Drug Information| Drug ID: | NPD7385 |
| Drug Name: | Etidronic Acid |
| Molecular Formula: | C2H8O7P2 |
| Canonical SMILES: | CC(P(=O)(O)O)(P(=O)(O)O)O |
| Standard InCHI: | InChI=1S/C2H8O7P2/c1-2(3,10(4,5)6)11(7,8)9/h3H,1H3,(H2,4,5,6)(H2,7,8,9) |
| Standard InCHIKey: | DBVJJBKOTRCVKF-UHFFFAOYSA-N |
| Max Developmental Stage: | Approved |
| Max Developmental Stage Source: | TTD; ChEMBL; IUPHAR/BPS |
Structural Similarity Between NPASS Natural Products and NPD7385Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient 
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.
Similar Natural Products High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7
| Similarity Level | Similarity Score | Natural Product ID |
|---|---|---|
| Intermediate Similarity | 0.72 | NPC314978 |
| Remote Similarity | 0.6296 | NPC317545 |
| Remote Similarity | 0.6 | NPC306022 |
| Remote Similarity | 0.5862 | NPC68114 |
| Remote Similarity | 0.5862 | NPC120097 |
| Remote Similarity | 0.5769 | NPC327597 |
| Remote Similarity | 0.5652 | NPC317825 |
| Remote Similarity | 0.5625 | NPC31433 |
| Remote Similarity | 0.5625 | NPC321170 |
| Remote Similarity | 0.5625 | NPC266566 |
| Molecular Weight | 205.97 |
| ALogP | -0.8018 |
| MLogP | 0.69 |
| XLogP | -3.815 |
| HDA | 7 |
| HBD | 5 |
| Rotatable Bonds | 8 |
| TPSA | 154.91 |
| RO5 Violation | 0 |