NPASS drugs

Drug Information

Drug ID:	NPD2158
Drug Name:
Molecular Formula:	C16H21NO2S
Canonical SMILES:	OC1CN(C1)CCCOCCc1ccc2c(c1)ccs2
Standard InCHI:	InChI=1S/C16H21NO2S/c18-15-11-17(12-15)6-1-7-19-8-4-13-2-3-16-14(10-13)5-9-20-16/h2-3,5,9-10,15,18H,1,4,6-8,11-12H2
Standard InCHIKey:	HQNACSFBDBYLJP-UHFFFAOYSA-N
Max Developmental Stage:	Clinical (unspecified phase)
Max Developmental Stage Source:	TTD

Structural Similarity Between NPASS Natural Products and NPD2158

Similarity level is defined by Tanimoto coefficient (Tc) between two molecules. Tc lies between [0, 1] where '1' indicates the highest similarity. What is Tanimoto coefficient
Tanimoto coefficient is calculated based on PubChem 881-bit substructure fingerprints.

Range	Similarity Score Range
0-0.1	102
0.1-0.2	963
0.2-0.3	4084
0.3-0.4	14469
0.4-0.5	10554
0.5-0.6	704
0.6-0.7	14
0.7-0.8	0
0.8-0.85	0
0.85-0.9	0
0.9-0.95	0
0.95-1	0

Similar Natural Products

High Similarity Level: Tc>=0.85; Intermediate Similarity Level: 0.7 <= Tc < 0.85; Remote Similarity Level: 0.65 <= Tc < 0.7

Similarity Level	Similarity Score	Natural Product ID
Remote Similarity	0.626	NPC316797
Remote Similarity	0.625	NPC65855
Remote Similarity	0.625	NPC292758
Remote Similarity	0.6136	NPC214200
Remote Similarity	0.6136	NPC228400
Remote Similarity	0.6129	NPC148231
Remote Similarity	0.6102	NPC149571
Remote Similarity	0.6027	NPC213126
Remote Similarity	0.6027	NPC84281
Remote Similarity	0.6027	NPC317474
Remote Similarity	0.6027	NPC291027
Remote Similarity	0.6027	NPC169485
Remote Similarity	0.6014	NPC474847
Remote Similarity	0.6	NPC472170
Remote Similarity	0.5986	NPC101139
Remote Similarity	0.597	NPC173019
Remote Similarity	0.596	NPC69496
Remote Similarity	0.5909	NPC474934
Remote Similarity	0.5899	NPC190955
Remote Similarity	0.5886	NPC468984
Remote Similarity	0.5878	NPC58674
Remote Similarity	0.5852	NPC327226
Remote Similarity	0.5844	NPC245836
Remote Similarity	0.5844	NPC233910
Remote Similarity	0.5809	NPC472172
Remote Similarity	0.5806	NPC121478
Remote Similarity	0.5806	NPC73637
Remote Similarity	0.5802	NPC300455
Remote Similarity	0.58	NPC477249
Remote Similarity	0.58	NPC477248
Remote Similarity	0.5782	NPC112823
Remote Similarity	0.5772	NPC184030
Remote Similarity	0.5772	NPC164449
Remote Similarity	0.5769	NPC49577
Remote Similarity	0.5769	NPC79465
Remote Similarity	0.5769	NPC474787
Remote Similarity	0.5769	NPC151706
Remote Similarity	0.5769	NPC474811
Remote Similarity	0.5769	NPC9687
Remote Similarity	0.5769	NPC476102
Remote Similarity	0.5769	NPC474855
Remote Similarity	0.5769	NPC273907
Remote Similarity	0.5769	NPC293377
Remote Similarity	0.5769	NPC475318
Remote Similarity	0.5769	NPC118099
Remote Similarity	0.5769	NPC76785
Remote Similarity	0.5769	NPC260045
Remote Similarity	0.5769	NPC475598
Remote Similarity	0.5769	NPC90194
Remote Similarity	0.5766	NPC147000
Remote Similarity	0.5766	NPC226778
Remote Similarity	0.5766	NPC150254
Remote Similarity	0.5766	NPC304761
Remote Similarity	0.5762	NPC65310
Remote Similarity	0.5746	NPC120203
Remote Similarity	0.5743	NPC86966
Remote Similarity	0.5743	NPC316896
Remote Similarity	0.5735	NPC472171
Remote Similarity	0.5733	NPC307020
Remote Similarity	0.5714	NPC471680
Remote Similarity	0.5706	NPC105717
Remote Similarity	0.5704	NPC269340
Remote Similarity	0.5694	NPC32356
Remote Similarity	0.5692	NPC166487
Remote Similarity	0.5692	NPC172128
Remote Similarity	0.5686	NPC40488
Remote Similarity	0.5683	NPC475086
Remote Similarity	0.5669	NPC99482
Remote Similarity	0.5662	NPC11466
Remote Similarity	0.5652	NPC224610
Remote Similarity	0.5652	NPC113326
Remote Similarity	0.5652	NPC88267
Remote Similarity	0.5652	NPC194390
Remote Similarity	0.5649	NPC300315
Remote Similarity	0.5639	NPC20142
Remote Similarity	0.5639	NPC215351
Remote Similarity	0.5633	NPC478140
Remote Similarity	0.5632	NPC24990
Remote Similarity	0.5629	NPC285394
Remote Similarity	0.5615	NPC2751
Remote Similarity	0.5612	NPC472919
Remote Similarity	0.5612	NPC211551
Remote Similarity	0.5606	NPC265521
Remote Similarity	0.56	NPC252878

Drug Structure

NPD2158 OpenBabel08211701392D 21 23 0 0 0 0 0 0 0 0999 V2000 1.4483 2.6730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5708 1.3282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.5367 1.5870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.8978 1.7765 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.5424 4.1510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7071 1.7071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4824 2.9319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1907 2.4836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5301 3.9946 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1225 3.0012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8637 2.0353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0884 3.2600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0000 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.7956 2.5529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0000 1.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -0.7071 -0.7071 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.2247 2.2247 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.6866 3.0069 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0 -1.6730 -0.4483 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 1 6 1 0 0 0 0 1 7 1 0 0 0 0 2 3 2 0 0 0 0 2 13 1 0 0 0 0 3 16 1 0 0 0 0 4 8 1 0 0 0 0 4 13 1 0 0 0 0 5 9 2 0 0 0 0 5 14 1 0 0 0 0 6 17 1 0 0 0 0 7 19 1 0 0 0 0 8 19 1 0 0 0 0 9 20 1 0 0 0 0 10 13 2 0 0 0 0 10 14 1 0 0 0 0 11 15 1 0 0 0 0 11 17 1 0 0 0 0 12 15 1 0 0 0 0 12 17 1 0 0 0 0 14 16 2 0 0 0 0 15 18 1 0 0 0 0 16 20 1 0 0 0 0 18 21 1 0 0 0 0 M END $$$$

External Identifiers

TTD	DNCL001994
DrugBank
ChEMBL
IUPHAR/BPS
PharmaGKB
KEGG Drug
PubChem CID	11338749
ChEBI
CAS Number

Drug Properties

Molecular Weight	291.13
ALogP	-0.0354
MLogP	2.78
XLogP	2.337
HDA	3
HBD	1
Rotatable Bonds	8
TPSA	60.94
RO5 Violation	0