Drug Information| Drug ID: | NPD8612 |
| Drug Name: | Trichlorfon |
| Molecular Formula: | C4H8Cl3O4P |
| Canonical SMILES: | COP(=O)(C(C(Cl)(Cl)Cl)O)OC |
| Standard InCHI: | InChI=1S/C4H8Cl3O4P/c1-10-12(9,11-2)3(8)4(5,6)7/h3,8H,1-2H3 |
| Standard InCHIKey: | NFACJZMKEDPNKN-UHFFFAOYSA-N |
| Max Developmental Stage: | Approved |
| Max Developmental Stage Source: | ChEMBL |
Structural Similarity Between NPASS Natural Products and NPD8612Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient 
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
Similar Natural Products High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Intermediate Similarity | 0.7353 | NPC290971 |
| Remote Similarity | 0.6875 | NPC314978 |
| Remote Similarity | 0.6176 | NPC317545 |
| Remote Similarity | 0.5833 | NPC68114 |
| Remote Similarity | 0.5833 | NPC120097 |
| Remote Similarity | 0.5758 | NPC327597 |
| Remote Similarity | 0.5641 | NPC321170 |
| Remote Similarity | 0.5641 | NPC31433 |
| Remote Similarity | 0.5641 | NPC266566 |
| Remote Similarity | 0.5625 | NPC254757 |