Drug Information| Drug ID: | NPD879 |
| Drug Name: | Nizatidine |
| Molecular Formula: | C12H21N5O2S2 |
| Canonical SMILES: | CN/C(=CN(=O)=O)/NCCSCc1csc(n1)CN(C)C |
| Standard InCHI: | InChI=1S/C12H21N5O2S2/c1-13-11(6-17(18)19)14-4-5-20-8-10-9-21-12(15-10)7-16(2)3/h6,9,13-14H,4-5,7-8H2,1-3H3/b11-6+ |
| Standard InCHIKey: | SGXXNSQHWDMGGP-IZZDOVSWSA-N |
| Max Developmental Stage: | Approved |
| Max Developmental Stage Source: | TTD; ChEMBL; IUPHAR/BPS |
Structural Similarity Between NPASS Natural Products and NPD879Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient 
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
Similar Natural Products High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Intermediate Similarity | 0.7264 | NPC323937 |
| Remote Similarity | 0.6531 | NPC148983 |
| Remote Similarity | 0.5814 | NPC214375 |
| Remote Similarity | 0.5606 | NPC135558 |