NPASS drugs

Drug Information

Drug ID:	NPD5268
Drug Name:	Thioproperazine
Molecular Formula:	C22H30N4O2S2
Canonical SMILES:	CN1CCN(CC1)CCCN1c2ccccc2Sc2c1cc(cc2)S(=O)(=O)N(C)C
Standard InCHI:	InChI=1S/C22H30N4O2S2/c1-23(2)30(27,28)18-9-10-22-20(17-18)26(19-7-4-5-8-21(19)29-22)12-6-11-25-15-13-24(3)14-16-25/h4-5,7-10,17H,6,11-16H2,1-3H3
Standard InCHIKey:	VZYCZNZBPPHOFY-UHFFFAOYSA-N
Max Developmental Stage:	Approved
Max Developmental Stage Source:	DrugBank

Structural Similarity Between NPASS Natural Products and NPD5268

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	655
0.1-0.2	11018
0.2-0.3	13220
0.3-0.4	4194
0.4-0.5	1625
0.5-0.6	168
0.6-0.7	7
0.7-0.8	3
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
Intermediate Similarity	0.7794	NPC473417
Intermediate Similarity	0.736	NPC328877
Intermediate Similarity	0.7143	NPC218710
Remote Similarity	0.6667	NPC291610
Remote Similarity	0.6558	NPC320863
Remote Similarity	0.619	NPC315403
Remote Similarity	0.6188	NPC321617
Remote Similarity	0.6138	NPC475915
Remote Similarity	0.6067	NPC321053
Remote Similarity	0.6	NPC229477
Remote Similarity	0.5984	NPC297532
Remote Similarity	0.5972	NPC31651
Remote Similarity	0.596	NPC328590
Remote Similarity	0.5933	NPC252794
Remote Similarity	0.5928	NPC469897
Remote Similarity	0.5862	NPC313449
Remote Similarity	0.5804	NPC296163
Remote Similarity	0.5797	NPC313362
Remote Similarity	0.5781	NPC43655
Remote Similarity	0.5753	NPC192209
Remote Similarity	0.5714	NPC20322
Remote Similarity	0.5714	NPC134825
Remote Similarity	0.5692	NPC107135
Remote Similarity	0.5686	NPC469949
Remote Similarity	0.5641	NPC66699
Remote Similarity	0.5621	NPC273714

Drug Structure

NPD5268 OpenBabel08211706322D 30 33 0 0 0 0 0 0 0 0999 V2000 1.5000 -0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5000 0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.7942 4.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5981 5.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7321 6.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4641 3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5981 4.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8660 5.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8660 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8660 2.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3301 2.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5981 2.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.9282 3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0622 4.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0622 2.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1962 4.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8660 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7321 4.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8660 2.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8660 4.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 3.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0000 0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 6.9282 4.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 5.1962 3.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 1.7321 3.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -1.0000 -0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -1.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 4.0000 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 -0.0000 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0 1 23 1 0 0 0 0 2 23 1 0 0 0 0 3 24 1 0 0 0 0 4 5 2 0 0 0 0 4 7 1 0 0 0 0 5 8 1 0 0 0 0 6 11 1 0 0 0 0 6 12 1 0 0 0 0 7 19 2 0 0 0 0 8 21 2 0 0 0 0 9 10 2 0 0 0 0 9 18 1 0 0 0 0 10 22 1 0 0 0 0 11 25 1 0 0 0 0 12 26 1 0 0 0 0 13 15 1 0 0 0 0 13 24 1 0 0 0 0 14 16 1 0 0 0 0 14 24 1 0 0 0 0 15 25 1 0 0 0 0 16 25 1 0 0 0 0 17 18 2 0 0 0 0 17 20 1 0 0 0 0 18 30 1 0 0 0 0 19 21 1 0 0 0 0 19 26 1 0 0 0 0 20 22 2 0 0 0 0 20 26 1 0 0 0 0 21 29 1 0 0 0 0 22 29 1 0 0 0 0 23 30 1 0 0 0 0 27 30 2 0 0 0 0 28 30 2 0 0 0 0 M END $$$$

External Identifiers

TTD
DrugBank	DB01622
ChEMBL	CHEMBL609109
IUPHAR/BPS
PharmaGKB	PA164754875
KEGG Drug	D08585
PubChem CID
ChEBI	59120
CAS Number	316-81-4

Drug Properties

Molecular Weight	446.18
ALogP	-0.2178
MLogP	3
XLogP	2.717
HDA	6
HBD	0
Rotatable Bonds	9
TPSA	80.78
RO5 Violation	0