | 5,7-dihydroxy-3-(4-hydroxyphenyl)chromen-4-one |
| Canonical SMILES | Oc1ccc(cc1)c1coc2c(c1=O)c(O)cc(c2)O |
| Standard InCHI | InChI=1S/C15H10O5/c16-9-3-1-8(2-4-9)11-7-20-13-6-10(17)5-12(18)14(13)15(11)19/h1-7,16-18H |
| Standard InCHIKey | TZBJGXHYKVUXJN-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 5280961 ChEMBL ID: CHEMBL44 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD152676] Database: NPASS [NPC39426] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Hyoscyamus pusillus | Hyoscyamus | Solanaceae |
|
| Teucrium betonicum | Teucrium | Lamiaceae | |
| Ipomoea muricata | Ipomoea | Convolvulaceae |
|
| Allagopappus viscosissimus | Allagopappus | Asteraceae | |
| Parameria laevigata | Parameria | Apocynaceae |
|
| Piper dilatatum | Piper | Piperaceae |
|
| Pinus koraiensis | Pinus | Pinaceae |
|
| Inulanthera calva | Inulanthera | Asteraceae | |
| Garcinia oblongifolia | Garcinia | Clusiaceae |
|
| Astragalus spinosus | Astragalus | Fabaceae | |
| Neomeris annulata | Neomeris | Dasycladaceae | |
| Swertia decussata | Swertia | Gentianaceae |
|
| Peltogyne pubescens | Peltogyne | Fabaceae | |
| Vepris nobilis | Vepris | Rutaceae |
|
| Nicotiana raimondii | Nicotiana | Solanaceae | |
| Ranunculus peltatus | Ranunculus | Ranunculaceae | |
| Murraya exotica | Murraya | Rutaceae |
|
| Hydrangea serrata | Hydrangea | Hydrangeaceae |
|
| Lunularia cruciata | Lunularia | Lunulariaceae | |
| Astragalus bicuspis | Astragalus | Fabaceae | |
| Euphrasia stricta | Euphrasia | Orobanchaceae | |
| Lespedeza floribunda | Lespedeza | Fabaceae |
|
| Bertya dimerostigma | Bertya | Euphorbiaceae | |
| Styrax agrestis | Styrax | Styracaceae | |
| Dalbergia parviflora | Dalbergia | Fabaceae |
|
| Vitex negundo | Vitex | Lamiaceae |
|
| Justicia adhatoda | Justicia | Acanthaceae |
|
| Convallaria majalis | Convallaria | Asparagaceae |
|
| Scolopia chinensis | Scolopia | Salicaceae | |
| Chrysanthemum uliginosum | Chrysanthemum | Asteraceae | |
| Prunus serrulata var. spontanea | Prunus | Rosaceae |
|
| Glycyrrhiza inflata | Glycyrrhiza | Fabaceae |
|
| Rabdosia angustifolia | Isodon | Lamiaceae | |
| Dalbergia odorifera | Dalbergia | Fabaceae |
|
| Dalbergia sissoo | Dalbergia | Fabaceae |
|
| Papaver tatricum | Papaver | Papaveraceae | |
| Sophora flavescens | Sophora | Fabaceae |
|
| Conyza japonica | Conyza | Asteraceae |
|
| Dalbergia frutescens | Dalbergia | Fabaceae | |
| Sophora japonica | Sophora | Fabaceae |
|
| Smilax bracteata | Smilax | Smilacaceae |
|
| Dendrobium candidum | Dendrobium | Orchidaceae | |
| Trifolium pratense | Trifolium | Fabaceae |
|
| Calicotome villosa | Calicotome | Fabaceae |
|
| Tynanthus panurensis | Tynanthus | Bignoniaceae | |
| Erysimum siliculosum | Erysimum | Brassicaceae | |
| Rosulabryum capillare | Rosulabryum | Bryaceae | |
| Citrus rugulosa | Citrus | Rutaceae | |
| Scutellaria sieberi | Scutellaria | Lamiaceae | |
| Christisonia bicolor | Christisonia | Orobanchaceae | |
| Lupinus luteus | Lupinus | Fabaceae |
|
| Aglaia australiensis | Aglaia | Meliaceae | |
| Spatholobus suberectus | Spatholobus | Fabaceae |
|
| Delphinium barbeyi | Delphinium | Ranunculaceae |
|
| Atroxima liberica | Atroxima | Polygalaceae | |
| Erycibe expansa | Erycibe | Convolvulaceae |
|
| Ginkgo biloba | Ginkgo | Ginkgoaceae |
|
| Trifolium resupinatum | Trifolium | Fabaceae |
|
| Linum crispum | Linum | Linaceae | |
| Palafoxia texana | Palafoxia | Asteraceae | |
| Macadamia ternifolia | Macadamia | Proteaceae |
|
| Heliotropium hirsutissimum | Heliotropium | Heliotropiaceae | |
| Sanguisorba officinalis | Sanguisorba | Rosaceae |
|
| Murraya paniculata | Murraya | Rutaceae |
|
| Derris scandens | Derris | Fabaceae |
|
| Cullen corylifolium | Cullen | Fabaceae |
|
| Piptanthus nepalensis | Piptanthus | Fabaceae |
|
| Glycyrrhiza glabra | Glycyrrhiza | Fabaceae |
|
| Pueraria lobata | Pueraria | Fabaceae |
|
| Cudrania tricuspidata | Maclura | Moraceae |
|
| Desmodium styracifolium | Desmodium | Fabaceae |
|
| Diplacus longiflorus | Diplacus | Phrymaceae | |
| Achillea pseudopectinata | Achillea | Asteraceae | |
| Trollius europaeus | Trollius | Ranunculaceae |
|
| Teucrium marum | Teucrium | Lamiaceae |
|
| Syzygium nervosum | Syzygium | Myrtaceae |
|
| Lepidosperma ustulatum | Lepidosperma | Cyperaceae | |
| Lawsonia inermis | Lawsonia | Lythraceae |
|
| Zanthoxylum decaryi | Zanthoxylum | Rutaceae |
|
| Astragalus wiedemannianus | Astragalus | Fabaceae | |
| Salvia miltiorrhiza | Salvia | Lamiaceae |
|
| Petroselinum crispum | Petroselinum | Apiaceae |
|
| Amaranthus spinosus | Amaranthus | Amaranthaceae |
|
| Dunalia solanacea | Dunalia | Solanaceae | |
| Bergenia crassifolia | Bergenia | Saxifragaceae |
|
| Cistanche salsa | Cistanche | Orobanchaceae |
|
| Camchaya loloana | Camchaya | Asteraceae | |
| Berberis floribunda | Berberis | Berberidaceae |
|
| Glycyrrhiza uralensis | Glycyrrhiza | Fabaceae |
|
| Pterocarpus indicus | Pterocarpus | Fabaceae |
|
| Jamesoniella colorata | Jamesoniella | Jungermanniaceae |
|
| Fumaria micrantha | Fumaria | Papaveraceae | |
| Glycine max | Glycine | Fabaceae |
|
| Sophora tonkinensis | Sophora | Fabaceae | |
| Pterodon emarginatus | Pterodon | Fabaceae | |
| Berlinia tomentosa | Berlinia | Fabaceae | |
| Pseudocinchona pachyceras | Pseudocinchona | Rubiaceae | |
| Hibiscus schizopetalus | Hibiscus | Malvaceae |
|
| Cymodocea nodosa | Cymodocea | Cymodoceaceae | |
| Flemingia macrophylla | Flemingia | Fabaceae |
|
| Bonamia spectabilis | Bonamia | Convolvulaceae | |
| Pueraria montana var. lobata | Pueraria | Fabaceae |
|
| Licaria brasiliensis | Licaria | Lauraceae | |
| Crotalaria orixensis | Crotalaria | Fabaceae |
|
| Kaempferia rotunda | Kaempferia | Zingiberaceae |
|
| Atuna racemosa | Atuna | Chrysobalanaceae |
|
| Astragalus pycnanthus | Astragalus | Fabaceae | |
| Piper wightii | Piper | Piperaceae | |
| Pulsatilla campanella | Pulsatilla | Ranunculaceae |
|
| Arum maximum | Arum | Araceae |
Ingredient ID: NPC32219
Formula: C20H18O6
Ingredient ID: NPC32219
| Common Name | n.a. |
| IUPAC Name | 5,7-dihydroxy-6-[(2R)-2-hydroxy-3-methylbut-3-enyl]-3-(4-hydroxyphenyl)chromen-4-one |
| Canonical SMILES | CC(=C)[C@@H](Cc1c(O)cc2c(c1O)c(=O)c(co2)c1ccc(cc1)O)O |
| Standard InCHI | InChI=1S/C20H18O6/c1-10(2)15(22)7-13-16(23)8-17-18(19(13)24)20(25)14(9-26-17)11-3-5-12(21)6-4-11/h3-6,8-9,15,21-24H,1,7H2,2H3/t15-/m1/s1 |
| Standard InCHIKey | GGHDLVXWIPWSLS-OAHLLOKOSA-N |
| Ingredient External Links |
PubChem CID: 26250194 ZINC ID: ZINC000014819515 |
| Plant-Ingredient Association Reference |
Database: UNPD [] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Piper dilatatum | Piper | Piperaceae |
|
| Amaranthus spinosus | Amaranthus | Amaranthaceae |
|
Ingredient ID: NPC268204
Formula: C20H18O6
Ingredient ID: NPC268204
| Common Name | Uncinanone A |
| IUPAC Name | 3-(2,4-dihydroxyphenyl)-5,7-dihydroxy-6-(3-methylbut-2-enyl)chromen-4-one |
| Canonical SMILES | CC(=CCc1c(O)cc2c(c1O)c(=O)c(co2)c1ccc(cc1O)O)C |
| Standard InCHI | InChI=1S/C20H18O6/c1-10(2)3-5-13-16(23)8-17-18(19(13)24)20(25)14(9-26-17)12-6-4-11(21)7-15(12)22/h3-4,6-9,21-24H,5H2,1-2H3 |
| Standard InCHIKey | MMPVAPMCVABQPS-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 5281797 ZINC ID: ZINC000005854353 ChEMBL ID: CHEMBL549617 |
| Plant-Ingredient Association Reference |
Database: UNPD [] Database: NPASS [NPC268204] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Piper dilatatum | Piper | Piperaceae |
|
| Erysimum leptophyllum | Erysimum | Brassicaceae | |
| Chondrodendron tomentosum | Chondrodendron | Menispermaceae |
|
| Haplophyllum obtusifolium | Haplophyllum | Rutaceae | |
| Syzygium polycephaloides | Syzygium | Myrtaceae |
|
| Piper regnellii | Piper | Piperaceae |
|
| Gymnocalycium schickendantzii | Gymnocalycium | Cactaceae | |
| Onopordum acanthium | Onopordum | Asteraceae |
|
| Pancratium sickenbergeri | Pancratium | Amaryllidaceae | |
| Centaurea maculosa | Centaurea | Asteraceae | |
| Ephedra sinica | Ephedra | Ephedraceae |
|
| Plathymenia reticulata | Plathymenia | Fabaceae | |
| Asimina parviflora | Asimina | Annonaceae |
|
| Pteridium esculentum | Pteridium | Dennstaedtiaceae |
|
| Esenbeckia leiocarpa | Esenbeckia | Rutaceae | |
| Sophora flavescens | Sophora | Fabaceae |
|
| Hypericum styphelioides | Hypericum | Hypericaceae | |
| Vellozia nanuzae | Vellozia | Velloziaceae | |
| Baccharis neglecta | Baccharis | Asteraceae | |
| Atraphaxis spinosa | Atraphaxis | Polygonaceae |
|
| Embelia schimperi | Embelia | Primulaceae |
|
| Epilobium hirsutum | Epilobium | Onagraceae |
|
| Lythrum salicaria | Lythrum | Lythraceae |
|
| Simarouba glauca | Simarouba | Simaroubaceae |
|
| Erythrina melanacantha | Erythrina | Fabaceae |
|
| Monsonia senegalensis | Monsonia | Geraniaceae |
|
| Clerodendrum bungei | Clerodendrum | Lamiaceae |
|
| Lemaireocereus longispinus | Lemaireocereus | Cactaceae | |
| Eria anomala | Eria | Orchidaceae | |
| Embelia parviflora | Embelia | Primulaceae |
|
| Euphorbia nematocypha | Euphorbia | Euphorbiaceae |
|
| Abelia chinensis | Abelia | Caprifoliaceae | |
| Diospyros assimilis | Diospyros | Ebenaceae |
|
| Faramea salicifolia | Faramea | Rubiaceae | |
| Vernonia fagifolia | Vernonia | Asteraceae | |
| Cordia leucocephala | Cordia | Cordiaceae | |
| Helichrysum tenuifolium | Helichrysum | Asteraceae | |
| Morella rubra | Morella | Myricaceae | |
| Amaranthus spinosus | Amaranthus | Amaranthaceae |
|
Ingredient ID: NPC259166
Formula: C20H18O5
Ingredient ID: NPC259166
| Common Name | Wighteone |
| IUPAC Name | 5,7-dihydroxy-3-(4-hydroxyphenyl)-6-(3-methylbut-2-enyl)chromen-4-one |
| Canonical SMILES | CC(=CCc1c(O)cc2c(c1O)c(=O)c(co2)c1ccc(cc1)O)C |
| Standard InCHI | InChI=1S/C20H18O5/c1-11(2)3-8-14-16(22)9-17-18(19(14)23)20(24)15(10-25-17)12-4-6-13(21)7-5-12/h3-7,9-10,21-23H,8H2,1-2H3 |
| Standard InCHIKey | KIMDVVKVNNSHGZ-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 5281814 ZINC ID: ZINC000005195795 ChEMBL ID: CHEMBL393222 |
| Plant-Ingredient Association Reference |
Database: UNPD [] Database: NPASS [NPC259166] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Piper dilatatum | Piper | Piperaceae |
|
| Centella asiatica | Centella | Apiaceae |
|
| Glycyrrhiza inflata | Glycyrrhiza | Fabaceae |
|
| Sophora flavescens | Sophora | Fabaceae |
|
| Erycibe expansa | Erycibe | Convolvulaceae |
|
| Calotropis procera | Calotropis | Apocynaceae |
|
| Glycyrrhiza glabra | Glycyrrhiza | Fabaceae |
|
| Erythrina variegate | Erythrina | Fabaceae | |
| Cudrania tricuspidata | Maclura | Moraceae |
|
| Amaranthus spinosus | Amaranthus | Amaranthaceae |
|
| Glycyrrhiza uralensis | Glycyrrhiza | Fabaceae |
|
Ingredient ID: NPC202564
Formula: C20H16O6
Ingredient ID: NPC202564
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | Oc1ccc(cc1)c1coc2c(c1=O)c(O)c1c(c2)OC([C@H]2[C@@H]1O2)(C)C |
| Standard InCHI | InChI=1S/C20H16O6/c1-20(2)19-18(25-19)15-13(26-20)7-12-14(17(15)23)16(22)11(8-24-12)9-3-5-10(21)6-4-9/h3-8,18-19,21,23H,1-2H3/t18-,19-/m1/s1 |
| Standard InCHIKey | VTCPKAZOZJPWSB-RTBURBONSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD73157] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Piper dilatatum | Piper | Piperaceae |
|
| Amaranthus spinosus | Amaranthus | Amaranthaceae |
|
Ingredient ID: NPC1804
Formula: C21H20O7
Ingredient ID: NPC1804
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | CO[C@@H]1c2c(cc3c(c2O)c(=O)c(co3)c2ccc(cc2)O)OC([C@@H]1O)(C)C |
| Standard InCHI | InChI=1S/C21H20O7/c1-21(2)20(25)19(26-3)16-14(28-21)8-13-15(18(16)24)17(23)12(9-27-13)10-4-6-11(22)7-5-10/h4-9,19-20,22,24-25H,1-3H3/t19-,20-/m1/s1 |
| Standard InCHIKey | QLZWONVOGYYLGJ-WOJBJXKFSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD157007] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Piper dilatatum | Piper | Piperaceae |
|
| Amaranthus spinosus | Amaranthus | Amaranthaceae |
|
Ingredient ID: NPC162045
Formula: CH4N2S
Ingredient ID: NPC162045
| Common Name | Thiourea |
| IUPAC Name | thiourea |
| Canonical SMILES | NC(=N)S |
| Standard InCHI | InChI=1S/CH4N2S/c2-1(3)4/h(H4,2,3,4) |
| Standard InCHIKey | UMGDCJDMYOKAJW-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 2723790 ChEMBL ID: CHEMBL260876 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD50688] Database: NPASS [NPC162045] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Piper dilatatum | Piper | Piperaceae |
|
| Amaranthus spinosus | Amaranthus | Amaranthaceae |
|
Ingredient ID: NPC161291
Formula: C8H15NO
Ingredient ID: NPC161291
| Common Name | n.a. |
| IUPAC Name | [(1S,8R)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]methanol |
| Canonical SMILES | OC[C@H]1CCN2[C@@H]1CCC2 |
| Standard InCHI | InChI=1S/C8H15NO/c10-6-7-3-5-9-4-1-2-8(7)9/h7-8,10H,1-6H2/t7-,8-/m1/s1 |
| Standard InCHIKey | LOFDEIYZIAVXHE-HTQZYQBOSA-N |
| Ingredient External Links |
PubChem CID: 94259 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD136648] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Piper dilatatum | Piper | Piperaceae |
|
| Rumex dentatus | Rumex | Polygonaceae |
|
| Atalantia buxifolia | Atalantia | Rutaceae | |
| Amaranthus spinosus | Amaranthus | Amaranthaceae |
|
Ingredient ID: NPC150980
Formula: C39H66N2O30
Ingredient ID: NPC150980
| Common Name | n.a. |
| IUPAC Name | N-[(2R,3R,4R,5S,6R)-5-[(2S,3R,4R,5S,6R)-3-acetamido-4-hydroxy-6-(hydroxymethyl)-5-[(2S,3S,4S,5R,6R)-5-hydroxy-4-[(2S,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-6-[[(2S,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]-3-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxyoxan-2-yl]oxy-2,4-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide |
| Canonical SMILES | OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@H]([C@@H]([C@H]2O)N=C(O)C)O)[C@@H]([C@H]([C@@H]1O[C@@H]1O[C@H](CO[C@H]2O[C@H](CO)[C@H]([C@@H]([C@@H]2O)O)O)[C@H]([C@@H]([C@@H]1O[C@@H]1OC[C@H]([C@@H]([C@H]1O)O)O)O[C@H]1O[C@H](CO)[C@H]([C@@H]([C@@H]1O)O)O)O)O)N=C(O)C |
| Standard InCHI | InChI=1S/C39H66N2O30/c1-9(46)40-17-23(53)30(14(5-44)63-34(17)60)68-35-18(41-10(2)47)24(54)31(15(6-45)66-35)69-39-33(71-37-27(57)19(49)11(48)7-61-37)32(70-38-29(59)26(56)21(51)13(4-43)65-38)22(52)16(67-39)8-62-36-28(58)25(55)20(50)12(3-42)64-36/h11-39,42-45,48-60H,3-8H2,1-2H3,(H,40,46)(H,41,47)/t11-,12-,13-,14-,15-,16-,17-,18-,19+,20-,21-,22-,23-,24-,25+,26+,27-,28+,29+,30-,31-,32+,33+,34-,35+,36+,37+,38-,39+/m1/s1 |
| Standard InCHIKey | ZMOFNTJDOXHCRX-FUBKJYJRSA-N |
| Ingredient External Links |
PubChem CID: 91859753 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD138192] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Piper dilatatum | Piper | Piperaceae |
|
| Amaranthus spinosus | Amaranthus | Amaranthaceae |
|
Ingredient ID: NPC13672
Formula: C23H34O7
Ingredient ID: NPC13672
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | CO[C@H]1[C@H](C)[C@@H]2CC(=O)O[C@H]3[C@@]2([C@H]([C@@H]1OC(=O)C)[C@]1(C)[C@@H](C3)[C@H](C)C[C@@H](C1=O)O)C |
| Standard InCHI | InChI=1S/C23H34O7/c1-10-7-15(25)21(27)23(5)13(10)8-16-22(4)14(9-17(26)30-16)11(2)18(28-6)19(20(22)23)29-12(3)24/h10-11,13-16,18-20,25H,7-9H2,1-6H3/t10-,11-,13+,14+,15+,16-,18+,19-,20+,22-,23+/m1/s1 |
| Standard InCHIKey | XTAVFXFXCFHNNF-SEMNJSAISA-N |
| Ingredient External Links |
PubChem CID: 182145 ZINC ID: ZINC000008221350 |
| Plant-Ingredient Association Reference |
Database: UNPD [] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Piper dilatatum | Piper | Piperaceae |
|
| Amaranthus spinosus | Amaranthus | Amaranthaceae |
|
| Picrasma quassioides | Picrasma | Simaroubaceae |
|
Ingredient ID: NPC13467
Formula: C10H12N2O2
Ingredient ID: NPC13467
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | Oc1ccc2n(c1=O)C[C@H]1C[C@@H]2NC1 |
| Standard InCHI | InChI=1S/C10H12N2O2/c13-9-2-1-8-7-3-6(4-11-7)5-12(8)10(9)14/h1-2,6-7,11,13H,3-5H2/t6-,7-/m0/s1 |
| Standard InCHIKey | AFTDVOKQJZAVLI-BQBZGAKWSA-N |
| Ingredient External Links |
PubChem CID: 25171260 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD145065] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Piper dilatatum | Piper | Piperaceae |
|
| Amaranthus spinosus | Amaranthus | Amaranthaceae |
|
Ingredient ID: NPC124608
Formula: C12H22N2O
Ingredient ID: NPC124608
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | CC[C@H](C(=N[C@@H]1CCN2[C@H]1CCC2)O)C |
| Standard InCHI | InChI=1S/C12H22N2O/c1-3-9(2)12(15)13-10-6-8-14-7-4-5-11(10)14/h9-11H,3-8H2,1-2H3,(H,13,15)/t9-,10-,11+/m1/s1 |
| Standard InCHIKey | JBALUFGTAJXLSF-MXWKQRLJSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD221264] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Piper dilatatum | Piper | Piperaceae |
|
| Amaranthus spinosus | Amaranthus | Amaranthaceae |
|
Properties
| Ingredient ID | Formulae | Name | MW | AlogP | MlogP | XlogP | # HBA | # HBD | PSA | # Rotatable Bond | # Ring | # Heacy Atom | Lipinski RO5 Violation |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| NPC124608 | C12H22N2O | 210.1732133 | -1.064 | 2.45 | 1.89 | 3 | 1 | 35.83 | 3 | 2 | 15 | 0 | |
| NPC13467 | C10H12N2O2 | 192.0898776 | -1.2072 | 2.12 | 0.172 | 4 | 2 | 52.57 | 0 | 3 | 14 | 0 | |
| NPC13672 | C23H34O7 | 422.2304534 | -0.0988 | 3.22 | 2.114 | 7 | 1 | 99.13 | 3 | 4 | 30 | 0 | |
| NPC150980 | C39H66N2O30 | N-[(2R,3R,4R,5S,6R)-5-[(2S,3R,4R,5S,6R)-3-acetamido-4-hydroxy-6-(hydroxymethyl)-5-[(2S,3S,4S,5R,6R)-5-hydroxy-4-[(2S,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-6-[[(2S,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]-3-[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxyoxan-2-yl]oxyoxan-2-yl]oxy-2,4-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide | 1042.370039 | -10.1842 | 2.23 | -9.898 | 32 | 19 | 510.62 | 17 | 6 | 71 | 3 |
| NPC161291 | C8H15NO | [(1S,8R)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]methanol | 141.1153641 | -1.6328 | 2.12 | 0.277 | 2 | 1 | 23.47 | 1 | 2 | 10 | 0 |
| NPC162045 | CH4N2S | Thiourea | 76.01 | 0.5528 | 1.24 | 0.067 | 2 | 2 | 88.67 | 2 | 0 | 4 | 0 |
| NPC1804 | C21H20O7 | 384.120903 | -1.7602 | 3 | 1.562 | 3 | 3 | 105.45 | 2 | 4 | 28 | 0 | |
| NPC202564 | C20H16O6 | 352.0946882 | -1.4022 | 3 | 2.061 | 2 | 2 | 88.52 | 1 | 5 | 26 | 0 | |
| NPC259166 | C20H18O5 | Wighteone | 338.12 | -0.1702 | 3.11 | 2.982 | 1 | 3 | 86.99 | 8 | 3 | 25 | 0 |
| NPC268204 | C20H18O6 | Uncinanone A | 354.11 | -0.6305 | 3 | 2.019 | 1 | 4 | 107.22 | 9 | 3 | 26 | 0 |
| NPC32219 | C20H18O6 | 5,7-dihydroxy-6-[(2R)-2-hydroxy-3-methylbut-3-enyl]-3-(4-hydroxyphenyl)chromen-4-one | 354.1103383 | -1.342 | 3 | 1.419 | 2 | 4 | 107.22 | 4 | 3 | 26 | 0 |
| NPC39426 | C15H10O5 | Genistein | 270.05 | -2.0476 | 2.56 | 1.512 | 1 | 3 | 86.99 | 4 | 3 | 20 | 0 |
| NPC56212 | C39H66N2O29 | 1026.375124 | -9.6842 | 2.34 | -8.766 | 31 | 18 | 490.39 | 16 | 6 | 70 | 3 | |
| NPC61321 | C15H20N2O | 244.1575633 | -1.6689 | 2.78 | 0.889 | 3 | 0 | 23.55 | 0 | 4 | 18 | 0 | |
| NPC7013 | C16H12O5 | 7-Hydroxy-3-(4-Hydroxyphenyl)-5-Methoxychromen-4-One | 284.07 | -1.6391 | 2.67 | 2.031 | 1 | 2 | 75.99 | 5 | 3 | 21 | 0 |
| NPC77890 | C11H14N2O | Cytisine | 190.11 | -1.1881 | 2.34 | -0.251 | 3 | 1 | 32.34 | 0 | 3 | 14 | 0 |
| NPC97716 | C20H16O5 | Alpinumisoflavone | 336.1 | -0.6795 | 3.11 | 2.912 | 1 | 2 | 75.99 | 5 | 4 | 25 | 0 |
Download Data
All data can be downloaded by:→ Selecting data type in the below download table
→ Then click the download button.
