20 Known Ingredients in Total
Unique ingredients have been isolated from this plant.
Plant-Ingredients Associations were manually curated from publications or collected from other databases.
5 Ingredients with Available Activity
Unique ingredients have activity data available.
Ingredient Structrual Cards
Ingredient ID: NPC94488
Formula: C19H30O4
Ingredient ID: NPC94488
| Common Name | n.a. |
| IUPAC Name | 5-ethoxy-2-hydroxy-3-undecylcyclohexa-2,5-diene-1,4-dione |
| Canonical SMILES | CCCCCCCCCCCC1=C(O)C(=O)C=C(C1=O)OCC |
| Standard InCHI | InChI=1S/C19H30O4/c1-3-5-6-7-8-9-10-11-12-13-15-18(21)16(20)14-17(19(15)22)23-4-2/h14,21H,3-13H2,1-2H3 |
| Standard InCHIKey | BKAZNQWWINLHDW-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 10358776 ZINC ID: ZINC000044387225 |
| Plant-Ingredient Association Reference |
ELECTRON J FOOD PLANTS CHEM,2007,2: 20 Database: NPASS [NPC94488] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Embelia ribes | Embelia | Primulaceae |
  |
| Aegiceras corniculatum | Aegiceras | Primulaceae |
|
| Embelia schimperi | Embelia | Primulaceae |
|
| Myrsine africana | Myrsine | Primulaceae |
|
Ingredient ID: NPC93334
Formula: C36H52O7
Ingredient ID: NPC93334
| Common Name | n.a. |
| IUPAC Name | 2,7-dihydroxy-9-methyl-3,6-di(undecyl)-9H-xanthene-1,4,5,8-tetrone |
| Canonical SMILES | CCCCCCCCCCCC1=C(O)C(=O)C2=C(C1=O)OC1=C(C2C)C(=O)C(=C(C1=O)CCCCCCCCCCC)O |
| Standard InCHI | InChI=1S/C36H52O7/c1-4-6-8-10-12-14-16-18-20-22-25-29(37)33(41)27-24(3)28-34(42)30(38)26(32(40)36(28)43-35(27)31(25)39)23-21-19-17-15-13-11-9-7-5-2/h24,37-38H,4-23H2,1-3H3 |
| Standard InCHIKey | PSIOYNVYDPZURD-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 101762593 ZINC ID: ZINC000086039337 |
| Plant-Ingredient Association Reference |
Database: TCMID [14133] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Myrsine africana | Myrsine | Primulaceae |
|
Ingredient ID: NPC90411
Formula: C9H8O4
Ingredient ID: NPC90411
| Common Name | Sid22414536 |
| IUPAC Name | 7-hydroxy-5-methoxy-3H-2-benzofuran-1-one |
| Canonical SMILES | COc1cc(O)c2c(c1)COC2=O |
| Standard InCHI | InChI=1S/C9H8O4/c1-12-6-2-5-4-13-9(11)8(5)7(10)3-6/h2-3,10H,4H2,1H3 |
| Standard InCHIKey | DQVAVEZQPWBKEW-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 181107 ChEMBL ID: CHEMBL507369 |
| Plant-Ingredient Association Reference |
PMID: 2778455 Database: NPASS [NPC90411] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Myrsine africana | Myrsine | Primulaceae |
|
Ingredient ID: NPC86143
Formula: C21H20O11
Ingredient ID: NPC86143
| Common Name | n.a. |
| IUPAC Name | 5,7-dihydroxy-2-(4-hydroxyphenyl)-3-[(2S,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one |
| Canonical SMILES | OC[C@@H]1O[C@@H](Oc2c(oc3c(c2=O)c(O)cc(c3)O)c2ccc(cc2)O)[C@H]([C@@H]([C@H]1O)O)O |
| Standard InCHI | InChI=1S/C21H20O11/c22-7-13-15(26)17(28)18(29)21(31-13)32-20-16(27)14-11(25)5-10(24)6-12(14)30-19(20)8-1-3-9(23)4-2-8/h1-6,13,15,17-18,21-26,28-29H,7H2/t13-,15-,17+,18-,21-/m0/s1 |
| Standard InCHIKey | JPUKWEQWGBDDQB-YSBXYMAXSA-N |
| Ingredient External Links |
PubChem CID: 72551446 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD3825] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Myrsine africana | Myrsine | Primulaceae |
|
Ingredient ID: NPC72471
Formula: C36H54O8
Ingredient ID: NPC72471
| Common Name | n.a. |
| IUPAC Name | 2-[1-(2,5-dihydroxy-3,6-dioxo-4-undecylcyclohexa-1,4-dien-1-yl)ethyl]-3,6-dihydroxy-5-undecylcyclohexa-2,5-diene-1,4-dione |
| Canonical SMILES | CCCCCCCCCCCC1=C(O)C(=O)C(=C(C1=O)O)C(C1=C(O)C(=O)C(=C(C1=O)O)CCCCCCCCCCC)C |
| Standard InCHI | InChI=1S/C36H54O8/c1-4-6-8-10-12-14-16-18-20-22-25-29(37)33(41)27(34(42)30(25)38)24(3)28-35(43)31(39)26(32(40)36(28)44)23-21-19-17-15-13-11-9-7-5-2/h24,37,39,42,44H,4-23H2,1-3H3 |
| Standard InCHIKey | DHSDUZQMIDNCKR-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 21576542 ZINC ID: ZINC000086052528 |
| Plant-Ingredient Association Reference |
Database: TCMID [14801] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Myrsine africana | Myrsine | Primulaceae |
|
Ingredient ID: NPC53810
Formula: C54H88O23
Ingredient ID: NPC53810
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | OC[C@H]1O[C@@H](O[C@H]2[C@@H](O[C@@H]([C@H]([C@@H]2O[C@@H]2O[C@H](CO)[C@@H]([C@@H]([C@H]2O[C@@H]2O[C@@H](C)[C@@H]([C@H]([C@H]2O)O)O)O)O)O)C(=O)O)O[C@H]2CC[C@]3([C@H](C2(C)C)CC[C@@]2([C@@H]3CC[C@]34[C@@]2(C)C[C@H]([C@@]2([C@H]4CC(C)(C)CC2)CO3)O)C)C)[C@@H]([C@H]([C@@H]1O)O)O |
| Standard InCHI | InChI=1S/C54H88O23/c1-22-30(58)33(61)36(64)44(70-22)76-41-35(63)32(60)24(20-56)72-46(41)74-39-38(66)40(43(67)68)75-47(42(39)77-45-37(65)34(62)31(59)23(19-55)71-45)73-29-11-12-50(6)25(49(29,4)5)9-13-51(7)26(50)10-14-54-27-17-48(2,3)15-16-53(27,21-69-54)28(57)18-52(51,54)8/h22-42,44-47,55-66H,9-21H2,1-8H3,(H,67,68)/t22-,23+,24+,25-,26+,27+,28+,29-,30-,31+,32-,33+,34-,35-,36+,37+,38-,39-,40-,41+,42+,44-,45-,46-,47+,50-,51+,52-,53+,54-/m0/s1 |
| Standard InCHIKey | DQUUSJCGJNQFPG-CBMAJASRSA-N |
| Ingredient External Links |
PubChem CID: 49787015 |
| Plant-Ingredient Association Reference |
Database: TCMID [17845] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Lysimachia clethroides | Lysimachia | Primulaceae |
|
| Myrsine africana | Myrsine | Primulaceae |
|
Ingredient ID: NPC4437
Formula: C14H10OS
Ingredient ID: NPC4437
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | C=CC#CC#C/C=C(/[S@](=O)C)C#CC#CC |
| Standard InCHI | InChI=1S/C14H10OS/c1-4-6-8-9-11-13-14(16(3)15)12-10-7-5-2/h4,13H,1H2,2-3H3/b14-13+/t16-/m1/s1 |
| Standard InCHIKey | HDLFDRNEHPOIHC-FIFPYPGSSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD141655] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Trachycarpus fortunei | Trachycarpus | Arecaceae |
|
| Myrsine africana | Myrsine | Primulaceae |
|
Ingredient ID: NPC416
Formula: C15H10O5
Ingredient ID: NPC416
| Common Name | n.a. |
| IUPAC Name | 1,2,8-trihydroxy-3-methylanthracene-9,10-dione |
| Canonical SMILES | Oc1cccc2c1C(=O)c1c(C2=O)cc(c(c1O)O)C |
| Standard InCHI | InChI=1S/C15H10O5/c1-6-5-8-11(15(20)12(6)17)14(19)10-7(13(8)18)3-2-4-9(10)16/h2-5,16-17,20H,1H3 |
| Standard InCHIKey | CQNVSNFEXPKHGW-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 442759 ZINC ID: ZINC000004098690 |
| Plant-Ingredient Association Reference |
PMID: 2778455 Database: NPASS [NPC416] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Myrsine africana | Myrsine | Primulaceae |
|
| Nelumbo nucifera | Nelumbo | Nelumbonaceae |
  |
| Annona glabra | Annona | Annonaceae |
|
Ingredient ID: NPC308404
Formula: C21H20O12
Ingredient ID: NPC308404
| Common Name | n.a. |
| IUPAC Name | 2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3-[(2R,3S,4R,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one |
| Canonical SMILES | OC[C@@H]1O[C@H](Oc2c(oc3c(c2=O)c(O)cc(c3)O)c2ccc(c(c2)O)O)[C@H]([C@@H]([C@@H]1O)O)O |
| Standard InCHI | InChI=1S/C21H20O12/c22-6-13-15(27)17(29)18(30)21(32-13)33-20-16(28)14-11(26)4-8(23)5-12(14)31-19(20)7-1-2-9(24)10(25)3-7/h1-5,13,15,17-18,21-27,29-30H,6H2/t13-,15+,17+,18-,21+/m0/s1 |
| Standard InCHIKey | OVSQVDMCBVZWGM-STUVATENSA-N |
| Ingredient External Links |
PubChem CID: 12304330 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD73469] Database: NPASS [NPC308404] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Cuscuta chinensis | Cuscuta | Convolvulaceae |
|
| Myrsine africana | Myrsine | Primulaceae |
|
| Cuscuta australis | Cuscuta | Convolvulaceae |
|
Ingredient ID: NPC267205
Formula: C15H12O4
Ingredient ID: NPC267205
| Common Name | Emodin Anthrone |
| IUPAC Name | 1,3,8-trihydroxy-6-methyl-10H-anthracen-9-one |
| Canonical SMILES | Cc1cc2Cc3cc(O)cc(c3C(=O)c2c(c1)O)O |
| Standard InCHI | InChI=1S/C15H12O4/c1-7-2-8-4-9-5-10(16)6-12(18)14(9)15(19)13(8)11(17)3-7/h2-3,5-6,16-18H,4H2,1H3 |
| Standard InCHIKey | LAJSXCAVRQXZIO-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 122635 ChEMBL ID: CHEMBL122192 |
| Plant-Ingredient Association Reference |
Database: NPASS [NPC267205] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Magnolia figo | Michelia | Magnoliaceae |
|
| Polygonum cuspidatum | Polygonum | Polygonaceae |
|
| Senna occidentalis | Senna | Fabaceae |
|
| Rumex crispus | Rumex | Polygonaceae |
|
| Rhamnus davurica | Rhamnus | Rhamnaceae |
|
| Fridericia triplinervia | Fridericia | Bignoniaceae | |
| Rheum wittrocki | Rheum | Polygonaceae |
|
| Artemisia scoparia | Artemisia | Asteraceae |
|
| Garcinia polyantha | Garcinia | Clusiaceae |
|
| Rheum officinale | Rheum | Polygonaceae |
|
| Epimedium koreanum | Epimedium | Berberidaceae |
|
| Myrsine africana | Myrsine | Primulaceae |
|
| Rumex dentatus | Rumex | Polygonaceae |
|
| Rumex japonicus | Rumex | Polygonaceae |
|
| Baccharis potosina | Baccharis | Asteraceae | |
| Maclura tinctoria | Maclura | Moraceae |
|
| Stevia berlandieri | Stevia | Asteraceae | |
| Ravenia spectabilis | Ravenia | Rutaceae | |
| Rheum palmatum | Rheum | Polygonaceae |
|
| Fallopia multiflora | Fallopia | Polygonaceae |
|
| Cassia occidentalis | Cassia | Fabaceae |
|
| Rhamnus frangula | Frangula | Rhamnaceae |
|
| Cassia tora | Cassia | Fabaceae |
|
| Frangula purshiana | Frangula | Rhamnaceae |
|
| Cranfillia fluviatilis | Cranfillia | Blechnaceae |
|
| Rumex nepalensis | Rumex | Polygonaceae |
|
| Persicaria perfoliata | Persicaria | Polygonaceae |
|
| Rheum tanguticum | Rheum | Polygonaceae |
|
| Senna tora | Senna | Fabaceae |
|
Ingredient ID: NPC257566
Formula: C29H34O14
Ingredient ID: NPC257566
| Common Name | n.a. |
| IUPAC Name | 6-[(2R,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2R,3S,4S,5S,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]-5-hydroxy-7-methoxy-2-(4-methoxyphenyl)chromen-4-one |
| Canonical SMILES | OC[C@H]1O[C@@H]([C@@H]([C@H]([C@@H]1O)O)O[C@H]1O[C@H](C)[C@H]([C@@H]([C@@H]1O)O)O)c1c(OC)cc2c(c1O)c(=O)cc(o2)c1ccc(cc1)OC |
| Standard InCHI | InChI=1S/C29H34O14/c1-11-21(32)24(35)26(37)29(40-11)43-28-25(36)22(33)18(10-30)42-27(28)20-16(39-3)9-17-19(23(20)34)14(31)8-15(41-17)12-4-6-13(38-2)7-5-12/h4-9,11,18,21-22,24-30,32-37H,10H2,1-3H3/t11-,18-,21-,22-,24+,25+,26+,27-,28-,29-/m1/s1 |
| Standard InCHIKey | OXTGLFRGBDFBHI-JUWPCJOESA-N |
| Ingredient External Links |
PubChem CID: 44559811 |
| Plant-Ingredient Association Reference |
Database: NPASS [NPC257566] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Iris tectorum | Iris | Iridaceae |
|
| Embelia ribes | Embelia | Primulaceae |
|
| Aegiceras corniculatum | Aegiceras | Primulaceae |
|
| Myrsine africana | Myrsine | Primulaceae |
|
| Ardisia crenata | Ardisia | Primulaceae |
|
| Clematis chinensis | Clematis | Ranunculaceae |
|
| Iris domestica | Iris | Iridaceae |
|
Ingredient ID: NPC254848
Formula: C15H10O5
Ingredient ID: NPC254848
| Common Name | n.a. |
| IUPAC Name | 3,8-dihydroxy-6-methyl-9,10-dioxoanthracen-1-olate |
| Canonical SMILES | [O-]c1cc(O)c2c(c1)C(=O)c1c(C2=O)c(O)cc(c1)C |
| Standard InCHI | InChI=1S/C15H10O5/c1-6-2-8-12(10(17)3-6)15(20)13-9(14(8)19)4-7(16)5-11(13)18/h2-5,16-18H,1H3/p-1 |
| Standard InCHIKey | RHMXXJGYXNZAPX-UHFFFAOYSA-M |
| Ingredient External Links |
PubChem CID: 25201450 |
| Plant-Ingredient Association Reference |
Database: TCMID [6775] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Dolomiaea souliei | Dolomiaea | Asteraceae | |
| Sargentodoxa cuneata | Sargentodoxa | Lardizabalaceae |
|
| Hedera helix | Hedera | Araliaceae |
|
| Rubus alceifolius | Rubus | Rosaceae |
|
| Polygonum cuspidatum | Polygonum | Polygonaceae |
|
| Senna occidentalis | Senna | Fabaceae |
|
| Rheum australe | Rheum | Polygonaceae |
|
| Rumex crispus | Rumex | Polygonaceae |
|
| Rhamnus davurica | Rhamnus | Rhamnaceae |
|
| Rumex patientia | Rumex | Polygonaceae |
|
| Dioscorea collettii var. hypoglauca | Dioscorea | Dioscoreaceae | |
| Codonopsis pilosula | Codonopsis | Campanulaceae |
|
| Rheum wittrocki | Rheum | Polygonaceae |
|
| Artemisia scoparia | Artemisia | Asteraceae |
|
| Senecio scandens | Senecio | Asteraceae |
|
| Rheum officinale | Rheum | Polygonaceae |
|
| Epimedium koreanum | Epimedium | Berberidaceae |
|
| Myrsine africana | Myrsine | Primulaceae |
|
| Ventilago leiocarpa | Ventilago | Rhamnaceae |
|
| Rumex dentatus | Rumex | Polygonaceae |
|
| Abrus pulchellus | Abrus | Fabaceae |
|
| Rumex japonicus | Rumex | Polygonaceae |
|
| Fagopyrum esculentum | Fagopyrum | Polygonaceae |
|
| Anemarrhena asphodeloides | Anemarrhena | Asparagaceae |
|
| Carapichea ipecacuanha | Carapichea | Rubiaceae |
|
| Rheum palmatum | Rheum | Polygonaceae |
|
| Oplopanax elatus | Oplopanax | Araliaceae |
|
| Fallopia multiflora | Fallopia | Polygonaceae |
|
| Rumex nepalensis | Rumex | Polygonaceae |
|
| Persicaria perfoliata | Persicaria | Polygonaceae |
|
| Vismia orientalis | Vismia | Hypericaceae |
|
| Rheum tanguticum | Rheum | Polygonaceae |
|
| Senna tora | Senna | Fabaceae |
|
| Senna obtusifolia | Senna | Fabaceae |
|
Ingredient ID: NPC243272
Formula: C18H28O4
Ingredient ID: NPC243272
| Common Name | 5-O-Methylembelin |
| IUPAC Name | 2-hydroxy-5-methoxy-3-undecylcyclohexa-2,5-diene-1,4-dione |
| Canonical SMILES | CCCCCCCCCCCC1=C(O)C(=O)C=C(C1=O)OC |
| Standard InCHI | InChI=1S/C18H28O4/c1-3-4-5-6-7-8-9-10-11-12-14-17(20)15(19)13-16(22-2)18(14)21/h13,20H,3-12H2,1-2H3 |
| Standard InCHIKey | KHBJLRRAMCJZLZ-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 171489 ZINC ID: ZINC000008234343 ChEMBL ID: CHEMBL471270 |
| Plant-Ingredient Association Reference |
ELECTRON J FOOD PLANTS CHEM,2007,2: 20 Database: NPASS [NPC243272] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Embelia ribes | Embelia | Primulaceae |
|
| Aegiceras corniculatum | Aegiceras | Primulaceae |
|
| Embelia schimperi | Embelia | Primulaceae |
|
| Myrsine africana | Myrsine | Primulaceae |
|
Ingredient ID: NPC23140
Formula: C16H19NO6
Ingredient ID: NPC23140
| Common Name | n.a. |
| IUPAC Name | 7-(2,3-dihydroxy-3-methylbutyl)-6-methoxy-9H-[1,3]dioxolo[4,5-h]quinolin-8-one |
| Canonical SMILES | COc1c(CC(C(O)(C)C)O)c(O)nc2c1ccc1c2OCO1 |
| Standard InCHI | InChI=1S/C16H19NO6/c1-16(2,20)11(18)6-9-13(21-3)8-4-5-10-14(23-7-22-10)12(8)17-15(9)19/h4-5,11,18,20H,6-7H2,1-3H3,(H,17,19) |
| Standard InCHIKey | FDPMWTPQUHILQG-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 6325747 |
| Plant-Ingredient Association Reference |
Database: TCMID [15776] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Myrsine africana | Myrsine | Primulaceae |
|
| Orixa japonica | Orixa | Rutaceae |
|
Ingredient ID: NPC158662
Formula: C30H50O3
Ingredient ID: NPC158662
| Common Name | n.a. |
| IUPAC Name | (3S,4aR,6aR,6bS,8R,8aS,12aS,14aR,14bR)-8a-(hydroxymethyl)-4,4,6a,6b,11,11,14b-heptamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicene-3,8-diol |
| Canonical SMILES | OC[C@@]12CCC(C[C@H]2C2=CC[C@H]3[C@@]([C@@]2(C[C@H]1O)C)(C)CC[C@@H]1[C@]3(C)CC[C@@H](C1(C)C)O)(C)C |
| Standard InCHI | InChI=1S/C30H50O3/c1-25(2)14-15-30(18-31)20(16-25)19-8-9-22-27(5)12-11-23(32)26(3,4)21(27)10-13-28(22,6)29(19,7)17-24(30)33/h8,20-24,31-33H,9-18H2,1-7H3/t20-,21-,22+,23-,24+,27-,28+,29+,30+/m0/s1 |
| Standard InCHIKey | YHGVYECWZWIVJC-TVZJSHMMSA-N |
| Ingredient External Links |
PubChem CID: 10004345 |
| Plant-Ingredient Association Reference |
Database: NPASS [NPC158662] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Lepisorus thunbergianus | Lepisorus | Polypodiaceae |
|
| Lysimachia clethroides | Lysimachia | Primulaceae |
|
| Rhododendron aureum | Rhododendron | Ericaceae |
|
| Myrsine africana | Myrsine | Primulaceae |
|
Ingredient ID: NPC156788
Formula: C14H10OS
Ingredient ID: NPC156788
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | C=CC#CC#C/C=C([S@](=O)C)/C#CC#CC |
| Standard InCHI | InChI=1S/C14H10OS/c1-4-6-8-9-11-13-14(16(3)15)12-10-7-5-2/h4,13H,1H2,2-3H3/b14-13-/t16-/m1/s1 |
| Standard InCHIKey | HDLFDRNEHPOIHC-OMACXJQVSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD19822] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Myrsine africana | Myrsine | Primulaceae |
|
Ingredient ID: NPC145571
Formula: C21H20O12
Ingredient ID: NPC145571
| Common Name | n.a. |
| IUPAC Name | 2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3-[(2S,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one |
| Canonical SMILES | OC[C@@H]1O[C@@H](Oc2c(oc3c(c2=O)c(O)cc(c3)O)c2ccc(c(c2)O)O)[C@H]([C@@H]([C@H]1O)O)O |
| Standard InCHI | InChI=1S/C21H20O12/c22-6-13-15(27)17(29)18(30)21(32-13)33-20-16(28)14-11(26)4-8(23)5-12(14)31-19(20)7-1-2-9(24)10(25)3-7/h1-5,13,15,17-18,21-27,29-30H,6H2/t13-,15-,17+,18-,21-/m0/s1 |
| Standard InCHIKey | OVSQVDMCBVZWGM-YSBXYMAXSA-N |
| Ingredient External Links |
PubChem CID: 5318574 ZINC ID: ZINC000013424725 |
| Plant-Ingredient Association Reference |
Database: UNPD [] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Myrsine africana | Myrsine | Primulaceae |
|
Ingredient ID: NPC143168
Formula: C17H26O4
Ingredient ID: NPC143168
| Common Name | Embelin |
| IUPAC Name | 2,5-dihydroxy-3-undecylcyclohexa-2,5-diene-1,4-dione |
| Canonical SMILES | CCCCCCCCCCCC1=C(O)C(=O)C=C(C1=O)O |
| Standard InCHI | InChI=1S/C17H26O4/c1-2-3-4-5-6-7-8-9-10-11-13-16(20)14(18)12-15(19)17(13)21/h12,18,21H,2-11H2,1H3 |
| Standard InCHIKey | IRSFLDGTOHBADP-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 3218 ZINC ID: ZINC000001531764 ChEMBL ID: CHEMBL221137 |
| Plant-Ingredient Association Reference |
Database: NPASS [NPC143168] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Myrsine capitellata | Myrsine | Primulaceae |
|
| Rapanea neurophylla | Rapanea | Primulaceae |
|
| Embelia ribes | Embelia | Primulaceae |
|
| Ipomoea nil | Ipomoea | Convolvulaceae |
|
| Aegiceras corniculatum | Aegiceras | Primulaceae |
|
| Myrsine africana | Myrsine | Primulaceae |
|
| Ardisia crenata | Ardisia | Primulaceae |
|
| Ardisia japonica | Ardisia | Primulaceae |
|
| Clematis chinensis | Clematis | Ranunculaceae |
|
| Embelia barbeyana | Embelia | Primulaceae |
|
Ingredient ID: NPC133671
Formula: C21H20O11
Ingredient ID: NPC133671
| Common Name | Astragalin |
| IUPAC Name | 5,7-dihydroxy-2-(4-hydroxyphenyl)-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one |
| Canonical SMILES | OC[C@H]1O[C@@H](Oc2c(oc3c(c2=O)c(O)cc(c3)O)c2ccc(cc2)O)[C@@H]([C@H]([C@@H]1O)O)O |
| Standard InCHI | InChI=1S/C21H20O11/c22-7-13-15(26)17(28)18(29)21(31-13)32-20-16(27)14-11(25)5-10(24)6-12(14)30-19(20)8-1-3-9(23)4-2-8/h1-6,13,15,17-18,21-26,28-29H,7H2/t13-,15-,17+,18-,21+/m1/s1 |
| Standard InCHIKey | JPUKWEQWGBDDQB-QSOFNFLRSA-N |
| Ingredient External Links |
PubChem CID: 5282102 ZINC ID: ZINC000004102435 ChEMBL ID: CHEMBL233930 |
| Plant-Ingredient Association Reference |
Database: UNPD [] Database: NPASS [NPC133671] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Echium pininana | Echium | Boraginaceae | |
| Mitracarpus scaber | Mitracarpus | Rubiaceae | |
| Tropaeolum majus | Tropaeolum | Tropaeolaceae |
|
| Fragaria x ananassa | Fragaria | Rosaceae |
|
| Ipomoea digitata | Ipomoea | Convolvulaceae |
|
| Periploca calophylla | Periploca | Apocynaceae |
|
| Artemisia apiacea | Artemisia | Asteraceae |
|
| Ixeris chinensis | Ixeris | Asteraceae |
|
| Allagopappus viscosissimus | Allagopappus | Asteraceae | |
| Asteriscus aquaticus | Asteriscus | Asteraceae | |
| Syncarpia hillii | Syncarpia | Myrtaceae | |
| Passiflora edulis | Passiflora | Passifloraceae |
|
| Dipsacus asper | Dipsacus | Caprifoliaceae | |
| Cinnamomum subavenium | Cinnamomum | Lauraceae |
|
| Sinopodophyllum hexandrum | Sinopodophyllum | Berberidaceae |
|
| Eupatorium petiolare | Eupatorium | Asteraceae | |
| Annona cornifolia | Annona | Annonaceae |
|
| Moringa oleifera | Moringa | Moringaceae |
|
| Coutarea latifolia | Coutarea | Rubiaceae | |
| Ratibida mexicana | Ratibida | Asteraceae |
|
| Centella asiatica | Centella | Apiaceae |
|
| Impatiens balsamina | Impatiens | Balsaminaceae |
|
| Rivina humilis | Rivina | Petiveriaceae |
|
| Pseudowintera colorata | Pseudowintera | Winteraceae | |
| Chelidonium majus | Chelidonium | Papaveraceae |
|
| Duguetia calycina | Duguetia | Annonaceae |
|
| Astragalus spinosus | Astragalus | Fabaceae | |
| Salvia syriaca | Salvia | Lamiaceae | |
| Phebalium dentatum | Phebalium | Rutaceae | |
| Solanum laxum | Solanum | Solanaceae |
|
| Ecballium elaterium | Ecballium | Cucurbitaceae |
|
| Citrus hassaku | Citrus | Rutaceae | |
| Swertia decussata | Swertia | Gentianaceae |
|
| Capparis ovata | Capparis | Capparaceae |
|
| Croton montevidensis | Croton | Euphorbiaceae | |
| Petrorhagia dubia | Petrorhagia | Caryophyllaceae | |
| Lemaireocereus griseus | Lemaireocereus | Cactaceae |
|
| Peltogyne pubescens | Peltogyne | Fabaceae | |
| Peltogyne porphyrocardia | Peltogyne | Fabaceae | |
| Vepris nobilis | Vepris | Rutaceae |
|
| Ranunculus peltatus | Ranunculus | Ranunculaceae | |
| Datisca glomerata | Datisca | Datiscaceae | |
| Hydrangea serrata | Hydrangea | Hydrangeaceae |
|
| Eriostemon spicatus | Eriostemon | Rutaceae | |
| Quercus imbricaria | Quercus | Fagaceae |
|
| Cneorum pulverulentum | Cneorum | Rutaceae |
|
| Euphorbia sieboldiana | Euphorbia | Euphorbiaceae |
|
| Phalaris canariensis | Phalaris | Poaceae |
|
| Dioscorea olfersiana | Dioscorea | Dioscoreaceae |
|
| Lunularia cruciata | Lunularia | Lunulariaceae | |
| Cassine papillosa | Cassine | Celastraceae |
|
| Diospyros eriantha | Diospyros | Ebenaceae | |
| Eucalyptus melliodora | Eucalyptus | Myrtaceae | |
| Alkanna cappadocica | Alkanna | Boraginaceae |
|
| Jacaranda chelonia | Jacaranda | Bignoniaceae | |
| Thymus quinquecostatus | Thymus | Lamiaceae |
|
| Onobrychis cyri | Onobrychis | Fabaceae | |
| Payena lucida | Payena | Sapotaceae |
|
| Artemisia dentata | Artemisia | Asteraceae | |
| Pteridium aquilinum | Pteridium | Dennstaedtiaceae |
|
| Crepidiastrum sonchifolium | Crepidiastrum | Asteraceae | |
| Garcinia xipshuanbannaensis | Garcinia | Clusiaceae |
|
| Scutellaria amoena | Scutellaria | Lamiaceae |
|
| Salvia hispanica | Salvia | Lamiaceae |
|
| Goniothalamus malayanus | Goniothalamus | Annonaceae | |
| Scorzonera pseudodivaricata | Scorzonera | Asteraceae | |
| Rapanea lancifolia | Rapanea | Primulaceae | |
| Pastinaca sativa | Pastinaca | Apiaceae |
|
| Ononis vaginalis | Ononis | Fabaceae | |
| Nepeta multifida | Nepeta | Lamiaceae | |
| Eremostachys moluccelloides | Eremostachys | Lamiaceae | |
| Cucumis myriocarpus | Cucumis | Cucurbitaceae |
|
| Humulus lupulus | Humulus | Cannabaceae |
|
| Caulerpa serrulata | Caulerpa | Caulerpaceae |
|
| Corydalis ochotensis | Corydalis | Papaveraceae |
|
| Leonurus persicus | Leonurus | Lamiaceae |
|
| Acnistus breviflorus | Acnistus | Solanaceae | |
| Delphinium shawurense | Delphinium | Ranunculaceae | |
| Lespedeza davidii | Lespedeza | Fabaceae | |
| Lysimachia mauritiana | Lysimachia | Primulaceae | |
| Oxalis purpurea | Oxalis | Oxalidaceae |
|
| Lathyrus nissolia | Lathyrus | Fabaceae |
|
| Swertia franchetiana | Swertia | Gentianaceae |
|
| Hippeastrum papilio | Hippeastrum | Amaryllidaceae | |
| Lonicera japonica | Lonicera | Caprifoliaceae |
|
| Gutierrezia lucida | Gutierrezia | Asteraceae | |
| Helipterum roseum | Helipterum | Asteraceae | |
| Rosa rugosa | Rosa | Rosaceae |
|
| Helichrysum graveolens | Helichrysum | Asteraceae | |
| Phalaenopsis schilleriana | Phalaenopsis | Orchidaceae | |
| Magnolia sieboldii | Magnolia | Magnoliaceae |
|
| Hedysarum connatum | Hedysarum | Fabaceae | |
| Habropetalum dawei | Habropetalum | Dioncophyllaceae | |
| Euonymus japonicus | Euonymus | Celastraceae |
|
| Zanthoxylum tetraspermum | Zanthoxylum | Rutaceae |
|
| Mitragyna speciosa | Mitragyna | Rubiaceae |
|
| Convallaria majalis | Convallaria | Asparagaceae |
|
| Astragalus mongholicus | Astragalus | Fabaceae |
|
| Artemisia assoana | Artemisia | Asteraceae | |
| Hunteria zeylanica | Hunteria | Apocynaceae |
|
| Glycyrrhiza | Glycyrrhiza | Fabaceae |
|
| Onobrychis bobrovii | Onobrychis | Fabaceae | |
| Peltophorum dasyrhachis | Peltophorum | Fabaceae |
|
| Dumortiera hirsuta | Dumortiera | Dumortieraceae |
|
| Cuscuta chinensis | Cuscuta | Convolvulaceae |
|
| Apocynum venetum | Apocynum | Apocynaceae |
|
| Morus bombycis | Morus | Moraceae |
|
| Rhodiola rosea | Rhodiola | Crassulaceae |
|
| Lepisorus ussuriensis | Lepisorus | Polypodiaceae |
|
| Pyrrosia lingua | Pyrrosia | Polypodiaceae |
|
| Iberis amara | Iberis | Brassicaceae |
|
| Alstonia spathulata | Alstonia | Apocynaceae | |
| Diospyros verrucosa | Diospyros | Ebenaceae |
|
| Phoebe pittieri | Phoebe | Lauraceae | |
| Sophora tometosa | Sophora | Fabaceae | |
| Codonopsis pilosula | Codonopsis | Campanulaceae |
|
| Glinus lotoides | Glinus | Molluginaceae |
|
| Eucommia ulmoides | Eucommia | Eucommiaceae |
|
| Hypericum laricifolium | Hypericum | Hypericaceae |
|
| Cichorium glandulosum | Cichorium | Asteraceae | |
| Aster oharai | Aster | Asteraceae | |
| Glycyrrhiza inflata | Glycyrrhiza | Fabaceae |
|
| Vitis vinifera | Vitis | Vitaceae |
|
| Adiantum lunulatum | Adiantum | Pteridaceae |
|
| Albizia inundata | Albizia | Fabaceae |
|
| Ipomopsis polycladon | Ipomopsis | Polemoniaceae | |
| Prumnopitys ferruginoides | Prumnopitys | Podocarpaceae | |
| Peltostigma guatemalense | Peltostigma | Rutaceae | |
| Prunella vulgaris | Prunella | Lamiaceae |
|
| Ribes nigrum | Ribes | Grossulariaceae |
|
| Acacia adunca | Acacia | Fabaceae | |
| Rabdosia angustifolia | Isodon | Lamiaceae | |
| Viguiera incana | Viguiera | Asteraceae | |
| Heliotropium amplexicaule | Heliotropium | Heliotropiaceae |
|
| Hymenaea courbaril | Hymenaea | Fabaceae |
|
| Astragalus sempervirens | Astragalus | Fabaceae | |
| Attalea excelsa | Attalea | Arecaceae | |
| Inula britannica | Inula | Asteraceae |
|
| Marrubium anisodon | Marrubium | Lamiaceae |
|
| Tipuana tipu | Tipuana | Fabaceae | |
| Wikstroemia retusa | Wikstroemia | Thymelaeaceae | |
| Berberis repens | Berberis | Berberidaceae | |
| Agrimonia pilosa | Agrimonia | Rosaceae |
|
| Naucleopsis ternstroemiiflora | Naucleopsis | Moraceae | |
| Acacia pruinosa | Acacia | Fabaceae | |
| Rosa chinensis | Rosa | Rosaceae |
|
| Cycas beddomei | Cycas | Cycadaceae |
|
| Guarea trichilioides | Guarea | Meliaceae | |
| Diospyros kaki | Diospyros | Ebenaceae |
|
| Dalbergia sissoo | Dalbergia | Fabaceae |
|
| Carthamus tinctorius | Carthamus | Asteraceae |
|
| Atalantia racemosa | Atalantia | Rutaceae |
|
| Papaver tatricum | Papaver | Papaveraceae | |
| Ligusticum sinense | Ligusticum | Apiaceae |
|
| Tamarix aphylla | Tamarix | Tamaricaceae |
|
| Agrostis epigeios | Agrostis | Poaceae | |
| Astragalus goktschaicus | Astragalus | Fabaceae | |
| Thymus vulgaris | Thymus | Lamiaceae |
|
| Lygodium japonicum | Lygodium | Lygodiaceae |
|
| Tilia miqueliana | Tilia | Malvaceae |
|
| Vicia benghalensis | Vicia | Fabaceae |
 |
| Penstemon gentianoides | Penstemon | Plantaginaceae |
|
| Centaurea sinaica | Centaurea | Asteraceae | |
| Decaisnea fargesii | Decaisnea | Lardizabalaceae |
|
| Phyllanthus oligospermus | Phyllanthus | Phyllanthaceae | |
| Eucalyptus staigeriana | Eucalyptus | Myrtaceae |
|
| Callerya cinerea | Callerya | Fabaceae |
|
| Athanasia crithmifolia | Athanasia | Asteraceae | |
| Astragalus complanatus | Astragalus | Fabaceae |
|
| Hylocereus ocamponis | Hylocereus | Cactaceae |
|
| Atractylodes macrocephala | Atractylodes | Asteraceae |
|
| Patrinia scabiosifolia | Patrinia | Caprifoliaceae |
|
| Sasa paniculata | Sasa | Poaceae | |
| Sedum forsteri | Sedum | Crassulaceae |
|
| Syzygium samarangense | Syzygium | Myrtaceae |
|
| Crotalaria lachnophora | Crotalaria | Fabaceae |
|
| Populus angustifolia | Populus | Salicaceae |
|
| Rubus adenotrichos | Rubus | Rosaceae | |
| Iodes cirrhosa | Iodes | Icacinaceae | |
| Smilax bracteata | Smilax | Smilacaceae |
|
| Scilla dracomontana | Scilla | Hyacinthaceae | |
| Buddleja cordata | Buddleja | Scrophulariaceae | |
| Commiphora abyssinica | Commiphora | Burseraceae |
|
| Cnidium officinale | Cnidium | Apiaceae |
|
| Peperomia proctorii | Peperomia | Piperaceae | |
| Miliusa sinensis | Miliusa | Annonaceae | |
| Perovskia abrotanoides | Salvia | Lamiaceae |
|
| Lasiosiphon kraussianus | Lasiosiphon | Thymelaeaceae | |
| Aframomum sulcatum | Aframomum | Zingiberaceae |
|
| Angelica pubescens | Angelica | Apiaceae |
|
| Morinda morindoides | Morinda | Rubiaceae |
|
| Clematis tangutica | Clematis | Ranunculaceae |
|
| Angylocalyx braunii | Angylocalyx | Fabaceae | |
| Lens culinaris | Lens | Fabaceae |
|
| Mitrephora diversifolia | Mitrephora | Annonaceae | |
| Populus ussuriensis | Populus | Salicaceae |
|
| Sedum litoreum | Sedum | Crassulaceae | |
| Xanthosoma violaceum | Xanthosoma | Araceae | |
| Wedelia scaberrima | Wedelia | Asteraceae | |
| Carlina acanthifolia | Carlina | Asteraceae |
|
| Tripterygium regelii | Tripterygium | Celastraceae |
|
| Tynanthus panurensis | Tynanthus | Bignoniaceae | |
| Diospyros buxifolia | Diospyros | Ebenaceae |
|
| Myrsine africana | Myrsine | Primulaceae |
|
| Litsea zeylanica | Litsea | Lauraceae |
|
| Rosulabryum capillare | Rosulabryum | Bryaceae | |
| Millettia erythrocalyx | Millettia | Fabaceae |
|
| Marrubium cylleneum | Marrubium | Lamiaceae | |
| Citrus rugulosa | Citrus | Rutaceae | |
| Melochia corchorifolia | Melochia | Malvaceae |
|
| Osmanthus heterophyllus | Osmanthus | Oleaceae | |
| Juniperus rigida var. conferta | Juniperus | Cupressaceae |
|
| Stachyurus himalaicus | Stachyurus | Stachyuraceae | |
| Aconitum violaceum | Aconitum | Ranunculaceae |
|
| Astragalus membranaceus | Astragalus | Fabaceae |
|
| Trifolium strepens | Trifolium | Fabaceae | |
| Rumex maritimus | Rumex | Polygonaceae |
|
| Scutellaria sieberi | Scutellaria | Lamiaceae | |
| Hoffmannia strigillosa | Hoffmannia | Rubiaceae | |
| Castanopsis cuspidata | Castanopsis | Fagaceae |
|
| Galega officinalis | Galega | Fabaceae |
|
| Christisonia bicolor | Christisonia | Orobanchaceae | |
| Plumbagella micrantha | Plumbagella | Plumbaginaceae |
|
| Aglaia australiensis | Aglaia | Meliaceae | |
| Tecoma grandiflora | Tecoma | Bignoniaceae | |
| Anthyllis onobrychoides | Anthyllis | Fabaceae | |
| Tetraneuris acaulis | Tetraneuris | Asteraceae | |
| Maytenus hookeri | Maytenus | Celastraceae |
|
| Aster ageratoides | Aster | Asteraceae |
|
| Delphinium cashmerianum | Delphinium | Ranunculaceae |
|
| Thaminophyllum multiflorum | Thaminophyllum | Asteraceae | |
| Tephrosia pumila | Tephrosia | Fabaceae |
|
| Diphasiastrum thyoides | Diphasiastrum | Lycopodiaceae | |
| Senecio rupestris | Senecio | Asteraceae | |
| Vitis silvestris | Vitis | Vitaceae | |
| Pluchea suaveolens | Pluchea | Asteraceae | |
| Atroxima liberica | Atroxima | Polygalaceae | |
| Mussaenda parviflora | Mussaenda | Rubiaceae | |
| Solanum andigena | Solanum | Solanaceae | |
| Pilocarpus spicatus | Pilocarpus | Rutaceae | |
| Walsura tubulata | Walsura | Meliaceae | |
| Anisodus tanguticus | Anisodus | Solanaceae |
|
| Chrysosplenium tetrandrum | Chrysosplenium | Saxifragaceae | |
| Tephrosia vogelii | Tephrosia | Fabaceae |
|
| Walsura piscidia | Walsura | Meliaceae |
|
| Panax papyrifer | Panax | Araliaceae | |
| Ginkgo biloba | Ginkgo | Ginkgoaceae |
|
| Chaenomeles sinensis | Chaenomeles | Rosaceae |
|
| Heuchera cylindrica | Heuchera | Saxifragaceae |
|
| Amelanchier vulgaris | Amelanchier | Rosaceae | |
| Tacca plantaginea | Tacca | Taccaceae |
|
| Linum crispum | Linum | Linaceae | |
| Caesalpinia crista | Guilandina | Fabaceae |
|
| Prunus lusitanica | Prunus | Rosaceae |
|
| Palafoxia texana | Palafoxia | Asteraceae | |
| Wyethia mollis | Wyethia | Asteraceae |
|
| Macadamia ternifolia | Macadamia | Proteaceae |
|
| Calea pilosa | Calea | Asteraceae | |
| Cordyline neocaledonica | Cordyline | Asparagaceae | |
| Stevia connata | Stevia | Asteraceae | |
| Baphia bancoensis | Baphia | Fabaceae | |
| Helichrysum davenportii | Helichrysum | Asteraceae | |
| Plectranthus purpuratus | Plectranthus | Lamiaceae | |
| Sanguisorba officinalis | Sanguisorba | Rosaceae |
|
| Cineraria geifolia | Cineraria | Asteraceae | |
| Halocarpus biformis | Halocarpus | Podocarpaceae | |
| Petteria ramentacea | Petteria | Fabaceae | |
| Iochroma australe | Iochroma | Solanaceae | |
| Tanacetum parthenifolium | Tanacetum | Asteraceae | |
| Cardamine pinnata | Cardamine | Brassicaceae | |
| Codonocarpus australis | Codonocarpus | Gyrostemonaceae | |
| Schizonepeta multifida | Schizonepeta | Lamiaceae | |
| Swertia japonica | Swertia | Gentianaceae |
|
| Quercus serrata | Quercus | Fagaceae |
|
| Crateva nurvala | Crateva | Capparaceae |
|
| Polygala amara | Polygala | Polygalaceae |
|
| Stephania sutchuenensis | Stephania | Menispermaceae | |
| Unonopsis glaucopetala | Unonopsis | Annonaceae | |
| Morus alba | Morus | Moraceae |
|
| Rubus rosa | Rubus | Rosaceae |
|
| Aegilops geniculata | Aegilops | Poaceae | |
| Foeniculum vulgare | Foeniculum | Apiaceae |
|
| Pleogyne cunninghamii | Pleogyne | Menispermaceae | |
| Pyrola decorata | Pyrola | Ericaceae |
|
| Pleogyne cunninghami | Pleogyne | Menispermaceae | |
| Euonymus nanoides | Euonymus | Celastraceae | |
| Cerbera dilatata | Cerbera | Apocynaceae | |
| Achillea clypeolata | Achillea | Asteraceae | |
| Bridelia ferruginea | Bridelia | Phyllanthaceae |
|
| Berberis julianae | Berberis | Berberidaceae |
|
| Tetragonia tetragonioides | Tetragonia | Aizoaceae |
|
| Zieria smithii | Zieria | Rutaceae | |
| Bystropogon origanifolius | Bystropogon | Lamiaceae | |
| Cuscuta australis | Cuscuta | Convolvulaceae |
|
| Cullen corylifolium | Cullen | Fabaceae |
|
| Sapium haematospermum | Sapium | Euphorbiaceae |
|
| Ranunculus acris | Ranunculus | Ranunculaceae |
|
| Aesculus chinensis | Aesculus | Sapindaceae |
|
| Glycyrrhiza glabra | Glycyrrhiza | Fabaceae |
|
| Urena lobata | Urena | Malvaceae |
|
| Samadera indica | Samadera | Simaroubaceae |
|
| Hippophae fructus | Hippophae | Elaeagnaceae | |
| Polygonum aviculare | Polygonum | Polygonaceae |
|
| Delphinium staphisagria | Delphinium | Ranunculaceae | |
| tripolium vulgare | Tripolium | Asteraceae | |
| dracocephalum ruyschiana | Dracocephalum | Lamiaceae | |
| Desmodium styracifolium | Desmodium | Fabaceae |
|
| Diplacus longiflorus | Diplacus | Phrymaceae | |
| Piper sanctum | Piper | Piperaceae |
|
| Alstonia undulifolia | Alstonia | Apocynaceae | |
| Teucrium asiaticum | Teucrium | Lamiaceae | |
| Nelumbo nucifera | Nelumbo | Nelumbonaceae |
|
| Achillea pseudopectinata | Achillea | Asteraceae | |
| Montanoa guatemalensis | Montanoa | Asteraceae | |
| Scrophularia koelzii | Scrophularia | Scrophulariaceae |
|
| Euphorbia myrsinites | Euphorbia | Euphorbiaceae |
|
| Melia indica | Melia | Meliaceae |
|
| Medinilla magnifica | Medinilla | Melastomataceae |
|
| Senecio variabilis | Senecio | Asteraceae | |
| Calostephane divaricata | Calostephane | Asteraceae | |
| Ostryopsis davidiana | Ostryopsis | Betulaceae |
|
| Archidendron lucidum | Archidendron | Fabaceae | |
| Vicia amurensis | Vicia | Fabaceae |
|
| Erigeron breviscapus | Erigeron | Asteraceae |
|
| Veronica persica | Veronica | Plantaginaceae |
|
| Betula platyphylla | Betula | Betulaceae |
|
| Knautia montana | Knautia | Caprifoliaceae | |
| Dendrobium thyrsiflorum | Dendrobium | Orchidaceae |
|
| Erigeron annuus | Erigeron | Asteraceae |
|
| Laggera alata | Laggera | Asteraceae |
|
| Polygonum flaccidum | Polygonum | Polygonaceae |
|
| Fagraea gracilipes | Fagraea | Gentianaceae |
|
| Isatis tinctoria | Isatis | Brassicaceae |
|
| Pteris pacifica | Pteris | Pteridaceae | |
| Kopsia profunda | Kopsia | Apocynaceae | |
| Polymnia uvedalia | Polymnia | Asteraceae | |
| Syzygium nervosum | Syzygium | Myrtaceae |
|
| Helipterum gnaphaloides | Helipterum | Asteraceae | |
| Lepidosperma ustulatum | Lepidosperma | Cyperaceae | |
| Toxicodendron vernicifluum | Toxicodendron | Anacardiaceae |
|
| Daemonorops draco | Daemonorops | Arecaceae |
|
| Garrya elliptica | Garrya | Garryaceae | |
| Hubertia tomentosa | Hubertia | Asteraceae | |
| Millettia ferruginea | Millettia | Fabaceae |
|
| Tsuga diversifolia | Tsuga | Pinaceae | |
| Lawsonia inermis | Lawsonia | Lythraceae |
|
| Tussilago farfara | Tussilago | Asteraceae |
|
| Laburnum watereri | Laburnum | Fabaceae | |
| Nassauvia cumingii | Nassauvia | Asteraceae | |
| Ligustrum obtusifolium | Ligustrum | Oleaceae |
|
| Papaver persicum | Papaver | Papaveraceae |
|
| Chisocheton ceramicus | Chisocheton | Meliaceae | |
| Chrysocoma peduncularis | Chrysocoma | Asteraceae | |
| Osyris abyssinica | Osyris | Santalaceae | |
| Hymenothrix wislizenii | Hymenothrix | Asteraceae | |
| Euphorbia humifusa | Euphorbia | Euphorbiaceae |
|
| Salvia miltiorrhiza | Salvia | Lamiaceae |
|
| Helichrysum auriceps | Helichrysum | Asteraceae | |
| Thermopsis dolichocarpa | Thermopsis | Fabaceae | |
| Crambe tatarica | Crambe | Brassicaceae |
|
| Garrya laurifolia | Garrya | Garryaceae | |
| Petroselinum crispum | Petroselinum | Apiaceae |
|
| Limnocharis flava | Limnocharis | Alismataceae |
|
| Cocos nucifera | Cocos | Arecaceae |
|
| Vaccinium oxycoccos | Vaccinium | Ericaceae |
|
| Picris conyzoides | Picris | Asteraceae | |
| Sequoia sempervirens | Sequoia | Cupressaceae |
|
| Amaranthus hypochondriacus | Amaranthus | Amaranthaceae |
|
| Jacobaea subalpina | Jacobaea | Asteraceae | |
| Iryanthera paraensis | Iryanthera | Myristicaceae |
|
| Conyza filaginoides | Conyza | Asteraceae | |
| Dendrobium crepidatum | Dendrobium | Orchidaceae | |
| Zanthoxylum fraxineum | Zanthoxylum | Rutaceae | |
| Dunalia solanacea | Dunalia | Solanaceae | |
| Hypericum sikokumontanum | Hypericum | Hypericaceae | |
| Ulva conglobata | Ulva | Ulvaceae |
|
| Bergenia crassifolia | Bergenia | Saxifragaceae |
|
| Sutherlandia frutescens | Sutherlandia | Fabaceae | |
| Mesua ferrea | Mesua | Calophyllaceae |
|
| Caragana aurantiaca | Caragana | Fabaceae | |
| Astragalus dissectus | Astragalus | Fabaceae | |
| Baillonella toxisperma | Baillonella | Sapotaceae |
|
| Berberis floribunda | Berberis | Berberidaceae |
|
| Vismia orientalis | Vismia | Hypericaceae |
|
| Phebalium ambiens | Phebalium | Rutaceae | |
| Glycyrrhiza uralensis | Glycyrrhiza | Fabaceae |
|
| Greenwayodendron oliveri | Greenwayodendron | Annonaceae | |
| Goniothalamus giganteus | Goniothalamus | Annonaceae |
|
| Helicteres angustifolia | Helicteres | Malvaceae |
|
| Brachychiton populneum | Brachychiton | Malvaceae | |
| Goupia glabra | Goupia | Goupiaceae | |
| Astragalus cicer | Astragalus | Fabaceae | |
| Jamesoniella colorata | Jamesoniella | Jungermanniaceae |
|
| Geranium wilfordii maxim | Geranium | Geraniaceae | |
| Premna odorata | Premna | Lamiaceae |
|
| Garcinia pyrifera | Garcinia | Clusiaceae | |
| Centaurea cana | Centaurea | Asteraceae | |
| Fagus fusca | Fagus | Fagaceae | |
| Fumaria micrantha | Fumaria | Papaveraceae | |
| Spiracantha cornifolia | Spiracantha | Asteraceae | |
| Cleome pungens | Cleome | Cleomaceae | |
| Senecio viscosus | Senecio | Asteraceae | |
| Alhagi persarum | Alhagi | Fabaceae | |
| Passiflora foetida | Passiflora | Passifloraceae |
|
| Asparagus officinalis | Asparagus | Asparagaceae |
|
| Pterodon emarginatus | Pterodon | Fabaceae | |
| Excoecaria acerifolia | Excoecaria | Euphorbiaceae |
|
| Buphthalmum salicifolium | Buphthalmum | Asteraceae | |
| Berlinia tomentosa | Berlinia | Fabaceae | |
| Tylophora tanakae | Tylophora | Apocynaceae | |
| Acacia kempeana | Acacia | Fabaceae |
|
| Ocotea minarum | Ocotea | Lauraceae | |
| Senecio cathcartensis | Senecio | Asteraceae | |
| Marcetella moquiniana | Marcetella | Rosaceae | |
| Croton laccifer | Croton | Euphorbiaceae | |
| Polygonatum stenophyllum | Polygonatum | Asparagaceae | |
| Pseudocinchona pachyceras | Pseudocinchona | Rubiaceae | |
| Ophryosporus floribundus | Ophryosporus | Asteraceae | |
| Cymodocea nodosa | Cymodocea | Cymodoceaceae | |
| Picrorhiza kurrooa | Picrorhiza | Plantaginaceae |
|
| Euphorbia pannonica | Euphorbia | Euphorbiaceae | |
| Teucrium lanigerum | Teucrium | Lamiaceae | |
| Myristica cagayanensis | Myristica | Myristicaceae | |
| Cotyledon secunda | Cotyledon | Crassulaceae | |
| Eupatorium lindleyanum | Eupatorium | Asteraceae |
|
| Holboellia fargesi | Holboellia | Lardizabalaceae | |
| Cryptocarya lividula | Cryptocarya | Lauraceae | |
| Artemisia lactiflora | Artemisia | Asteraceae |
|
| Bonamia spectabilis | Bonamia | Convolvulaceae | |
| Monopteryx uaucu | Monopteryx | Fabaceae |
|
| Licaria brasiliensis | Licaria | Lauraceae | |
| Narthecium asiaticum | Narthecium | Nartheciaceae | |
| Stachys palustris | Stachys | Lamiaceae |
|
| Crotalaria orixensis | Crotalaria | Fabaceae |
|
| Pteris semipinnata | Pteris | Pteridaceae | |
| Atuna racemosa | Atuna | Chrysobalanaceae |
|
| Persicaria tinctoria | Persicaria | Polygonaceae |
|
| Patrinia villosa | Patrinia | Caprifoliaceae |
|
| Inula japonica | Inula | Asteraceae |
|
| Daphniphyllum angustifolium | Daphniphyllum | Daphniphyllaceae | |
| Astragalus pycnanthus | Astragalus | Fabaceae | |
| Fritillaria ningguoensis | Fritillaria | Liliaceae |
|
| Crocus sativus | Crocus | Iridaceae |
|
| Pulsatilla campanella | Pulsatilla | Ranunculaceae |
|
| Rauvolfia vomitoria | Rauvolfia | Apocynaceae |
|
| Charpentiera obovata | Charpentiera | Amaranthaceae | |
| Gnetum latifolium | Gnetum | Gnetaceae |
|
| Gardenia jasminoides | Gardenia | Rubiaceae |
|
| Vernonanthura pinguis | Vernonanthura | Asteraceae | |
| Lotus ucrainicus | Lotus | Fabaceae | |
| Catalpa ovata | Catalpa | Bignoniaceae |
|
| Pinus brutia var. eldarica | Pinus | Pinaceae |
|
| Cichorium intybus | Cichorium | Asteraceae |
|
Ingredient ID: NPC111882
Formula: C6H12O5
Ingredient ID: NPC111882
| Common Name | n.a. |
| IUPAC Name | (1R,2S,4S,5R)-cyclohexane-1,2,3,4,5-pentol |
| Canonical SMILES | O[C@@H]1C[C@@H](O)[C@@H](C([C@H]1O)O)O |
| Standard InCHI | InChI=1S/C6H12O5/c7-2-1-3(8)5(10)6(11)4(2)9/h2-11H,1H2/t2-,3-,4+,5+/m1/s1 |
| Standard InCHIKey | IMPKVMRTXBRHRB-MBMOQRBOSA-N |
| Ingredient External Links |
PubChem CID: 441437 ZINC ID: ZINC000004097493 |
| Plant-Ingredient Association Reference |
Database: NPASS [NPC111882] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Phoenix loureiroi | Phoenix | Arecaceae |
|
| Thalictrum longistylum | Thalictrum | Ranunculaceae |
|
| Atylosia trinervia | Atylosia | Fabaceae | |
| Salvia parryi | Salvia | Lamiaceae | |
| Iris ensata | Iris | Iridaceae |
|
| Solanum lasiocarpum | Solanum | Solanaceae |
|
| Petasites georgicus | Petasites | Asteraceae | |
| Cissampelos pareira | Cissampelos | Menispermaceae |
|
| Glycyrrhiza inflata | Glycyrrhiza | Fabaceae |
|
| Turpinia ternata | Turpinia | Staphyleaceae |
|
| Nuphar lutea | Nuphar | Nymphaeaceae |
|
| Polygonatum odoratum | Polygonatum | Asparagaceae |
|
| Myrsine africana | Myrsine | Primulaceae |
|
| Phoenix dactylifera | Phoenix | Arecaceae |
|
| Aglaia odorata | Aglaia | Meliaceae |
|
| Stephania hernandifolia | Stephania | Menispermaceae |
|
| Xyris pterygoblephara | Xyris | Xyridaceae | |
| Elephantopus mollis | Elephantopus | Asteraceae |
|
| Gomortega keule | Gomortega | Gomortegaceae |
|
| Quercus robur | Quercus | Fagaceae |
|
| Picea mariana | Picea | Pinaceae |
|
| Viguiera oblongifolia | Viguiera | Asteraceae | |
| Viburnum urceolatum | Viburnum | Adoxaceae | |
| Euryops algoensis | Euryops | Asteraceae | |
| Artemisia schimperi | Artemisia | Asteraceae | |
| Gardenia jasminoides | Gardenia | Rubiaceae |
|
| Litsea pungens | Litsea | Lauraceae |
|
Properties
| Ingredient ID | Formulae | Name | MW | AlogP | MlogP | XlogP | # HBA | # HBD | PSA | # Rotatable Bond | # Ring | # Heacy Atom | Lipinski RO5 Violation |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| NPC111882 | C6H12O5 | 164.0684735 | -2.8415 | 1.57 | -1.286 | 5 | 5 | 101.15 | 5 | 1 | 11 | 0 | |
| NPC133671 | C21H20O11 | Astragalin | 448.1 | -4.4318 | 2.56 | 0.18 | 7 | 7 | 186.37 | 11 | 4 | 32 | 1 |
| NPC143168 | C17H26O4 | Embelin | 294.18 | -3.4988 | 2.89 | 6.234 | 4 | 2 | 74.6 | 13 | 1 | 21 | 1 |
| NPC145571 | C21H20O12 | 2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3-[(2S,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one | 464.0954761 | -4.8921 | 2.45 | -0.354 | 7 | 8 | 206.6 | 4 | 4 | 33 | 1 |
| NPC156788 | C14H10OS | 226.0452359 | 3.3132 | 2.78 | 3.036 | 1 | 0 | 36.28 | 1 | 0 | 16 | 0 | |
| NPC158662 | C30H50O3 | 458.3759955 | 1.3478 | 4.43 | 8.336 | 3 | 3 | 60.69 | 11 | 5 | 33 | 1 | |
| NPC23140 | C16H19NO6 | 7-(2,3-dihydroxy-3-methylbutyl)-6-methoxy-9H-[1,3]dioxolo[4,5-h]quinolin-8-one | 321.1212373 | -1.1293 | 2.45 | 0.492 | 3 | 3 | 101.27 | 4 | 3 | 23 | 0 |
| NPC243272 | C18H28O4 | 5-O-Methylembelin | 308.2 | -3.4343 | 3 | 6.126 | 4 | 1 | 63.6 | 14 | 1 | 22 | 2 |
| NPC254848 | C15H10O5 | 3,8-dihydroxy-6-methyl-9,10-dioxoanthracen-1-olate | 269.0449984 | -1.6003 | 2.56 | 0.664 | 2 | 2 | 97.66 | 0 | 3 | 20 | 0 |
| NPC257566 | C29H34O14 | 606.1948558 | -4.5501 | 3.11 | -0.304 | 10 | 7 | 214.06 | 17 | 5 | 43 | 1 | |
| NPC267205 | C15H12O4 | Emodin Anthrone | 256.07 | -0.5465 | 2.67 | 1.793 | 1 | 3 | 77.76 | 4 | 3 | 19 | 0 |
| NPC308404 | C21H20O12 | 464.0954761 | -4.8921 | 2.45 | -0.354 | 12 | 8 | 206.6 | 12 | 4 | 33 | 1 | |
| NPC416 | C15H10O5 | 270.0528234 | -1.2665 | 2.56 | 0.882 | 2 | 3 | 94.83 | 4 | 3 | 20 | 0 | |
| NPC4437 | C14H10OS | 226.0452359 | 3.3132 | 2.78 | 3.036 | 1 | 0 | 36.28 | 1 | 0 | 16 | 0 | |
| NPC53810 | C54H88O23 | 1104.571639 | -4.7431 | 4.87 | 3.159 | 23 | 13 | 363.13 | 11 | 10 | 77 | 3 | |
| NPC72471 | C36H54O8 | 2-[1-(2,5-dihydroxy-3,6-dioxo-4-undecylcyclohexa-1,4-dien-1-yl)ethyl]-3,6-dihydroxy-5-undecylcyclohexa-2,5-diene-1,4-dione | 614.3818687 | -6.7702 | 4.54 | 12.536 | 8 | 4 | 149.2 | 22 | 2 | 44 | 2 |
| NPC86143 | C21H20O11 | 5,7-dihydroxy-2-(4-hydroxyphenyl)-3-[(2S,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one | 448.1005615 | -4.4318 | 2.56 | 0.18 | 7 | 7 | 186.37 | 4 | 4 | 32 | 1 |
| NPC90411 | C9H8O4 | Sid22414536 | 180.04 | -0.5916 | 2.01 | 0.98 | 2 | 1 | 55.76 | 3 | 2 | 13 | 0 |
| NPC93334 | C36H52O7 | 2,7-dihydroxy-9-methyl-3,6-di(undecyl)-9H-xanthene-1,4,5,8-tetrone | 596.371304 | -6.6917 | 4.65 | 11.949 | 7 | 2 | 117.97 | 20 | 3 | 43 | 2 |
| NPC94488 | C19H30O4 | 322.2144094 | -3.1839 | 3.11 | 6.549 | 4 | 1 | 63.6 | 15 | 1 | 23 | 2 |
Download Data
All data can be downloaded by:→ Selecting data type in the below download table
→ Then click the download button.
