20 Known Ingredients in Total
Unique ingredients have been isolated from this plant.
Plant-Ingredients Associations were manually curated from publications or collected from other databases.
5 Ingredients with Available Activity
Unique ingredients have activity data available.
Ingredient Structrual Cards
Ingredient ID: NPC93504
Formula: C50H80O18
Ingredient ID: NPC93504
| Common Name | n.a. |
| IUPAC Name | (2S,3S,4S,5R,6R)-6-[[(3S,4aR,6aR,6bS,8aR,9R,12aS,14aR,14bR)-9-acetyloxy-4,4,6a,6b,8a,11,11,14b-octamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy]-5-[(2S,3R,4S,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxy-3,4-dihydroxyoxane-2-carboxylic acid |
| Canonical SMILES | OC[C@H]1O[C@@H](O[C@H]2[C@@H](O[C@@H]([C@H]([C@@H]2O)O)C(=O)O)O[C@H]2CC[C@]3([C@H](C2(C)C)CC[C@@]2([C@@H]3CC=C3[C@@]2(C)CC[C@@]2([C@H]3CC(C)(C)C[C@H]2OC(=O)C)C)C)C)[C@@H]([C@H]([C@H]1O)O)O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O)O |
| Standard InCHI | InChI=1S/C50H80O18/c1-22-31(53)33(55)37(59)42(62-22)67-39-34(56)32(54)26(21-51)64-43(39)68-40-36(58)35(57)38(41(60)61)66-44(40)65-29-14-15-48(8)27(46(29,5)6)13-16-50(10)28(48)12-11-24-25-19-45(3,4)20-30(63-23(2)52)47(25,7)17-18-49(24,50)9/h11,22,25-40,42-44,51,53-59H,12-21H2,1-10H3,(H,60,61)/t22-,25-,26+,27-,28+,29-,30+,31-,32-,33+,34-,35-,36-,37+,38-,39+,40+,42-,43-,44+,47+,48-,49+,50+/m0/s1 |
| Standard InCHIKey | UKPFVFBHAGBCKA-SIERVQKMSA-N |
| Ingredient External Links |
PubChem CID: 101997830 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD196484] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Bertya dimerostigma | Bertya | Euphorbiaceae | |
| Delphinium barbeyi | Delphinium | Ranunculaceae |
 |
| Astragalus wiedemannianus | Astragalus | Fabaceae |
Ingredient ID: NPC77656
Formula: C50H80O19
Ingredient ID: NPC77656
| Common Name | n.a. |
| IUPAC Name | (2S,3S,4S,5R,6R)-6-[[(3S,4S,4aR,6aR,6bS,8aR,9R,12aS,14aR,14bR)-9-acetyloxy-4-(hydroxymethyl)-4,6a,6b,8a,11,11,14b-heptamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy]-5-[(2S,3R,4S,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxy-3,4-dihydroxyoxane-2-carboxylic acid |
| Canonical SMILES | OC[C@H]1O[C@@H](O[C@H]2[C@@H](O[C@@H]([C@H]([C@@H]2O)O)C(=O)O)O[C@H]2CC[C@]3([C@H]([C@@]2(C)CO)CC[C@@]2([C@@H]3CC=C3[C@@]2(C)CC[C@@]2([C@H]3CC(C)(C)C[C@H]2OC(=O)C)C)C)C)[C@@H]([C@H]([C@H]1O)O)O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O)O |
| Standard InCHI | InChI=1S/C50H80O19/c1-22-31(54)33(56)37(60)42(63-22)68-39-34(57)32(55)26(20-51)65-43(39)69-40-36(59)35(58)38(41(61)62)67-44(40)66-29-13-14-47(6)27(48(29,7)21-52)12-15-50(9)28(47)11-10-24-25-18-45(3,4)19-30(64-23(2)53)46(25,5)16-17-49(24,50)8/h10,22,25-40,42-44,51-52,54-60H,11-21H2,1-9H3,(H,61,62)/t22-,25-,26+,27+,28+,29-,30+,31-,32-,33+,34-,35-,36-,37+,38-,39+,40+,42-,43-,44+,46+,47-,48+,49+,50+/m0/s1 |
| Standard InCHIKey | NSSYEACXOHRXGX-KYEUEQJESA-N |
| Ingredient External Links |
PubChem CID: 101997831 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD8830] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Bertya dimerostigma | Bertya | Euphorbiaceae | |
| Melilotus officinalis | Melilotus | Fabaceae |
 |
| Delphinium barbeyi | Delphinium | Ranunculaceae |
|
| Astragalus wiedemannianus | Astragalus | Fabaceae |
Ingredient ID: NPC74119
Formula: C22H22O10
Ingredient ID: NPC74119
| Common Name | n.a. |
| IUPAC Name | 3-(4-hydroxyphenyl)-6-methoxy-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one |
| Canonical SMILES | OC[C@H]1O[C@@H](Oc2cc3occ(c(=O)c3cc2OC)c2ccc(cc2)O)[C@@H]([C@H]([C@@H]1O)O)O |
| Standard InCHI | InChI=1S/C22H22O10/c1-29-15-6-12-14(30-9-13(18(12)25)10-2-4-11(24)5-3-10)7-16(15)31-22-21(28)20(27)19(26)17(8-23)32-22/h2-7,9,17,19-24,26-28H,8H2,1H3/t17-,19-,20+,21-,22-/m1/s1 |
| Standard InCHIKey | OZBAVEKZGSOMOJ-MIUGBVLSSA-N |
| Ingredient External Links |
PubChem CID: 187808 ZINC ID: ZINC000004349794 |
| Plant-Ingredient Association Reference |
Database: UNPD [] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Murraya exotica | Murraya | Rutaceae |
|
| Bertya dimerostigma | Bertya | Euphorbiaceae | |
| Delphinium barbeyi | Delphinium | Ranunculaceae |
|
| Murraya paniculata | Murraya | Rutaceae |
 |
| Astragalus wiedemannianus | Astragalus | Fabaceae | |
| Glycine max | Glycine | Fabaceae |
|
| Pueraria montana var. lobata | Pueraria | Fabaceae |
|
Ingredient ID: NPC39426
Formula: C15H10O5
Ingredient ID: NPC39426
| Common Name | Genistein |
| IUPAC Name | 5,7-dihydroxy-3-(4-hydroxyphenyl)chromen-4-one |
| Canonical SMILES | Oc1ccc(cc1)c1coc2c(c1=O)c(O)cc(c2)O |
| Standard InCHI | InChI=1S/C15H10O5/c16-9-3-1-8(2-4-9)11-7-20-13-6-10(17)5-12(18)14(13)15(11)19/h1-7,16-18H |
| Standard InCHIKey | TZBJGXHYKVUXJN-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 5280961 ChEMBL ID: CHEMBL44 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD152676] Database: NPASS [NPC39426] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Hyoscyamus pusillus | Hyoscyamus | Solanaceae |
|
| Teucrium betonicum | Teucrium | Lamiaceae | |
| Ipomoea muricata | Ipomoea | Convolvulaceae |
|
| Allagopappus viscosissimus | Allagopappus | Asteraceae | |
| Parameria laevigata | Parameria | Apocynaceae |
|
| Piper dilatatum | Piper | Piperaceae |
|
| Pinus koraiensis | Pinus | Pinaceae |
|
| Inulanthera calva | Inulanthera | Asteraceae | |
| Garcinia oblongifolia | Garcinia | Clusiaceae |
|
| Astragalus spinosus | Astragalus | Fabaceae | |
| Neomeris annulata | Neomeris | Dasycladaceae | |
| Swertia decussata | Swertia | Gentianaceae |
|
| Peltogyne pubescens | Peltogyne | Fabaceae | |
| Vepris nobilis | Vepris | Rutaceae |
|
| Nicotiana raimondii | Nicotiana | Solanaceae | |
| Ranunculus peltatus | Ranunculus | Ranunculaceae | |
| Murraya exotica | Murraya | Rutaceae |
|
| Hydrangea serrata | Hydrangea | Hydrangeaceae |
|
| Lunularia cruciata | Lunularia | Lunulariaceae | |
| Astragalus bicuspis | Astragalus | Fabaceae | |
| Euphrasia stricta | Euphrasia | Orobanchaceae | |
| Lespedeza floribunda | Lespedeza | Fabaceae |
|
| Bertya dimerostigma | Bertya | Euphorbiaceae | |
| Styrax agrestis | Styrax | Styracaceae | |
| Dalbergia parviflora | Dalbergia | Fabaceae |
|
| Vitex negundo | Vitex | Lamiaceae |
|
| Justicia adhatoda | Justicia | Acanthaceae |
|
| Convallaria majalis | Convallaria | Asparagaceae |
|
| Scolopia chinensis | Scolopia | Salicaceae | |
| Chrysanthemum uliginosum | Chrysanthemum | Asteraceae | |
| Prunus serrulata var. spontanea | Prunus | Rosaceae |
|
| Glycyrrhiza inflata | Glycyrrhiza | Fabaceae |
|
| Rabdosia angustifolia | Isodon | Lamiaceae | |
| Dalbergia odorifera | Dalbergia | Fabaceae |
|
| Dalbergia sissoo | Dalbergia | Fabaceae |
|
| Papaver tatricum | Papaver | Papaveraceae | |
| Sophora flavescens | Sophora | Fabaceae |
|
| Conyza japonica | Conyza | Asteraceae |
|
| Dalbergia frutescens | Dalbergia | Fabaceae | |
| Sophora japonica | Sophora | Fabaceae |
|
| Smilax bracteata | Smilax | Smilacaceae |
|
| Dendrobium candidum | Dendrobium | Orchidaceae | |
| Trifolium pratense | Trifolium | Fabaceae |
 |
| Calicotome villosa | Calicotome | Fabaceae |
|
| Tynanthus panurensis | Tynanthus | Bignoniaceae | |
| Erysimum siliculosum | Erysimum | Brassicaceae | |
| Rosulabryum capillare | Rosulabryum | Bryaceae | |
| Citrus rugulosa | Citrus | Rutaceae | |
| Scutellaria sieberi | Scutellaria | Lamiaceae | |
| Christisonia bicolor | Christisonia | Orobanchaceae | |
| Lupinus luteus | Lupinus | Fabaceae |
|
| Aglaia australiensis | Aglaia | Meliaceae | |
| Spatholobus suberectus | Spatholobus | Fabaceae |
|
| Delphinium barbeyi | Delphinium | Ranunculaceae |
|
| Atroxima liberica | Atroxima | Polygalaceae | |
| Erycibe expansa | Erycibe | Convolvulaceae |
|
| Ginkgo biloba | Ginkgo | Ginkgoaceae |
|
| Trifolium resupinatum | Trifolium | Fabaceae |
 |
| Linum crispum | Linum | Linaceae | |
| Palafoxia texana | Palafoxia | Asteraceae | |
| Macadamia ternifolia | Macadamia | Proteaceae |
|
| Heliotropium hirsutissimum | Heliotropium | Heliotropiaceae | |
| Sanguisorba officinalis | Sanguisorba | Rosaceae |
|
| Murraya paniculata | Murraya | Rutaceae |
|
| Derris scandens | Derris | Fabaceae |
|
| Cullen corylifolium | Cullen | Fabaceae |
|
| Piptanthus nepalensis | Piptanthus | Fabaceae |
|
| Glycyrrhiza glabra | Glycyrrhiza | Fabaceae |
|
| Pueraria lobata | Pueraria | Fabaceae |
|
| Cudrania tricuspidata | Maclura | Moraceae |
|
| Desmodium styracifolium | Desmodium | Fabaceae |
|
| Diplacus longiflorus | Diplacus | Phrymaceae | |
| Achillea pseudopectinata | Achillea | Asteraceae | |
| Trollius europaeus | Trollius | Ranunculaceae |
|
| Teucrium marum | Teucrium | Lamiaceae |
|
| Syzygium nervosum | Syzygium | Myrtaceae |
|
| Lepidosperma ustulatum | Lepidosperma | Cyperaceae | |
| Lawsonia inermis | Lawsonia | Lythraceae |
|
| Zanthoxylum decaryi | Zanthoxylum | Rutaceae |
|
| Astragalus wiedemannianus | Astragalus | Fabaceae | |
| Salvia miltiorrhiza | Salvia | Lamiaceae |
|
| Petroselinum crispum | Petroselinum | Apiaceae |
|
| Amaranthus spinosus | Amaranthus | Amaranthaceae |
|
| Dunalia solanacea | Dunalia | Solanaceae | |
| Bergenia crassifolia | Bergenia | Saxifragaceae |
|
| Cistanche salsa | Cistanche | Orobanchaceae |
|
| Camchaya loloana | Camchaya | Asteraceae | |
| Berberis floribunda | Berberis | Berberidaceae |
|
| Glycyrrhiza uralensis | Glycyrrhiza | Fabaceae |
|
| Pterocarpus indicus | Pterocarpus | Fabaceae |
|
| Jamesoniella colorata | Jamesoniella | Jungermanniaceae |
|
| Fumaria micrantha | Fumaria | Papaveraceae | |
| Glycine max | Glycine | Fabaceae |
|
| Sophora tonkinensis | Sophora | Fabaceae | |
| Pterodon emarginatus | Pterodon | Fabaceae | |
| Berlinia tomentosa | Berlinia | Fabaceae | |
| Pseudocinchona pachyceras | Pseudocinchona | Rubiaceae | |
| Hibiscus schizopetalus | Hibiscus | Malvaceae |
|
| Cymodocea nodosa | Cymodocea | Cymodoceaceae | |
| Flemingia macrophylla | Flemingia | Fabaceae |
|
| Bonamia spectabilis | Bonamia | Convolvulaceae | |
| Pueraria montana var. lobata | Pueraria | Fabaceae |
|
| Licaria brasiliensis | Licaria | Lauraceae | |
| Crotalaria orixensis | Crotalaria | Fabaceae |
|
| Kaempferia rotunda | Kaempferia | Zingiberaceae |
|
| Atuna racemosa | Atuna | Chrysobalanaceae |
|
| Astragalus pycnanthus | Astragalus | Fabaceae | |
| Piper wightii | Piper | Piperaceae | |
| Pulsatilla campanella | Pulsatilla | Ranunculaceae |
|
| Arum maximum | Arum | Araceae |
Ingredient ID: NPC313163
Formula: C21H20O10
Ingredient ID: NPC313163
| Common Name | n.a. |
| IUPAC Name | 5-hydroxy-3-(4-hydroxyphenyl)-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one |
| Canonical SMILES | OC[C@H]1O[C@@H](Oc2cc(O)c3c(c2)occ(c3=O)c2ccc(cc2)O)[C@@H]([C@H]([C@@H]1O)O)O |
| Standard InCHI | InChI=1S/C21H20O10/c22-7-15-18(26)19(27)20(28)21(31-15)30-11-5-13(24)16-14(6-11)29-8-12(17(16)25)9-1-3-10(23)4-2-9/h1-6,8,15,18-24,26-28H,7H2/t15-,18-,19+,20-,21-/m1/s1 |
| Standard InCHIKey | ZCOLJUOHXJRHDI-CMWLGVBASA-N |
| Ingredient External Links |
PubChem CID: 5281377 ZINC ID: ZINC000004097913 |
| Plant-Ingredient Association Reference |
Database: UNPD [] Database: NPASS [NPC313163] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Hyoscyamus pusillus | Hyoscyamus | Solanaceae |
|
| Ipomoea muricata | Ipomoea | Convolvulaceae |
|
| Allagopappus viscosissimus | Allagopappus | Asteraceae | |
| Parameria laevigata | Parameria | Apocynaceae |
|
| Astragalus spinosus | Astragalus | Fabaceae | |
| Swertia decussata | Swertia | Gentianaceae |
|
| Peltogyne pubescens | Peltogyne | Fabaceae | |
| Ranunculus peltatus | Ranunculus | Ranunculaceae | |
| Murraya exotica | Murraya | Rutaceae |
|
| Hydrangea serrata | Hydrangea | Hydrangeaceae |
|
| Lunularia cruciata | Lunularia | Lunulariaceae | |
| Astragalus bicuspis | Astragalus | Fabaceae | |
| Euphrasia stricta | Euphrasia | Orobanchaceae | |
| Bertya dimerostigma | Bertya | Euphorbiaceae | |
| Styrax agrestis | Styrax | Styracaceae | |
| Iris tectorum | Iris | Iridaceae |
|
| Justicia adhatoda | Justicia | Acanthaceae |
|
| Chrysanthemum uliginosum | Chrysanthemum | Asteraceae | |
| Dalbergia sissoo | Dalbergia | Fabaceae |
|
| Papaver tatricum | Papaver | Papaveraceae | |
| Conyza japonica | Conyza | Asteraceae |
|
| Ocimum basilicum | Ocimum | Lamiaceae |
|
| Sophora japonica | Sophora | Fabaceae |
|
| Magnolia coco | Magnolia | Magnoliaceae | |
| Dendrobium candidum | Dendrobium | Orchidaceae | |
| Orthocaulis attenuatus | Orthocaulis | Anastrophyllaceae | |
| Calicotome villosa | Calicotome | Fabaceae |
|
| Erysimum siliculosum | Erysimum | Brassicaceae | |
| Rosulabryum capillare | Rosulabryum | Bryaceae | |
| Citrus rugulosa | Citrus | Rutaceae | |
| Lupinus luteus | Lupinus | Fabaceae |
|
| Blitum virgatum | Blitum | Chenopodiaceae | |
| Aglaia australiensis | Aglaia | Meliaceae | |
| Spatholobus suberectus | Spatholobus | Fabaceae |
|
| Delphinium barbeyi | Delphinium | Ranunculaceae |
|
| Scabiosa pyrenaica | Scabiosa | Caprifoliaceae | |
| Macadamia ternifolia | Macadamia | Proteaceae |
|
| Barbarea verna | Barbarea | Brassicaceae |
|
| Murraya paniculata | Murraya | Rutaceae |
|
| Piptanthus nepalensis | Piptanthus | Fabaceae |
|
| Pueraria lobata | Pueraria | Fabaceae |
|
| ducrosia ismaelis | Ducrosia | Apiaceae | |
| Desmodium styracifolium | Desmodium | Fabaceae |
|
| Diplacus longiflorus | Diplacus | Phrymaceae | |
| Achillea pseudopectinata | Achillea | Asteraceae | |
| Teucrium marum | Teucrium | Lamiaceae |
|
| Syzygium nervosum | Syzygium | Myrtaceae |
|
| Lepidosperma ustulatum | Lepidosperma | Cyperaceae | |
| Astragalus wiedemannianus | Astragalus | Fabaceae | |
| Salvia miltiorrhiza | Salvia | Lamiaceae |
|
| Dunalia solanacea | Dunalia | Solanaceae | |
| Camchaya loloana | Camchaya | Asteraceae | |
| Berberis floribunda | Berberis | Berberidaceae |
|
| Pterocarpus indicus | Pterocarpus | Fabaceae |
|
| Jamesoniella colorata | Jamesoniella | Jungermanniaceae |
|
| Fumaria micrantha | Fumaria | Papaveraceae | |
| Glycine max | Glycine | Fabaceae |
|
| Pterodon emarginatus | Pterodon | Fabaceae | |
| Berlinia tomentosa | Berlinia | Fabaceae | |
| Hibiscus schizopetalus | Hibiscus | Malvaceae |
|
| Cymodocea nodosa | Cymodocea | Cymodoceaceae | |
| Flemingia macrophylla | Flemingia | Fabaceae |
|
| Bonamia spectabilis | Bonamia | Convolvulaceae | |
| Pueraria montana var. lobata | Pueraria | Fabaceae |
|
| Kaempferia rotunda | Kaempferia | Zingiberaceae |
|
| Atuna racemosa | Atuna | Chrysobalanaceae |
|
| Astragalus pycnanthus | Astragalus | Fabaceae | |
| Pulsatilla campanella | Pulsatilla | Ranunculaceae |
|
Ingredient ID: NPC310109
Formula: C27H30O14
Ingredient ID: NPC310109
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | OC[C@@H]1O[C@H](Oc2ccc(cc2)c2coc3c(c2=O)ccc(c3)O[C@H]2O[C@@H](CO)[C@@H]([C@H]([C@@H]2O)O)O)[C@H]([C@@H]([C@H]1O)O)O |
| Standard InCHI | InChI=1S/C27H30O14/c28-8-17-20(31)22(33)24(35)26(40-17)38-12-3-1-11(2-4-12)15-10-37-16-7-13(5-6-14(16)19(15)30)39-27-25(36)23(34)21(32)18(9-29)41-27/h1-7,10,17-18,20-29,31-36H,8-9H2/t17-,18-,20-,21-,22+,23+,24-,25-,26-,27-/m0/s1 |
| Standard InCHIKey | VWEWSCDQMVNOJP-OVNHQYECSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD140258] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Bertya dimerostigma | Bertya | Euphorbiaceae | |
| Delphinium barbeyi | Delphinium | Ranunculaceae |
|
| Astragalus wiedemannianus | Astragalus | Fabaceae |
Ingredient ID: NPC269451
Formula: C16H12O6
Ingredient ID: NPC269451
| Common Name | Tectorigenin |
| IUPAC Name | 5,7-dihydroxy-3-(4-hydroxyphenyl)-6-methoxychromen-4-one |
| Canonical SMILES | COc1c(O)cc2c(c1O)c(=O)c(co2)c1ccc(cc1)O |
| Standard InCHI | InChI=1S/C16H12O6/c1-21-16-11(18)6-12-13(15(16)20)14(19)10(7-22-12)8-2-4-9(17)5-3-8/h2-7,17-18,20H,1H3 |
| Standard InCHIKey | OBBCRPUNCUPUOS-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 5281811 ChEMBL ID: CHEMBL242740 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD108275] Database: NPASS [NPC269451] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Plectranthus nummularius | Plectranthus | Lamiaceae |
|
| Entada polystachya | Entada | Fabaceae | |
| Entada africana | Entada | Fabaceae |
|
| Iberis sempervirens | Iberis | Brassicaceae | |
| Schumanniophyton magnificum | Schumanniophyton | Rubiaceae | |
| Bertya dimerostigma | Bertya | Euphorbiaceae | |
| Fumaria indica | Fumaria | Papaveraceae |
|
| Dalbergia parviflora | Dalbergia | Fabaceae |
|
| Dioscorea gracillima | Dioscorea | Dioscoreaceae |
|
| Iris tectorum | Iris | Iridaceae |
|
| Vitex limonifolia | Vitex | Lamiaceae | |
| Eichhornia crassipes | Eichhornia | Pontederiaceae |
|
| Echium rubrum | Echium | Boraginaceae | |
| Lantana camara | Lantana | Verbenaceae |
|
| Bassia scoparia | Bassia | Chenopodiaceae |
|
| Delphinium barbeyi | Delphinium | Ranunculaceae |
|
| Codonopsis radix | Codonopsis | Campanulaceae | |
| Astragalus wiedemannianus | Astragalus | Fabaceae | |
| Roemeria carica | Roemeria | Papaveraceae | |
| Ononis spinosa | Ononis | Fabaceae |
|
| Iris domestica | Iris | Iridaceae |
|
| Pteris setuloso-costulata | Pteris | Pteridaceae | |
| Pueraria montana var. lobata | Pueraria | Fabaceae |
|
| Pseuduvaria indochinensis | Pseuduvaria | Annonaceae | |
| Monomeria barbata | Monomeria | Orchidaceae |
Ingredient ID: NPC26580
Formula: C54H88O25
Ingredient ID: NPC26580
| Common Name | n.a. |
| IUPAC Name | n.a. |
| Canonical SMILES | OC[C@H]1O[C@@H](O[C@H]2[C@@H](O[C@@H]([C@H]([C@@H]2O)O)C(=O)O)O[C@H]2CC[C@]3([C@H]([C@@]2(C)CO)CC[C@@]2([C@@H]3CC=C3[C@@]2(C)CC[C@@]2([C@H]3C[C@@](C)(CO[C@@H]3O[C@H](CO)[C@H]([C@@H]([C@H]3O)O)O)[C@H]([C@H]2O)O)C)C)C)[C@@H]([C@H]([C@H]1O)O)O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O)O |
| Standard InCHI | InChI=1S/C54H88O25/c1-21-29(58)32(61)38(67)46(73-21)78-40-34(63)31(60)25(18-56)75-47(40)79-41-36(65)35(64)39(44(70)71)77-48(41)76-28-11-12-51(4)26(52(28,5)19-57)10-13-54(7)27(51)9-8-22-23-16-49(2,42(68)43(69)50(23,3)14-15-53(22,54)6)20-72-45-37(66)33(62)30(59)24(17-55)74-45/h8,21,23-43,45-48,55-69H,9-20H2,1-7H3,(H,70,71)/t21-,23-,24+,25+,26+,27+,28-,29-,30+,31-,32+,33-,34-,35-,36-,37+,38+,39-,40+,41+,42-,43+,45+,46-,47-,48+,49-,50+,51-,52+,53+,54+/m0/s1 |
| Standard InCHIKey | BEEJZTKKIGKODU-NQLGLYBNSA-N |
| Ingredient External Links | |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD166587] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Bertya dimerostigma | Bertya | Euphorbiaceae | |
| Delphinium barbeyi | Delphinium | Ranunculaceae |
|
| Astragalus wiedemannianus | Astragalus | Fabaceae |
Ingredient ID: NPC253135
Formula: C22H22O9
Ingredient ID: NPC253135
| Common Name | n.a. |
| IUPAC Name | 7-hydroxy-3-(4-methoxyphenyl)-8-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]chromen-4-one |
| Canonical SMILES | OC[C@H]1O[C@H]([C@@H]([C@H]([C@@H]1O)O)O)c1c(O)ccc2c1occ(c2=O)c1ccc(cc1)OC |
| Standard InCHI | InChI=1S/C22H22O9/c1-29-11-4-2-10(3-5-11)13-9-30-21-12(17(13)25)6-7-14(24)16(21)22-20(28)19(27)18(26)15(8-23)31-22/h2-7,9,15,18-20,22-24,26-28H,8H2,1H3/t15-,18-,19+,20-,22+/m1/s1 |
| Standard InCHIKey | UWRLUNPRLSNXRR-PGPONNFDSA-N |
| Ingredient External Links |
PubChem CID: 5319486 ZINC ID: ZINC000033832535 |
| Plant-Ingredient Association Reference |
Database: UNPD [] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Bertya dimerostigma | Bertya | Euphorbiaceae | |
| Delphinium barbeyi | Delphinium | Ranunculaceae |
|
| Astragalus wiedemannianus | Astragalus | Fabaceae | |
| Pueraria montana var. lobata | Pueraria | Fabaceae |
|
Ingredient ID: NPC252750
Formula: C47H76O16
Ingredient ID: NPC252750
| Common Name | n.a. |
| IUPAC Name | (2S,3S,4S,5R,6R)-6-[[(3S,4aR,6aR,6bS,8aR,9R,12aS,14aR,14bR)-9-hydroxy-4,4,6a,6b,8a,11,11,14b-octamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy]-5-[(2S,3R,4S,5S)-4,5-dihydroxy-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxy-3,4-dihydroxyoxane-2-carboxylic acid |
| Canonical SMILES | O[C@@H]1[C@@H](O[C@@H]2OC[C@@H]([C@@H]([C@H]2O[C@@H]2O[C@@H](C)[C@@H]([C@H]([C@H]2O)O)O)O)O)[C@@H](O[C@@H]([C@H]1O)C(=O)O)O[C@H]1CC[C@]2([C@H](C1(C)C)CC[C@@]1([C@@H]2CC=C2[C@@]1(C)CC[C@@]1([C@H]2CC(C)(C)C[C@H]1O)C)C)C |
| Standard InCHI | InChI=1S/C47H76O16/c1-21-29(50)31(52)34(55)39(59-21)62-36-30(51)24(48)20-58-40(36)63-37-33(54)32(53)35(38(56)57)61-41(37)60-28-13-14-45(7)25(43(28,4)5)12-15-47(9)26(45)11-10-22-23-18-42(2,3)19-27(49)44(23,6)16-17-46(22,47)8/h10,21,23-37,39-41,48-55H,11-20H2,1-9H3,(H,56,57)/t21-,23-,24-,25-,26+,27+,28-,29-,30-,31+,32-,33-,34+,35-,36+,37+,39-,40-,41+,44+,45-,46+,47+/m0/s1 |
| Standard InCHIKey | AVJNWIDNAJCPRK-USYDSXQJSA-N |
| Ingredient External Links |
PubChem CID: 100945993 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD207942] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Bertya dimerostigma | Bertya | Euphorbiaceae | |
| Delphinium barbeyi | Delphinium | Ranunculaceae |
|
| Astragalus wiedemannianus | Astragalus | Fabaceae | |
| Pueraria montana var. lobata | Pueraria | Fabaceae |
|
Ingredient ID: NPC236657
Formula: C48H78O18
Ingredient ID: NPC236657
| Common Name | n.a. |
| IUPAC Name | (2S,3S,4S,5R,6R)-6-[[(3S,4S,4aR,6aR,6bS,8aR,9R,12aS,14aR,14bR)-9-hydroxy-4-(hydroxymethyl)-4,6a,6b,8a,11,11,14b-heptamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy]-5-[(2S,3R,4S,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxy-3,4-dihydroxyoxane-2-carboxylic acid |
| Canonical SMILES | OC[C@H]1O[C@@H](O[C@H]2[C@@H](O[C@@H]([C@H]([C@@H]2O)O)C(=O)O)O[C@H]2CC[C@]3([C@H]([C@@]2(C)CO)CC[C@@]2([C@@H]3CC=C3[C@@]2(C)CC[C@@]2([C@H]3CC(C)(C)C[C@H]2O)C)C)C)[C@@H]([C@H]([C@H]1O)O)O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O)O |
| Standard InCHI | InChI=1S/C48H78O18/c1-21-29(52)31(54)35(58)40(61-21)65-37-32(55)30(53)24(19-49)62-41(37)66-38-34(57)33(56)36(39(59)60)64-42(38)63-28-12-13-45(5)25(46(28,6)20-50)11-14-48(8)26(45)10-9-22-23-17-43(2,3)18-27(51)44(23,4)15-16-47(22,48)7/h9,21,23-38,40-42,49-58H,10-20H2,1-8H3,(H,59,60)/t21-,23-,24+,25+,26+,27+,28-,29-,30-,31+,32-,33-,34-,35+,36-,37+,38+,40-,41-,42+,44+,45-,46+,47+,48+/m0/s1 |
| Standard InCHIKey | PTDAHAWQAGSZDD-IOVCITQVSA-N |
| Ingredient External Links |
PubChem CID: 122097 ZINC ID: ZINC000238809332 |
| Plant-Ingredient Association Reference |
Database: UNPD [] Database: NPASS [NPC236657] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Allagopappus viscosissimus | Allagopappus | Asteraceae | |
| Erysimum leptophyllum | Erysimum | Brassicaceae | |
| Astragalus spinosus | Astragalus | Fabaceae | |
| Swertia decussata | Swertia | Gentianaceae |
|
| Peltogyne pubescens | Peltogyne | Fabaceae | |
| Chondrodendron tomentosum | Chondrodendron | Menispermaceae |
|
| Ranunculus peltatus | Ranunculus | Ranunculaceae | |
| Hydrangea serrata | Hydrangea | Hydrangeaceae |
|
| Haplophyllum obtusifolium | Haplophyllum | Rutaceae | |
| Lunularia cruciata | Lunularia | Lunulariaceae | |
| Syzygium polycephaloides | Syzygium | Myrtaceae |
|
| Pyrola japonica | Pyrola | Ericaceae |
|
| Bertya dimerostigma | Bertya | Euphorbiaceae | |
| Astragalus mongholicus | Astragalus | Fabaceae |
|
| Piper regnellii | Piper | Piperaceae |
|
| Gymnocalycium schickendantzii | Gymnocalycium | Cactaceae | |
| Onopordum acanthium | Onopordum | Asteraceae |
|
| Pancratium sickenbergeri | Pancratium | Amaryllidaceae | |
| Centaurea maculosa | Centaurea | Asteraceae | |
| Ephedra sinica | Ephedra | Ephedraceae |
|
| Papaver tatricum | Papaver | Papaveraceae | |
| Plathymenia reticulata | Plathymenia | Fabaceae | |
| Asimina parviflora | Asimina | Annonaceae |
|
| Pteridium esculentum | Pteridium | Dennstaedtiaceae |
|
| Esenbeckia leiocarpa | Esenbeckia | Rutaceae | |
| Sophora flavescens | Sophora | Fabaceae |
|
| Hypericum styphelioides | Hypericum | Hypericaceae | |
| Melilotus officinalis | Melilotus | Fabaceae |
|
| Vellozia nanuzae | Vellozia | Velloziaceae | |
| Baccharis neglecta | Baccharis | Asteraceae | |
| Atraphaxis spinosa | Atraphaxis | Polygonaceae |
|
| Embelia schimperi | Embelia | Primulaceae |
|
| Epilobium hirsutum | Epilobium | Onagraceae |
|
| Lythrum salicaria | Lythrum | Lythraceae |
|
| Simarouba glauca | Simarouba | Simaroubaceae |
|
| Erythrina melanacantha | Erythrina | Fabaceae |
|
| Monsonia senegalensis | Monsonia | Geraniaceae |
|
| Sophora japonica | Sophora | Fabaceae |
|
| Clerodendrum bungei | Clerodendrum | Lamiaceae |
|
| Lemaireocereus longispinus | Lemaireocereus | Cactaceae | |
| Eria anomala | Eria | Orchidaceae | |
| Embelia parviflora | Embelia | Primulaceae |
|
| Euphorbia nematocypha | Euphorbia | Euphorbiaceae |
|
| Abelia chinensis | Abelia | Caprifoliaceae | |
| Diospyros assimilis | Diospyros | Ebenaceae |
|
| Faramea salicifolia | Faramea | Rubiaceae | |
| Vernonia fagifolia | Vernonia | Asteraceae | |
| Cordia leucocephala | Cordia | Cordiaceae | |
| Rosulabryum capillare | Rosulabryum | Bryaceae | |
| Citrus rugulosa | Citrus | Rutaceae | |
| Astragalus membranaceus | Astragalus | Fabaceae |
|
| Hedysarum multijugum maxim | Hedysarum | Fabaceae | |
| Aglaia australiensis | Aglaia | Meliaceae | |
| Delphinium barbeyi | Delphinium | Ranunculaceae |
|
| Macadamia ternifolia | Macadamia | Proteaceae |
|
| Helichrysum tenuifolium | Helichrysum | Asteraceae | |
| Pogostemon cablin | Pogostemon | Lamiaceae |
|
| Morella rubra | Morella | Myricaceae | |
| Desmodium styracifolium | Desmodium | Fabaceae |
|
| Diplacus longiflorus | Diplacus | Phrymaceae | |
| Achillea pseudopectinata | Achillea | Asteraceae | |
| Syzygium nervosum | Syzygium | Myrtaceae |
|
| Lepidosperma ustulatum | Lepidosperma | Cyperaceae | |
| Astragalus wiedemannianus | Astragalus | Fabaceae | |
| Salvia miltiorrhiza | Salvia | Lamiaceae |
|
| Dunalia solanacea | Dunalia | Solanaceae | |
| Hedysarum polybotrys | Hedysarum | Fabaceae |
|
| Berberis floribunda | Berberis | Berberidaceae |
|
| Jamesoniella colorata | Jamesoniella | Jungermanniaceae |
|
| Fumaria micrantha | Fumaria | Papaveraceae | |
| Pterodon emarginatus | Pterodon | Fabaceae | |
| Berlinia tomentosa | Berlinia | Fabaceae | |
| Cymodocea nodosa | Cymodocea | Cymodoceaceae | |
| Bonamia spectabilis | Bonamia | Convolvulaceae | |
| Pueraria montana var. lobata | Pueraria | Fabaceae |
|
| Atuna racemosa | Atuna | Chrysobalanaceae |
|
| Astragalus pycnanthus | Astragalus | Fabaceae | |
| Pulsatilla campanella | Pulsatilla | Ranunculaceae |
|
Ingredient ID: NPC234560
Formula: C15H10O4
Ingredient ID: NPC234560
| Common Name | Daidzein |
| IUPAC Name | 7-hydroxy-3-(4-hydroxyphenyl)chromen-4-one |
| Canonical SMILES | Oc1ccc(cc1)c1coc2c(c1=O)ccc(c2)O |
| Standard InCHI | InChI=1S/C15H10O4/c16-10-3-1-9(2-4-10)13-8-19-14-7-11(17)5-6-12(14)15(13)18/h1-8,16-17H |
| Standard InCHIKey | ZQSIJRDFPHDXIC-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 5281708 ChEMBL ID: CHEMBL8145 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD117319] Database: NPASS [NPC234560] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Mitracarpus scaber | Mitracarpus | Rubiaceae | |
| Abies pinsapo var. marocana | Abies | Pinaceae | |
| Teucrium betonicum | Teucrium | Lamiaceae | |
| Ipomoea muricata | Ipomoea | Convolvulaceae |
|
| Pinus koraiensis | Pinus | Pinaceae |
|
| Epimedium sagittatum | Epimedium | Berberidaceae |
|
| Inulanthera calva | Inulanthera | Asteraceae | |
| Garcinia oblongifolia | Garcinia | Clusiaceae |
|
| Neomeris annulata | Neomeris | Dasycladaceae | |
| Nicotiana raimondii | Nicotiana | Solanaceae | |
| Murraya exotica | Murraya | Rutaceae |
|
| Epimedium sempervirens | Epimedium | Berberidaceae | |
| Euphrasia genargentea | Euphrasia | Orobanchaceae | |
| Bertya dimerostigma | Bertya | Euphorbiaceae | |
| Persea kusanoi | Persea | Lauraceae | |
| Xanthorhiza simplicissima | Xanthorhiza | Ranunculaceae |
|
| Astragalus mongholicus | Astragalus | Fabaceae |
|
| Scolopia chinensis | Scolopia | Salicaceae | |
| Epimedium pubescens | Epimedium | Berberidaceae |
|
| Dalbergia odorifera | Dalbergia | Fabaceae |
|
| Medicago sativa | Medicago | Fabaceae |
|
| Melia azedarach | Melia | Meliaceae |
|
| Epimedium grandiflorum | Epimedium | Berberidaceae |
|
| Dalbergia frutescens | Dalbergia | Fabaceae | |
| Dactylorhiza viridis | Dactylorhiza | Orchidaceae | |
| Pterolobium hexapetalum | Pterolobium | Fabaceae |
|
| Trifolium pratense | Trifolium | Fabaceae |
|
| Croton megistocarpus | Croton | Euphorbiaceae | |
| Calicotome villosa | Calicotome | Fabaceae |
|
| Epimedium koreanum | Epimedium | Berberidaceae |
|
| Diplopterygium glaucum | Diplopterygium | Gleicheniaceae | |
| Astragalus membranaceus | Astragalus | Fabaceae |
|
| Hedysarum multijugum maxim | Hedysarum | Fabaceae | |
| Spatholobus suberectus | Spatholobus | Fabaceae |
|
| Delphinium barbeyi | Delphinium | Ranunculaceae |
|
| Trifolium resupinatum | Trifolium | Fabaceae |
|
| Glycine soja | Glycine | Fabaceae |
|
| Heliotropium hirsutissimum | Heliotropium | Heliotropiaceae | |
| Maytenus chuchuhuasha | Maytenus | Celastraceae | |
| Dorstenia dinklagei | Dorstenia | Moraceae | |
| Croton zehntneri | Croton | Euphorbiaceae | |
| Murraya paniculata | Murraya | Rutaceae |
|
| Oxytropis falcata | Oxytropis | Fabaceae | |
| Cullen corylifolium | Cullen | Fabaceae |
|
| Piptanthus nepalensis | Piptanthus | Fabaceae |
|
| Sapium haematospermum | Sapium | Euphorbiaceae |
|
| Angelica acutiloba | Angelica | Apiaceae |
|
| Pueraria lobata | Pueraria | Fabaceae |
|
| Solanum lanceolatum | Solanum | Solanaceae |
|
| Bryonia alba | Bryonia | Cucurbitaceae |
|
| Viburnum erubescens | Viburnum | Adoxaceae |
|
| Trollius europaeus | Trollius | Ranunculaceae |
|
| Geranium sibiricum | Geranium | Geraniaceae |
|
| Remirea maritima | Remirea | Cyperaceae | |
| Baphicacanthus cusia | Baphicacanthus | Acanthaceae |
|
| Lagerstroemia indica | Lagerstroemia | Lythraceae |
|
| Arnica mollis | Arnica | Asteraceae | |
| Epimedium brevicornu | Epimedium | Berberidaceae | |
| Zanthoxylum decaryi | Zanthoxylum | Rutaceae |
|
| Astragalus wiedemannianus | Astragalus | Fabaceae | |
| Croton gratissimus | Croton | Euphorbiaceae |
|
| Wikstroemia viridiflora | Wikstroemia | Thymelaeaceae |
|
| Brassica carinata | Brassica | Brassicaceae |
|
| Cistanche salsa | Cistanche | Orobanchaceae |
|
| Ranunculus asiaticus | Ranunculus | Ranunculaceae | |
| Eurycoma harmandiana | Eurycoma | Simaroubaceae |
|
| Glycyrrhiza uralensis | Glycyrrhiza | Fabaceae |
|
| Eucalyptus resinifera | Eucalyptus | Myrtaceae |
|
| Glycine max | Glycine | Fabaceae |
|
| Senecio isatideus | Senecio | Asteraceae | |
| Sophora tonkinensis | Sophora | Fabaceae | |
| Sinapis alba | Sinapis | Brassicaceae |
|
| Trigonella foenum-graecum | Trigonella | Fabaceae |
|
| Carpha glomerata | Carpha | Cyperaceae | |
| Pueraria montana var. lobata | Pueraria | Fabaceae |
|
| Cyanostegia angustifolia | Cyanostegia | Lamiaceae | |
| Orthosiphon spicatus | Orthosiphon | Lamiaceae |
|
| Epimedium wushanense | Epimedium | Berberidaceae |
|
| Piper wightii | Piper | Piperaceae | |
| Lysimachia fordiana | Lysimachia | Primulaceae | |
| Ampelocera edentula | Ampelocera | Ulmaceae | |
| Arum maximum | Arum | Araceae | |
| Ixeris debilis | Ixeris | Asteraceae | |
| Abies excelsa | Abies | Pinaceae |
Ingredient ID: NPC219663
Formula: C48H76O21
Ingredient ID: NPC219663
| Common Name | n.a. |
| IUPAC Name | (2S,3S,4S,5R,6R)-6-[[(3S,4S,4aR,6aR,6bS,8aR,9S,10R,11S,12aS,14aR,14bR)-11-carboxy-9,10-dihydroxy-4-(hydroxymethyl)-4,6a,6b,8a,11,14b-hexamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy]-5-[(2S,3R,4S,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxy-3,4-dihydroxyoxane-2-carboxylic acid |
| Canonical SMILES | OC[C@H]1O[C@@H](O[C@H]2[C@@H](O[C@@H]([C@H]([C@@H]2O)O)C(=O)O)O[C@H]2CC[C@]3([C@H]([C@@]2(C)CO)CC[C@@]2([C@@H]3CC=C3[C@@]2(C)CC[C@@]2([C@H]3C[C@](C)(C(=O)O)[C@H]([C@H]2O)O)C)C)C)[C@@H]([C@H]([C@H]1O)O)O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O)O |
| Standard InCHI | InChI=1S/C48H76O21/c1-19-26(51)28(53)32(57)39(64-19)68-34-29(54)27(52)22(17-49)65-40(34)69-35-31(56)30(55)33(38(60)61)67-41(35)66-25-11-12-44(3)23(46(25,5)18-50)10-13-48(7)24(44)9-8-20-21-16-45(4,42(62)63)37(59)36(58)43(21,2)14-15-47(20,48)6/h8,19,21-37,39-41,49-59H,9-18H2,1-7H3,(H,60,61)(H,62,63)/t19-,21-,22+,23+,24+,25-,26-,27-,28+,29-,30-,31-,32+,33-,34+,35+,36+,37-,39-,40-,41+,43+,44-,45-,46+,47+,48+/m0/s1 |
| Standard InCHIKey | MUWPBWRABGOPKR-XIOIIYPLSA-N |
| Ingredient External Links |
PubChem CID: 101998410 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD140996] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Bertya dimerostigma | Bertya | Euphorbiaceae | |
| Delphinium barbeyi | Delphinium | Ranunculaceae |
|
| Astragalus wiedemannianus | Astragalus | Fabaceae |
Ingredient ID: NPC208554
Formula: C27H30O15
Ingredient ID: NPC208554
| Common Name | n.a. |
| IUPAC Name | 5-hydroxy-3-(4-hydroxyphenyl)-6-methoxy-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxymethyl]oxan-2-yl]oxychromen-4-one |
| Canonical SMILES | COc1c(O[C@@H]2O[C@H](CO[C@@H]3OC[C@H]([C@@H]([C@H]3O)O)O)[C@H]([C@@H]([C@H]2O)O)O)cc2c(c1O)c(=O)c(co2)c1ccc(cc1)O |
| Standard InCHI | InChI=1S/C27H30O15/c1-37-25-15(6-14-17(21(25)33)18(30)12(7-38-14)10-2-4-11(28)5-3-10)41-27-24(36)22(34)20(32)16(42-27)9-40-26-23(35)19(31)13(29)8-39-26/h2-7,13,16,19-20,22-24,26-29,31-36H,8-9H2,1H3/t13-,16-,19+,20-,22+,23-,24-,26+,27-/m1/s1 |
| Standard InCHIKey | MCYJIRFKDCXYCX-YUPZTAPUSA-N |
| Ingredient External Links |
PubChem CID: 100968221 ZINC ID: ZINC000095099608 |
| Plant-Ingredient Association Reference |
Database: UNPD [] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Bertya dimerostigma | Bertya | Euphorbiaceae | |
| Delphinium barbeyi | Delphinium | Ranunculaceae |
|
| Astragalus wiedemannianus | Astragalus | Fabaceae | |
| Pueraria montana var. lobata | Pueraria | Fabaceae |
|
Ingredient ID: NPC205076
Formula: C22H22O11
Ingredient ID: NPC205076
| Common Name | n.a. |
| IUPAC Name | 5-hydroxy-3-(4-hydroxyphenyl)-6-methoxy-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one |
| Canonical SMILES | OC[C@H]1O[C@@H](Oc2cc3occ(c(=O)c3c(c2OC)O)c2ccc(cc2)O)[C@@H]([C@H]([C@@H]1O)O)O |
| Standard InCHI | InChI=1S/C22H22O11/c1-30-21-13(32-22-20(29)19(28)17(26)14(7-23)33-22)6-12-15(18(21)27)16(25)11(8-31-12)9-2-4-10(24)5-3-9/h2-6,8,14,17,19-20,22-24,26-29H,7H2,1H3/t14-,17-,19+,20-,22-/m1/s1 |
| Standard InCHIKey | CNOURESJATUGPN-UDEBZQQRSA-N |
| Ingredient External Links |
PubChem CID: 5281810 ZINC ID: ZINC000004098747 |
| Plant-Ingredient Association Reference |
Database: UNPD [] Database: NPASS [NPC205076] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Psammosilene tunicoides | Psammosilene | Caryophyllaceae | |
| Bertya dimerostigma | Bertya | Euphorbiaceae | |
| Iris tectorum | Iris | Iridaceae |
|
| Polygonatum odoratum | Polygonatum | Asparagaceae |
|
| Delphinium barbeyi | Delphinium | Ranunculaceae |
|
| Codonopsis radix | Codonopsis | Campanulaceae | |
| Astragalus wiedemannianus | Astragalus | Fabaceae | |
| Iris domestica | Iris | Iridaceae |
|
| Pueraria montana var. lobata | Pueraria | Fabaceae |
|
Ingredient ID: NPC177109
Formula: C48H78O17
Ingredient ID: NPC177109
| Common Name | n.a. |
| IUPAC Name | (2S,3S,4S,5R,6R)-6-[[(3S,4aR,6aR,6bS,8aR,9R,12aS,14aR,14bR)-9-hydroxy-4,4,6a,6b,8a,11,11,14b-octamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy]-5-[(2S,3R,4S,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxy-3,4-dihydroxyoxane-2-carboxylic acid |
| Canonical SMILES | OC[C@H]1O[C@@H](O[C@H]2[C@@H](O[C@@H]([C@H]([C@@H]2O)O)C(=O)O)O[C@H]2CC[C@]3([C@H](C2(C)C)CC[C@@]2([C@@H]3CC=C3[C@@]2(C)CC[C@@]2([C@H]3CC(C)(C)C[C@H]2O)C)C)C)[C@@H]([C@H]([C@H]1O)O)O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O)O |
| Standard InCHI | InChI=1S/C48H78O17/c1-21-29(51)31(53)35(57)40(60-21)64-37-32(54)30(52)24(20-49)61-41(37)65-38-34(56)33(55)36(39(58)59)63-42(38)62-28-13-14-46(7)25(44(28,4)5)12-15-48(9)26(46)11-10-22-23-18-43(2,3)19-27(50)45(23,6)16-17-47(22,48)8/h10,21,23-38,40-42,49-57H,11-20H2,1-9H3,(H,58,59)/t21-,23-,24+,25-,26+,27+,28-,29-,30-,31+,32-,33-,34-,35+,36-,37+,38+,40-,41-,42+,45+,46-,47+,48+/m0/s1 |
| Standard InCHIKey | ISTWCKNDZOSMPU-UUOPLRLOSA-N |
| Ingredient External Links |
PubChem CID: 21629874 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD81315] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Bertya dimerostigma | Bertya | Euphorbiaceae | |
| Delphinium barbeyi | Delphinium | Ranunculaceae |
|
| Astragalus wiedemannianus | Astragalus | Fabaceae |
Ingredient ID: NPC176244
Formula: C27H30O16
Ingredient ID: NPC176244
| Common Name | n.a. |
| IUPAC Name | 5-hydroxy-3-(4-hydroxyphenyl)-6,7-bis[[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy]chromen-4-one |
| Canonical SMILES | OC[C@H]1O[C@@H](Oc2c(O[C@@H]3O[C@H](CO)[C@H]([C@@H]([C@H]3O)O)O)cc3c(c2O)c(=O)c(co3)c2ccc(cc2)O)[C@@H]([C@H]([C@@H]1O)O)O |
| Standard InCHI | InChI=1S/C27H30O16/c28-6-14-18(32)21(35)23(37)26(41-14)40-13-5-12-16(17(31)11(8-39-12)9-1-3-10(30)4-2-9)20(34)25(13)43-27-24(38)22(36)19(33)15(7-29)42-27/h1-5,8,14-15,18-19,21-24,26-30,32-38H,6-7H2/t14-,15-,18-,19-,21+,22+,23-,24-,26-,27+/m1/s1 |
| Standard InCHIKey | UZFVFMDEGBUPFO-ZZZQZPNGSA-N |
| Ingredient External Links |
PubChem CID: 44207161 |
| Plant-Ingredient Association Reference |
Database: UNPD [UNPD108027] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Bertya dimerostigma | Bertya | Euphorbiaceae | |
| Delphinium barbeyi | Delphinium | Ranunculaceae |
|
| Astragalus wiedemannianus | Astragalus | Fabaceae |
Ingredient ID: NPC161749
Formula: C21H20O9
Ingredient ID: NPC161749
| Common Name | Daidzin |
| IUPAC Name | 3-(4-hydroxyphenyl)-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one |
| Canonical SMILES | OC[C@H]1O[C@@H](Oc2ccc3c(c2)occ(c3=O)c2ccc(cc2)O)[C@@H]([C@H]([C@@H]1O)O)O |
| Standard InCHI | InChI=1S/C21H20O9/c22-8-16-18(25)19(26)20(27)21(30-16)29-12-5-6-13-15(7-12)28-9-14(17(13)24)10-1-3-11(23)4-2-10/h1-7,9,16,18-23,25-27H,8H2/t16-,18-,19+,20-,21-/m1/s1 |
| Standard InCHIKey | KYQZWONCHDNPDP-QNDFHXLGSA-N |
| Ingredient External Links |
PubChem CID: 107971 ZINC ID: ZINC000004098610 ChEMBL ID: CHEMBL486422 |
| Plant-Ingredient Association Reference |
Database: UNPD [] Database: NPASS [NPC161749] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Hyoscyamus pusillus | Hyoscyamus | Solanaceae |
|
| Parameria laevigata | Parameria | Apocynaceae |
|
| Murraya exotica | Murraya | Rutaceae |
|
| Astragalus bicuspis | Astragalus | Fabaceae | |
| Bertya dimerostigma | Bertya | Euphorbiaceae | |
| Styrax agrestis | Styrax | Styracaceae | |
| Justicia adhatoda | Justicia | Acanthaceae |
|
| Platymiscium floribundum | Platymiscium | Fabaceae | |
| Delphinium barbeyi | Delphinium | Ranunculaceae |
|
| Caesalpinia crista | Guilandina | Fabaceae |
|
| Rubia cordifolia | Rubia | Rubiaceae |
|
| Murraya paniculata | Murraya | Rutaceae |
|
| Cullen corylifolium | Cullen | Fabaceae |
|
| Pueraria lobata | Pueraria | Fabaceae |
|
| ducrosia ismaelis | Ducrosia | Apiaceae | |
| Teucrium marum | Teucrium | Lamiaceae |
|
| Astragalus wiedemannianus | Astragalus | Fabaceae | |
| Pterocarpus indicus | Pterocarpus | Fabaceae |
|
| Glycine max | Glycine | Fabaceae |
|
| Hibiscus schizopetalus | Hibiscus | Malvaceae |
|
| Flemingia macrophylla | Flemingia | Fabaceae |
|
| Pueraria montana var. lobata | Pueraria | Fabaceae |
|
Ingredient ID: NPC124478
Formula: C21H20O9
Ingredient ID: NPC124478
| Common Name | Puerarin |
| IUPAC Name | 7-hydroxy-3-(4-hydroxyphenyl)-8-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]chromen-4-one |
| Canonical SMILES | OC[C@H]1O[C@H]([C@@H]([C@H]([C@@H]1O)O)O)c1c(O)ccc2c1occ(c2=O)c1ccc(cc1)O |
| Standard InCHI | InChI=1S/C21H20O9/c22-7-14-17(26)18(27)19(28)21(30-14)15-13(24)6-5-11-16(25)12(8-29-20(11)15)9-1-3-10(23)4-2-9/h1-6,8,14,17-19,21-24,26-28H,7H2/t14-,17-,18+,19-,21+/m1/s1 |
| Standard InCHIKey | HKEAFJYKMMKDOR-VPRICQMDSA-N |
| Ingredient External Links |
PubChem CID: 5281807 ZINC ID: ZINC000004098745 ChEMBL ID: CHEMBL486386 |
| Plant-Ingredient Association Reference |
Database: UNPD [] Database: NPASS [NPC124478] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Hemerocallis radix | Hemerocallis | Asphodelaceae | |
| Bertya dimerostigma | Bertya | Euphorbiaceae | |
| Hemerocallis fulva | Hemerocallis | Xanthorrhoeaceae |
|
| Spatholobus suberectus | Spatholobus | Fabaceae |
|
| Delphinium barbeyi | Delphinium | Ranunculaceae |
|
| Scutellaria baicalensis | Scutellaria | Lamiaceae |
|
| Bupleurum chinense | Bupleurum | Apiaceae |
|
| Pueraria lobata | Pueraria | Fabaceae |
|
| Astragalus wiedemannianus | Astragalus | Fabaceae | |
| Ziziphus jujuba | Ziziphus | Rhamnaceae |
|
| Pueraria montana var. lobata | Pueraria | Fabaceae |
|
Ingredient ID: NPC100971
Formula: C16H12O5
Ingredient ID: NPC100971
| Common Name | n.a. |
| IUPAC Name | 7-hydroxy-3-(4-hydroxyphenyl)-6-methoxychromen-4-one |
| Canonical SMILES | COc1cc2c(cc1O)occ(c2=O)c1ccc(cc1)O |
| Standard InCHI | InChI=1S/C16H12O5/c1-20-15-6-11-14(7-13(15)18)21-8-12(16(11)19)9-2-4-10(17)5-3-9/h2-8,17-18H,1H3 |
| Standard InCHIKey | DXYUAIFZCFRPTH-UHFFFAOYSA-N |
| Ingredient External Links |
PubChem CID: 5317750 ZINC ID: ZINC000005999205 |
| Plant-Ingredient Association Reference |
Database: UNPD [] Database: NPASS [NPC100971] |
Distribution of the ingredient across plants
| Plant Name | Plant Genus | Plant Family | Plant Usage |
|---|---|---|---|
| Bertya dimerostigma | Bertya | Euphorbiaceae | |
| Dalbergia frutescens | Dalbergia | Fabaceae | |
| Delphinium barbeyi | Delphinium | Ranunculaceae |
|
| Codonopsis radix | Codonopsis | Campanulaceae | |
| Astragalus wiedemannianus | Astragalus | Fabaceae | |
| Glycine max | Glycine | Fabaceae |
|
| Pueraria montana var. lobata | Pueraria | Fabaceae |
|
Properties
| Ingredient ID | Formulae | Name | MW | AlogP | MlogP | XlogP | # HBA | # HBD | PSA | # Rotatable Bond | # Ring | # Heacy Atom | Lipinski RO5 Violation |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| NPC100971 | C16H12O5 | 284.0684735 | -1.6391 | 2.67 | 2.031 | 1 | 2 | 75.99 | 5 | 3 | 21 | 0 | |
| NPC124478 | C21H20O9 | Puerarin | 416.11 | -3.823 | 2.78 | 0.4 | 6 | 6 | 156.91 | 9 | 4 | 30 | 1 |
| NPC161749 | C21H20O9 | Daidzin | 416.11 | -3.3342 | 2.78 | 1.367 | 6 | 5 | 145.91 | 9 | 4 | 30 | 0 |
| NPC176244 | C27H30O16 | 5-hydroxy-3-(4-hydroxyphenyl)-6,7-bis[[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy]chromen-4-one | 610.1533849 | -6.0017 | 2.67 | -1.667 | 11 | 10 | 265.52 | 7 | 5 | 43 | 2 |
| NPC177109 | C48H78O17 | (2S,3S,4S,5R,6R)-6-[[(3S,4aR,6aR,6bS,8aR,9R,12aS,14aR,14bR)-9-hydroxy-4,4,6a,6b,8a,11,11,14b-octamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy]-5-[(2S,3R,4S,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxy-3,4-dihydroxyoxane-2-carboxylic acid | 926.523901 | -2.2 | 4.87 | 5.717 | 17 | 10 | 274.75 | 8 | 8 | 65 | 3 |
| NPC205076 | C22H22O11 | 462.1162115 | -3.8463 | 2.67 | -0.04 | 11 | 6 | 175.37 | 12 | 4 | 33 | 1 | |
| NPC208554 | C27H30O15 | 5-hydroxy-3-(4-hydroxyphenyl)-6-methoxy-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxymethyl]oxan-2-yl]oxychromen-4-one | 594.1584703 | -5.0825 | 2.78 | -1.334 | 10 | 8 | 234.29 | 7 | 5 | 42 | 1 |
| NPC219663 | C48H76O21 | (2S,3S,4S,5R,6R)-6-[[(3S,4S,4aR,6aR,6bS,8aR,9S,10R,11S,12aS,14aR,14bR)-11-carboxy-9,10-dihydroxy-4-(hydroxymethyl)-4,6a,6b,8a,11,14b-hexamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy]-5-[(2S,3R,4S,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxy-3,4-dihydroxyoxane-2-carboxylic acid | 988.4879095 | -4.7456 | 4.43 | 2.341 | 21 | 13 | 352.51 | 10 | 8 | 69 | 2 |
| NPC234560 | C15H10O4 | Daidzein | 254.06 | -1.5873 | 2.67 | 2.475 | 1 | 2 | 66.76 | 3 | 3 | 19 | 0 |
| NPC236657 | C48H78O18 | 942.5188157 | -3.2907 | 4.76 | 4.585 | 18 | 11 | 294.98 | 28 | 8 | 66 | 2 | |
| NPC252750 | C47H76O16 | (2S,3S,4S,5R,6R)-6-[[(3S,4aR,6aR,6bS,8aR,9R,12aS,14aR,14bR)-9-hydroxy-4,4,6a,6b,8a,11,11,14b-octamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy]-5-[(2S,3R,4S,5S)-4,5-dihydroxy-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxy-3,4-dihydroxyoxane-2-carboxylic acid | 896.5133364 | -1.6893 | 4.87 | 5.96 | 16 | 9 | 254.52 | 7 | 8 | 63 | 3 |
| NPC253135 | C22H22O9 | 7-hydroxy-3-(4-methoxyphenyl)-8-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]chromen-4-one | 430.1263823 | -3.4145 | 2.89 | 0.919 | 6 | 5 | 145.91 | 4 | 4 | 31 | 0 |
| NPC26580 | C54H88O25 | 1136.561468 | -6.7014 | 4.65 | 1.111 | 25 | 16 | 414.59 | 13 | 9 | 79 | 3 | |
| NPC269451 | C16H12O6 | Tectorigenin | 300.06 | -2.0994 | 2.56 | 1.068 | 1 | 3 | 96.22 | 6 | 3 | 22 | 0 |
| NPC310109 | C27H30O14 | 578.1635556 | -5.0811 | 2.89 | 0.259 | 11 | 8 | 225.06 | 7 | 5 | 41 | 2 | |
| NPC313163 | C21H20O10 | 432.1056468 | -3.7945 | 2.67 | 0.404 | 10 | 6 | 166.14 | 10 | 4 | 31 | 1 | |
| NPC39426 | C15H10O5 | Genistein | 270.05 | -2.0476 | 2.56 | 1.512 | 1 | 3 | 86.99 | 4 | 3 | 20 | 0 |
| NPC74119 | C22H22O10 | 3-(4-hydroxyphenyl)-6-methoxy-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one | 446.1212969 | -3.386 | 2.78 | 0.923 | 6 | 5 | 155.14 | 5 | 4 | 32 | 0 |
| NPC77656 | C50H80O19 | (2S,3S,4S,5R,6R)-6-[[(3S,4S,4aR,6aR,6bS,8aR,9R,12aS,14aR,14bR)-9-acetyloxy-4-(hydroxymethyl)-4,6a,6b,8a,11,11,14b-heptamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy]-5-[(2S,3R,4S,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxy-3,4-dihydroxyoxane-2-carboxylic acid | 984.5293803 | -2.9116 | 4.87 | 5.325 | 19 | 10 | 301.05 | 11 | 8 | 69 | 4 |
| NPC93504 | C50H80O18 | (2S,3S,4S,5R,6R)-6-[[(3S,4aR,6aR,6bS,8aR,9R,12aS,14aR,14bR)-9-acetyloxy-4,4,6a,6b,8a,11,11,14b-octamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy]-5-[(2S,3R,4S,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxy-3,4-dihydroxyoxane-2-carboxylic acid | 968.5344657 | -1.8209 | 4.98 | 6.457 | 18 | 9 | 280.82 | 10 | 8 | 68 | 3 |
Download Data
All data can be downloaded by:→ Selecting data type in the below download table
→ Then click the download button.
