Drug Information| Drug ID: | NPD8787 |
| Drug Name: | |
| Molecular Formula: | C5H10N2O7P2 |
| Canonical SMILES: | OC(P(=O)(O)[O-])(P(=O)([O-])[O-])Cn1ccnc1 |
| Standard InCHI: | InChI=1S/C5H10N2O7P2/c8-5(15(9,10)11,16(12,13)14)3-7-2-1-6-4-7/h1-2,4,8H,3H2,(H2,9,10,11)(H2,12,13,14)/p-3 |
| Standard InCHIKey: | XRASPMIURGNCCH-UHFFFAOYSA-K |
| Max Developmental Stage: | Clinical (unspecified phase) |
| Max Developmental Stage Source: | TTD |
Structural Similarity Between NPASS Natural Products and NPD8787Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient 
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
Similar Natural Products High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Intermediate Similarity | 0.7426 | NPC332382 |
| Remote Similarity | 0.6882 | NPC237936 |
| Remote Similarity | 0.6566 | NPC190949 |
| Remote Similarity | 0.6481 | NPC273327 |
| Remote Similarity | 0.5946 | NPC187191 |
| Remote Similarity | 0.5946 | NPC326248 |
| Remote Similarity | 0.5926 | NPC9639 |
| Remote Similarity | 0.5798 | NPC327613 |
| Remote Similarity | 0.5603 | NPC155498 |