21 Known Ingredients in Total
Unique ingredients have been isolated from this plant.
Plant-Ingredients Associations were manually curated from publications or collected from other databases.
5 Ingredients with Available Activity
Unique ingredients have activity data available.
Ingredient Structrual Cards
Ingredient ID: NPC99773
Formula: C18H18O5
Ingredient ID: NPC99773
| Common Name | n.a. |
| IUPAC Name | 1-(2-hydroxy-4,6-dimethoxyphenyl)-3-(2-methoxyphenyl)prop-2-en-1-one |
| Canonical SMILES | COc1cc(O)c(c(c1)OC)C(=O)C=Cc1ccccc1OC |
| Standard InCHI | InChI=1S/C18H18O5/c1-21-13-10-15(20)18(17(11-13)23-3)14(19)9-8-12-6-4-5-7-16(12)22-2/h4-11,20H,1-3H3 |
| Standard InCHIKey | KKTYCZKXENFEJP-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 4309692 |
| Plant-Ingredient Association Reference |
Database: TCMID [10784] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Andrographis lineata | Andrographis | Acanthaceae |
 |
Ingredient ID: NPC9966
Formula: C20H20O7
Ingredient ID: NPC9966
| Common Name | n.a. |
| IUPAC Name | 5,7-dimethoxy-2-(2,3,4-trimethoxyphenyl)chromen-4-one |
| Canonical SMILES | COc1cc(OC)c2c(c1)oc(cc2=O)c1ccc(c(c1OC)OC)OC |
| Standard InCHI | InChI=1S/C20H20O7/c1-22-11-8-16(24-3)18-13(21)10-15(27-17(18)9-11)12-6-7-14(23-2)20(26-5)19(12)25-4/h6-10H,1-5H3 |
| Standard InCHIKey | XCRISFHOPWXTMT-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 373146 ZINC ID: ZINC000001631688 |
| Plant-Ingredient Association Reference |
Database: NPASS [NPC9966] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Andrographis lineata | Andrographis | Acanthaceae |
|
Ingredient ID: NPC96225
Formula: C21H28O4
Ingredient ID: NPC96225
| Common Name | n.a. |
| IUPAC Name | methyl (4R,4aR,6aS,11aR,11bS)-6a-hydroxy-4,11b-dimethyl-7-methylidene-1,2,3,4a,5,6,11,11a-octahydronaphtho[2,1-f][1]benzofuran-4-carboxylate |
| Canonical SMILES | COC(=O)[C@]1(C)CCC[C@]2([C@H]1CC[C@@]1([C@@H]2Cc2c(C1=C)cco2)O)C |
| Standard InCHI | InChI=1S/C21H28O4/c1-13-14-7-11-25-15(14)12-17-19(2)8-5-9-20(3,18(22)24-4)16(19)6-10-21(13,17)23/h7,11,16-17,23H,1,5-6,8-10,12H2,2-4H3/t16-,17-,19+,20-,21-/m1/s1 |
| Standard InCHIKey | PCWIZDNRFPIZQO-JBYOPCTKSA-N |
| Ingredient External Links |
PubChem CID: 49780444 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD181868] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Andrographis lineata | Andrographis | Acanthaceae |
|
| Baccharis patagonica | Baccharis | Asteraceae | |
| Hoya australis | Hoya | Apocynaceae | |
| Thalictrum glaucum | Thalictrum | Ranunculaceae |
Ingredient ID: NPC95526
Formula: C23H28O5
Ingredient ID: NPC95526
| Common Name | Taepeenin D |
| IUPAC Name | methyl (4R,4aR,5R,11bS)-5-acetyloxy-4,7,11b-trimethyl-1,2,3,4a,5,6-hexahydronaphtho[2,1-f][1]benzofuran-4-carboxylate |
| Canonical SMILES | COC(=O)[C@]1(C)CCC[C@]2([C@H]1[C@H](OC(=O)C)Cc1c2cc2c(c1C)cco2)C |
| Standard InCHI | InChI=1S/C23H28O5/c1-13-15-7-10-27-18(15)12-17-16(13)11-19(28-14(2)24)20-22(17,3)8-6-9-23(20,4)21(25)26-5/h7,10,12,19-20H,6,8-9,11H2,1-5H3/t19-,20-,22-,23-/m1/s1 |
| Standard InCHIKey | KUDGKETXNRKTHI-OHUMZHCVSA-N |
| Ingredient External Links |
PubChem CID: 11703693 ChEMBL ID: CHEMBL1096147 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD74033] Database: NPASS [NPC95526] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Andrographis lineata | Andrographis | Acanthaceae |
|
| Baccharis patagonica | Baccharis | Asteraceae | |
| Hoya australis | Hoya | Apocynaceae | |
| Thalictrum glaucum | Thalictrum | Ranunculaceae |
Ingredient ID: NPC31363
Formula: C17H14O5
Ingredient ID: NPC31363
| Common Name | Intricatinol |
| IUPAC Name | (3E)-7,8-dihydroxy-3-[(4-methoxyphenyl)methylidene]chromen-4-one |
| Canonical SMILES | COc1ccc(cc1)/C=C/1COc2c(C1=O)ccc(c2O)O |
| Standard InCHI | InChI=1S/C17H14O5/c1-21-12-4-2-10(3-5-12)8-11-9-22-17-13(15(11)19)6-7-14(18)16(17)20/h2-8,18,20H,9H2,1H3/b11-8+ |
| Standard InCHIKey | VXIWIIHDWPBCIM-DHZHZOJOSA-N |
| Ingredient External Links |
PubChem CID: 6439175 ChEMBL ID: CHEMBL233805 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD323] Database: NPASS [NPC31363] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Andrographis lineata | Andrographis | Acanthaceae |
|
| Baccharis patagonica | Baccharis | Asteraceae | |
| Hoya australis | Hoya | Apocynaceae | |
| Thalictrum glaucum | Thalictrum | Ranunculaceae |
Ingredient ID: NPC311550
Formula: C14H16O9
Ingredient ID: NPC311550
| Common Name | n.a. |
| IUPAC Name | (2S,3R,4R,4aS,10bR)-3,4,8,10-tetrahydroxy-2-(hydroxymethyl)-9-methoxy-3,4,4a,10b-tetrahydro-2H-pyrano[3,2-c]isochromen-6-one |
| Canonical SMILES | OC[C@@H]1O[C@H]2[C@H]([C@@H]([C@H]1O)O)OC(=O)c1c2c(O)c(c(c1)O)OC |
| Standard InCHI | InChI=1S/C14H16O9/c1-21-11-5(16)2-4-7(9(11)18)12-13(23-14(4)20)10(19)8(17)6(3-15)22-12/h2,6,8,10,12-13,15-19H,3H2,1H3/t6-,8-,10+,12+,13-/m0/s1 |
| Standard InCHIKey | YWJXCIXBAKGUKZ-SIOUWEMCSA-N |
| Ingredient External Links |
PubChem CID: 471287 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD20428] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Andrographis lineata | Andrographis | Acanthaceae |
|
| Baccharis patagonica | Baccharis | Asteraceae | |
| Hoya australis | Hoya | Apocynaceae | |
| Thalictrum glaucum | Thalictrum | Ranunculaceae |
Ingredient ID: NPC30128
Formula: C18H18O5
Ingredient ID: NPC30128
| Common Name | n.a. |
| IUPAC Name | 1-[2-(hydroxymethyl)prop-2-enyl]-3,7-dimethoxydibenzofuran-2-ol |
| Canonical SMILES | OCC(=C)Cc1c(O)c(OC)cc2c1c1ccc(cc1o2)OC |
| Standard InCHI | InChI=1S/C18H18O5/c1-10(9-19)6-13-17-12-5-4-11(21-2)7-14(12)23-15(17)8-16(22-3)18(13)20/h4-5,7-8,19-20H,1,6,9H2,2-3H3 |
| Standard InCHIKey | BOFHQPMMHJWOEP-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 49780663 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD61542] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Andrographis lineata | Andrographis | Acanthaceae |
|
| Baccharis patagonica | Baccharis | Asteraceae | |
| Hoya australis | Hoya | Apocynaceae | |
| Thalictrum glaucum | Thalictrum | Ranunculaceae |
Ingredient ID: NPC290489
Formula: C33H56O4
Ingredient ID: NPC290489
| Common Name | n.a. |
| IUPAC Name | tetracosyl 3-(3,4-dihydroxyphenyl)prop-2-enoate |
| Canonical SMILES | CCCCCCCCCCCCCCCCCCCCCCCCOC(=O)C=Cc1ccc(c(c1)O)O |
| Standard InCHI | InChI=1S/C33H56O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-28-37-33(36)27-25-30-24-26-31(34)32(35)29-30/h24-27,29,34-35H,2-23,28H2,1H3 |
| Standard InCHIKey | VMRFEDBTCSVDGN-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 78385378 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD216202] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Andrographis lineata | Andrographis | Acanthaceae |
|
| Baccharis patagonica | Baccharis | Asteraceae | |
| Hoya australis | Hoya | Apocynaceae | |
| Thalictrum glaucum | Thalictrum | Ranunculaceae |
Ingredient ID: NPC290038
Formula: C21H26O3
Ingredient ID: NPC290038
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | COC(=O)[C@]1(C)CCC[C@]2([C@H]1CCc1c2cc2c(c1C)cco2)C |
| Standard InCHI | InChI=1S/C21H26O3/c1-13-14-6-7-18-20(2,9-5-10-21(18,3)19(22)23-4)16(14)12-17-15(13)8-11-24-17/h8,11-12,18H,5-7,9-10H2,1-4H3/t18-,20-,21-/m1/s1 |
| Standard InCHIKey | ZWGUMZQPAPPDMV-HMXCVIKNSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD69748] Database: NPASS [NPC290038] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Andrographis lineata | Andrographis | Acanthaceae |
|
| Baccharis patagonica | Baccharis | Asteraceae | |
| Hoya australis | Hoya | Apocynaceae | |
| Thalictrum glaucum | Thalictrum | Ranunculaceae |
Ingredient ID: NPC264749
Formula: C42H54O6
Ingredient ID: NPC264749
| Common Name | n.a. |
| IUPAC Name | methyl (4S,4aS,11bR)-9-[(4R,4aR,6aR,7S,11aS,11bR)-4-methoxycarbonyl-4,7,11b-trimethyl-2,3,4a,5,6,6a,11,11a-octahydro-1H-naphtho[2,1-f][1]benzofuran-7-yl]-4,7,11b-trimethyl-1,2,3,4a,5,6-hexahydronaphtho[2,1-f][1]benzofuran-4-carboxylate |
| Canonical SMILES | COC(=O)[C@]1(C)CCC[C@]2([C@H]1CC[C@@H]1[C@@H]2Cc2c([C@@]1(C)c1oc3c(c1)c(C)c1c(c3)[C@]3(C)CCC[C@]([C@H]3CC1)(C)C(=O)OC)cco2)C |
| Standard InCHI | InChI=1S/C42H54O6/c1-24-25-11-13-33-38(2,16-9-18-40(33,4)36(43)45-7)29(25)22-31-26(24)21-35(48-31)42(6)27-12-14-34-39(3,17-10-19-41(34,5)37(44)46-8)30(27)23-32-28(42)15-20-47-32/h15,20-22,27,30,33-34H,9-14,16-19,23H2,1-8H3/t27-,30+,33+,34-,38+,39-,40+,41-,42+/m1/s1 |
| Standard InCHIKey | YTSRCEGDVADHHH-VSEWOVCTSA-N |
| Ingredient External Links |
PubChem CID: 49780661 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD121366] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Andrographis lineata | Andrographis | Acanthaceae |
|
| Baccharis patagonica | Baccharis | Asteraceae | |
| Hoya australis | Hoya | Apocynaceae | |
| Thalictrum glaucum | Thalictrum | Ranunculaceae |
Ingredient ID: NPC257648
Formula: C18H16O5
Ingredient ID: NPC257648
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | COc1ccc(cc1)/C=C/1COc2c(C1=O)ccc(c2OC)O |
| Standard InCHI | InChI=1S/C18H16O5/c1-21-13-5-3-11(4-6-13)9-12-10-23-17-14(16(12)20)7-8-15(19)18(17)22-2/h3-9,19H,10H2,1-2H3/b12-9+ |
| Standard InCHIKey | WOXQROZUZURVHX-FMIVXFBMSA-N |
| Ingredient External Links |
ZINC ID: ZINC000013327557 |
| Plant-Ingredient Association Reference |
Database: UNPD [] Database: NPASS [NPC257648] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Andrographis lineata | Andrographis | Acanthaceae |
|
| Baccharis patagonica | Baccharis | Asteraceae | |
| Hoya australis | Hoya | Apocynaceae | |
| Thalictrum glaucum | Thalictrum | Ranunculaceae |
Ingredient ID: NPC247807
Formula: C15H26O2
Ingredient ID: NPC247807
| Common Name | n.a. |
| IUPAC Name | (2S,4aS,6R,8aS)-6-(2-hydroxypropan-2-yl)-8a-methyl-4-methylidene-1,2,3,4a,5,6,7,8-octahydronaphthalen-2-ol |
| Canonical SMILES | O[C@H]1CC(=C)[C@H]2[C@@](C1)(C)CC[C@H](C2)C(O)(C)C |
| Standard InCHI | InChI=1S/C15H26O2/c1-10-7-12(16)9-15(4)6-5-11(8-13(10)15)14(2,3)17/h11-13,16-17H,1,5-9H2,2-4H3/t11-,12+,13+,15+/m1/s1 |
| Standard InCHIKey | XZXBGGYJQALVAW-OSFYFWSMSA-N |
| Ingredient External Links |
PubChem CID: 12314741 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD150858] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Andrographis lineata | Andrographis | Acanthaceae |
|
| Baccharis patagonica | Baccharis | Asteraceae | |
| Hoya australis | Hoya | Apocynaceae | |
| Thalictrum glaucum | Thalictrum | Ranunculaceae |
Ingredient ID: NPC241715
Formula: C20H34O
Ingredient ID: NPC241715
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | OCC=C1CC[C@H]2[C@H]([C@H]1C)CC[C@@H]1[C@]2(C)CCCC1(C)C |
| Standard InCHI | InChI=1S/C20H34O/c1-14-15(10-13-21)6-8-17-16(14)7-9-18-19(2,3)11-5-12-20(17,18)4/h10,14,16-18,21H,5-9,11-13H2,1-4H3/t14-,16-,17-,18-,20+/m0/s1 |
| Standard InCHIKey | SUOAJIGEPHEMQV-ATCHWDNASA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD222538] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Andrographis lineata | Andrographis | Acanthaceae |
|
| Baccharis patagonica | Baccharis | Asteraceae | |
| Hoya australis | Hoya | Apocynaceae | |
| Thalictrum glaucum | Thalictrum | Ranunculaceae |
Ingredient ID: NPC233763
Formula: C20H26O4
Ingredient ID: NPC233763
| Common Name | Nortaepeenin A |
| IUPAC Name | methyl (4R,4aR,6aR,11aS,11bR)-4,11b-dimethyl-7-oxo-2,3,4a,5,6,6a,11,11a-octahydro-1H-naphtho[2,1-f][1]benzofuran-4-carboxylate |
| Canonical SMILES | COC(=O)[C@]1(C)CCC[C@]2([C@H]1CC[C@@H]1[C@@H]2Cc2c(C1=O)cco2)C |
| Standard InCHI | InChI=1S/C20H26O4/c1-19-8-4-9-20(2,18(22)23-3)16(19)6-5-12-14(19)11-15-13(17(12)21)7-10-24-15/h7,10,12,14,16H,4-6,8-9,11H2,1-3H3/t12-,14+,16-,19-,20-/m1/s1 |
| Standard InCHIKey | YSMSCOUXKWVCGA-HRPNNTJESA-N |
| Ingredient External Links |
PubChem CID: 11587964 ChEMBL ID: CHEMBL3358072 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD67701] Database: NPASS [NPC233763] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Andrographis lineata | Andrographis | Acanthaceae |
|
| Baccharis patagonica | Baccharis | Asteraceae | |
| Hoya australis | Hoya | Apocynaceae | |
| Thalictrum glaucum | Thalictrum | Ranunculaceae |
Ingredient ID: NPC224577
Formula: C24H38O4
Ingredient ID: NPC224577
| Common Name | n.a. |
| IUPAC Name | [(1R,1aR,1bR,3aS,7aR,7bS,9R,9aR)-9-acetyloxy-4,4,7a,9a-tetramethyl-1,1a,1b,2,3,3a,5,6,7,7b,8,9-dodecahydrocyclopropa[a]phenanthren-1-yl]methyl acetate |
| Canonical SMILES | CC(=O)O[C@@H]1C[C@H]2[C@H]([C@H]3[C@]1(C)[C@@H]3COC(=O)C)CC[C@@H]1[C@]2(C)CCCC1(C)C |
| Standard InCHI | InChI=1S/C24H38O4/c1-14(25)27-13-18-21-16-8-9-19-22(3,4)10-7-11-23(19,5)17(16)12-20(24(18,21)6)28-15(2)26/h16-21H,7-13H2,1-6H3/t16-,17+,18-,19+,20-,21-,23-,24-/m1/s1 |
| Standard InCHIKey | DUQGTHMKPLWCMC-XWINOTSYSA-N |
| Ingredient External Links |
PubChem CID: 49780446 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD56064] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Andrographis lineata | Andrographis | Acanthaceae |
|
| Baccharis patagonica | Baccharis | Asteraceae | |
| Hoya australis | Hoya | Apocynaceae | |
| Thalictrum glaucum | Thalictrum | Ranunculaceae |
Ingredient ID: NPC21465
Formula: C20H34O2
Ingredient ID: NPC21465
| Common Name | n.a. |
| IUPAC Name | (1R,2Z,3R,4aS,4bR,8aS,10aS)-2-(2-hydroxyethylidene)-1,4b,8,8-tetramethyl-3,4,4a,5,6,7,8a,9,10,10a-decahydro-1H-phenanthren-3-ol |
| Canonical SMILES | OC/C=C/1[C@H](O)C[C@H]2[C@H]([C@H]1C)CC[C@@H]1[C@]2(C)CCCC1(C)C |
| Standard InCHI | InChI=1S/C20H34O2/c1-13-14-6-7-18-19(2,3)9-5-10-20(18,4)16(14)12-17(22)15(13)8-11-21/h8,13-14,16-18,21-22H,5-7,9-12H2,1-4H3/b15-8-/t13-,14+,16+,17-,18+,20-/m1/s1 |
| Standard InCHIKey | OFMUTCQENVXLBA-HPHNHNPLSA-N |
| Ingredient External Links |
PubChem CID: 49780445 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD190379] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Andrographis lineata | Andrographis | Acanthaceae |
|
| Baccharis patagonica | Baccharis | Asteraceae | |
| Hoya australis | Hoya | Apocynaceae | |
| Thalictrum glaucum | Thalictrum | Ranunculaceae |
Ingredient ID: NPC206420
Formula: C17H16O5
Ingredient ID: NPC206420
| Common Name | n.a. |
| IUPAC Name | 1-[2-(hydroxymethyl)prop-2-enyl]-3-methoxydibenzofuran-2,7-diol |
| Canonical SMILES | OCC(=C)Cc1c(O)c(OC)cc2c1c1ccc(cc1o2)O |
| Standard InCHI | InChI=1S/C17H16O5/c1-9(8-18)5-12-16-11-4-3-10(19)6-13(11)22-14(16)7-15(21-2)17(12)20/h3-4,6-7,18-20H,1,5,8H2,2H3 |
| Standard InCHIKey | HAWHWUJMXJUFKL-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 49780662 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD119949] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Andrographis lineata | Andrographis | Acanthaceae |
|
| Baccharis patagonica | Baccharis | Asteraceae | |
| Hoya australis | Hoya | Apocynaceae | |
| Thalictrum glaucum | Thalictrum | Ranunculaceae |
Ingredient ID: NPC188947
Formula: C17H14O4
Ingredient ID: NPC188947
| Common Name | Bonducellin |
| IUPAC Name | (3E)-7-hydroxy-3-[(4-methoxyphenyl)methylidene]chromen-4-one |
| Canonical SMILES | COc1ccc(cc1)/C=C/1COc2c(C1=O)ccc(c2)O |
| Standard InCHI | InChI=1S/C17H14O4/c1-20-14-5-2-11(3-6-14)8-12-10-21-16-9-13(18)4-7-15(16)17(12)19/h2-9,18H,10H2,1H3/b12-8+ |
| Standard InCHIKey | DLQSYZMPSWHYMW-XYOKQWHBSA-N |
| Ingredient External Links |
PubChem CID: 14079439 ChEMBL ID: CHEMBL450675 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD101943] Database: NPASS [NPC188947] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Cyperus capitatus | Cyperus | Cyperaceae | |
| Eucalyptus froggattii | Eucalyptus | Myrtaceae | |
| Litsea nitida | Litsea | Lauraceae | |
| Pistacia mexicana | Pistacia | Anacardiaceae |
 |
| Tripterygium wilfordii | Tripterygium | Celastraceae |
|
| Delphinium tricorne | Delphinium | Ranunculaceae | |
| Jatropha gossypiifolia | Jatropha | Euphorbiaceae |
|
| Tamarix dioica | Tamarix | Tamaricaceae |
|
| Boronia alata | Boronia | Rutaceae | |
| Lobelia langeana | Lobelia | Campanulaceae | |
| Helleborus viridis | Helleborus | Ranunculaceae |
|
| Xanthium canadense | Xanthium | Asteraceae |
|
| Iris sibirica | Iris | Iridaceae |
 |
| Haemanthus albiflos | Haemanthus | Amaryllidaceae |
|
| Sibiraea angustata | Sibiraea | Rosaceae | |
| Valeriana officinalis | Valeriana | Caprifoliaceae |
 |
| Peltophorum dubium | Peltophorum | Fabaceae | |
| Hordeum bulbosum | Hordeum | Poaceae |
|
| Magnolia henryi | Magnolia | Magnoliaceae | |
| Micromelum falcatum | Micromelum | Rutaceae |
|
| Andrographis lineata | Andrographis | Acanthaceae |
|
| Eria siamensis | Eria | Orchidaceae | |
| Prunus pseudocerasus | Prunus | Rosaceae |
|
| Vernonia aurea | Vernonia | Asteraceae | |
| Baccharis patagonica | Baccharis | Asteraceae | |
| Betula papyrifera | Betula | Betulaceae |
|
| Hoya australis | Hoya | Apocynaceae | |
| Ephedra altissima | Ephedra | Ephedraceae |
|
| Bignonia unguiscati | Bignonia | Bignoniaceae | |
| Coronilla hyrcana | Coronilla | Fabaceae | |
| Erica cinerea | Erica | Ericaceae |
|
| Maytenus emarginata | Maytenus | Celastraceae | |
| Biancaea sappan | Biancaea | Fabaceae |
|
| stuhlmannia moavi | Stuhlmannia | Fabaceae | |
| Isolona pilosa | Isolona | Annonaceae | |
| Thalictrum glaucum | Thalictrum | Ranunculaceae | |
| Cinnamomum philippinense | Cinnamomum | Lauraceae |
|
| Salvia miniata | Salvia | Lamiaceae | |
| Eria tomentosa | Eria | Orchidaceae | |
| Aeschynanthus parvifolius | Aeschynanthus | Gesneriaceae |
Ingredient ID: NPC166805
Formula: C20H34O2
Ingredient ID: NPC166805
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | OC/C=C1/CC[C@H]2[C@H]([C@H]1C)CC[C@@H]1[C@]2(C)CCC[C@@]1(C)CO |
| Standard InCHI | InChI=1S/C20H34O2/c1-14-15(9-12-21)5-7-17-16(14)6-8-18-19(2,13-22)10-4-11-20(17,18)3/h9,14,16-18,21-22H,4-8,10-13H2,1-3H3/b15-9-/t14-,16-,17-,18-,19-,20+/m0/s1 |
| Standard InCHIKey | FPQIUXBFIZQQFH-KIJNBTKSSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD36436] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Andrographis lineata | Andrographis | Acanthaceae |
|
| Baccharis patagonica | Baccharis | Asteraceae | |
| Hoya australis | Hoya | Apocynaceae | |
| Thalictrum glaucum | Thalictrum | Ranunculaceae |
Ingredient ID: NPC161571
Formula: C14H12O3
Ingredient ID: NPC161571
| Common Name | Resveratrol |
| IUPAC Name | 5-[(E)-2-(4-hydroxyphenyl)ethenyl]benzene-1,3-diol |
| Canonical SMILES | Oc1ccc(cc1)/C=C/c1cc(O)cc(c1)O |
| Standard InCHI | InChI=1S/C14H12O3/c15-12-5-3-10(4-6-12)1-2-11-7-13(16)9-14(17)8-11/h1-9,15-17H/b2-1+ |
| Standard InCHIKey | LUKBXSAWLPMMSZ-OWOJBTEDSA-N |
| Ingredient External Links |
PubChem CID: 445154 ChEMBL ID: CHEMBL165 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD162428] Database: NPASS [NPC161571] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Ipomoea digitata | Ipomoea | Convolvulaceae |
|
| Artocarpus dadah | Artocarpus | Moraceae |
|
| Flacourtia jangomas | Flacourtia | Salicaceae |
|
| Heliotropium hirsutum | Heliotropium | Heliotropiaceae |
|
| Annona cornifolia | Annona | Annonaceae |
|
| Maytenus imbricata | Maytenus | Celastraceae | |
| Polygonum cuspidatum | Polygonum | Polygonaceae |
|
| Salvia syriaca | Salvia | Lamiaceae | |
| Curcuma xanthorrhiza | Curcuma | Zingiberaceae |
|
| Onobrychis arenaria | Onobrychis | Fabaceae | |
| Solanum laxum | Solanum | Solanaceae |
|
| Eria mollis | Eria | Orchidaceae | |
| Ageratina adenophora | Ageratina | Asteraceae |
|
| Eleutherococcus sessiliflorus | Eleutherococcus | Araliaceae |
|
| Dysoxylum cumingianum | Dysoxylum | Meliaceae | |
| Psychotria stachyoides | Psychotria | Rubiaceae | |
| Dodonaea viscosa | Dodonaea | Sapindaceae |
|
| Eucalyptus melliodora | Eucalyptus | Myrtaceae | |
| Dracaena cochinchinensis | Dracaena | Asparagaceae |
|
| Scutellaria amoena | Scutellaria | Lamiaceae |
|
| Teucrium yemense | Teucrium | Lamiaceae | |
| Senecio toluccanus | Senecio | Asteraceae |
|
| Goniothalamus malayanus | Goniothalamus | Annonaceae | |
| Neobalanocarpus heimii | Neobalanocarpus | Dipterocarpaceae | |
| Pastinaca sativa | Pastinaca | Apiaceae |
|
| Aconitum tasiromontanum | Aconitum | Ranunculaceae | |
| Humulus lupulus | Humulus | Cannabaceae |
|
| Dendriopoterium menendezii | Dendriopoterium | Rosaceae | |
| Adansonia grandidieri | Adansonia | Malvaceae |
|
| Physalis alkekengi | Physalis | Solanaceae |
|
| Lysimachia mauritiana | Lysimachia | Primulaceae | |
| Aphyllocladus denticulatus | Aphyllocladus | Asteraceae | |
| Bassia muricata | Bassia | Chenopodiaceae |
|
| Swertia franchetiana | Swertia | Gentianaceae |
|
| Senecio subdentatus | Senecio | Asteraceae | |
| Hippophae rhamnoides | Hippophae | Elaeagnaceae |
|
| Helipterum roseum | Helipterum | Asteraceae | |
| Aconitum seravschanicum | Aconitum | Ranunculaceae | |
| Hedysarum connatum | Hedysarum | Fabaceae | |
| Sideritis chamaedryfolia | Sideritis | Lamiaceae | |
| Zanthoxylum tetraspermum | Zanthoxylum | Rutaceae |
|
| Artemisia assoana | Artemisia | Asteraceae | |
| Dumortiera hirsuta | Dumortiera | Dumortieraceae |
|
| Lepisorus ussuriensis | Lepisorus | Polypodiaceae |
|
| Trifolium dubium | Trifolium | Fabaceae |
|
| Alstonia spathulata | Alstonia | Apocynaceae | |
| Phoebe pittieri | Phoebe | Lauraceae | |
| Hypericum laricifolium | Hypericum | Hypericaceae |
|
| Vitis vinifera | Vitis | Vitaceae |
|
| Hylotelephium telephium | Hylotelephium | Crassulaceae |
|
| Adiantum lunulatum | Adiantum | Pteridaceae |
|
| Peltostigma guatemalense | Peltostigma | Rutaceae | |
| Acacia adunca | Acacia | Fabaceae | |
| Viguiera incana | Viguiera | Asteraceae | |
| Astragalus sempervirens | Astragalus | Fabaceae | |
| Marrubium anisodon | Marrubium | Lamiaceae |
|
| Piper caninum | Piper | Piperaceae |
|
| Wikstroemia retusa | Wikstroemia | Thymelaeaceae | |
| Naucleopsis ternstroemiiflora | Naucleopsis | Moraceae | |
| Andrographis lineata | Andrographis | Acanthaceae |
|
| Vigna umbeuata | Vigna | Fabaceae | |
| Rheum wittrocki | Rheum | Polygonaceae |
|
| Carica pennata | Carica | Caricaceae | |
| Baccharis patagonica | Baccharis | Asteraceae | |
| Cassia dentata | Cassia | Fabaceae |
|
| Hoya australis | Hoya | Apocynaceae | |
| Astragalus cibarius | Astragalus | Fabaceae |
|
| Rheum officinale | Rheum | Polygonaceae |
|
| Veratrum dahuricum | Veratrum | Melanthiaceae | |
| Vernonia menthaefolia | Vernonia | Asteraceae | |
| Capsicum tetragonum | Capsicum | Solanaceae | |
| Aconitum heterophylloides | Aconitum | Ranunculaceae | |
| Justicia secunda | Justicia | Acanthaceae | |
| Gymnosporia diversifolia | Gymnosporia | Celastraceae | |
| Lycoris traubii | Lycoris | Amaryllidaceae | |
| Rumex maritimus | Rumex | Polygonaceae |
|
| Rheum coreanum | Rheum | Polygonaceae | |
| Arachis hypogaea | Arachis | Fabaceae |
|
| Smilax china | Smilax | Smilacaceae |
|
| Vatica rassak | Vatica | Dipterocarpaceae |
|
| Aster sedifolius | Aster | Asteraceae | |
| Chaenomeles sinensis | Chaenomeles | Rosaceae |
|
| Rubia cordifolia | Rubia | Rubiaceae |
|
| Lygodium flexuosum | Lygodium | Lygodiaceae |
|
| Rheum palmatum | Rheum | Polygonaceae |
|
| Morus alba | Morus | Moraceae |
|
| Oroxylum indicum | Oroxylum | Bignoniaceae |
|
| Strychnos staudtii | Strychnos | Loganiaceae | |
| Dictyoloma incanescens | Dictyoloma | Rutaceae | |
| Saccharum spontaneum | Saccharum | Poaceae |
|
| Crotalaria anagyroides | Crotalaria | Fabaceae |
|
| Caragana sinica | Caragana | Fabaceae |
|
| Dasymaschalon sootepense | Dasymaschalon | Annonaceae | |
| Croton poilanei | Croton | Euphorbiaceae | |
| Tsuga mertensiana | Tsuga | Pinaceae |
|
| Leptactina senegambica | Leptactina | Rubiaceae | |
| Panax ginseng | Panax | Araliaceae |
|
| Guatteria melosma | Guatteria | Annonaceae | |
| Securinega melanthesoides | Securinega | Phyllanthaceae | |
| Euonymus sachalinensis | Euonymus | Celastraceae |
|
| Felicia erigeroides | Felicia | Asteraceae | |
| Lupinus paniculatus | Lupinus | Fabaceae | |
| Fallopia multiflora | Fallopia | Polygonaceae |
|
| Boehmeria nivea | Boehmeria | Urticaceae |
|
| Vigna angularis | Vigna | Fabaceae |
|
| Ampelopsis brevipedunculata | Ampelopsis | Vitaceae |
|
| Lavandula vera | Lavandula | Lamiaceae |
|
| stuhlmannia moavi | Stuhlmannia | Fabaceae | |
| Vigna umbellata | Vigna | Fabaceae |
|
| Calostephane divaricata | Calostephane | Asteraceae | |
| Artemisia chinensis | Artemisia | Asteraceae |
|
| Veratrum grandiflorum | Veratrum | Melanthiaceae |
|
| Daemonorops draco | Daemonorops | Arecaceae |
|
| Fritillaria persica | Fritillaria | Liliaceae |
|
| Thalictrum glaucum | Thalictrum | Ranunculaceae | |
| Dryopteris crassirhizoma | Dryopteris | Dryopteridaceae |
|
| Broussonetia papyrifera | Broussonetia | Moraceae |
|
| Eupatorium glutinosum | Eupatorium | Asteraceae | |
| Vaccinium oxycoccos | Vaccinium | Ericaceae |
|
| Trinia scabra | Trinia | Apiaceae | |
| Polyalthia evecta | Polyalthia | Annonaceae |
|
| Caragana aurantiaca | Caragana | Fabaceae | |
| Smilax glabra | Smilax | Smilacaceae |
|
| Iris domestica | Iris | Iridaceae |
|
| Premna odorata | Premna | Lamiaceae |
|
| Rheum tanguticum | Rheum | Polygonaceae |
|
| Coprosma lucida | Coprosma | Rubiaceae |
|
| Canthium berberidifolium | Canthium | Rubiaceae |
|
| Enceliopsis argophylla | Enceliopsis | Asteraceae | |
| Cotyledon secunda | Cotyledon | Crassulaceae | |
| Rheum undulatum | Rheum | Polygonaceae |
|
| Tanacetum parthenium | Tanacetum | Asteraceae |
|
| Phalaenopsis cornu-cervi | Phalaenopsis | Orchidaceae | |
| Cotula filicula | Cotula | Asteraceae | |
| Rauvolfia vomitoria | Rauvolfia | Apocynaceae |
|
| Gnetum latifolium | Gnetum | Gnetaceae |
|
| Miliusa velutina | Miliusa | Annonaceae |
|
| Leucosceptrum canum | Leucosceptrum | Lamiaceae |
|
| Cinnamosma macrocarpa | Cinnamosma | Canellaceae | |
| Garcinia quaesita | Garcinia | Clusiaceae |
|
Ingredient ID: NPC138291
Formula: C17H16O6
Ingredient ID: NPC138291
| Common Name | n.a. |
| IUPAC Name | (2S)-5-hydroxy-2-(2-hydroxyphenyl)-7,8-dimethoxy-2,3-dihydrochromen-4-one |
| Canonical SMILES | COc1c(OC)cc(c2c1O[C@@H](CC2=O)c1ccccc1O)O |
| Standard InCHI | InChI=1S/C17H16O6/c1-21-14-8-12(20)15-11(19)7-13(23-17(15)16(14)22-2)9-5-3-4-6-10(9)18/h3-6,8,13,18,20H,7H2,1-2H3/t13-/m0/s1 |
| Standard InCHIKey | BTVSNVKVWQGSKK-ZDUSSCGKSA-N |
| Ingredient External Links |
PubChem CID: 12098358 ZINC ID: ZINC000014728122 |
| Plant-Ingredient Association Reference |
Database: TCMID [29708] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Andrographis lineata | Andrographis | Acanthaceae |
|
| Andrographis paniculata | Andrographis | Acanthaceae |
|
Properties
| Ingredient ID | Formulae | Name | MW | AlogP | MlogP | XlogP | # HBA | # HBD | PSA | # Rotatable Bond | # Ring | # Heacy Atom | Lipinski RO5 Violation |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| NPC138291 | C17H16O6 | (2S)-5-hydroxy-2-(2-hydroxyphenyl)-7,8-dimethoxy-2,3-dihydrochromen-4-one | 316.0946882 | -1.4577 | 2.67 | 1.183 | 1 | 2 | 85.22 | 3 | 3 | 23 | 0 |
| NPC161571 | C14H12O3 | Resveratrol | 228.08 | -0.9131 | 2.67 | 3.436 | 0 | 3 | 60.69 | 5 | 2 | 17 | 0 |
| NPC166805 | C20H34O2 | 306.2558803 | 0.2473 | 3.44 | 5.524 | 2 | 2 | 40.46 | 2 | 3 | 22 | 1 | |
| NPC188947 | C17H14O4 | Bonducellin | 282.09 | -0.6462 | 2.89 | 3.016 | 1 | 1 | 55.76 | 4 | 3 | 21 | 0 |
| NPC206420 | C17H16O5 | 300.0997736 | -0.6071 | 2.78 | 0.758 | 5 | 3 | 83.06 | 4 | 3 | 22 | 0 | |
| NPC21465 | C20H34O2 | 306.2558803 | 0.7649 | 3.44 | 6.103 | 2 | 2 | 40.46 | 1 | 3 | 22 | 1 | |
| NPC224577 | C24H38O4 | 390.2770097 | 0.9527 | 3.66 | 7.613 | 4 | 0 | 52.6 | 5 | 4 | 28 | 1 | |
| NPC233763 | C20H26O4 | Nortaepeenin A | 330.18 | 0.2382 | 3.22 | 3.89 | 3 | 0 | 56.51 | 5 | 4 | 24 | 0 |
| NPC241715 | C20H34O | 290.2609657 | 1.338 | 3.55 | 7.711 | 1 | 1 | 20.23 | 1 | 3 | 21 | 1 | |
| NPC247807 | C15H26O2 | 238.1932801 | 0.4754 | 2.89 | 2.745 | 2 | 2 | 40.46 | 1 | 2 | 17 | 0 | |
| NPC257648 | C18H16O5 | 312.1 | -0.698 | 2.89 | 2.572 | 1 | 1 | 64.99 | 6 | 3 | 23 | 0 | |
| NPC264749 | C42H54O6 | 654.3920394 | 1.952 | 5.42 | 11.085 | 6 | 0 | 78.88 | 5 | 8 | 48 | 1 | |
| NPC290038 | C21H26O3 | 326.19 | 1.0674 | 3.44 | 5.774 | 2 | 0 | 39.44 | 6 | 4 | 24 | 1 | |
| NPC290489 | C33H56O4 | 516.4178603 | -6.9237 | 4.65 | 14.192 | 4 | 2 | 66.76 | 26 | 1 | 37 | 2 | |
| NPC30128 | C18H18O5 | 314.1154237 | -0.1986 | 2.89 | 1.277 | 5 | 2 | 72.06 | 5 | 3 | 23 | 0 | |
| NPC311550 | C14H16O9 | 328.0794321 | -2.8389 | 2.01 | -2.021 | 9 | 5 | 145.91 | 2 | 3 | 23 | 0 | |
| NPC31363 | C17H14O5 | Intricatinol | 298.08 | -1.1065 | 2.78 | 2.482 | 1 | 2 | 75.99 | 5 | 3 | 22 | 0 |
| NPC95526 | C23H28O5 | Taepeenin D | 384.19 | 0.6802 | 3.44 | 4.64 | 4 | 0 | 65.74 | 9 | 4 | 28 | 0 |
| NPC96225 | C21H28O4 | 344.1987594 | 0.4134 | 3.33 | 3.34 | 4 | 1 | 59.67 | 2 | 4 | 25 | 0 | |
| NPC9966 | C20H20O7 | 372.12 | -0.7626 | 2.89 | 2.236 | 1 | 0 | 72.45 | 11 | 3 | 27 | 0 | |
| NPC99773 | C18H18O5 | 314.1154237 | -0.5184 | 2.89 | 3.358 | 5 | 1 | 64.99 | 6 | 2 | 23 | 0 |
Download Data
All data can be downloaded by:→ Selecting data type in the below download table
→ Then click the download button.
